{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5a3ebd18-e2fb-499a-b967-9363a316a6c5",
          "code": "317815-83-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=317815-83-1",
          "code_system": "CAS",
          "references": [
            "cb83024f-61c2-48d7-a7c0-8ef32ea0ea8d",
            "412c2ea1-e9c8-40f3-bb6e-26f6987ee495"
          ]
        },
        {
          "uuid": "e5d10ecc-e187-4ccb-8276-609cc6751b49",
          "code": "15804",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4036",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "cb83024f-61c2-48d7-a7c0-8ef32ea0ea8d"
          ]
        },
        {
          "uuid": "6f8f677e-68b9-4908-8ee3-09b5afce77cd",
          "code": "11205153",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11205153",
          "code_system": "PUBCHEM",
          "references": [
            "cb83024f-61c2-48d7-a7c0-8ef32ea0ea8d"
          ]
        },
        {
          "uuid": "1a2dd927-45ba-88a0-c999-17c1d82c7bc3",
          "code": "DTXSID0058275",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0058275",
          "code_system": "EPA CompTox",
          "references": [
            "9edb1ad7-5332-35f6-f782-362cfd086e81"
          ]
        },
        {
          "uuid": "feaff4e1-0a2f-4d08-9cb5-04836a32ff44",
          "code": "1MX00PIM4H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6869e5a7-f058-94cb-fd24-760481ebfc52",
          "code": "thiencarbazone-methyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/thiencarbazone-methyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "2865a556-b0fd-ea75-047a-8555390031c9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7a0a0942-35a7-41bb-a0a2-d045a38c1f4c",
          "name": "METHYL 4-((((4,5-DIHYDRO-3-METHOXY-4-METHYL-5-OXO-1H-1,2,4-TRIAZOL-1-YL)CARBONYL)AMINO)SULFONYL)-5-METHYL-3-THIOPHENECARBOXYLATE",
          "stdName": "METHYL 4-((((4,5-DIHYDRO-3-METHOXY-4-METHYL-5-OXO-1H-1,2,4-TRIAZOL-1-YL)CARBONYL)AMINO)SULFONYL)-5-METHYL-3-THIOPHENECARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c18a9f1e-2342-4a38-ac7f-8665def50861",
            "035fa16b-a13e-4c33-9eb7-d294670717c5"
          ],
          "display_name": false
        },
        {
          "uuid": "a869ffff-9c41-49a4-a266-4e0a48ca22c1",
          "name": "METHYL 4-((4,5-DIHYDRO-3-METHOXY-4-METHYL-5-OXO-1H-1,2,4-TRIAZOL-1-YL)CARBONYLSULFAMOYL)-5-METHYLTHIOPHENE-3-CARBOXYLATE",
          "stdName": "METHYL 4-((4,5-DIHYDRO-3-METHOXY-4-METHYL-5-OXO-1H-1,2,4-TRIAZOL-1-YL)CARBONYLSULFAMOYL)-5-METHYLTHIOPHENE-3-CARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c18a9f1e-2342-4a38-ac7f-8665def50861",
            "035fa16b-a13e-4c33-9eb7-d294670717c5"
          ],
          "display_name": false
        },
        {
          "uuid": "330a4092-3e93-4259-b47f-3a8e32e0d13c",
          "name": "THIENCARBAZONE-METHYL",
          "stdName": "THIENCARBAZONE-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e751c05e-594a-4a8f-91a5-f2894f0d8015",
            "c18a9f1e-2342-4a38-ac7f-8665def50861",
            "383ee252-a177-4dfd-ba2a-8228851b1977",
            "8719bb9b-be74-45ca-8966-b2949c249bb8"
          ],
          "display_name": true
        },
        {
          "uuid": "291459be-00c8-4f08-9816-5e6dcdc0fd2f",
          "name": "THIENCARBAZONE-METHYL [ISO]",
          "stdName": "THIENCARBAZONE-METHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e751c05e-594a-4a8f-91a5-f2894f0d8015",
            "c18a9f1e-2342-4a38-ac7f-8665def50861"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "383ee252-a177-4dfd-ba2a-8228851b1977",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "035fa16b-a13e-4c33-9eb7-d294670717c5",
          "citation": "http://www.alanwood.net/pesticides/derivatives/thiencarbazone-methyl.html",
          "url": "http://www.alanwood.net/pesticides/derivatives/thiencarbazone-methyl.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c18a9f1e-2342-4a38-ac7f-8665def50861",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e751c05e-594a-4a8f-91a5-f2894f0d8015",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb83024f-61c2-48d7-a7c0-8ef32ea0ea8d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a575aab-2a72-4995-88dd-09fd393afd6e",
          "citation": "SRS import [1MX00PIM4H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1MX00PIM4H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a4586dd-3363-43b8-84ba-c81367bb0eff",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8719bb9b-be74-45ca-8966-b2949c249bb8",
          "citation": "THIENCARBAZONE-METHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9edb1ad7-5332-35f6-f782-362cfd086e81",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=317815-83-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2865a556-b0fd-ea75-047a-8555390031c9",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "412c2ea1-e9c8-40f3-bb6e-26f6987ee495",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5e94a045-5812-4cc8-a8fa-84827860043c",
