{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e5162f69-77af-4013-ba2d-48476426da88", "code": "1SD9VS79J1", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "2575942f-eb0b-4cca-861d-1e9425c234c2", "code": "117964-21-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=117964-21-3", "code_system": "CAS", "references": [ "b1b0da21-f02b-491a-a113-708155c627e5", "68efb9b5-abe6-4ab6-b591-fc329a0e770d" ] }, { "uuid": "d3932778-ff83-459a-bd51-9bbc327c09eb", "code": "11967214", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11967214", "code_system": "PUBCHEM", "references": [ "b1b0da21-f02b-491a-a113-708155c627e5" ] }, { "uuid": "57590c60-9838-5269-e2bd-8194714c0432", "code": "DTXSID9074775", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9074775", "code_system": "EPA CompTox", "references": [ "a117cf23-f010-0452-8eef-b459310ebc5b" ] }, { "uuid": "ed6b0e8c-b4dc-fccc-9428-500f40d2faec", "code": "300000053711", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "22412ef2-7e34-dabc-123e-501b9b7a90bf" ] } ], "substance_class": "chemical", "names": [ { "uuid": "a2d64556-477f-4bf9-b42a-010a5c263d80", "name": "2,2',3,3',4,4',6,6'-OCTABROMODIPHENYL ETHER", "stdName": "2,2',3,3',4,4',6,6'-OCTABROMODIPHENYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e62b75f3-6726-4f3f-8340-f15071d72d7b", "0426afc1-2cd8-4f2d-baae-7d62ecd06a8d" ], "display_name": true }, { "uuid": "4518b9a4-499c-4a1e-8fc8-c5e39d3b5c90", "name": "BENZENE, 1,1'-OXYBIS(2,3,4,6-TETRABROMO-", "stdName": "BENZENE, 1,1'-OXYBIS(2,3,4,6-TETRABROMO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e62b75f3-6726-4f3f-8340-f15071d72d7b", "0426afc1-2cd8-4f2d-baae-7d62ecd06a8d" ], "display_name": false }, { "uuid": "e70b4742-ed1d-4e0d-9804-002f70fb666d", "name": "PBDE 197", "stdName": "PBDE 197", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e62b75f3-6726-4f3f-8340-f15071d72d7b", "0426afc1-2cd8-4f2d-baae-7d62ecd06a8d" ], "display_name": false } ], "references": [ { "uuid": "e62b75f3-6726-4f3f-8340-f15071d72d7b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0426afc1-2cd8-4f2d-baae-7d62ecd06a8d", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b1b0da21-f02b-491a-a113-708155c627e5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392455000, "tags": [ "NOMEN" ] }, { "uuid": "41d9a230-2bfe-49cd-be83-14e2ed70b42f", "citation": "SRS import [1SD9VS79J1]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1SD9VS79J1", "doc_type": "SRS", "public_domain": true, "document_date": 1493392455000, "tags": [ "NOMEN" ] }, { "uuid": "a117cf23-f010-0452-8eef-b459310ebc5b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=117964-21-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "68efb9b5-abe6-4ab6-b591-fc329a0e770d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "22412ef2-7e34-dabc-123e-501b9b7a90bf", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4d534a79-cc4e-4f74-b772-3ca9c4e21c99", "id": "4d534a79-cc4e-4f74-b772-3ca9c4e21c99", "molfile": "\n Marvin 01132104022D \n\n 21 22 0 0 0 0 999 V2000\n 0.7357 -2.3096 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4441 -2.7322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4325 -3.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1409 -3.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1292 -4.8046 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8612 -3.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9924 -4.2571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1175 -3.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8260 -4.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8143 -4.8742 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5463 -3.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5580 -2.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2783 -2.4198 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8494 -2.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8612 -1.5746 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1292 -2.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4207 -2.3792 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8730 -2.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5932 -2.3503 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1644 -2.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1761 -1.5050 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 20 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 18 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 16 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "c1c(c(c(c(c1Br)Oc2c(cc(c(c2Br)Br)Br)Br)Br)Br)Br", "formula": "C12H2Br8O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "851f9c8d-593f-4988-9da6-cc6ddc710b97" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "801.3723", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b9d0be93-2556-4068-8d30-18d1a3eb7ab5", "version": "4", "structure": { "id": "d4f9c0ce-4343-477a-9f55-e397bf32e868", "molfile": "\n Marvin 01132111022D \n\n 21 22 0 0 0 0 999 V2000\n 6.5463 -3.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8260 -4.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1175 -3.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9924 -4.2571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8612 -3.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1409 -3.9797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4325 -3.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4441 -2.7322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1644 -2.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8730 -2.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5932 -2.3503 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1761 -1.5050 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7357 -2.3096 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1292 -4.8046 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1292 -2.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4207 -2.3792 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8494 -2.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5580 -2.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2783 -2.4198 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8612 -1.5746 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8143 -4.8742 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 5 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 8 13 1 0 0 0 0\n 6 14 1 0 0 0 0\n 15 3 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 15 2 0 0 0 0\n 18 17 1 0 0 0 0\n 1 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 17 20 1 0 0 0 0\n 2 21 1 0 0 0 0\nM END", "smiles": "c1c(c(c(c(c1Br)Oc2c(cc(c(c2Br)Br)Br)Br)Br)Br)Br", "formula": "C12H2Br8O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "801.3723", "optical_activity": "NONE", "references": [ "e62b75f3-6726-4f3f-8340-f15071d72d7b", "41d9a230-2bfe-49cd-be83-14e2ed70b42f" ], "stereo_centers": 0 }, "unii": "1SD9VS79J1" } ] }