{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c542ef16-c3b1-49d0-9be7-7101b457195a",
          "code": "NBK548408",
          "comments": "LiverTox|CNS|Parkinsons agent|Anticholinergic",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548408/",
          "code_system": "LIVERTOX",
          "references": [
            "1bd1bb5b-ae4f-ac48-28e6-9bc785e708cf"
          ]
        },
        {
          "uuid": "bcbd25eb-53f4-4dc9-8122-4fe0155e01b7",
          "code": "BENZATROPINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Benzatropine",
          "code_system": "WIKIPEDIA",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "ddfb18e5-a4dc-4274-a75b-3a7b062938ef",
          "code": "SUB05742MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "1f844584-3912-41f8-bdb9-2108b3061c52",
          "code": "292",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=292",
          "code_system": "INN",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "0ab777c5-371c-42cc-a7e6-21fa062c3386",
          "code": "7601",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7601",
          "code_system": "IUPHAR",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "a46a64e3-337b-4ee1-9089-81221daefe59",
          "code": "C61649",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61649",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "b58b151c-08c3-48ef-b7fe-818b31c0c31b",
          "code": "1424",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1424/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "ac30ddc5-3d98-49ca-9982-9522eb4425ad",
          "code": "m2394",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2394?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "2a329c6f-686f-4f8a-a484-269ba83fe8e5",
          "code": "DB00245",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00245",
          "code_system": "DRUG BANK",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "6e566228-6f0c-46da-bbde-644ffd1bb04f",
          "code": "CHEMBL1201203",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1201203",
          "code_system": "ChEMBL",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "e60db816-83a2-4f5b-adc4-1d80035c240a",
          "code": "N04AC01",
          "comments": "ATC|NERVOUS SYSTEM|ANTI-PARKINSON DRUGS|ANTICHOLINERGIC AGENTS|Ethers of tropine or tropine derivatives|benzatropine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N04AC01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "4756c219-e2e1-4d5d-b202-755515208d3e",
          "code": "N0000175370",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Cholinergic Interactions [MoA]|Cholinergic Antagonists [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175370",
          "code_system": "NDF-RT",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "d714bf5d-53db-425e-8a05-0a92fc653281",
          "code": "N0000000207",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Histamine Receptor Interactions [MoA]|Histamine Receptor Antagonists [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000207",
          "code_system": "NDF-RT",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "b956647a-e79c-4e3c-96c1-9c19c32bb79c",
          "code": "N0000175574",
          "comments": "Established Pharmacologic Class [EPC]|Anticholinergic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175574",
          "code_system": "NDF-RT",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "a4daa515-d0a3-4f06-8723-a6b0143e3a87",
          "code": "N0000175750",
          "comments": "Established Pharmacologic Class [EPC]|Antihistamine [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175750",
          "code_system": "NDF-RT",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "d96b0c5c-e590-4267-9a5e-cf2870dafde7",
          "code": "QN04AC01",
          "comments": "VATC|ANTI-PARKINSON DRUGS|ANTICHOLINERGIC AGENTS|Ethers of tropine or tropine derivatives|benzatropine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN04AC01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "c680565d-accf-44a3-94e4-42a0c806b4e1",
          "code": "86-13-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=86-13-5",
          "code_system": "CAS",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4",
            "29548432-588e-46a5-8b81-89fcf884b9d7"
          ]
        },
        {
          "uuid": "92e9347e-8fff-4a4c-ac0c-ffbc5a285c2f",
          "code": "D001590",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001590",
          "code_system": "MESH",
          "references": [
            "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4"
          ]
        },
        {
          "uuid": "43061795-738b-9a74-7888-0097f15ac1d6",
          "code": "3014",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3014",
          "code_system": "HSDB",
          "references": [
            "5ff479ea-1675-0a4d-2e70-824273e03585"
          ]
        },
        {
          "uuid": "191a263f-444a-9387-bd81-7c2eae53c9fd",
