{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c6c0b012-151e-42ea-a37b-ef83a8d74bfd",
          "code": "25612-59-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=25612-59-3",
          "code_system": "CAS",
          "references": [
            "0bc15772-30fa-4a58-a89c-173e86bfac2f",
            "3f8b3834-2f63-4704-8432-baf05da2826d"
          ]
        },
        {
          "uuid": "52c4af8a-ad1c-49ab-a530-10d45176b4cf",
          "code": "C082097",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67082097",
          "code_system": "MESH",
          "references": [
            "0bc15772-30fa-4a58-a89c-173e86bfac2f"
          ]
        },
        {
          "uuid": "572638e2-743a-4a5d-a3cd-6d402eb95907",
          "code": "5282350",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5282350",
          "code_system": "PUBCHEM",
          "references": [
            "0bc15772-30fa-4a58-a89c-173e86bfac2f"
          ]
        },
        {
          "uuid": "33d8f748-e5c8-bfb2-13ce-f83371f35c64",
          "code": "DTXSID30180288",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30180288",
          "code_system": "EPA CompTox",
          "references": [
            "306f583f-825a-28a6-adc3-aa3cee0930f6"
          ]
        },
        {
          "uuid": "8d9c933c-e465-1a0a-2c34-20f4e76640b5",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "70f403e0-b0e0-957a-db15-f38f16a11cd3"
          ]
        },
        {
          "uuid": "2f8e8a56-ab13-31de-b33a-18f13d23fa94",
          "code": "C68318",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Tocotrienol",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68318",
          "code_system": "NCI_THESAURUS",
          "references": [
            "70f403e0-b0e0-957a-db15-f38f16a11cd3"
          ]
        },
        {
          "uuid": "2d332fb0-7a25-404f-b3c9-61afb06d8fae",
          "code": "1SRB74OWSI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "df35dc7a-e375-4f5c-20ac-f22e22ae9cd2",
          "code": "33276",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33276",
          "code_system": "CHEBI",
          "references": [
            "70f403e0-b0e0-957a-db15-f38f16a11cd3"
          ]
        },
        {
          "uuid": "e4701f50-6b89-6c43-87f0-bcce6cbaad37",
          "code": "C116743",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C116743",
          "code_system": "NCI_THESAURUS",
          "references": [
            "62e1210f-11d4-2362-75f3-9926bc6e4e9e"
          ]
        },
        {
          "uuid": "37510f69-734e-f604-8fa5-3cae473f149d",
          "code": "100000172043",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cf76fc66-da57-8325-b5fc-6d53fbe8ad2c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3143ffe4-6862-4726-a022-b15f89fb8b8e",
          "name": "(R)-.DELTA.-TOCOTRIENOL",
          "stdName": "(R)-.DELTA.-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97a5f72a-3983-4577-8ad9-ac824cdefd4f",
            "3f8b3834-2f63-4704-8432-baf05da2826d"
          ],
          "display_name": false
        },
        {
          "uuid": "6b7917ec-db6d-4924-a03a-dac14d758c90",
          "name": ".DELTA.-TOCOTRIENOL",
          "stdName": ".DELTA.-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97a5f72a-3983-4577-8ad9-ac824cdefd4f",
            "3f8b3834-2f63-4704-8432-baf05da2826d"
          ],
          "display_name": true
        },
        {
          "uuid": "f1361a4d-2435-455d-9909-be81a99fd0e7",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,8-DIMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIEN-1-YL)-, (2R)-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,8-DIMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIEN-1-YL)-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97a5f72a-3983-4577-8ad9-ac824cdefd4f",
            "3f8b3834-2f63-4704-8432-baf05da2826d"
          ],
          "display_name": false
        },
        {
          "uuid": "e4cd6aa1-4f32-4d5f-9882-829b9a78ff0b",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,8-DIMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (2R)-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,8-DIMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97a5f72a-3983-4577-8ad9-ac824cdefd4f",
            "3f8b3834-2f63-4704-8432-baf05da2826d"
          ],
          "display_name": false
        },
        {
          "uuid": "f8820c13-4570-4bc2-9e2d-998bd866146d",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,8-DIMETHYL-2-(4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (R-(E,E))-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,8-DIMETHYL-2-(4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (R-(E,E))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97a5f72a-3983-4577-8ad9-ac824cdefd4f",
            "3f8b3834-2f63-4704-8432-baf05da2826d"
          ],
          "display_name": false
        },
        {
          "uuid": "8edcdcab-5b13-46ed-a46c-c4761243b980",
          "name": "8-METHYLTOCOTRIENOL",
          "stdName": "8-METHYLTOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97a5f72a-3983-4577-8ad9-ac824cdefd4f",
            "3f8b3834-2f63-4704-8432-baf05da2826d"
          ],
          "display_name": false
        },
        {
          "uuid": "b7c43b3b-05c0-4ec0-8d6f-ace8a4f994d3",
          "name": "D-DELTA-TOCOTRIENOL",
          "stdName": "D-DELTA-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f8b3834-2f63-4704-8432-baf05da2826d"
          ],
          "display_name": false
        },
        {
          "uuid": "2f2fed16-f6c9-47b7-b910-e514bb07b92d",
          "name": "DELTA-TOCOTRIENOL",
          "stdName": "DELTA-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "128c2dab-0cc2-494e-856a-ae6807db56ee"
          ],
          "display_name": false
        },
        {
          "uuid": "7970ac54-4706-08c3-f7b2-cb2911d6db58",
          "name": "Delta Tocotrienol [WHO-DD]",
          "stdName": "DELTA TOCOTRIENOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "728f321e-6f84-412a-80ac-c615096941cd"
          ],
          "display_name": false
        },
        {
          "uuid": "bfdae641-f29d-40a2-ac1f-888323557f55",
          "name": "J17.358D",
          "stdName": "J17.358D",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "354b1f02-83ce-4aba-b794-3f502110c2db",
