{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "618b1c9c-fd08-41f1-b547-f13530b18aad", "code": "7144", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I. |Hallucinogenic substances", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "ee26dd07-c7ab-49c0-8375-9d40c5a1ac83" ] }, { "uuid": "2c7905fd-b32f-485b-9c63-31b606d85257", "code": "UR-144", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/UR-144", "code_system": "WIKIPEDIA", "references": [ "ee26dd07-c7ab-49c0-8375-9d40c5a1ac83" ] }, { "uuid": "1695d54f-7466-44c3-bbab-2d6ccfd3ed02", "code": "1199943-44-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1199943-44-6", "code_system": "CAS", "references": [ "ee26dd07-c7ab-49c0-8375-9d40c5a1ac83", "f353736b-916e-40bd-8f08-4ab0cfcaa787" ] }, { "uuid": "81ecf2f1-4236-4f06-9b06-341638c73b5e", "code": "44626619", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44626619", "code_system": "PUBCHEM", "references": [ "ee26dd07-c7ab-49c0-8375-9d40c5a1ac83" ] }, { "uuid": "c8a30fc2-4694-dbbc-1ae1-1514bfc5ab61", "code": "DTXSID60152635", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60152635", "code_system": "EPA CompTox", "references": [ "ea926232-92bc-a3eb-949b-67fc1db766ad" ] }, { "uuid": "666abff6-9f99-481c-87f2-01dc08f21369", "code": "1TYA7HVP1B", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ba1f5d92-4fea-0c15-b40e-41e6bcbfd41d", "code": "Designer-drugs-UR-144", "comments": "Wikipedia|List of designer drugs|Synthetic cannabinoids|Indole based", "type": "CONCEPT", "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs", "code_system": "WIKIPEDIA", "references": [ "2f28d8c4-aadf-b718-38c9-965cbba47404" ] } ], "relationships": [ { "uuid": "612cd428-be96-44ca-8c37-340bb69042ba", "amount": { "uuid": "539e5520-b7c8-4ae3-a761-456c9fc6530c", "type": "RELATIONSHIP_AMOUNT", "units": "NANOMOLAR" }, "comments": "Human cannabinoid 1 receptor (CB1) and 2 receptor (CB2) agonist; Ki=150 nM (CB1), 1.8 nM (CB2)", "qualification": "Ki", "type": "ACTIVE MOIETY", "interaction_type": "IN-VITRO", "references": [ "e82ad404-130f-401e-93c9-e8281b30f4bc" ], "related_substance": { "uuid": "e3d75e43-a39e-4c9b-adfe-0dc71463d224", "refuuid": "ee21a6ef-4038-490b-9c69-c09cebcdf0e0", "name": "UR-144", "unii": "1TYA7HVP1B", "linking_id": "1TYA7HVP1B", "ref_pname": "UR-144", "substance_class": "reference" } }, { "uuid": "654fe9ac-63ca-4f88-adee-8f3aba9ad04d", "amount": { "uuid": "d8436d0a-b9f5-4a3f-a475-d703f5755353", "average": 421, "units": "NANOMOLAR" }, "comments": "Mouse AtT-20 neuroblastoma cells stably transfected with human CB1", "qualification": "EC50", "type": "TARGET->AGONIST", "references": [ "136a9d21-15c7-4ad0-9fa2-4341e8184610" ], "related_substance": { "uuid": "ef4b8896-6b25-4ce7-b188-746c07495192", "refuuid": "72b773c6-8217-42c9-82c1-8f9104a414b4", "name": "CANNABINOID RECEPTOR 1", "unii": "NJ1Q2Q7LO5", "linking_id": "NJ1Q2Q7LO5", "ref_pname": "CANNABINOID RECEPTOR 1" } }, { "uuid": "f1aa1123-39ba-476c-a0a5-25d7d5a29a6d", "amount": { "uuid": "fcfcb49b-2ba1-46ae-bc3e-a131901f4871", "average": 72, "units": "NANOMOLAR" }, "comments": "Mouse AtT-20 neuroblastoma cells stably transfected with human CB2", "qualification": "EC50", "type": "TARGET->AGONIST", "related_substance": { "uuid": "2db8d2fb-7500-4284-a823-890d048729fb", "refuuid": "4da43617-82f9-4e30-b375-4d59d4f6fe58", "name": "CANNABINOID RECEPTOR 2", "unii": "SKEU5X23RI", "linking_id": "SKEU5X23RI", "ref_pname": "CANNABINOID RECEPTOR 2" } } ], "substance_class": "chemical", "names": [ { "uuid": "2840be25-9175-c58c-41a8-de8c7efde500", "name": "(1-PENTYL-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL)METHANONE", "stdName": "(1-PENTYL-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL)METHANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5339fdf4-a0ab-008f-ef56-b69930f639d1" ], "display_name": false }, { "uuid": "052ed624-392d-4551-84c6-ff27bf3f9dfc", "name": "2,2,3,3-TETRAMETHYLCYCLOPROPYL(1-PENTYL-1H-INDOLE-3-YL) KETONE", "stdName": "2,2,3,3-TETRAMETHYLCYCLOPROPYL(1-PENTYL-1H-INDOLE-3-YL) KETONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bf4ad8aa-2312-4d7b-8cbd-8c97e405f79f" ], "display_name": false }, { "uuid": "a011e06d-1a07-4dcd-8ed4-5712236d23f3", "name": "DEA NO. 7144", "stdName": "DEA NO. 7144", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "78a74fc5-4cd0-4fd8-b2dd-5d3f882f3882" ], "display_name": false }, { "uuid": "5756afc3-acdb-4fb3-89c8-218b5391f6f5", "name": "J3.184.806G", "stdName": "J3.184.806G", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "bf4ad8aa-2312-4d7b-8cbd-8c97e405f79f" ], "display_name": false }, { "uuid": "96ada419-b4f4-47f0-9100-03f446ade9e4", "name": "KM-X1", "stdName": "KM-X1", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "6f21a077-b26d-421f-9968-14a4cec9ae22" ], "display_name": false }, { "uuid": "ed4e1780-1dac-4729-aa8e-bbd2d57878fa", "name": "METHANONE, (1-PENTYL-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL)-", "stdName": "METHANONE, (1-PENTYL-1H-INDOL-3-YL)(2,2,3,3-TETRAMETHYLCYCLOPROPYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1bec1e0f-86a8-442b-b5ec-8e05df1be537" ], "display_name": false }, { "uuid": "6c38dda4-bf54-4251-bcf9-5dae16d8820c", "name": "TMCP-018", "stdName": "TMCP-018", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "6f21a077-b26d-421f-9968-14a4cec9ae22" ], "display_name": false }, { "uuid": "11adc47a-cf0b-4ba4-aef4-7f013d913f7a", "name": "UR-144", "stdName": "UR-144", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "1bec1e0f-86a8-442b-b5ec-8e05df1be537" ], "display_name": true }, { "uuid": "6cbe8937-de6b-476c-b987-20768356e4a8", "name": "YX-17", "stdName": "YX-17", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "6f21a077-b26d-421f-9968-14a4cec9ae22" ], "display_name": false } ], "references": [ { "uuid": "6f21a077-b26d-421f-9968-14a4cec9ae22", "citation": "https://en.wikipedia.org/wiki/UR-144", "url": "https://en.wikipedia.org/wiki/UR-144", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "1bec1e0f-86a8-442b-b5ec-8e05df1be537", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bf4ad8aa-2312-4d7b-8cbd-8c97e405f79f", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J3.184.806G", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J3.184.806G", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "78a74fc5-4cd0-4fd8-b2dd-5d3f882f3882", "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/1199943-44-6", "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/1199943-44-6", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ee26dd07-c7ab-49c0-8375-9d40c5a1ac83", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393311000, "tags": [ "NOMEN" ] }, { "uuid": "e82ad404-130f-401e-93c9-e8281b30f4bc", "citation": "J MED CHEM, 53, 295-315 (2010)", "url": "http://pubs.acs.org/doi/abs/10.1021/jm901214q", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bfe199ab-e3ec-4b69-b198-9022076e4044", "citation": "SRS import [1TYA7HVP1B]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1TYA7HVP1B", "doc_type": "SRS", "public_domain": true, "document_date": 1493393311000, "tags": [ "NOMEN" ] }, { "uuid": "5f5503d1-b24b-458d-9e48-2b569c19298c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ea926232-92bc-a3eb-949b-67fc1db766ad", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1199943-44-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5339fdf4-a0ab-008f-ef56-b69930f639d1", "citation": "Controlled Substances \n- by DEA Drug Code Number-", "url": "https://www.deadiversion.usdoj.gov/schedules/orangebook/d_cs_drugcode.pdf", "doc_type": "WEB PAGE", "public_domain": true }, { "uuid": "136a9d21-15c7-4ad0-9fa2-4341e8184610", "citation": "Banister, Samuel D., et al. \"Effects of bioisosteric fluorine in synthetic cannabinoid designer drugs JWH-018, AM-2201, UR-144, XLR-11, PB-22, 5F-PB-22, APICA, and STS-135.\" ACS chemical neuroscience 6.8 (2015): 1445-1458.", "url": "https://pubs.acs.org/doi/pdf/10.1021/acschemneuro.5b00107", "doc_type": "JA", "public_domain": true }, { "uuid": "f353736b-916e-40bd-8f08-4ab0cfcaa787", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "2f28d8c4-aadf-b718-38c9-965cbba47404", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4918f791-41e5-44a7-87ea-53fa25fe5809", "id": "4918f791-41e5-44a7-87ea-53fa25fe5809", "molfile": "\n Marvin 01132103502D \n\n 23 25 0 0 0 0 999 V2000\n 7.0597 -7.