{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ae2324e8-8331-4d21-a092-1756ba943e3e",
          "code": "QP53BC51",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR SYSTEMIC USE|Chitin synthesis inhibitors|lufenuron, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53BC51&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "f480e0f3-7a23-4db5-9914-e80e1d9b1411",
          "code": "QP53BC01",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR SYSTEMIC USE|Chitin synthesis inhibitors|lufenuron",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53BC01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "746238ec-3f51-423f-ab1f-05859b02123a",
          "code": "103055-07-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=103055-07-8",
          "code_system": "CAS",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039",
            "cf5cfccb-f10e-4cc2-88af-61b1dcba8543"
          ]
        },
        {
          "uuid": "67297fe0-a165-43b2-9323-2f483b60af33",
          "code": "C76874",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76874",
          "code_system": "NCI_THESAURUS",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "78fb8a01-c99e-4711-ba0f-2927519aff5b",
          "code": "C070364",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67070364",
          "code_system": "MESH",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "dddc17ce-e2c3-43fc-8ad2-61a1d8c8af08",
          "code": "LUFENURON",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Lufenuron",
          "code_system": "WIKIPEDIA",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "bfed38e7-0359-4796-82f8-e39cd6934222",
          "code": "21 CFR 522.1289",
          "comments": "PART 522 IMPLANTATION OR INJECTABLE DOSAGE FORM NEW ANIMAL DRUGS|Sec. 522.1289 Lufenuron suspension.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=522.1289",
          "code_system": "CFR",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "ccec7430-ec56-44e2-9aa5-5b927466872c",
          "code": "SUB08615MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "43232d92-e1a3-4f76-bcbd-41aa0b070e31",
          "code": "118205",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1429",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "ccda56ef-b0f6-450e-8ff7-1d03c4aad0f0",
          "code": "6804",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6804",
          "code_system": "INN",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "eb147e9b-afb0-4544-8569-20ecda32b792",
          "code": "83586",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/83586/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "5d0f9a4a-65d6-40f2-becb-3977e375be41",
          "code": "m6924",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6924?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "5c80773a-7f7f-44bd-8373-c9605e0aa094",
          "code": "21 CFR 520.1288",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.1288 Lufenuron tablets.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.1288",
          "code_system": "CFR",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "cd0abdab-e412-468a-baf3-eb2b8d4a404d",
          "code": "21 CFR 520.1289",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.1289 Lufenuron suspension.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.1289",
          "code_system": "CFR",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "af05e813-4c40-48cd-b145-83354ad9ac11",
          "code": "21 CFR 520.1443",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.1443 Milbemycin oxime and lufenuron.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.1443",
          "code_system": "CFR",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "a58b1b2c-d7af-4ba5-a7ee-3dbdefc30060",
          "code": "21 CFR 520.1447",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.1447 Milbemycin oxime, lufenuron, and praziquantel tablets.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.1447",
          "code_system": "CFR",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "8d8b634a-c026-4417-aed6-9f7293f8338c",
          "code": "CHEMBL1364906",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1364906",
          "code_system": "ChEMBL",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "8bd88ef4-7cf7-447d-88d3-14f327acd0b1",
          "code": "71777",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71777",
