{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8ca977ed-84fa-4cd0-ad07-035d89581481",
          "code": "91-44-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=91-44-1",
          "code_system": "CAS",
          "references": [
            "36d68573-17aa-4158-8484-c4bc43747cb2",
            "423a7556-2b3f-4ee7-a599-fb315639ff75"
          ]
        },
        {
          "uuid": "0ae7af6e-ab47-4bd3-8488-fa6d52dcc0f9",
          "code": "202-068-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.881",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "36d68573-17aa-4158-8484-c4bc43747cb2"
          ]
        },
        {
          "uuid": "4d0de3f3-740b-47ca-9345-565af89606ce",
          "code": "1737792",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1737792/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "36d68573-17aa-4158-8484-c4bc43747cb2"
          ]
        },
        {
          "uuid": "0b2ed52c-0194-4113-a108-9bf62b8395b5",
          "code": "7050",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7050",
          "code_system": "PUBCHEM",
          "references": [
            "36d68573-17aa-4158-8484-c4bc43747cb2"
          ]
        },
        {
          "uuid": "5d017093-19e1-6487-ee82-26fb65334905",
          "code": "4244",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4244",
          "code_system": "HSDB",
          "references": [
            "fd23ff57-4042-fc78-60ac-6b558c8a47ea"
          ]
        },
        {
          "uuid": "76d1ea04-58f8-1cdb-09b2-1a546c481f51",
          "code": "DTXSID9025035",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9025035",
          "code_system": "EPA CompTox",
          "references": [
            "742b1934-a9bf-c256-059f-ff54dbe59554"
          ]
        },
        {
          "uuid": "4069e3a7-8b67-484e-9f20-fbfc204e7b2d",
          "code": "1SFJ7F6R2C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e2e46d73-f273-1538-5e46-df2825155f9d",
          "code": "51938",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:51938",
          "code_system": "CHEBI",
          "references": [
            "bb073897-7b45-bba9-ab03-0eba07853bf0"
          ]
        },
        {
          "uuid": "25058129-650a-1ba8-b28e-ac475f351379",
          "code": "61830",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=61830",
          "code_system": "NSC",
          "references": [
            "b4d45c1d-049b-eda1-2444-e13771a68226"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2131709c-a8dd-4794-825f-6d95cc5f5f1e",
          "name": "2H-1-BENZOPYRAN-2-ONE, 7-(DIETHYLAMINO)-4-METHYL-",
          "stdName": "2H-1-BENZOPYRAN-2-ONE, 7-(DIETHYLAMINO)-4-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55f5848f-8684-44fd-b9b8-f2a8c29f57d3",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376"
          ],
          "display_name": false
        },
        {
          "uuid": "0549e93f-1544-423e-8639-f50b326977ba",
          "name": "4-METHYL-7-(DIETHYLAMINO)COUMARIN",
          "stdName": "4-METHYL-7-(DIETHYLAMINO)COUMARIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55f5848f-8684-44fd-b9b8-f2a8c29f57d3",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376"
          ],
          "display_name": false
        },
        {
          "uuid": "3b8fc55b-b876-4aaf-b6dc-0e3ef7f84289",
          "name": "7-(DIETHYLAMINO)-4-METHYL-2H-1-BENZOPYRAN-2-ONE",
          "stdName": "7-(DIETHYLAMINO)-4-METHYL-2H-1-BENZOPYRAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55f5848f-8684-44fd-b9b8-f2a8c29f57d3",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376"
          ],
          "display_name": false
        },
        {
          "uuid": "9ba99008-6e15-4e13-b062-b33158f5a755",
          "name": "7-(DIETHYLAMINO)-4-METHYLCOUMARIN",
          "stdName": "7-(DIETHYLAMINO)-4-METHYLCOUMARIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55f5848f-8684-44fd-b9b8-f2a8c29f57d3",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376"
          ],
          "display_name": false
        },
        {
          "uuid": "4ee4f465-0c5c-492e-bb5f-7f301054ff4e",
          "name": "7-DIETHYLAMINO-4-METHYLCOUMARIN",
          "stdName": "7-DIETHYLAMINO-4-METHYLCOUMARIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ad958cf-23be-4e5a-bd12-e70f9fb31c46",
            "1de68b79-c216-4b70-aa16-70422ea48913",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376",
            "9a6c4aae-25dd-40c0-8930-5893f4632bdc"
          ],
          "display_name": false
        },
        {
          "uuid": "955126ea-1508-41a8-908a-18f3d86f1e01",
          "name": "7-DIETHYLAMINO-4-METHYLCOUMARIN [HSDB]",
          "stdName": "7-DIETHYLAMINO-4-METHYLCOUMARIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ad958cf-23be-4e5a-bd12-e70f9fb31c46",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376"
          ],
          "display_name": false
        },
        {
          "uuid": "2efd2491-1d0e-4d5f-8b21-18f6b5558fd5",
          "name": "C.I. FLUORESCENT BRIGHTENER 140",
          "stdName": "C.I. FLUORESCENT BRIGHTENER 140",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55f5848f-8684-44fd-b9b8-f2a8c29f57d3",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376"
          ],
          "display_name": false
        },
        {
          "uuid": "082f7d6c-94e0-4623-881a-a2e09f4868b1",
          "name": "C.I. FLUORESCENT BRIGHTENER 52",
          "stdName": "C.I. FLUORESCENT BRIGHTENER 52",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55f5848f-8684-44fd-b9b8-f2a8c29f57d3",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376"
          ],
          "display_name": false
        },
        {
          "uuid": "133f93b8-e57d-491e-9c61-bc5bdc0c8c74",
          "name": "COUMARIN, 7-(DIETHYLAMINO)-4-METHYL-",
          "stdName": "COUMARIN, 7-(DIETHYLAMINO)-4-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55f5848f-8684-44fd-b9b8-f2a8c29f57d3",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376"
          ],
          "display_name": false
        },
        {
          "uuid": "c398a166-73f8-44f8-9438-55dba4fd306a",
          "name": "DIETHYLAMINOMETHYLCOUMARIN",
          "stdName": "DIETHYLAMINOMETHYLCOUMARIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376",