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8123 -6.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9878 -6.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7404 -5.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9434 -5.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6685 -4.5986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1632 -3.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6685 -3.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -2.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3662 -1.8776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7129 -2.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3451 -1.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9498 -1.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1527 -0.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5100 -2.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6749 -3.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3070 -2.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8715 -3.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1569 -3.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4422 -3.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4697 -4.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1843 -4.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8990 -4.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 23 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 8 18 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 15 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 15 12 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 23 18 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\nM END", "smiles": "CCCCCn1cc(c2ccccc21)C(=O)C3C(C)(C)C3(C)C", "formula": "C21H29NO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "951f0d39-5c83-42b5-b44f-d026893da32b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "311.4618", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "ee21a6ef-4038-490b-9c69-c09cebcdf0e0", "version": "8", "structure": { "id": "85fd5bf0-7610-479e-ac5c-f5515351f0a1", "molfile": "\n Marvin 01132106572D \n\n 23 25 0 0 0 0 999 V2000\n 2.4422 -3.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4697 -4.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1843 -4.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8990 -4.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8715 -3.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1569 -3.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6685 -3.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1632 -3.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6685 -4.5986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9434 -5.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7404 -5.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9878 -6.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8123 -6.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0597 -7.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9158 -2.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7129 -2.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5100 -2.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3451 -1.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9498 -1.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1527 -0.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6749 -3.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3070 -2.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3662 -1.8776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 1 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 7 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 16 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 17 21 1 0 0 0 0\n 17 22 1 0 0 0 0\n 15 23 2 0 0 0 0\nM END", "smiles": "CCCCCn1cc(c2ccccc21)C(=O)C3C(C)(C)C3(C)C", "formula": "C21H29NO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "311.4618", "optical_activity": "NONE", "references": [ "5f5503d1-b24b-458d-9e48-2b569c19298c", "bfe199ab-e3ec-4b69-b198-9022076e4044" ], "stereo_centers": 0 }, "unii": "1TYA7HVP1B" } ] }