          "code": "DTXSID9022659",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9022659",
          "code_system": "EPA CompTox",
          "references": [
            "203d5129-4a01-2089-30da-b5579741b1a3"
          ]
        },
        {
          "uuid": "27a2bf65-8c9a-7e9b-6274-4aec6bb87971",
          "code": "Benztropine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM759/",
          "code_system": "LACTMED",
          "references": [
            "1bd1bb5b-ae4f-ac48-28e6-9bc785e708cf"
          ]
        },
        {
          "uuid": "d8f44ce6-e2ee-ff1c-0269-3bb3ecefc020",
          "code": "C29704",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent[C66880]|Antimuscarinic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29704",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1bd1bb5b-ae4f-ac48-28e6-9bc785e708cf"
          ]
        },
        {
          "uuid": "c28b258d-4cd7-4e38-8569-728f336b7b3f",
          "code": "1NHL2J4X8K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7212800b-4d56-ae2d-b9f8-ba40817039b8",
          "code": "333",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/333",
          "code_system": "DRUG CENTRAL",
          "references": [
            "1bd1bb5b-ae4f-ac48-28e6-9bc785e708cf"
          ]
        },
        {
          "uuid": "868ebbb7-05f9-fa7b-be1d-f4f370d97e11",
          "code": "3048",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3048",
          "code_system": "CHEBI",
          "references": [
            "1bd1bb5b-ae4f-ac48-28e6-9bc785e708cf"
          ]
        },
        {
          "uuid": "ab4096f3-87dd-b095-749a-2644eafb4974",
          "code": "100000086381",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "33bea902-9586-fbce-cfbc-f9dd3575b955"
          ]
        },
        {
          "uuid": "98bf2196-e361-1e08-4cb8-5c81097a8d6e",
          "code": "1NHL2J4X8K",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1NHL2J4X8K",
          "code_system": "DAILYMED",
          "references": [
            "6a943e36-872c-e5a9-5906-2355faf58ac9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "edf0c866-ab8d-485e-9408-d0374d392d7b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "08713678-cfbf-40b4-aee1-cc07ae2dce94",
            "refuuid": "7d345cd2-dcc5-49e0-b01c-be2bf6058a8b",
            "name": "BENZTROPINE",
            "unii": "1NHL2J4X8K",
            "linking_id": "1NHL2J4X8K",
            "ref_pname": "BENZTROPINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3b8067d4-5700-4d2b-9e12-527305a1fc01",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "3b4714bb-029b-4f17-9794-d622cab92b5e",
            "refuuid": "215ab010-cb15-45ee-985e-37d434050614",
            "name": "BENZTROPINE MESYLATE",
            "unii": "WMJ8TL7510",
            "linking_id": "WMJ8TL7510",
            "ref_pname": "BENZTROPINE MESYLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4ea9443b-0d79-44d2-b46e-e338a5ecffaf",
          "amount": {
            "uuid": "141ee141-ca1d-4487-8fc1-79bddafe4fcb"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "1cbd4f58-af8e-4f21-b46d-874fa435cc91",
            "refuuid": "c69dc921-6643-4090-834c-74ecd84b4251",
            "name": "Benztropine hydrobromide",
            "unii": "464GRB9DVD",
            "linking_id": "464GRB9DVD",
            "ref_pname": "Benztropine hydrobromide",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fe318c96-2282-486c-a2c6-9a3ad94acfeb",
          "name": "1.ALPHA.H,5.ALPHA.H-TROPANE, 3.ALPHA.-(DIPHENYLMETHOXY)-",
          "stdName": "1.ALPHA.H,5.ALPHA.H-TROPANE, 3.ALPHA.-(DIPHENYLMETHOXY)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8f9f7d5-c23b-48b9-9d3d-b01df662737a"
          ],
          "display_name": false
        },
        {
          "uuid": "84d537ce-dd7b-4f3f-9d7b-d283dde55ee3",
          "name": "8-AZABICYCLO(3.2.1)OCTANE, 3-(DIPHENYLMETHOXY)-8-METHYL-, (3-ENDO)-",
          "stdName": "8-AZABICYCLO(3.2.1)OCTANE, 3-(DIPHENYLMETHOXY)-8-METHYL-, (3-ENDO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8f9f7d5-c23b-48b9-9d3d-b01df662737a"
          ],
          "display_name": false
        },
        {
          "uuid": "293f1281-8914-45b1-87b4-1e68dffe9f07",
          "name": "BENZATROPINE",
          "stdName": "BENZATROPINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20f211ca-ab70-4edb-ad1c-6ae4e48a04cd",
            "ffc55dcf-ae4a-478c-b3f0-ef7ef376228b",
            "22776de7-b42c-4ce8-853f-f73d8bea278b",
            "847013ed-69f8-45f8-9e0e-801fbcd7a4b4",
            "ecf2eda0-26b3-4c44-9540-0b79abee083e"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "59f7ee1a-06bd-45f5-9482-8f19ff3bfc52",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "34befb28-efd8-4f62-a001-62e35779dfe1",
          "name": "BENZTROPINE",
          "stdName": "BENZTROPINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d815b10-bcfe-41a8-840b-a2203cf87d57",
            "20f0c025-0034-4aff-927e-643c6faf3ad5",
            "3059a299-7be9-4d47-81af-61a0123dfbcc",