          "code_system": "PUBCHEM",
          "references": [
            "958b9f71-5a6d-48e4-9458-09495ad08039"
          ]
        },
        {
          "uuid": "cc7595a5-ff86-962b-3634-96a26506ca1c",
          "code": "DTXSID5034357",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5034357",
          "code_system": "EPA CompTox",
          "references": [
            "7c991efe-2ec4-a4f7-3609-087f5e405533"
          ]
        },
        {
          "uuid": "2360f3e4-876e-d71e-4bce-85d483e21647",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "92d8a2e6-4266-aa59-2b22-ccc8c534cc29"
          ]
        },
        {
          "uuid": "8cf55891-91e3-4476-9260-66cbdc82fdda",
          "code": "1R754M4918",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "73150a05-2a21-8782-3d8a-c3b25d50b67a",
          "code": "DB11424",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11424",
          "code_system": "DRUG BANK",
          "references": [
            "92d8a2e6-4266-aa59-2b22-ccc8c534cc29"
          ]
        },
        {
          "uuid": "c4e6a38e-ee71-2f40-cb48-fc466c9776f3",
          "code": "39384",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:39384",
          "code_system": "CHEBI",
          "references": [
            "92d8a2e6-4266-aa59-2b22-ccc8c534cc29"
          ]
        },
        {
          "uuid": "47ba1d27-ded7-82eb-dc7b-6b19d1c3e911",
          "code": "1370779",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1370779",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "92d8a2e6-4266-aa59-2b22-ccc8c534cc29"
          ]
        },
        {
          "uuid": "5055da8c-5fcc-4a21-40c6-79aabcf189ed",
          "code": "1R754M4918",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1R754M4918",
          "code_system": "DAILYMED",
          "references": [
            "c37fccea-c5ca-5367-f27a-939c450bd90b"
          ]
        },
        {
          "uuid": "8209dc46-672f-37f1-09ce-86ef7ae3d84a",
          "code": "100000082270",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "247a3969-514d-e347-da25-b709f64ea71b"
          ]
        },
        {
          "uuid": "bb137a93-ced4-476f-70ad-4769e354d555",
          "code": "lufenuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/lufenuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "f611ae7b-9c30-b60d-3323-219c5c3a51dd"
          ]
        },
        {
          "uuid": "50a6442f-246e-efd5-19d0-abe7f1f7fa09",
          "code": "759097",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759097",
          "code_system": "NSC",
          "references": [
            "3939774e-4537-3534-068e-8533216530f5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "467d4f52-489a-4223-b1db-caf6ad3b39b0",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a0736fd2-1c37-43fa-8346-e8d76b5a0e47",
            "refuuid": "377ad6a5-fe42-4f56-aac8-ef3905903487",
            "name": "LUFENURON",
            "unii": "1R754M4918",
            "linking_id": "1R754M4918",
            "ref_pname": "LUFENURON",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fba5c331-3291-4232-8c56-44245efc561c",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "31a4a09f-a974-438b-9fd0-4337f1f8cfef",
            "refuuid": "de3c51d6-11c2-44e8-9246-f4743623b370",
            "name": "LUFENURON, (+)-",
            "unii": "9CR45YMS74",
            "linking_id": "9CR45YMS74",
            "ref_pname": "LUFENURON, (+)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "257f243d-829b-4155-8e65-35b4da3e355c",
          "amount": {
            "uuid": "f22f255a-52dc-438f-8d44-89569defb388"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "c9159f04-5669-428d-ad15-8b6b3062c69c",
            "refuuid": "a24c13fd-5fa2-4b09-ac9f-bc75d22658a6",
            "name": "LUFENURON, (-)-",
            "unii": "4629851K7Q",
            "linking_id": "4629851K7Q",
            "ref_pname": "LUFENURON, (-)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9f8760c9-d372-42d2-9c64-a0f3ee02a0fe",
          "amount": {
            "uuid": "24ee6e9b-7151-44b9-98d6-d467804de41f",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "comments": "for veterinary use",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "2a66c5f9-d84e-4ef8-9545-54de767190c1"
          ],
          "related_substance": {
            "uuid": "e009aecc-54c9-49d6-8da1-9a5d46ab5f95",
            "refuuid": "c8384f52-5578-4922-9f5c-e95005a65e99",