          "id": "5e94a045-5812-4cc8-a8fa-84827860043c",
          "molfile": "\n  Marvin  01132104542D          \n\n 25 26  0  0  0  0            999 V2000\n   10.2168   -6.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4093   -6.3503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8541   -5.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0512   -5.9117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1063   -4.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8929   -4.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8929   -3.8660    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0997   -3.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8462   -2.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6175   -4.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7940   -4.2874    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2211   -3.5854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1793   -5.0143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9679   -4.2874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1399   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7493   -3.5153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7121   -4.9440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0256   -5.7034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3985   -6.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4656   -7.0587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2091   -7.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6962   -5.8100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9329   -6.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8871   -5.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3539   -4.3786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  2  0  0  0  0\n 10  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 24  1  0  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 22 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 22  1  0  0  0  0\n 24 25  2  0  0  0  0\nM  END",
          "smiles": "Cc1c(c(cs1)C(=O)OC)S(=O)(=O)NC(=O)n2c(=O)n(C)c(n2)OC",
          "formula": "C12H14N4O7S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c62dc13c-d9b2-43be-839e-2bce6fd44450"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "390.3948",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6c40f09a-a56e-4ca0-9111-02ce5f5b4bf3",
      "version": "4",
      "structure": {
        "id": "43de77a0-ed56-4941-9350-c439d495c7e2",
        "molfile": "\n  Marvin  01132103352D          \n\n 25 26  0  0  0  0            999 V2000\n    9.8929   -3.8660    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0997   -3.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6175   -4.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7940   -4.2874    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2211   -3.5854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9679   -4.2874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1399   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7493   -3.5153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7121   -4.9440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8871   -5.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6962   -5.8100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3985   -6.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0256   -5.7034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4656   -7.0587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2091   -7.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9329   -6.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3539   -4.3786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1793   -5.0143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1063   -4.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8541   -5.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0512   -5.9117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4093   -6.3503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2168   -6.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8929   -4.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8462   -2.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13  9  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 11 16  1  0  0  0  0\n 10 17  2  0  0  0  0\n  4 18  2  0  0  0  0\n  3 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 19 24  2  0  0  0  0\n 24  1  1  0  0  0  0\n  2 25  1  0  0  0  0\nM  END",
        "smiles": "Cc1c(c(cs1)C(=O)OC)S(=O)(=O)NC(=O)n2c(=O)n(C)c(n2)OC",
        "formula": "C12H14N4O7S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "390.3948",
        "optical_activity": "NONE",
        "references": [
          "2a4586dd-3363-43b8-84ba-c81367bb0eff",
          "9a575aab-2a72-4995-88dd-09fd393afd6e"
        ],
        "stereo_centers": 0
      },
      "unii": "1MX00PIM4H"
    }
  ]
}