            "cc292b1f-c488-4975-aee1-77aa7f7c81e0",
            "9e605a3d-7524-4738-a726-2bb88e39618b",
            "93fe68c2-22af-4f3a-bcfb-a305bfb32d35",
            "23b46522-3d5b-4461-af7e-80ec42b6edcb"
          ],
          "display_name": true
        },
        {
          "uuid": "8c94a356-741f-4b11-aed2-dcc50ea27707",
          "name": "BENZTROPINE [HSDB]",
          "stdName": "BENZTROPINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20f0c025-0034-4aff-927e-643c6faf3ad5"
          ],
          "display_name": false
        },
        {
          "uuid": "ed54984f-fb55-4c86-89a6-2f73e678ee28",
          "name": "BENZTROPINE [MI]",
          "stdName": "BENZTROPINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e605a3d-7524-4738-a726-2bb88e39618b"
          ],
          "display_name": false
        },
        {
          "uuid": "5d1a27e0-ba24-4832-9758-6ad1692fd3b6",
          "name": "BENZTROPINE [VANDF]",
          "stdName": "BENZTROPINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3059a299-7be9-4d47-81af-61a0123dfbcc"
          ],
          "display_name": false
        },
        {
          "uuid": "c845c937-ec08-0af8-ba67-51411b813b07",
          "name": "Benzatropine [WHO-DD]",
          "stdName": "BENZATROPINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b9f9834-22ef-3f90-0050-d3e1012ae1fc"
          ],
          "display_name": false
        },
        {
          "uuid": "bf80db11-b213-4ac4-9933-6fe7f37750a4",
          "name": "COBRENTIN",
          "stdName": "COBRENTIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8f9f7d5-c23b-48b9-9d3d-b01df662737a"
          ],
          "display_name": false
        },
        {
          "uuid": "c4193552-aa5c-4fff-862a-fc93f256ca39",
          "name": "NK-02",
          "stdName": "NK-02",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8f9f7d5-c23b-48b9-9d3d-b01df662737a"
          ],
          "display_name": false
        },
        {
          "uuid": "8f0af14e-a9ba-4098-9879-a526bc4f6473",
          "name": "benzatropine [INN]",
          "stdName": "BENZATROPINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22776de7-b42c-4ce8-853f-f73d8bea278b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cc292b1f-c488-4975-aee1-77aa7f7c81e0",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ffc55dcf-ae4a-478c-b3f0-ef7ef376228b",
          "citation": "EMEA 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22776de7-b42c-4ce8-853f-f73d8bea278b",
          "citation": "INN Proposed List 4",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL04.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9e605a3d-7524-4738-a726-2bb88e39618b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20f0c025-0034-4aff-927e-643c6faf3ad5",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecf2eda0-26b3-4c44-9540-0b79abee083e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3059a299-7be9-4d47-81af-61a0123dfbcc",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8f9f7d5-c23b-48b9-9d3d-b01df662737a",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e294eb4f-c7d9-4832-9ce7-1b1efeb069a4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7e6ce4b-5a88-44d5-b6eb-75bea1e2de60",
          "citation": "SRS import [1NHL2J4X8K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1NHL2J4X8K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390736000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbf9c01d-89ae-41b7-81fa-3825c2377b75",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20f211ca-ab70-4edb-ad1c-6ae4e48a04cd",
          "citation": "BENZATROPINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "23b46522-3d5b-4461-af7e-80ec42b6edcb",
          "citation": "BENZTROPINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1d815b10-bcfe-41a8-840b-a2203cf87d57",
          "citation": "BENZTROPINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "847013ed-69f8-45f8-9e0e-801fbcd7a4b4",
          "citation": "BENZATROPINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "93fe68c2-22af-4f3a-bcfb-a305bfb32d35",
          "citation": "BENZTROPINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5ff479ea-1675-0a4d-2e70-824273e03585",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+86-13-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "203d5129-4a01-2089-30da-b5579741b1a3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=86-13-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "58c80592-6b71-7bfd-25e7-0f8618db2b65",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+86-13-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "33bea902-9586-fbce-cfbc-f9dd3575b955",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1bd1bb5b-ae4f-ac48-28e6-9bc785e708cf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "29548432-588e-46a5-8b81-89fcf884b9d7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6a943e36-872c-e5a9-5906-2355faf58ac9",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8b9f9834-22ef-3f90-0050-d3e1012ae1fc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f0167862-0309-48e9-9b85-e08fa13dc1bb",