            "name": "1-(2-CHLORO-4-((2RS)-1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)-3-(2,6-DIFLUOROBENZOYL)UREA",
            "unii": "N7WXT6L6T6",
            "linking_id": "N7WXT6L6T6",
            "ref_pname": "1-(2-CHLORO-4-((2RS)-1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)-3-(2,6-DIFLUOROBENZOYL)UREA"
          }
        },
        {
          "uuid": "4d3fd895-423e-4866-b92a-64b2c28cafc8",
          "amount": {
            "uuid": "cab50a3f-de04-4b7b-b656-88dc1246e97a",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "comments": "for veterinary use",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "37c342dc-c4ab-43b3-a11f-b2e4c4010994"
          ],
          "related_substance": {
            "uuid": "6892d051-2759-45fe-9531-66ff9428bdd6",
            "refuuid": "e77a9983-61b1-4e4f-9201-bb6048afa7e6",
            "name": "2,6-DIFLUOROBENZAMIDE",
            "unii": "SJ2RN214MK",
            "linking_id": "SJ2RN214MK",
            "ref_pname": "2,6-DIFLUOROBENZAMIDE"
          }
        },
        {
          "uuid": "0fada578-85aa-4d2a-ac67-0b038134fda8",
          "amount": {
            "uuid": "27e8d235-4350-4ff1-ac9f-63e2f60693d5",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "comments": "for veterinary use",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "8abb149c-d16a-4498-be46-da9ea2c10355"
          ],
          "related_substance": {
            "uuid": "449574ba-20eb-4303-a1eb-f36503917224",
            "refuuid": "75857b0a-3e09-4341-9219-4669d021c273",
            "name": "1-(2-CHLORO-6-FLUOROBENZOYL)-3-(2,5-DICHLORO-4-((2RS)-1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)UREA",
            "unii": "39NL422AQS",
            "linking_id": "39NL422AQS",
            "ref_pname": "1-(2-CHLORO-6-FLUOROBENZOYL)-3-(2,5-DICHLORO-4-((2RS)-1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)UREA"
          }
        },
        {
          "uuid": "7b9d9333-5cc2-45e1-85fa-f96900185443",
          "amount": {
            "uuid": "384951c4-b662-423b-b374-c0654c4bb775",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "comments": "for veterinary use",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "eda471a1-8331-4dfa-840b-f8500fa8b3ef"
          ],
          "related_substance": {
            "uuid": "1da34cd0-4049-473a-bedc-fac9c881e96a",
            "refuuid": "26566cfb-0f0b-4c12-b476-78dff3594bf1",
            "name": "2,5-DICHLORO-4-(3-(2,6-DIFLUOROBENZOYL)UREIDO)PHENYL PHENYL CARBONATE",
            "unii": "Q699X0V42C",
            "linking_id": "Q699X0V42C",
            "ref_pname": "2,5-DICHLORO-4-(3-(2,6-DIFLUOROBENZOYL)UREIDO)PHENYL PHENYL CARBONATE"
          }
        },
        {
          "uuid": "f09ed214-f669-4e8a-8c54-565ffe976cbe",
          "amount": {
            "uuid": "e20306e4-7d4f-4ba1-9b92-fb43bb9c3560",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "comments": "for veterinary use",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "afdd7a31-d573-4a43-a808-d265dc737406"
          ],
          "related_substance": {
            "uuid": "6b40f33d-40a5-4e24-88e2-ce19e419da5a",
            "refuuid": "f616d65d-9fed-4704-8ae6-a5c34777107e",
            "name": "1,3-BIS(2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)UREA",
            "unii": "KQ1W5BIP3X",
            "linking_id": "KQ1W5BIP3X",
            "ref_pname": "1,3-BIS(2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)UREA"
          }
        },
        {
          "uuid": "2fb6e88f-af88-4045-8652-0f1f1c0170a3",
          "amount": {
            "uuid": "d05d4824-ab87-4468-b639-309c8b5a4929",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "comments": "for veterinary use",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "e87b447b-d3bb-4a45-ae20-9f78b88c31ec"
          ],
          "related_substance": {
            "uuid": "c4f6bbd2-e9b7-4a79-aefc-f380e7676e2a",
            "refuuid": "7c39b228-edc5-46b8-b64e-52935e185230",
            "name": "1-(2,5-DICHLORO-4-((2RS)-1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)-3-(2-FLUOROBENZOYL)UREA",
            "unii": "E02IX0KO25",
            "linking_id": "E02IX0KO25",
            "ref_pname": "1-(2,5-DICHLORO-4-((2RS)-1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)-3-(2-FLUOROBENZOYL)UREA"
          }
        },
        {
          "uuid": "619638fb-3926-4f3a-8e03-fd3f238bcec7",
