{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "183c53a4-f427-4bb3-90ba-d79d26361d8d",
          "code": "N06BA08",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Centrally acting sympathomimetics|fenozolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06BA08&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "f88252a2-4bd7-4793-be7c-393d7a8481a3",
          "code": "QN06BA08",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Centrally acting sympathomimetics|fenozolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BA08&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "5fc980a8-b20a-4618-af28-f7e1cfa68dd2",
          "code": "15302-16-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15302-16-6",
          "code_system": "CAS",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66",
            "843a900e-3780-4030-8644-2480adc973c3"
          ]
        },
        {
          "uuid": "34073707-11a8-4800-a8c8-5fdd62cdbfe9",
          "code": "C65663",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65663",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "6e44c275-8861-4c19-a810-06ff399067b1",
          "code": "C004996",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004996",
          "code_system": "MESH",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "5f2ad005-a569-49a5-97ce-e795a15f9b29",
          "code": "SUB07584MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "f1b8fc50-0ed6-4365-a3ea-988619107b7f",
          "code": "1694",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1694",
          "code_system": "INN",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "e3b42486-1c20-4eed-b6bd-3f29a00a1cd5",
          "code": "24860",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/24860/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "d69a8f2f-9e8b-47d2-8942-cc40c730a007",
          "code": "m1160",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1160?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "c72915d0-89fd-4715-a616-18191d0fecd4",
          "code": "CHEMBL2104907",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104907",
          "code_system": "ChEMBL",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "3d91ad2c-ce3f-4c88-b94a-e7e91da0839a",
          "code": "239-339-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.747",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a993e04a-5752-4201-b1f9-5667549c5b66"
          ]
        },
        {
          "uuid": "b5fbe5e4-520a-e2fe-3307-cba2a000c213",
          "code": "Fenozolone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fenozolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "e67fe199-fdf3-8191-f2a5-fbb6f7aa3e51"
          ]
        },
        {
          "uuid": "1eae9330-2b0f-237d-b6c8-d81964cf6bdb",
          "code": "C47795",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|CNS Stimulant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47795",
          "code_system": "NCI_THESAURUS",
          "references": [
            "98b12c54-0f85-dd29-227a-b99497b797e4"
          ]
        },
        {
          "uuid": "742394f3-5a14-7083-6f5f-fa265d09bdd6",
          "code": "135436543",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135436543",
          "code_system": "PUBCHEM",
          "references": [
            "2c46019f-53b7-1c58-30f7-7e7b860a5694"
          ]
        },
        {
          "uuid": "03d86e9d-c994-48a4-ab25-479f4cafe2e9",
          "code": "1NZI4LMU6G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "48ad4bb0-d80a-036f-ab01-ea91a94a01d3",
          "code": "1157",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1157",
          "code_system": "DRUG CENTRAL",
          "references": [
            "98b12c54-0f85-dd29-227a-b99497b797e4"
          ]
        },
        {
          "uuid": "e797ddad-b3c8-41f7-1392-049b8a555145",
          "code": "DB13341",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13341",
          "code_system": "DRUG BANK",
          "references": [
            "98b12c54-0f85-dd29-227a-b99497b797e4"
          ]
        },
        {
          "uuid": "1c7515e5-ab75-67ad-1543-3c22a16eb5f7",
          "code": "DTXSID00864583",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00864583",
          "code_system": "EPA CompTox",
          "references": [
            "98b12c54-0f85-dd29-227a-b99497b797e4"
          ]
        },
        {
          "uuid": "2c54b2cb-a4d8-682b-fef6-0470935beed9",
          "code": "100000081502",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "dc318038-c352-692c-e0f2-4a31ce2df3ed"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "cc77e87c-2359-43a5-bde6-e5ecb1307661",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2c87c3d9-d5f9-41c0-a5b7-c0d9c0deb168",
            "refuuid": "509c4e1e-f59a-48e9-a4cc-16c60d95eb26",
            "name": "FENOZOLONE",
