{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "366910e6-eac1-4ef2-8a67-ec9eadb8a3d8",
          "code": "m5696",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5696?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "498ae024-7e14-4bab-8080-8d34a1aeb1a7"
          ]
        },
        {
          "uuid": "413ed7d7-6dbb-4cd3-8fea-f2756294a110",
          "code": "5281377",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281377",
          "code_system": "PUBCHEM",
          "references": [
            "498ae024-7e14-4bab-8080-8d34a1aeb1a7"
          ]
        },
        {
          "uuid": "24166f7c-92d1-4098-a067-140ef7b56dd5",
          "code": "529-59-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=529-59-9",
          "code_system": "CAS",
          "references": [
            "498ae024-7e14-4bab-8080-8d34a1aeb1a7",
            "56a3e2a5-e459-4d4b-886c-2ca79d57a437"
          ]
        },
        {
          "uuid": "6e11219f-1e2e-434f-90dc-281ce903e487",
          "code": "C040641",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67040641",
          "code_system": "MESH",
          "references": [
            "498ae024-7e14-4bab-8080-8d34a1aeb1a7"
          ]
        },
        {
          "uuid": "d05c53dd-ef88-428a-91d1-8f5f6679637e",
          "code": "GENISTIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Genistin",
          "code_system": "WIKIPEDIA",
          "references": [
            "498ae024-7e14-4bab-8080-8d34a1aeb1a7"
          ]
        },
        {
          "uuid": "2445b3f4-9ce6-9c01-f132-7136c657b69f",
          "code": "DTXSID3022324",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3022324",
          "code_system": "EPA CompTox",
          "references": [
            "bbff0634-9f0f-c84d-4c83-fc3324e106e8"
          ]
        },
        {
          "uuid": "41a139d7-8dc1-4863-b494-b81a5d025079",
          "code": "1POG3SCN5T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "273d7de9-fdfe-bd58-55a7-458b05055a69",
          "code": "27514",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27514",
          "code_system": "CHEBI",
          "references": [
            "ca2b37c4-443f-e6fb-c846-2f7738aead7e"
          ]
        },
        {
          "uuid": "6f61fb90-546f-d188-46cd-347edb5f877a",
          "code": "1288805",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1288805",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "ca2b37c4-443f-e6fb-c846-2f7738aead7e"
          ]
        },
        {
          "uuid": "4c09a3a1-1807-64ef-139f-2d27bc2ba72e",
          "code": "5112",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5112",
          "code_system": "NSC",
          "references": [
            "85d0ce2f-b701-5dfe-b74a-ddf6328b9d9f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "77b03c7a-7f24-4ea7-b6ad-d2f1a1cc594a",
          "name": "4',5,7-TRIHYDROXYISOFLAVONE 7-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "4',5,7-TRIHYDROXYISOFLAVONE 7-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8e6aee6-90f1-40bc-acbd-47523edf7311"
          ],
          "display_name": false
        },
        {
          "uuid": "11e2caee-78c5-46c0-a2c6-592923ab3efd",
          "name": "4H-1-BENZOPYRAN-4-ONE, 7-(.BETA.-D-GLUCOPYRANOSYLOXY)-5-HYDROXY-3-(4-HYDROXYPHENYL)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 7-(.BETA.-D-GLUCOPYRANOSYLOXY)-5-HYDROXY-3-(4-HYDROXYPHENYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8e6aee6-90f1-40bc-acbd-47523edf7311"
          ],
          "display_name": false
        },
        {
          "uuid": "26c2a5b2-7041-4b93-9509-c4301681601a",
          "name": "5,4'-DI-HYDROXYISOFLAVONE-7-O-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "5,4'-DI-HYDROXYISOFLAVONE-7-O-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8e6aee6-90f1-40bc-acbd-47523edf7311"
          ],
          "display_name": false
        },
        {
          "uuid": "9c89b55d-f504-4bc7-acb7-3b955a5fcbf9",
          "name": "GENISTEIN 7-O-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "GENISTEIN 7-O-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8e6aee6-90f1-40bc-acbd-47523edf7311"
          ],
          "display_name": false
        },
        {
          "uuid": "e2a5110d-7e5d-42e3-ab01-bf0d3cd8b83f",
          "name": "GENISTEIN 7-O-.BETA.-D-GLUCOSIDE",
          "stdName": "GENISTEIN 7-O-.BETA.-D-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ded0a33d-bedb-426e-b1c8-b06f8ef6d966"
          ],
          "display_name": false
        },
        {
          "uuid": "c4480e59-2091-4f9c-ba80-48e05f1023f2",
          "name": "GENISTEIN 7-O-GLUCOSIDE",
          "stdName": "GENISTEIN 7-O-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8e6aee6-90f1-40bc-acbd-47523edf7311"
          ],
          "display_name": false
        },
        {
          "uuid": "1bc7d359-dea1-4fea-b52f-841f8da18c2d",
          "name": "GENISTEIN GENISTIN [MI]",
          "stdName": "GENISTEIN GENISTIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf39017d-b945-4f64-9a96-f44715d86b53"
          ],
          "display_name": false
        },
        {
          "uuid": "07c45fea-8dee-45d5-8c61-dd2fbb52fbf1",
          "name": "GENISTIN",
          "stdName": "GENISTIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ea03865-7d68-43df-a201-8223e7770d57",
            "ded0a33d-bedb-426e-b1c8-b06f8ef6d966",
            "f1749241-f1aa-4fc9-a147-b700b3ebf985"
          ],
          "display_name": true
        },
        {
          "uuid": "b24c3f0e-e6fd-4b99-9bb5-7c6ff8141e1c",
          "name": "GENISTIN (CONSTITUENT OF SOY ISOFLAVONES) [DSC]",
          "stdName": "GENISTIN (CONSTITUENT OF SOY ISOFLAVONES) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fef1759-22ec-45c5-a57f-d72b01a65f0a"
          ],
          "display_name": false
        },
        {
          "uuid": "bacb9963-3119-46a3-9280-96b370850aa8",
          "name": "GENISTIN [USP-RS]",
          "stdName": "GENISTIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ea03865-7d68-43df-a201-8223e7770d57"
          ],
          "display_name": false
        },
        {
          "uuid": "c1ec2c30-1fea-44ab-9dab-f2d25cb86ed8",
          "name": "GENISTOSIDE",
          "stdName": "GENISTOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ded0a33d-bedb-426e-b1c8-b06f8ef6d966"
          ],
          "display_name": false
        },
        {
          "uuid": "8465bbb9-bc25-4499-894a-d2fd341fbad2",
          "name": "NSC-5112",
          "stdName": "NSC-5112",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8e6aee6-90f1-40bc-acbd-47523edf7311"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ded0a33d-bedb-426e-b1c8-b06f8ef6d966",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d8e6aee6-90f1-40bc-acbd-47523edf7311",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ea03865-7d68-43df-a201-8223e7770d57",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fef1759-22ec-45c5-a57f-d72b01a65f0a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf39017d-b945-4f64-9a96-f44715d86b53",
          "citation": "Merck Index",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "498ae024-7e14-4bab-8080-8d34a1aeb1a7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389913000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "922dd5d6-1fe7-4f87-86c9-556a8b9f6193",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f1d9981-8969-4da2-abe2-c02d14272096",