          "amount": {
            "uuid": "789a0efc-3d45-406e-bff1-3f149bdf3336",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.3
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "927e7a2f-8d4b-4b83-89de-c5573ffd34d7"
          ],
          "related_substance": {
            "uuid": "c399a172-7305-4e38-9b5d-d44fb182c52a",
            "refuuid": "eaec8fca-81d5-4d9f-9195-58b6c6dd4d7f",
            "name": "N-((2,5-dichloro-4-hydroxyphenyl)carbamoyl)-2,6-difluorobenzamide",
            "unii": "616ZSF7UH1",
            "linking_id": "616ZSF7UH1",
            "ref_pname": "N-((2,5-dichloro-4-hydroxyphenyl)carbamoyl)-2,6-difluorobenzamide"
          }
        },
        {
          "uuid": "7e3180e0-81ee-48f0-bfa5-627454da1aad",
          "amount": {
            "uuid": "df7e0e46-bd1d-40d9-ad87-cd4ab0115b62",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.3
          },
          "comments": "for veterinary use",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ca896650-bd8c-ab46-0005-9de9c21cfed6"
          ],
          "related_substance": {
            "uuid": "1ec69bd5-3939-4b87-99a9-f47fdecf736c",
            "refuuid": "eaec8fca-81d5-4d9f-9195-58b6c6dd4d7f",
            "name": "N-((2,5-dichloro-4-hydroxyphenyl)carbamoyl)-2,6-difluorobenzamide",
            "unii": "616ZSF7UH1",
            "linking_id": "616ZSF7UH1",
            "ref_pname": "N-((2,5-dichloro-4-hydroxyphenyl)carbamoyl)-2,6-difluorobenzamide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3fd7d5cd-44d1-4000-8ab2-e5334197822d",
          "amount": {
            "uuid": "500a149d-5bf0-4a50-98f5-30a7a1383bf4",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.4
          },
          "comments": "for veterinary use",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ca896650-bd8c-ab46-0005-9de9c21cfed6"
          ],
          "related_substance": {
            "uuid": "dbec7c34-6558-41d9-989a-f4659b04e28c",
            "refuuid": "4d3286a4-affe-4f98-990e-7426b1b2582a",
            "name": "N-(3-CHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYLCARBAMOYL)-2,6-DIFLUOROBENZAMIDE",
            "unii": "B0U5842Q0E",
            "linking_id": "B0U5842Q0E",
            "ref_pname": "N-(3-CHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYLCARBAMOYL)-2,6-DIFLUOROBENZAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "da2c45ae-2d87-4083-ad3c-7d4d0ff5262c",
          "amount": {
            "uuid": "78939911-f962-4308-9f37-66aa4b439844",
            "type": "WEIGHT PERCENT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.4,
            "non_numeric_value": "corrected by response factor"
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "related_substance": {
            "uuid": "aaeca3c5-5f9c-4758-93f3-537bb49c0006",
            "refuuid": "4d3286a4-affe-4f98-990e-7426b1b2582a",
            "name": "N-(3-CHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYLCARBAMOYL)-2,6-DIFLUOROBENZAMIDE",
            "unii": "B0U5842Q0E",
            "linking_id": "B0U5842Q0E",
            "ref_pname": "N-(3-CHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYLCARBAMOYL)-2,6-DIFLUOROBENZAMIDE"
          }
        },
        {
          "uuid": "98c71de2-1afa-46f4-a2af-2cde163dcab4",
          "amount": {
            "uuid": "a5e65c10-985d-4d51-99d0-6d56de7b904b"
          },
          "comments": "inhibits chitin biosynthesis",
          "type": "TARGET->INHIBITOR",
          "references": [
            "728420d0-49b5-4f0b-853b-363cc27e6e7b"
          ],
          "related_substance": {
            "uuid": "49c73916-aea3-44de-a398-8ef1c1b9f3f3",
            "refuuid": "0af8b35e-fcc6-4fe8-adb2-fa9406262639",
            "name": "CHITIN",
            "unii": "8SH93A7QWW",
            "linking_id": "8SH93A7QWW",
            "ref_pname": "CHITIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c32e671f-b108-431b-b97a-e1b559cc3192",
          "name": "(RS)-1-(2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)-3-(2,6-DIFLUOROBENZOYL)UREA",
          "stdName": "(RS)-1-(2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)-3-(2,6-DIFLUOROBENZOYL)UREA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c51f5842-8e1e-411c-b0ee-0c985fedbed9",
            "eb49d23d-23aa-4854-a41a-659fe8af8e05"
          ],
          "display_name": false
        },
        {
          "uuid": "19cb568e-77a3-4302-85fe-c75c9a85cd30",
