{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "688a3613-7087-4b47-8c47-9fcc08a872ec",
          "code": "1119831-25-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1119831-25-2",
          "code_system": "CAS",
          "references": [
            "534c9f76-c3b6-da9d-f5fe-c1c8df0c6f63"
          ]
        },
        {
          "uuid": "3b7418ef-b1b4-48bd-a660-47734bbddbc0",
          "code": "57422431",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/57422431",
          "code_system": "PUBCHEM",
          "references": [
            "94c414c4-6f24-8d74-d6a4-9c674848942c"
          ]
        },
        {
          "uuid": "cdac4709-aa47-4e17-9609-aa545f917b17",
          "code": "1P43YY1KO2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8c597819-5375-63cb-45f6-a9cd7d002eee",
          "code": "DTXSID401020013",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401020013",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "1a336910-363a-69c6-4b2a-005dff5ea65d",
          "code": "2137",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2137/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "c03f2bab-bbe1-e940-82cb-69277e5eade7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3e807351-6b9c-6696-9234-a5b5db5b64f0",
          "name": "2,4-IMIDAZOLIDINEDIONE, 3-(1-((3,5-DIMETHYL-4-ISOXAZOLYL)-METHYL)-1H-PYRAZOL-4-YL)-1-((3-HYDROXYPHENYL)METHYL)-",
          "stdName": "2,4-IMIDAZOLIDINEDIONE, 3-(1-((3,5-DIMETHYL-4-ISOXAZOLYL)-METHYL)-1H-PYRAZOL-4-YL)-1-((3-HYDROXYPHENYL)METHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ab4f6db-6e21-ed8b-1670-5a2597a0f016",
            "534c9f76-c3b6-da9d-f5fe-c1c8df0c6f63"
          ],
          "display_name": false
        },
        {
          "uuid": "d45e58e6-704f-1d95-4be7-46fd8db659bd",
          "name": "3-(1-((3,5-DIMETHYLISOXAZOL-4-YL)METHYL)-1H-PYRAZOL-4-YL)-1-(3-HYDROXYBENZYL)-IMIDAZOLIDINE-2,4-DIONE",
          "stdName": "3-(1-((3,5-DIMETHYLISOXAZOL-4-YL)METHYL)-1H-PYRAZOL-4-YL)-1-(3-HYDROXYBENZYL)-IMIDAZOLIDINE-2,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "534c9f76-c3b6-da9d-f5fe-c1c8df0c6f63",
            "1ab4f6db-6e21-ed8b-1670-5a2597a0f016"
          ],
          "display_name": true
        },
        {
          "uuid": "60670cff-53ad-0974-6bec-9e211dcef60f",
          "name": "FEMA NO. 4725",
          "stdName": "FEMA NO. 4725",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ab4f6db-6e21-ed8b-1670-5a2597a0f016"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "94c414c4-6f24-8d74-d6a4-9c674848942c",
          "citation": "FDA srs import",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "534c9f76-c3b6-da9d-f5fe-c1c8df0c6f63",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "1ab4f6db-6e21-ed8b-1670-5a2597a0f016",
          "citation": "FHFI",
          "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "c03f2bab-bbe1-e940-82cb-69277e5eade7",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        },
        {
          "uuid": "ed9a66f1-e82e-4209-d9e5-7f669058250a",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "56061e34-d0b1-e757-b560-c534ccbc1b76",
          "id": "56061e34-d0b1-e757-b560-c534ccbc1b76",
          "molfile": "\n  Marvin  01132104282D          \n\n 28 31  0  0  0  0            999 V2000\n   15.4434   -1.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0262   -2.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3145   -2.0012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0875   -2.9215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6458   -3.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6458   -4.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2348   -2.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8483   -3.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8483   -4.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4066   -5.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1735   -5.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4618   -5.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2594   -5.0075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7870   -6.4308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9895   -7.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5784   -8.1548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6950   -7.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9220   -6.4308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5356   -5.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1491   -6.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1491   -7.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7626   -7.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3700   -7.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3700   -6.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9835   -5.9339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7626   -5.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3699   -5.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3699   -4.8356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  7  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 13  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 14 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 27 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 27 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 26  2  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 24  1  0  0  0  0\n 28 27  2  0  0  0  0\nM  END",
          "smiles": "Cc1c(Cn2cc(cn2)N3C(=O)CN(Cc4cccc(c4)O)C3=O)c(C)on1",
          "formula": "C19H19N5O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6702ba83-62a9-4a67-be11-3b63512575d5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "381.386",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4ca62ae6-3a87-44ba-bb36-b669d7c4c57a",
      "version": "8",
      "structure": {
        "id": "7f0493d3-f45c-f8dc-1114-0b3c8edb5a4a",
        "molfile": "2,4-Imidazolidinedione, 3-[1-[(3,5-dimethyl-4-isoxazolyl)methyl]-1H-pyrazol-4...\n  Marvin  01132106362D          \n\n 28 31  0  0  0  0            999 V2000\n   15.5906   -3.0341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7621   -3.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2101   -4.4541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6226   -5.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4296   -4.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5159   -4.1766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2303   -3.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9448   -4.1766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6593   -3.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3738   -4.1766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0883   -3.7641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3738   -5.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6593   -5.4141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9448   -5.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2870   -5.9223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3895   -4.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9771   -3.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1700   -3.8249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0838   -4.6454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8375   -4.9809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5569   -3.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7723   -3.5279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1049   -3.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1049   -2.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4374   -3.5279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6923   -4.3125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5173   -4.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0023   -4.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n  8 14  1  0  0  0  0\n  4 15  2  0  0  0  0\n  3 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 16 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 22 27  2  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
        "smiles": "Cc1c(Cn2cc(cn2)N3C(=O)CN(Cc4cccc(c4)O)C3=O)c(C)on1",
        "formula": "C19H19N5O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "381.386",
        "optical_activity": "NONE",
        "references": [
          "1ab4f6db-6e21-ed8b-1670-5a2597a0f016",
          "534c9f76-c3b6-da9d-f5fe-c1c8df0c6f63"
        ],
        "stereo_centers": 0
      },
      "unii": "1P43YY1KO2"
    }
  ]
}