          "citation": "SRS import [1POG3SCN5T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1POG3SCN5T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389913000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1749241-f1aa-4fc9-a147-b700b3ebf985",
          "citation": "GENISTIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bbff0634-9f0f-c84d-4c83-fc3324e106e8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=529-59-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3ef790b2-1497-7889-1db1-27142f81bb38",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "56a3e2a5-e459-4d4b-886c-2ca79d57a437",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ca2b37c4-443f-e6fb-c846-2f7738aead7e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "85d0ce2f-b701-5dfe-b74a-ddf6328b9d9f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5ac1d26e-173e-4377-846b-02cfe88e5f1d",
          "id": "5ac1d26e-173e-4377-846b-02cfe88e5f1d",
          "molfile": "\n  Marvin  01132104422D          \n\n 31 34  0  0  1  0            999 V2000\n    3.8811   -2.9144    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.4685   -2.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6574   -2.3396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7061   -2.9144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1234   -3.6330    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.9484   -3.6330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6623   -4.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6623   -4.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3762   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3762   -6.1081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0945   -4.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0945   -4.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3762   -3.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8083   -3.6236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5269   -4.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5269   -4.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2406   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9498   -4.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6637   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6637   -6.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3776   -6.5254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9498   -6.5207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2406   -6.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8083   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8083   -6.1081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7061   -4.3420    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.1188   -5.0651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8765   -4.3420    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.4593   -5.0606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4685   -3.6283    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.6389   -3.6283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 30  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 26  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 13  2  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 24  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 24  1  0  0  0  0\n 18 17  1  0  0  0  0\n 23 17  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 27  1  6  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  1  0  0  0\n 30 28  1  0  0  0  0\n 30 31  1  6  0  0  0\nM  END",
          "smiles": "c1cc(ccc1-c2coc3cc(cc(c3c2=O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)O",
          "formula": "C21H20O10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc2ac5db-e267-4d6e-9f60-cd760578c199"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "432.3783",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d3b441f5-6200-460c-8969-2a8f69307406",
      "version": "10",
      "structure": {
        "id": "bf923011-d562-43db-a41b-25c1a9c559b7",
        "molfile": "\n  Marvin  01132109542D          \n\n 31 34  0  0  1  0            999 V2000\n    8.8083   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0945   -4.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0945   -4.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3762   -3.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6623   -4.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9484   -3.6330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1234   -3.6330    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.7061   -4.3420    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.8765   -4.3420    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4685   -3.6283    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.6389   -3.6283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8811   -2.9144    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7061   -2.9144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4685   -2.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6574   -2.3396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4593   -5.0606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1188   -5.0651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6623   -4.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3762   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3762   -6.1081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8083   -3.6236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5269   -4.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5269   -4.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2406   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9498   -4.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6637   -5.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6637   -6.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3776   -6.5254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9498   -6.5207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2406   -6.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8083   -6.1081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  6  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13  7  1  0  0  0  0\n 12 14  1  1  0  0  0\n 15 14  1  0  0  0  0\n  9 16  1  1  0  0  0\n  8 17  1  6  0  0  0\n 18  5  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19  2  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21  3  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23  1  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 27 29  2  0  0  0  0\n 29 30  1  0  0  0  0\n 30 24  2  0  0  0  0\n 31  1  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1-c2coc3cc(cc(c3c2=O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)O",
        "formula": "C21H20O10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "432.3783",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4f1d9981-8969-4da2-abe2-c02d14272096",
          "d8e6aee6-90f1-40bc-acbd-47523edf7311"
        ],
        "stereo_centers": 5
      },
      "unii": "1POG3SCN5T"
    }
  ]
}