            "3f8b3834-2f63-4704-8432-baf05da2826d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "128c2dab-0cc2-494e-856a-ae6807db56ee",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "97a5f72a-3983-4577-8ad9-ac824cdefd4f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f8b3834-2f63-4704-8432-baf05da2826d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "354b1f02-83ce-4aba-b794-3f502110c2db",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J17.358D",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J17.358D",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bc15772-30fa-4a58-a89c-173e86bfac2f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391115000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1e314fa-ce32-457f-9470-7bd67acd339f",
          "citation": "SRS import [1SRB74OWSI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1SRB74OWSI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391115000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3576627c-6380-443e-9056-72f9209191ff",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5647a511-21e9-66f1-4a71-4e87267163da",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=25612-59-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cf76fc66-da57-8325-b5fc-6d53fbe8ad2c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "70f403e0-b0e0-957a-db15-f38f16a11cd3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "728f321e-6f84-412a-80ac-c615096941cd",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62e1210f-11d4-2362-75f3-9926bc6e4e9e",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "306f583f-825a-28a6-adc3-aa3cee0930f6",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d6dece2e-0813-400b-b1bc-70cf9a3c8c53",
          "id": "d6dece2e-0813-400b-b1bc-70cf9a3c8c53",
          "molfile": "\n  Marvin  01132111082D          \n\n 29 30  0  0  1  0            999 V2000\n    1.0543   -7.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6861   -6.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5435   -5.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4603   -6.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0919   -6.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8661   -6.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5025   -6.1386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3553   -5.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2767   -6.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9084   -5.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6826   -6.1724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3143   -5.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1718   -4.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0886   -5.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7248   -5.3929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4990   -5.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1308   -5.1489    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.4990   -4.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5434   -5.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3684   -5.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7809   -5.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6060   -5.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0186   -4.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8436   -4.4302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6060   -3.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7809   -3.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3684   -3.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3684   -4.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5434   -4.4302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 17 29  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 28  2  0  0  0  0\n 23 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 25  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC/C(=C/CC/C(=C/CC[C@]1(C)CCc2cc(cc(C)c2O1)O)/C)/C)C",
          "formula": "C27H40O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5f8a7b62-eebe-4d33-8af1-602757286fb7"
          },
          "defined_stereo": 1,
          "ez_centers": 2,
          "molecular_weight": "396.6063",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ee9a0a18-472d-4482-b5cd-f20b1131d1bc",
      "version": "14",
      "structure": {
        "id": "a0774b20-58f5-4494-8cf9-ead8ea5b9224",
        "molfile": "\n  Marvin  01132108202D          \n\n 29 30  0  0  1  0            999 V2000\n   10.1308   -5.1489    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.5434   -5.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3684   -5.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7809   -5.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3684   -4.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5434   -4.4302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7809   -3.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6060   -3.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0186   -4.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6060   -5.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8436   -4.4302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3684   -3.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4990   -5.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7248   -5.3929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0886   -5.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3143   -5.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6826   -6.1724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9084   -5.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2767   -6.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5025   -6.1386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8661   -6.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0919   -6.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4603   -6.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6861   -6.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0543   -7.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5435   -5.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3553   -5.3252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1718   -4.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4990   -4.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  4 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n  1 13  1  1  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 20 27  1  0  0  0  0\n 16 28  1  0  0  0  0\n  1 29  1  6  0  0  0\nM  END",
        "smiles": "CC(=CCC/C(=C/CC/C(=C/CC[C@]1(C)CCc2cc(cc(C)c2O1)O)/C)/C)C",
        "formula": "C27H40O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 2,
        "molecular_weight": "396.6063",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3576627c-6380-443e-9056-72f9209191ff",
          "e1e314fa-ce32-457f-9470-7bd67acd339f"
        ],
        "stereo_centers": 1
      },
      "unii": "1SRB74OWSI"
    }
  ]
}