{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9a3dd017-f49e-4786-96b5-cd2d4cff981f", "code": "74839-84-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=74839-84-2", "code_system": "CAS", "references": [ "d81a69dd-593c-4f1b-b765-5c85d5498920", "22e84df7-f809-4999-9684-a6851f2d3234" ] }, { "uuid": "5ca1b36f-e28e-4536-b680-e496af21cd4a", "code": "2724948", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2724948", "code_system": "PUBCHEM", "references": [ "d81a69dd-593c-4f1b-b765-5c85d5498920" ] }, { "uuid": "948544da-7aa6-4bf3-b2c2-c77ec3043c20", "code": "1T086B9Q1J", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "87c10c4d-337a-3d5c-d0c8-1981bd6866ac", "code": "DTXSID901336752", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901336752", "code_system": "EPA CompTox", "references": [ "2650de6b-6959-0637-c1ff-5de684e1994e" ] } ], "substance_class": "chemical", "names": [ { "uuid": "da5340fe-ff48-4c12-9186-333a2c65586e", "name": "(2R,3R)-BIS(DIPHENYLPHOSPHINO)BUTANE", "stdName": "(2R,3R)-BIS(DIPHENYLPHOSPHINO)BUTANE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0900fac8-19b2-4cee-bef2-0a325651cdb7", "58f1013b-7b36-446c-bcb7-0383d6f1607a" ], "display_name": false }, { "uuid": "4123f7bc-459b-4ce8-8201-150cbaf7d81b", "name": "(R,R)-CHIRAPHOS", "stdName": "(R,R)-CHIRAPHOS", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0900fac8-19b2-4cee-bef2-0a325651cdb7", "58f1013b-7b36-446c-bcb7-0383d6f1607a" ], "display_name": false }, { "uuid": "7a0c9bd2-09ee-40b0-8514-fd956f9299c7", "name": "CHIRAPHOS, (R,R)-", "stdName": "CHIRAPHOS, (R,R)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0900fac8-19b2-4cee-bef2-0a325651cdb7", "3df1c0d0-e50d-4fb0-b921-16cf0be1daef" ], "display_name": true }, { "uuid": "5451fd37-2c05-465f-afbb-9c26ab82eade", "name": "CIRA", "stdName": "CIRA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0900fac8-19b2-4cee-bef2-0a325651cdb7", "58f1013b-7b36-446c-bcb7-0383d6f1607a" ], "display_name": false }, { "uuid": "58a74017-9d93-4bb2-b26a-87d78820245e", "name": "PHOSPHINE, 1,1'-((1R,2R)-1,2-DIMETHYL-1,2-ETHANEDIYL)BIS(1,1-DIPHENYL-", "stdName": "PHOSPHINE, 1,1'-((1R,2R)-1,2-DIMETHYL-1,2-ETHANEDIYL)BIS(1,1-DIPHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0900fac8-19b2-4cee-bef2-0a325651cdb7", "58f1013b-7b36-446c-bcb7-0383d6f1607a" ], "display_name": false } ], "references": [ { "uuid": "3df1c0d0-e50d-4fb0-b921-16cf0be1daef", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0900fac8-19b2-4cee-bef2-0a325651cdb7", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "58f1013b-7b36-446c-bcb7-0383d6f1607a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d81a69dd-593c-4f1b-b765-5c85d5498920", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391981000, "tags": [ "NOMEN" ] }, { "uuid": "a04e8811-205c-4f07-9576-6e5b029e0690", "citation": "SRS import [1T086B9Q1J]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1T086B9Q1J", "doc_type": "SRS", "public_domain": true, "document_date": 1493391981000, "tags": [ "NOMEN" ] }, { "uuid": "22e84df7-f809-4999-9684-a6851f2d3234", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "2650de6b-6959-0637-c1ff-5de684e1994e", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e3890e5a-8703-4d35-9c32-8ccdea5f79e7", "id": "e3890e5a-8703-4d35-9c32-8ccdea5f79e7", "molfile": "\n Marvin 01132111472D \n\n 30 33 0 0 1 0 999 V2000\n 16.2037 -9.2444 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 16.2037 -10.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4891 -8.8319 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4891 -8.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2037 -7.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2037 -6.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4891 -6.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7747 -6.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7747 -7.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7747 -9.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7747 -10.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0603 -10.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3458 -10.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3458 -9.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0602 -8.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9181 -8.8319 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 16.9181 -8.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6326 -9.2444 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6326 -10.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3470 -10.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3470 -11.3069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6326 -11.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9181 -11.3069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9181 -10.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3470 -8.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0615 -9.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7759 -8.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7759 -8.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0615 -7.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3470 -8.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 3 1 1 0 0 0 0\n 1 16 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 10 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 9 2 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 17 1 1 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 25 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 24 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 30 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 29 1 0 0 0 0\nM END", "smiles": "C[C@H]([C@@H](C)P(c1ccccc1)c2ccccc2)P(c3ccccc3)c4ccccc4", "formula": "C28H28P2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "62658b1d-33c4-4240-81ad-b69c6cfd0937" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "426.4705", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "028267d0-bf6a-4e95-9377-6eba206b223d", "version": "5", "structure": { "id": "593de574-fbf6-4160-885a-b7334d99063a", "molfile": "\n Marvin 01132104382D \n\n 30 33 0 0 1 0 999 V2000\n 15.4891 -8.8319 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4891 -8.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2037 -7.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2037 -6.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4891 -6.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7747 -6.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7747 -7.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7747 -9.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7747 -10.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0603 -10.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3458 -10.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3458 -9.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0602 -8.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2037 -9.2444 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.2037 -10.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9181 -8.8319 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.9181 -8.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6326 -9.2444 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6326 -10.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3470 -10.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3470 -11.3069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6326 -11.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9181 -11.3069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9181 -10.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3470 -8.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0615 -9.2444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7759 -8.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7759 -8.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0615 -7.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.3470 -8.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 2 7 2 0 0 0 0\n 1 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 8 13 2 0 0 0 0\n 1 14 1 0 0 0 0\n 14 15 1 1 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 1 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 19 24 2 0 0 0 0\n 18 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 29 1 0 0 0 0\n 25 30 2 0 0 0 0\nM END", "smiles": "C[C@H]([C@@H](C)P(c1ccccc1)c2ccccc2)P(c3ccccc3)c4ccccc4", "formula": "C28H28P2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "426.4705", "optical_activity": "UNSPECIFIED", "references": [ "58f1013b-7b36-446c-bcb7-0383d6f1607a", "a04e8811-205c-4f07-9576-6e5b029e0690" ], "stereo_centers": 2 }, "unii": "1T086B9Q1J" } ] }