          "name": "1-(2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)-3-(2,6-DIFLUOROBENZOYL)-UREA",
          "stdName": "1-(2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)-3-(2,6-DIFLUOROBENZOYL)-UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99f37364-0d3f-4410-a6b8-45705d6079d4"
          ],
          "display_name": false
        },
        {
          "uuid": "a094615b-06e8-4cdd-8a53-e310532bb6ce",
          "name": "CGA-184699",
          "stdName": "CGA-184699",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "997fe9d2-c7e2-4885-9397-3bb9b096b80c"
          ],
          "display_name": false
        },
        {
          "uuid": "5c81566e-4397-434e-b538-7897c94a8485",
          "name": "LUFENURON",
          "stdName": "LUFENURON",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfb66b9e-3720-481d-a900-72c3201d5760",
            "6c68a5fd-1a8f-41ab-9fc9-36a328886291",
            "3285992e-76b2-4901-9980-3c328997dfc3",
            "791146b2-da41-43ac-afa0-c506f62607e7",
            "c2ea06e3-f747-4fc4-bb6e-33caecc3173a",
            "db4ea902-53dd-48e2-9582-9803c2a933ed",
            "82d9468c-ab9d-484a-b5f7-0631ce3a72bf",
            "7eb73206-e757-43d6-b0b4-029f7eecabdf",
            "8a91f19f-86f7-4a02-a110-5e940d08460c",
            "103f29a5-669e-4531-9880-71b9c71c7b92",
            "6747a025-baec-45b5-bd6d-39d73884a1be"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "64e04ffa-e4ca-420c-9a7f-88f15704343d",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "842bdeca-ea16-4190-9b54-248fd54e4e3b",
          "name": "LUFENURON (ANHYDROUS) FOR VETERINARY USE",
          "stdName": "LUFENURON (ANHYDROUS) FOR VETERINARY USE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84973d49-3ef9-4828-9a25-4e0ccdbc0567",
            "6b6622ef-4b38-47d6-be54-4b9c0f86c291",
            "04591990-3699-4df4-84d9-f541d4b5ae66"
          ],
          "display_name": false
        },
        {
          "uuid": "8b1000c7-bd78-0a1c-f04d-10d07bed8079",
          "name": "LUFENURON (ANHYDROUS) FOR VETERINARY USE [EP IMPURITY]",
          "stdName": "LUFENURON (ANHYDROUS) FOR VETERINARY USE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b6622ef-4b38-47d6-be54-4b9c0f86c291"
          ],
          "display_name": false
        },
        {
          "uuid": "35863673-0a15-49e2-bb26-cd11160835f4",
          "name": "LUFENURON [GREEN BOOK]",
          "stdName": "LUFENURON [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c68a5fd-1a8f-41ab-9fc9-36a328886291"
          ],
          "display_name": false
        },
        {
          "uuid": "4a1c7b93-0cf7-43f3-a905-f24f6a638534",
          "name": "LUFENURON [MART.]",
          "stdName": "LUFENURON [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db4ea902-53dd-48e2-9582-9803c2a933ed"
          ],
          "display_name": false
        },
        {
          "uuid": "2d4f46b7-efb4-46db-8785-8789c68cb32c",
          "name": "LUFENURON [MI]",
          "stdName": "LUFENURON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "103f29a5-669e-4531-9880-71b9c71c7b92"
          ],
          "display_name": false
        },
        {
          "uuid": "9a0af19e-64f5-1079-9720-35d63c9d8709",
          "name": "LUFENURON [USP MONOGRAPH]",
          "stdName": "LUFENURON [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c465e882-aa9a-0e91-8f1c-d5508f9dead7"
          ],
          "display_name": false
        },
        {
          "uuid": "6e690c47-1688-4bb7-b883-5d2659443449",
          "name": "LUFENURON [USP-RS]",
          "stdName": "LUFENURON [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "791146b2-da41-43ac-afa0-c506f62607e7"
          ],
          "display_name": false
        },
        {
          "uuid": "ac08ed7a-f934-4b40-bc14-11a8558e5eed",
          "name": "N-(((2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)AMINO)CARBONYL)-2,6-DIFLUOROBENZAMIDE",
          "stdName": "N-(((2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)PHENYL)AMINO)CARBONYL)-2,6-DIFLUOROBENZAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb49d23d-23aa-4854-a41a-659fe8af8e05",
            "d12be7fa-da9d-4b56-a973-7a7e3a4b3db3"
          ],
          "display_name": false
        },
        {
          "uuid": "6da0fc49-3ac3-5744-03fa-2c06947c079d",
          "name": "NSC-759097",
          "stdName": "NSC-759097",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3939774e-4537-3534-068e-8533216530f5"
