{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "55a9e74d-484a-4a79-aebe-9843cda3bc61",
          "code": "87392-12-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87392-12-9",
          "code_system": "CAS",
          "references": [
            "6fb8d144-b4b7-4e1e-9fc0-14540fcad01a",
            "4f55421a-59f4-4809-9db6-f99cef6135da"
          ]
        },
        {
          "uuid": "0a3cd619-c31b-4911-98e3-586c2a521dde",
          "code": "108800",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3736",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "6fb8d144-b4b7-4e1e-9fc0-14540fcad01a"
          ]
        },
        {
          "uuid": "6e05c8df-bb3b-4304-8039-aaae6c978f5d",
          "code": "m7493",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7493?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6fb8d144-b4b7-4e1e-9fc0-14540fcad01a"
          ]
        },
        {
          "uuid": "622fc8d3-a8b1-46d9-923a-8a7a33445d3c",
          "code": "11140605",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11140605",
          "code_system": "PUBCHEM",
          "references": [
            "6fb8d144-b4b7-4e1e-9fc0-14540fcad01a"
          ]
        },
        {
          "uuid": "664263d7-1bf6-8a56-f76c-d482e9a3acde",
          "code": "DTXSID6032431",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6032431",
          "code_system": "EPA CompTox",
          "references": [
            "4a38f6ec-80f0-7e3a-7621-8422f31415ba"
          ]
        },
        {
          "uuid": "e476582f-d182-4b3e-956b-759c0b63cd13",
          "code": "1O4NMK7I6H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "45eb343b-1243-23ba-d511-3d4fba3ce7b9",
          "code": "S-metolachlor",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/S-metolachlor.html",
          "code_system": "ALANWOOD",
          "references": [
            "fbf59c61-9a09-7aa7-81e1-bc40f1778f2e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3e5ea4e6-c3a0-455a-9616-08d51435300a",
          "name": "(S)-METOLACHOR",
          "stdName": "(S)-METOLACHOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6025a6ac-66bd-4244-9373-e1c863e4033f",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c"
          ],
          "display_name": false
        },
        {
          "uuid": "368897a7-5990-4f89-8df1-68070d78d4a7",
          "name": ".ALPHA.-METOLACHLOR",
          "stdName": ".ALPHA.-METOLACHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6025a6ac-66bd-4244-9373-e1c863e4033f",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c"
          ],
          "display_name": false
        },
        {
          "uuid": "974b94ef-873e-44da-8f24-a354b48806ff",
          "name": "ACETAMIDE, 2-CHLORO-N-(2-ETHYL-6-METHYLPHENYL)-N-((1S)-2-METHOXY-1-METHYLETHYL)-",
          "stdName": "ACETAMIDE, 2-CHLORO-N-(2-ETHYL-6-METHYLPHENYL)-N-((1S)-2-METHOXY-1-METHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6025a6ac-66bd-4244-9373-e1c863e4033f",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c"
          ],
          "display_name": false
        },
        {
          "uuid": "a7db707b-9842-4aec-94b7-ae9c088de687",
          "name": "BRAWL",
          "stdName": "BRAWL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6025a6ac-66bd-4244-9373-e1c863e4033f",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c"
          ],
          "display_name": false
        },
        {
          "uuid": "a89f7391-86f0-4f58-b8ea-95f38a04e7e2",
          "name": "DUAL GOLD",
          "stdName": "DUAL GOLD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6025a6ac-66bd-4244-9373-e1c863e4033f",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c"
          ],
          "display_name": false
        },
        {
          "uuid": "13261c53-16d9-4ca1-a4eb-7f4f5fa43aab",
          "name": "DUAL II MAGNUM",
          "stdName": "DUAL II MAGNUM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6025a6ac-66bd-4244-9373-e1c863e4033f",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c"
          ],
          "display_name": false
        },
        {
          "uuid": "a359c908-dec7-4da0-a71e-aeedc8465713",
          "name": "METOLACHLOR S-FORM",
          "stdName": "METOLACHLOR S-FORM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40dd204f-c774-45b2-a1d7-e5e62ae31986",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c",
            "6e5f9cc0-a239-433b-88ec-c45b3876fe29"
          ],
          "display_name": false
        },
        {
          "uuid": "630e550d-5720-4e97-9cbb-91dae1fd0fc6",
          "name": "METOLACHLOR S-FORM [MI]",
          "stdName": "METOLACHLOR S-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c",
            "6e5f9cc0-a239-433b-88ec-c45b3876fe29"
          ],
          "display_name": false
        },
        {
          "uuid": "8d3659ec-3d26-49e2-9ff6-b2ca31c3cd82",
          "name": "METOLACHLOR, (S)-",
          "stdName": "METOLACHLOR, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c",
            "f4ee947d-9fff-4cb4-8ab0-7dd8d2f7a280"
          ],
          "display_name": false
        },
        {
          "uuid": "1ad8a3b1-0100-4a19-bcfc-2cf34a742ab1",
          "name": "S-METHOLACHLOR",
          "stdName": "S-METHOLACHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6025a6ac-66bd-4244-9373-e1c863e4033f",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c"
          ],
          "display_name": false
        },
        {
          "uuid": "d00be6ef-75c0-43ff-8d62-27a9eae593a6",
          "name": "S-METOLACHLOR",
          "stdName": "S-METOLACHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65c9bfb8-8be7-4176-8651-19a022fb65fc",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c",