            "unii": "1NZI4LMU6G",
            "linking_id": "1NZI4LMU6G",
            "ref_pname": "FENOZOLONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "76d46e22-b710-4821-8d42-be2a7a2cf702",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "e15767ff-05e4-4a26-b528-2a7a840d96c4",
            "refuuid": "24bb6774-de2b-42f6-9201-842d9cccde80",
            "name": "FENOZOLONE, (R)-",
            "unii": "0WQH8H2701",
            "linking_id": "0WQH8H2701",
            "ref_pname": "FENOZOLONE, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "71b05e46-f1db-4b8f-adc7-d5c211c3b191",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "30b7491b-cc9c-4d53-a3de-41cbe207f84a",
            "refuuid": "8011c038-39a9-4b58-86a0-93e0df9ba842",
            "name": "FENOZOLONE, (S)-",
            "unii": "JI5FV0WA1N",
            "linking_id": "JI5FV0WA1N",
            "ref_pname": "FENOZOLONE, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1bcd8f3a-a814-4f66-85f2-0c2040d903cb",
          "name": "2-ETHYLAMINO-4-OXO-5-PHENYL-2-OXAZOLIN",
          "stdName": "2-ETHYLAMINO-4-OXO-5-PHENYL-2-OXAZOLIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8cb8ba6-211f-455e-a96c-696c5e1aab7b"
          ],
          "display_name": false
        },
        {
          "uuid": "d8f7c209-8849-429a-859f-11dfdfe9d8e4",
          "name": "FENOZOLONE",
          "stdName": "FENOZOLONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ab31f5f-82bd-42ff-88ea-d50d930b1e00",
            "232ee457-6ddd-4827-b9e5-7fd16da923f0",
            "d02c3b93-a5d2-43e5-bb22-df1583b22667",
            "ab272eb1-be6d-40f6-9f06-8fc0118b6b7c",
            "a7b641d9-4f07-4e1a-afe2-5da81d81d99b",
            "56423945-3893-473f-b73b-5a6f900abd2b",
            "e8cb8ba6-211f-455e-a96c-696c5e1aab7b",
            "d72ceeba-156c-47dc-b950-b03d2d5e1120",
            "3076ab32-8f53-4054-83db-c8072333a48e",
            "b59cd55b-7390-440f-98a5-f85d038b0308"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "345329a0-2b43-47ad-9a4d-87711e49d647",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "9601b2cf-67fe-4d99-b27e-4a04bbdf54f9",
          "name": "FENOZOLONE [MART.]",
          "stdName": "FENOZOLONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d72ceeba-156c-47dc-b950-b03d2d5e1120"
          ],
          "display_name": false
        },
        {
          "uuid": "d3c3b69c-7cbc-4b45-a89a-466aab574592",
          "name": "FENOZOLONE [MI]",
          "stdName": "FENOZOLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab272eb1-be6d-40f6-9f06-8fc0118b6b7c",
            "3076ab32-8f53-4054-83db-c8072333a48e"
          ],
          "display_name": false
        },
        {
          "uuid": "debe041a-227a-3bf6-d33c-aecad4528006",
          "name": "Fenozolone [WHO-DD]",
          "stdName": "FENOZOLONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b806528e-6903-f7fb-4882-51c10cd4efb0"
          ],
          "display_name": false
        },
        {
          "uuid": "be006bbc-574b-429d-ac94-8d511ba6bc89",
          "name": "LD 3394",
          "stdName": "LD 3394",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8cb8ba6-211f-455e-a96c-696c5e1aab7b"
          ],
          "display_name": false
        },
        {
          "uuid": "457414bb-f2cc-4704-899d-f0b66ba5af51",
          "name": "LD-3394",
          "stdName": "LD-3394",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fccc2df-5350-4d5e-8cfd-4e80cf3ad006",
            "3076ab32-8f53-4054-83db-c8072333a48e"
          ],
          "display_name": false
        },
        {
          "uuid": "f464f75b-d9a9-4990-b23d-2ac2db429e97",
          "name": "fenozolone [INN]",
          "stdName": "FENOZOLONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ab31f5f-82bd-42ff-88ea-d50d930b1e00"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e8cb8ba6-211f-455e-a96c-696c5e1aab7b",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6ab31f5f-82bd-42ff-88ea-d50d930b1e00",
          "citation": "INN Proposed List 14",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL14.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d72ceeba-156c-47dc-b950-b03d2d5e1120",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab272eb1-be6d-40f6-9f06-8fc0118b6b7c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3076ab32-8f53-4054-83db-c8072333a48e",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "232ee457-6ddd-4827-b9e5-7fd16da923f0",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fccc2df-5350-4d5e-8cfd-4e80cf3ad006",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a993e04a-5752-4201-b1f9-5667549c5b66",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9cd2689-009c-4372-8da6-fa2b1c7f1b8a",
          "citation": "SRS import [1NZI4LMU6G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1NZI4LMU6G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390704000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6eeefcf-2599-4654-a997-1aeccaa36b24",