          ],
          "display_name": false
        },
        {
          "uuid": "45071d91-b76a-44a5-8718-fcfe54e7ba84",
          "name": "PROGRAM",
          "stdName": "PROGRAM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b021c55-84f8-4054-8130-8a4fee294445"
          ],
          "display_name": false
        },
        {
          "uuid": "8b3bd8f9-8ca8-4be9-bd08-00b3005c9ab3",
          "name": "SENTINEL COMPONENT LUFENURON",
          "stdName": "SENTINEL COMPONENT LUFENURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dbe984c-aa9d-4062-aed1-ffb6dd1621aa"
          ],
          "display_name": false
        },
        {
          "uuid": "fc7c56d9-bc47-4db4-830f-c7d16bbc59e3",
          "name": "lufenuron [INN]",
          "stdName": "LUFENURON [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2ea06e3-f747-4fc4-bb6e-33caecc3173a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "927e7a2f-8d4b-4b83-89de-c5573ffd34d7",
          "citation": "USP42-NF37 - 2647, Lufenuron Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e87b447b-d3bb-4a45-ae20-9f78b88c31ec",
          "citation": "European Pharmacopoeia Online 9.8, Lufenuron for veterinary use Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8abb149c-d16a-4498-be46-da9ea2c10355",
          "citation": "European Pharmacopoeia Online 9.8, Lufenuron for veterinary use Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "03f30b15-b2fe-4923-9d55-bb45758eacdf",
          "citation": "European Pharmacopoeia Online 9.8, Lufenuron for veterinary use Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "37c342dc-c4ab-43b3-a11f-b2e4c4010994",
          "citation": "European Pharmacopoeia Online 9.8, Lufenuron for veterinary use Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ca896650-bd8c-ab46-0005-9de9c21cfed6",
          "citation": "European Pharmacopoeia Online 9.8, Lufenuron for veterinary use Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eda471a1-8331-4dfa-840b-f8500fa8b3ef",
          "citation": "European Pharmacopoeia Online 9.8, Lufenuron for veterinary use Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a65f83ff-65d8-4e2c-b3c4-e8768ad5a26d",
          "citation": "European Pharmacopoeia Online 9.8, Lufenuron for veterinary use Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "afdd7a31-d573-4a43-a808-d265dc737406",
          "citation": "European Pharmacopoeia Online 9.8, Lufenuron for veterinary use Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2a66c5f9-d84e-4ef8-9545-54de767190c1",
          "citation": "European Pharmacopoeia Online 9.8, Lufenuron for veterinary use Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bfb66b9e-3720-481d-a900-72c3201d5760",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "99f37364-0d3f-4410-a6b8-45705d6079d4",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb49d23d-23aa-4854-a41a-659fe8af8e05",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c51f5842-8e1e-411c-b0ee-0c985fedbed9",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d12be7fa-da9d-4b56-a973-7a7e3a4b3db3",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2ea06e3-f747-4fc4-bb6e-33caecc3173a",
          "citation": "INN Proposed List 65",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL65.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "84973d49-3ef9-4828-9a25-4e0ccdbc0567",
          "citation": "ep",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b6622ef-4b38-47d6-be54-4b9c0f86c291",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db4ea902-53dd-48e2-9582-9803c2a933ed",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "103f29a5-669e-4531-9880-71b9c71c7b92",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c68a5fd-1a8f-41ab-9fc9-36a328886291",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "791146b2-da41-43ac-afa0-c506f62607e7",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2dbe984c-aa9d-4062-aed1-ffb6dd1621aa",
          "citation": "http://en.wikipedia.org/wiki/Milbemycin_oxime/lufenuron",
          "url": "http://en.wikipedia.org/wiki/Milbemycin_oxime/lufenuron",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "997fe9d2-c7e2-4885-9397-3bb9b096b80c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b021c55-84f8-4054-8130-8a4fee294445",
          "citation": "https://en.wikipedia.org/wiki/Lufenuron",
