{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5c33fa0a-e663-47f4-b100-77ac8863914b",
          "code": "847250-01-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=847250-01-5",
          "code_system": "CAS",
          "references": [
            "f7bc61d6-f945-404b-b459-c9cfe99b1420",
            "767f29ae-f783-4ebf-ac98-b18b3e5d31ca"
          ]
        },
        {
          "uuid": "582e6fbf-dc60-4226-88a2-d8e3238fd101",
          "code": "11652770",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11652770",
          "code_system": "PUBCHEM",
          "references": [
            "f7bc61d6-f945-404b-b459-c9cfe99b1420"
          ]
        },
        {
          "uuid": "ee76131e-392e-905d-1c5b-185d3bc5a4d9",
          "code": "DTXSID50233745",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50233745",
          "code_system": "EPA CompTox",
          "references": [
            "c2a7f048-c836-9ef4-dcc5-8aa78a3c687c"
          ]
        },
        {
          "uuid": "8e39b2de-074d-48cf-9ac1-8d0c2826adbb",
          "code": "1PD67623G7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7541b9b9-10c7-4796-b9c7-40aaf62836cb",
          "name": "BENZENEACETAMIDE, 4-((4-(1,1-DIMETHYLETHYL)BENZOYL)AMINO)-N-HYDROXY-",
          "stdName": "BENZENEACETAMIDE, 4-((4-(1,1-DIMETHYLETHYL)BENZOYL)AMINO)-N-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12d448bb-0cdd-41e9-a58a-e21fdbbca7f4",
            "64716c4d-2802-44ca-8ec6-aa28ffe0e7f3"
          ],
          "display_name": false
        },
        {
          "uuid": "f04d8337-8ede-48fc-8d46-b63862a4a83f",
          "name": "ELATINATE AE140",
          "stdName": "ELATINATE AE140",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d4dd4b-4287-406e-999c-25e8424f5350",
            "64716c4d-2802-44ca-8ec6-aa28ffe0e7f3"
          ],
          "display_name": false
        },
        {
          "uuid": "2487bbcd-3e9e-4233-9f73-2681484b3aba",
          "name": "T-BUTYLBENZAMIDO HYDROXYLPHENYLACETAMIDE",
          "stdName": "T-BUTYLBENZAMIDO HYDROXYLPHENYLACETAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "74d4dd4b-4287-406e-999c-25e8424f5350",
            "934fb947-faeb-4877-bc48-d034a547f991",
            "64716c4d-2802-44ca-8ec6-aa28ffe0e7f3"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4a1d6b11-5c39-45fd-b430-d2270a355de2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e15bfc05-b42d-4453-a562-8c47dadfb9b4",
          "name": "TERT-BUTYLBENZAMIDO HYDROXYLPHENYLACETAMIDE",
          "stdName": "TERT-BUTYLBENZAMIDO HYDROXYLPHENYLACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2be90441-077c-4dba-90c7-e6ee55be0792",
            "64716c4d-2802-44ca-8ec6-aa28ffe0e7f3"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "74d4dd4b-4287-406e-999c-25e8424f5350",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "64716c4d-2802-44ca-8ec6-aa28ffe0e7f3",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12d448bb-0cdd-41e9-a58a-e21fdbbca7f4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2be90441-077c-4dba-90c7-e6ee55be0792",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7bc61d6-f945-404b-b459-c9cfe99b1420",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391622000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45d07db2-2c48-48bf-afe5-e6a8d70d71b0",
          "citation": "SRS import [1PD67623G7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1PD67623G7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391622000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "934fb947-faeb-4877-bc48-d034a547f991",
          "citation": "T-BUTYLBENZAMIDO HYDROXYLPHENYLACETAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2a7f048-c836-9ef4-dcc5-8aa78a3c687c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=847250-01-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "767f29ae-f783-4ebf-ac98-b18b3e5d31ca",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "783a2328-31cb-4c33-8521-e5b4506591ae",
          "id": "783a2328-31cb-4c33-8521-e5b4506591ae",
          "molfile": "\n  Marvin  01132106152D          \n\n 24 25  0  0  0  0            999 V2000\n    4.0621   -4.0160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0621   -4.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3478   -4.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3480   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7765   -5.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4906   -4.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2053   -5.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2053   -6.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4912   -6.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7765   -6.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9196   -6.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0751   -7.3786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7725   -6.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4866   -5.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4866   -4.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2005   -4.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9149   -4.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6293   -4.3821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3436   -4.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3436   -5.6190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0577   -4.3822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0577   -3.5576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9149   -5.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2010   -6.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 11  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 24  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 23  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(cc1)C(=O)Nc2ccc(cc2)CC(=O)NO",
          "formula": "C19H22N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bd4ae953-1c4f-4535-8583-e89fcce8d9d9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "326.3903",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "04b726b0-e078-4df0-afe2-41ef0d5cfe56",
      "version": "4",
      "structure": {
        "id": "35f89067-735c-4d75-a759-a15e47c8b9a4",
        "molfile": "\n  Marvin  01132102522D          \n\n 24 25  0  0  0  0            999 V2000\n   11.3436   -4.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0577   -4.3822    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3436   -5.6190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0577   -3.5576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6293   -4.3821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9149   -4.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2005   -4.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4866   -4.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4866   -5.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2010   -6.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9149   -5.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7725   -6.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0751   -7.3786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0621   -4.0160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3478   -4.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3480   -5.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0621   -4.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9196   -6.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2053   -5.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2053   -6.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4912   -6.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7765   -6.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7765   -5.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4906   -4.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 18 12  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n  6 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n 18 13  2  0  0  0  0\n 17 14  1  0  0  0  0\n 17 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 23 17  1  0  0  0  0\n 20 18  1  0  0  0  0\n 24 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n  1  5  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(cc1)C(=O)Nc2ccc(cc2)CC(=O)NO",
        "formula": "C19H22N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "326.3903",
        "optical_activity": "NONE",
        "references": [
          "45d07db2-2c48-48bf-afe5-e6a8d70d71b0",
          "12d448bb-0cdd-41e9-a58a-e21fdbbca7f4"
        ],
        "stereo_centers": 0
      },
      "unii": "1PD67623G7"
    }
  ]
}