          "citation": "USP Dictionary 2010; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d02c3b93-a5d2-43e5-bb22-df1583b22667",
          "citation": "FENOZOLONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b59cd55b-7390-440f-98a5-f85d038b0308",
          "citation": "FENOZOLONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7b641d9-4f07-4e1a-afe2-5da81d81d99b",
          "citation": "FENOZOLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56423945-3893-473f-b73b-5a6f900abd2b",
          "citation": "FENOZOLONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e67fe199-fdf3-8191-f2a5-fbb6f7aa3e51",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Fenozolone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dc318038-c352-692c-e0f2-4a31ce2df3ed",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "98b12c54-0f85-dd29-227a-b99497b797e4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "843a900e-3780-4030-8644-2480adc973c3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2c46019f-53b7-1c58-30f7-7e7b860a5694",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "b806528e-6903-f7fb-4882-51c10cd4efb0",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bd931e3a-14a5-41f7-9292-8ab73b1bd857",
          "id": "bd931e3a-14a5-41f7-9292-8ab73b1bd857",
          "molfile": "\n  Marvin  01132109482D          \n\n 15 16  0  0  0  0            999 V2000\n   -0.3804   -1.0179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4446   -1.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8542   -1.7375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6808   -1.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9333   -2.5250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7583   -2.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1625   -3.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0151   -1.7409    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.3458   -1.2542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8001   -1.4871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4085   -2.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1929   -1.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3662   -0.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7489   -0.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9669   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  9  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 15 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "CCNC1=NC(=O)C(c2ccccc2)O1",
          "formula": "C11H12N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bdb300ca-c6d6-4e12-bff3-9dd14f042272"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "204.2256",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "509c4e1e-f59a-48e9-a4cc-16c60d95eb26",
      "version": "17",
      "structure": {
        "id": "c5be34cd-9e77-4907-a12d-1d75787b66bf",
        "molfile": "\n  Marvin  01132110132D          \n\n 15 16  0  0  0  0            999 V2000\n    1.9333   -2.5250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7583   -2.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0151   -1.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3458   -1.2542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6808   -1.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8001   -1.4871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4085   -2.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1929   -1.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3662   -0.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7489   -0.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9669   -0.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1625   -3.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8542   -1.7375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4446   -1.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3804   -1.0179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  7  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  9  2  0  0  0  0\n  4  5  1  0  0  0  0\n  9 10  1  0  0  0  0\n  5  1  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11  6  1  0  0  0  0\n  1  2  1  0  0  0  0\n  2 12  2  0  0  0  0\n  3  6  1  0  0  0  0\n  5 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  6  7  2  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
        "smiles": "CCNC1=NC(=O)C(c2ccccc2)O1",
        "formula": "C11H12N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "204.2256",
        "optical_activity": "( + / - )",
        "references": [
          "e9cd2689-009c-4372-8da6-fa2b1c7f1b8a",
          "b6eeefcf-2599-4654-a997-1aeccaa36b24",
          "6ab31f5f-82bd-42ff-88ea-d50d930b1e00"
        ],
        "stereo_centers": 1
      },
      "unii": "1NZI4LMU6G"
    }
  ]
}