          "url": "https://en.wikipedia.org/wiki/Lufenuron",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "958b9f71-5a6d-48e4-9458-09495ad08039",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d363fee-2c3b-46be-a5c2-975fa3d1f962",
          "citation": "SRS import [1R754M4918]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1R754M4918",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af9b3d67-5405-4b8d-a514-75c46b7028a7",
          "citation": "USP Dictionary 2010; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6747a025-baec-45b5-bd6d-39d73884a1be",
          "citation": "LUFENURON [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "04591990-3699-4df4-84d9-f541d4b5ae66",
          "citation": "LUFENURON (ANHYDROUS) FOR VETERINARY USE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3285992e-76b2-4901-9980-3c328997dfc3",
          "citation": "LUFENURON [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7eb73206-e757-43d6-b0b4-029f7eecabdf",
          "citation": "LUFENURON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82d9468c-ab9d-484a-b5f7-0631ce3a72bf",
          "citation": "LUFENURON [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a91f19f-86f7-4a02-a110-5e940d08460c",
          "citation": "LUFENURON [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7c991efe-2ec4-a4f7-3609-087f5e405533",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=103055-07-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "247a3969-514d-e347-da25-b709f64ea71b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "92d8a2e6-4266-aa59-2b22-ccc8c534cc29",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9eac5ca3-5f89-27dc-37cf-6ef7df5bde6c",
          "citation": "https://en.wikipedia.org/wiki/Lufenuron",
          "url": "https://en.wikipedia.org/wiki/Lufenuron",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "cf5cfccb-f10e-4cc2-88af-61b1dcba8543",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f611ae7b-9c30-b60d-3323-219c5c3a51dd",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "83d8e81e-391a-f811-1c9a-afd53701f46c",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "c465e882-aa9a-0e91-8f1c-d5508f9dead7",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "3939774e-4537-3534-068e-8533216530f5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "728420d0-49b5-4f0b-853b-363cc27e6e7b",
          "citation": "https://en.wikipedia.org/wiki/Lufenuron",
          "url": "https://en.wikipedia.org/wiki/Lufenuron",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "c37fccea-c5ca-5367-f27a-939c450bd90b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "991b30ca-5f0a-4db1-9b85-be71a1ec2968",
          "id": "991b30ca-5f0a-4db1-9b85-be71a1ec2968",
          "molfile": "\n  Marvin  01132107572D          \n\n 32 33  0  0  0  0            999 V2000\n    1.4922    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4612   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.7293   -1.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0310   -0.7707    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6905   -2.0353    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5931    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1517   -1.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1207   -2.0896    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1905   -0.4371    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8861   -0.8793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -1.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3008   -2.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3008   -3.3853    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.0146   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7335   -2.5629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4473   -2.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4473   -1.3267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1636   -2.5629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8774   -2.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8774   -1.3267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5963   -2.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3101   -2.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3101   -1.3267    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0187   -2.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0187   -3.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3101   -3.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5963   -3.