          "id": "f0167862-0309-48e9-9b85-e08fa13dc1bb",
          "molfile": "\n  Marvin  01132112272D          \n\n 23 26  0  0  0  0            999 V2000\n   -0.9396   -1.3387    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -1.1142   -0.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5904    0.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2328    0.0915    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.7359   -0.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5446   -1.3637    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -0.2037   -1.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1682   -1.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9539   -1.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7231   -1.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7231   -2.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4381   -3.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1532   -2.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1490   -1.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4340   -1.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9498   -0.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2389   -0.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2389    0.6486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9498    1.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6648    0.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6648   -0.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0582   -0.9770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4592    0.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  6  0  0  0\n  1 22  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4 22  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  6  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 16  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 21 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(c3ccccc3)c4ccccc4",
          "formula": "C21H25NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ecfe600f-d8eb-4f8a-8b1c-8e383a6e996e"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "307.4301",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7d345cd2-dcc5-49e0-b01c-be2bf6058a8b",
      "version": "19",
      "structure": {
        "id": "a4ddb496-22f7-4e46-afa8-43c751d7733c",
        "molfile": "\n  Marvin  01132108342D          \n\n 23 26  0  0  1  0            999 V2000\n    0.0582   -0.9770    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.9396   -1.3387    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.2328    0.0915    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.5446   -1.3637    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.9539   -1.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7359   -0.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2037   -1.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1682   -1.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5904    0.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1142   -0.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9498   -0.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7231   -1.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4592    0.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4340   -1.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6648   -0.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2389   -0.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7231   -2.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2389    0.6486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6648    0.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4381   -3.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1490   -1.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1532   -2.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9498    1.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  1  1  1  0  0  0\n  4  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  4  8  1  6  0  0  0\n  9  3  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 11  2  0  0  0  0\n 16 11  1  0  0  0  0\n 17 12  2  0  0  0  0\n 18 16  2  0  0  0  0\n 19 15  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 14  2  0  0  0  0\n 22 20  2  0  0  0  0\n 23 18  1  0  0  0  0\n 10  9  1  0  0  0  0\n  4  6  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 19  2  0  0  0  0\nM  END",
        "smiles": "CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(c3ccccc3)c4ccccc4",
        "formula": "C21H25NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "307.4301",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "dbf9c01d-89ae-41b7-81fa-3825c2377b75",
          "e7e6ce4b-5a88-44d5-b6eb-75bea1e2de60",
          "22776de7-b42c-4ce8-853f-f73d8bea278b"
        ],
        "stereo_centers": 3
      },
      "unii": "1NHL2J4X8K"
    }
  ]
}