            "cfd1c17f-89db-4fd9-a067-8e325c5915c9",
            "6e5f9cc0-a239-433b-88ec-c45b3876fe29"
          ],
          "display_name": true
        },
        {
          "uuid": "7bba9490-ff60-44b5-998d-9a0b48d683d0",
          "name": "S-METOLACHLOR [ISO]",
          "stdName": "S-METOLACHLOR [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cfd1c17f-89db-4fd9-a067-8e325c5915c9",
            "b8165c3e-f2ee-4d7b-926b-67e24b61083c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6e5f9cc0-a239-433b-88ec-c45b3876fe29",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b8165c3e-f2ee-4d7b-926b-67e24b61083c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4ee947d-9fff-4cb4-8ab0-7dd8d2f7a280",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfd1c17f-89db-4fd9-a067-8e325c5915c9",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6025a6ac-66bd-4244-9373-e1c863e4033f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fb8d144-b4b7-4e1e-9fc0-14540fcad01a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391424000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a078a289-0f99-4f0c-bb5f-03b0ed4656ca",
          "citation": "SRS import [1O4NMK7I6H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1O4NMK7I6H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391424000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40dd204f-c774-45b2-a1d7-e5e62ae31986",
          "citation": "METOLACHLOR S-FORM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "65c9bfb8-8be7-4176-8651-19a022fb65fc",
          "citation": "S-METOLACHLOR [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4a38f6ec-80f0-7e3a-7621-8422f31415ba",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87392-12-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fbf59c61-9a09-7aa7-81e1-bc40f1778f2e",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4f55421a-59f4-4809-9db6-f99cef6135da",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "66b13cb3-c189-478d-968b-31c63db9f61e",
          "id": "66b13cb3-c189-478d-968b-31c63db9f61e",
          "molfile": "\n  Marvin  01132105212D          \n\n 19 19  0  0  1  0            999 V2000\n    4.8992   -1.7023    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.8992   -0.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6136   -2.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3281   -1.7023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0426   -2.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1847   -2.1148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4702   -1.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4702   -0.8773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7558   -2.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0413   -1.7023    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1847   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4702   -3.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7558   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4702   -4.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1847   -4.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8992   -4.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8992   -3.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6136   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3281   -3.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 11  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "CCc1cccc(C)c1N([C@@H](C)COC)C(=O)CCl",
          "formula": "C15H22ClNO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cd7ede86-d2fb-4acf-9e2b-25e2b34fb17c"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "283.7942",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "06e3f0f0-b3f9-4439-b1dc-7bfc1931c6fe",
      "version": "4",
      "structure": {
        "id": "069ec5c4-2da8-4e06-8212-640f184e8677",
        "molfile": "\n  Marvin  01132100382D          \n\n 19 19  0  0  1  0            999 V2000\n    3.4702   -3.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7558   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4702   -4.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1847   -4.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8992   -4.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8992   -3.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6136   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3281   -3.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1847   -2.9398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1847   -2.1148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4702   -1.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4702   -0.8773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7558   -2.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0413   -1.7023    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.8992   -1.7023    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.6136   -2.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3281   -1.7023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0426   -2.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8992   -0.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 10  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 15 19  1  1  0  0  0\n  9  1  2  0  0  0  0\nM  END",
        "smiles": "CCc1cccc(C)c1N([C@@H](C)COC)C(=O)CCl",
        "formula": "C15H22ClNO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "283.7942",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a078a289-0f99-4f0c-bb5f-03b0ed4656ca",
          "6e5f9cc0-a239-433b-88ec-c45b3876fe29"
        ],
        "stereo_centers": 1
      },
      "unii": "1O4NMK7I6H"
    }
  ]
}