            "66210548-449d-4fd5-b8ff-3e678d840480",
            "a9bee05c-a0fa-476b-a620-7f16d467a258"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "94402473-c75f-417b-9574-ab4c52a9da2a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "330cb67b-96b0-405a-9cad-50ba27fb1c1b",
          "name": "NSC-61830",
          "stdName": "NSC-61830",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fd30cad-eb9f-4bb4-ad92-fdd1cc46a2b4",
            "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "66210548-449d-4fd5-b8ff-3e678d840480",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9b7a53b1-4fc9-436c-aabd-17dbaa3c7376",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55f5848f-8684-44fd-b9b8-f2a8c29f57d3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ad958cf-23be-4e5a-bd12-e70f9fb31c46",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a6c4aae-25dd-40c0-8930-5893f4632bdc",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0fd30cad-eb9f-4bb4-ad92-fdd1cc46a2b4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36d68573-17aa-4158-8484-c4bc43747cb2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391492000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a108f0a-63f2-4ce6-9e6a-53b781bbf60c",
          "citation": "SRS import [1SFJ7F6R2C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1SFJ7F6R2C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391492000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9bee05c-a0fa-476b-a620-7f16d467a258",
          "citation": "DIETHYLAMINOMETHYLCOUMARIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1de68b79-c216-4b70-aa16-70422ea48913",
          "citation": "7-DIETHYLAMINO-4-METHYLCOUMARIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fd23ff57-4042-fc78-60ac-6b558c8a47ea",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+91-44-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "742b1934-a9bf-c256-059f-ff54dbe59554",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=91-44-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "423a7556-2b3f-4ee7-a599-fb315639ff75",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bb073897-7b45-bba9-ab03-0eba07853bf0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b4d45c1d-049b-eda1-2444-e13771a68226",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "77a69775-97ab-dc56-58e0-72cf62d97fa5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "980ffc72-30fb-40e1-84f9-6cb1a72c1f77",
          "id": "980ffc72-30fb-40e1-84f9-6cb1a72c1f77",
          "molfile": "\n  Marvin  01132107542D          \n\n 17 18  0  0  0  0            999 V2000\n   10.2636   -5.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4525   -5.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8948   -5.3102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1461   -4.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9573   -4.3447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0882   -5.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8369   -6.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0411   -6.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4813   -5.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6725   -6.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4256   -6.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1192   -5.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3705   -4.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8150   -4.0032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1772   -4.4374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7348   -5.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5327   -4.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 17  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 16  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)c1ccc2c(C)cc(=O)oc2c1",
          "formula": "C14H17NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cda310e1-4c6e-4e8c-ae80-09b78ec30410"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "231.2908",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e61a8976-266b-4032-986c-479e5a272b87",
      "version": "9",
      "structure": {
        "id": "3ccf3bbb-d8a8-475c-a45b-83cc42ca8049",
        "molfile": "\n  Marvin  01132103132D          \n\n 17 18  0  0  0  0            999 V2000\n   10.2636   -5.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9573   -4.3447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4525   -5.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1461   -4.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8150   -4.0032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8948   -5.3102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4256   -6.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1192   -5.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8369   -6.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3705   -4.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0882   -5.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6725   -6.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0411   -6.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1772   -4.4374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5327   -4.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4813   -5.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7348   -5.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 10  8  1  0  0  0  0\n 11  9  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  6  4  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  6  1  0  0  0  0\n 12  7  1  0  0  0  0\n 12  8  2  0  0  0  0\n 13  9  2  0  0  0  0\n 14 10  1  0  0  0  0\n 15 11  2  0  0  0  0\n 16 12  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 14  1  0  0  0  0\n 17 15  1  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
        "smiles": "CCN(CC)c1ccc2c(C)cc(=O)oc2c1",
        "formula": "C14H17NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "231.2908",
        "optical_activity": "NONE",
        "references": [
          "55f5848f-8684-44fd-b9b8-f2a8c29f57d3",
          "4a108f0a-63f2-4ce6-9e6a-53b781bbf60c"
        ],
        "stereo_centers": 0
      },
      "unii": "1SFJ7F6R2C"
    }
  ]
}