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8774   -3.8042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0146   -1.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3008   -0.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3008   -0.0853    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  3  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 31 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 30  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 28 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  2  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 31  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(c(c1)F)C(=O)NC(=O)Nc2cc(c(cc2Cl)OC(C(C(F)(F)F)F)(F)F)Cl)F",
          "formula": "C17H8Cl2F8N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ccf127c6-5cbb-4ba1-9337-b0b1e700a7b4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "511.1508",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "377ad6a5-fe42-4f56-aac8-ef3905903487",
      "version": "35",
      "structure": {
        "id": "e3c14f33-faa0-434a-8e98-a2fbe289a927",
        "molfile": "\n  Marvin  01132111472D          \n\n 32 33  0  0  0  0            999 V2000\n    2.1517   -1.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8774   -2.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1636   -2.5629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4612   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5963   -2.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4473   -2.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7293   -1.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8861   -0.8793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -1.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0146   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7335   -2.5629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5844   -2.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0146   -1.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3008   -0.9103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3008   -2.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8774   -1.3267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3101   -2.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5963   -3.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4473   -1.3267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1207   -2.0896    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1905   -0.4371    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0310   -0.7707    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6905   -2.0353    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5931    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4922    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3008   -3.3853    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.3008   -0.0853    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.3101   -1.3267    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8774   -3.8042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0187   -3.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3101   -3.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0187   -2.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6 11  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  9  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14  9  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16  2  2  0  0  0  0\n 17  5  1  0  0  0  0\n 18  5  2  0  0  0  0\n 19  6  2  0  0  0  0\n 20  1  1  0  0  0  0\n 21  1  1  0  0  0  0\n 22  7  1  0  0  0  0\n 23  7  1  0  0  0  0\n 24  7  1  0  0  0  0\n 25  4  1  0  0  0  0\n 26 15  1  0  0  0  0\n 27 14  1  0  0  0  0\n 28 17  1  0  0  0  0\n 29 18  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 18  1  0  0  0  0\n 32 17  2  0  0  0  0\n 10 15  2  0  0  0  0\n 30 32  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(c(c1)F)C(=O)NC(=O)Nc2cc(c(cc2Cl)OC(C(C(F)(F)F)F)(F)F)Cl)F",
        "formula": "C17H8Cl2F8N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "511.1508",
        "optical_activity": "( + / - )",
        "references": [
          "af9b3d67-5405-4b8d-a514-75c46b7028a7",
          "4d363fee-2c3b-46be-a5c2-975fa3d1f962",
          "c2ea06e3-f747-4fc4-bb6e-33caecc3173a"
        ],
        "stereo_centers": 1
      },
      "unii": "1R754M4918"
    }
  ]
}