{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "26bcc9cf-e89f-41df-971f-275b118f5d2e",
          "code": "1579-21-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1579-21-1",
          "code_system": "CAS",
          "references": [
            "046cfcce-e4f2-4b98-9f6a-aaa6559d7af2",
            "848811aa-6863-454b-a4d2-3c0531b193a7"
          ]
        },
        {
          "uuid": "02577394-b76a-4d59-be3c-d731e6d42609",
          "code": "216-422-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.014.930",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "046cfcce-e4f2-4b98-9f6a-aaa6559d7af2"
          ]
        },
        {
          "uuid": "f7d71e4a-dd6b-4662-a367-c268784907a1",
          "code": "246289",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/246289",
          "code_system": "PUBCHEM",
          "references": [
            "046cfcce-e4f2-4b98-9f6a-aaa6559d7af2"
          ]
        },
        {
          "uuid": "fac1a1c2-98a4-4f62-9269-cf11e126f7a1",
          "code": "1T26M36ZIE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f36b0424-4099-9d05-43c6-bde3084bf75a",
          "code": "DTXSID70883701",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70883701",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "9a7e3569-5479-217b-510d-7264502aae84",
          "code": "59022",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=59022",
          "code_system": "NSC",
          "references": [
            "7891d815-f6b7-67c5-cb8a-61ecafb17874"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5f373224-9b3b-41b4-a432-7dfdb78c4415",
          "name": "(±)-CIS-2-DECALONE",
          "stdName": "(+/-)-CIS-2-DECALONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d5ea2a-79c7-4aff-8c11-9314be8b69fa",
            "eba963db-c086-4ed1-945a-82f88f5c6328"
          ],
          "display_name": false
        },
        {
          "uuid": "a958b307-14b2-423e-b83b-a7347c97b211",
          "name": "2(1H)-NAPHTHALENONE, OCTAHYDRO-, (4AR,8AS)-REL-",
          "stdName": "2(1H)-NAPHTHALENONE, OCTAHYDRO-, (4AR,8AS)-REL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d5ea2a-79c7-4aff-8c11-9314be8b69fa",
            "eba963db-c086-4ed1-945a-82f88f5c6328"
          ],
          "display_name": false
        },
        {
          "uuid": "d053859c-ed84-412c-adaa-60e8d72cf644",
          "name": "2-DECALONE, CIS-",
          "stdName": "2-DECALONE, CIS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bd3ee56-ea0a-4598-83c6-251be35c3cac",
            "eba963db-c086-4ed1-945a-82f88f5c6328"
          ],
          "display_name": true
        },
        {
          "uuid": "bcf39ab9-787a-4c61-bbad-e9a785726881",
          "name": "3-CIS-BICYCLO(4.4.0)DECANONE",
          "stdName": "3-CIS-BICYCLO(4.4.0)DECANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d5ea2a-79c7-4aff-8c11-9314be8b69fa",
            "eba963db-c086-4ed1-945a-82f88f5c6328"
          ],
          "display_name": false
        },
        {
          "uuid": "32537481-e98e-4d1a-9a7d-0a97552c1899",
          "name": "CIS-.BETA.-DECALONE",
          "stdName": "CIS-.BETA.-DECALONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d5ea2a-79c7-4aff-8c11-9314be8b69fa",
            "eba963db-c086-4ed1-945a-82f88f5c6328"
          ],
          "display_name": false
        },
        {
          "uuid": "a41f7719-4916-4110-9078-03d0f90aee96",
          "name": "CIS-2-DECALONE",
          "stdName": "CIS-2-DECALONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d5ea2a-79c7-4aff-8c11-9314be8b69fa",
            "eba963db-c086-4ed1-945a-82f88f5c6328"
          ],
          "display_name": false
        },
        {
          "uuid": "82bd70ff-bdd6-4f0e-b56a-10ed04deb909",
          "name": "NSC-59022",
          "stdName": "NSC-59022",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d5ea2a-79c7-4aff-8c11-9314be8b69fa",
            "eba963db-c086-4ed1-945a-82f88f5c6328"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7bd3ee56-ea0a-4598-83c6-251be35c3cac",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "eba963db-c086-4ed1-945a-82f88f5c6328",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10d5ea2a-79c7-4aff-8c11-9314be8b69fa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "046cfcce-e4f2-4b98-9f6a-aaa6559d7af2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393388000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69e98fd8-8a63-4ddc-9ec5-32bac21d9ea3",
          "citation": "SRS import [1T26M36ZIE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1T26M36ZIE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393388000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "848811aa-6863-454b-a4d2-3c0531b193a7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7891d815-f6b7-67c5-cb8a-61ecafb17874",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "893e5f08-3644-4f5f-9b04-4fc30f67c169",
          "id": "893e5f08-3644-4f5f-9b04-4fc30f67c169",
          "molfile": "\n  Marvin  01132107082D          \n\n 11 12  0  0  0  0            999 V2000\n    7.0463   -4.5476    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.3321   -4.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6178   -4.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6178   -3.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3321   -3.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0463   -3.7226    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.7606   -3.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4748   -3.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1093   -3.3563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4748   -4.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7606   -4.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1 11  1  6  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  6  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\nM  END",
          "smiles": "C1CC[C@@H]2CC(=O)CC[C@@H]2C1",
          "formula": "C10H16O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "69b48aca-b204-419f-9b22-3cd402588a19"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "152.2338",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a57520d9-869c-4aa9-9a0c-ed95a2940b16",
      "version": "5",
      "structure": {
        "id": "8cc1f00e-5b06-414f-a26b-cad326623f53",
        "molfile": "\n  Marvin  01132107182D          \n\n 13 14  0  0  0  0            999 V2000\n    5.6178   -3.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3321   -3.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0463   -3.7226    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0463   -4.5476    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.7606   -4.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4748   -4.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4748   -3.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7606   -3.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3321   -4.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6178   -4.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0427   -5.3690    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0427   -2.8941    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1093   -3.3563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  7  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n  9 10  1  0  0  0  0\n  4 11  1  1  0  0  0\n  3 12  1  1  0  0  0\n  7 13  2  0  0  0  0\nM  END",
        "smiles": "C1CC[C@]2([H])CC(=O)CC[C@]2([H])C1",
        "formula": "C10H16O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "152.2338",
        "optical_activity": "( + / - )",
        "references": [
          "10d5ea2a-79c7-4aff-8c11-9314be8b69fa",
          "69e98fd8-8a63-4ddc-9ec5-32bac21d9ea3"
        ],
        "stereo_centers": 2
      },
      "unii": "1T26M36ZIE"
    }
  ]
}