{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f50c2089-37ff-42f6-9c2a-b29b66d0966e",
          "code": "63468-13-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=63468-13-3",
          "code_system": "CAS",
          "references": [
            "917e2b8a-803c-43f2-af66-7e12bb2fef2c",
            "099a5858-f2dc-451c-927e-c8e0c2d73c86"
          ]
        },
        {
          "uuid": "3ca5d8ca-92b2-4809-b594-35e3527fb856",
          "code": "264-249-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.058.391",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "917e2b8a-803c-43f2-af66-7e12bb2fef2c"
          ]
        },
        {
          "uuid": "01950ce5-c1d9-4afd-8c37-2c5a03292c69",
          "code": "3017423",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3017423",
          "code_system": "PUBCHEM",
          "references": [
            "917e2b8a-803c-43f2-af66-7e12bb2fef2c"
          ]
        },
        {
          "uuid": "ed2bbcca-2f76-4745-94e6-219582d8c33a",
          "code": "1N3HUI3RDR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "189a4cc8-a3d0-3b73-153c-0cdac6d03793",
          "code": "DTXSID80979700",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80979700",
          "code_system": "EPA CompTox",
          "references": [
            "4fd53241-afd9-c7a2-1dc5-316c19838952"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bd3cd8e0-8bd4-46e6-b5c1-10e1407ec5b7",
          "name": "1,4-BENZENEDICARBOXYLIC ACID, 1-(2-ETHYLHEXYL) 4-METHYL ESTER",
          "stdName": "1,4-BENZENEDICARBOXYLIC ACID, 1-(2-ETHYLHEXYL) 4-METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce30c6e9-ff12-43d4-a239-d86e4f66dabc",
            "7ef32e02-dd9a-48b9-a861-8491cb5c0a5e"
          ],
          "display_name": false
        },
        {
          "uuid": "5acec39f-4184-4ff1-88bd-6bc9a560cb3d",
          "name": "1,4-BENZENEDICARBOXYLIC ACID, 2-ETHYLHEXYL METHYL ESTER",
          "stdName": "1,4-BENZENEDICARBOXYLIC ACID, 2-ETHYLHEXYL METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce30c6e9-ff12-43d4-a239-d86e4f66dabc",
            "7ef32e02-dd9a-48b9-a861-8491cb5c0a5e"
          ],
          "display_name": false
        },
        {
          "uuid": "d37a78ac-4c08-4dbc-bf48-bacc952c4e76",
          "name": "2-ETHYLHEXYL METHYL TEREPHTHALATE",
          "stdName": "2-ETHYLHEXYL METHYL TEREPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce30c6e9-ff12-43d4-a239-d86e4f66dabc",
            "7ef32e02-dd9a-48b9-a861-8491cb5c0a5e"
          ],
          "display_name": true
        },
        {
          "uuid": "28462f56-6f20-4676-97ea-7a8eefde4411",
          "name": "METHYL (2-ETHYLHEXYL) TEREPHTHALATE",
          "stdName": "METHYL (2-ETHYLHEXYL) TEREPHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a5ec102-113a-4fc5-b56b-f661937ea675",
            "7ef32e02-dd9a-48b9-a861-8491cb5c0a5e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ce30c6e9-ff12-43d4-a239-d86e4f66dabc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7ef32e02-dd9a-48b9-a861-8491cb5c0a5e",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a5ec102-113a-4fc5-b56b-f661937ea675",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "917e2b8a-803c-43f2-af66-7e12bb2fef2c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393335000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33815ea5-6eb9-462e-a461-85e42725e146",
          "citation": "SRS import [1N3HUI3RDR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1N3HUI3RDR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393335000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fd53241-afd9-c7a2-1dc5-316c19838952",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "099a5858-f2dc-451c-927e-c8e0c2d73c86",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e7eb0056-a1e6-4813-944e-f912afcae0dd",
          "id": "e7eb0056-a1e6-4813-944e-f912afcae0dd",
          "molfile": "\n  Marvin  01132112002D          \n\n 21 21  0  0  0  0            999 V2000\n   11.5010   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7865   -3.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0720   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3576   -3.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6431   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.6431   -4.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3576   -4.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9286   -3.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2142   -3.6411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4997   -3.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4997   -2.4037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7852   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7852   -4.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0708   -4.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3563   -4.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3563   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0708   -3.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6418   -4.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6418   -5.7036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9274   -4.4661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2129   -4.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 18  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)C(=O)OC",
          "formula": "C17H24O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d0dea856-55e8-4bba-aa2a-c37b9819c525"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "292.3707",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ef4a4ce8-5cc1-47f4-b50f-f8f01c1a304d",
      "version": "5",
      "structure": {
        "id": "4924e86a-4150-47ee-8f4e-15d92cbdc1c6",
        "molfile": "\n  Marvin  01132103502D          \n\n 21 21  0  0  0  0            999 V2000\n    6.4997   -3.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7852   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7852   -4.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0708   -4.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3563   -4.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6418   -4.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6418   -5.7036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9274   -4.4661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2129   -4.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3563   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0708   -3.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4997   -2.4037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2142   -3.6411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9286   -3.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6431   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6431   -4.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3576   -4.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3576   -3.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0720   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7865   -3.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5010   -3.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11 10  1  0  0  0  0\n  2 11  2  0  0  0  0\n  1 12  2  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)C(=O)OC",
        "formula": "C17H24O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "292.3707",
        "optical_activity": "( + / - )",
        "references": [
          "ce30c6e9-ff12-43d4-a239-d86e4f66dabc",
          "33815ea5-6eb9-462e-a461-85e42725e146"
        ],
        "stereo_centers": 1
      },
      "unii": "1N3HUI3RDR"
    }
  ]
}