{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ddac559b-8260-4394-b333-142c2f35ee64",
          "code": "847249-61-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=847249-61-0",
          "code_system": "CAS",
          "references": [
            "af44176d-5599-423e-932d-ffeeb3d3af0d",
            "401cd60a-ebbf-406e-ab54-3cb223de5da9"
          ]
        },
        {
          "uuid": "ffca99d3-e973-4d71-a103-1e356c43fd7b",
          "code": "11507916",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11507916",
          "code_system": "PUBCHEM",
          "references": [
            "af44176d-5599-423e-932d-ffeeb3d3af0d"
          ]
        },
        {
          "uuid": "1825024a-1221-43e6-b1d9-a80cbdc2ad20",
          "code": "1M84V6QIEM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fe460b7d-d50e-4dfa-b166-e74925846a25",
          "name": "ADAMANTANYLCARBOXAMIDO HYDROXYLBENZAMIDE",
          "stdName": "ADAMANTANYLCARBOXAMIDO HYDROXYLBENZAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0edbb37b-b869-4b6b-9b6a-daa020046849",
            "865c537f-ad8e-403a-a1bb-475f5ead3515",
            "965284a3-fa14-4978-af0f-d6537cbd1594"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8688e96f-6b63-4c54-b083-6c0b4e6b7ee7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a2847a27-e33a-45f4-a892-c2390da8b22d",
          "name": "ECLATNOID AP144",
          "stdName": "ECLATNOID AP144",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0edbb37b-b869-4b6b-9b6a-daa020046849",
            "865c537f-ad8e-403a-a1bb-475f5ead3515"
          ],
          "display_name": false
        },
        {
          "uuid": "57203df5-2dc3-4fd6-a012-46e02d61bbca",
          "name": "TRICYCLO(3.3.1.13,7)DECANE-1-CARBOXAMIDE, N-(4-((HYDROXYAMINO)CARBONYL)PHENYL)-",
          "stdName": "TRICYCLO(3.3.1.13,7)DECANE-1-CARBOXAMIDE, N-(4-((HYDROXYAMINO)CARBONYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "116a5b85-ef63-4a5e-b02e-38a9784fde00",
            "0edbb37b-b869-4b6b-9b6a-daa020046849"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "865c537f-ad8e-403a-a1bb-475f5ead3515",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0edbb37b-b869-4b6b-9b6a-daa020046849",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "116a5b85-ef63-4a5e-b02e-38a9784fde00",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af44176d-5599-423e-932d-ffeeb3d3af0d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9585008-c7e5-4f43-a50d-1e0b0e838996",
          "citation": "SRS import [1M84V6QIEM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1M84V6QIEM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "965284a3-fa14-4978-af0f-d6537cbd1594",
          "citation": "ADAMANTANYLCARBOXAMIDO HYDROXYLBENZAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "401cd60a-ebbf-406e-ab54-3cb223de5da9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "272ea6b5-e1c9-4771-bf75-3e20e11bf17f",
          "id": "272ea6b5-e1c9-4771-bf75-3e20e11bf17f",
          "molfile": "\n  Marvin  01132102092D          \n\n 23 26  0  0  0  0            999 V2000\n    7.2431   -2.9731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8373   -3.6914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2565   -4.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0815   -4.3942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8508   -5.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2700   -5.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8642   -6.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0393   -6.5570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6335   -7.2753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8086   -7.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3893   -6.5725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4028   -8.0015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9345   -8.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4206   -9.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4135   -9.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8877   -8.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3680   -9.2183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8410   -8.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3740   -9.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3573   -8.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8817   -8.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6201   -5.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0258   -5.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n 23  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 22  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 20  1  0  0  0  0\n 21 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1C(=O)NO)NC(=O)C23CC4CC(CC(C4)C2)C3",
          "formula": "C18H22N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a4663598-93e3-4bf9-8d66-ff4796b37c7b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "314.3796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "643de60a-0a87-4f09-b210-74514590b238",
      "version": "3",
      "structure": {
        "id": "c289a633-7a0d-421d-9c02-2cbae528db25",
        "molfile": "\n  Marvin  01132110032D          \n\n 23 26  0  0  0  0            999 V2000\n    4.8086   -7.2832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6335   -7.2753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4028   -8.0015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8817   -8.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8877   -8.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4135   -9.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4206   -9.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9345   -8.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3740   -9.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8410   -8.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3680   -9.2183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3573   -8.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3893   -6.5725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0393   -6.5570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8642   -6.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2700   -5.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8508   -5.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0258   -5.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6201   -5.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2565   -4.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8373   -3.6914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0815   -4.3942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2431   -2.9731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n  5 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n  3 12  1  0  0  0  0\n  1 13  2  0  0  0  0\n  2 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 15 14  2  0  0  0  0\n 14 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 21 23  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1C(=O)NO)NC(=O)C23CC4CC(CC(C4)C2)C3",
        "formula": "C18H22N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "314.3796",
        "optical_activity": "NONE",
        "references": [
          "d9585008-c7e5-4f43-a50d-1e0b0e838996",
          "865c537f-ad8e-403a-a1bb-475f5ead3515"
        ],
        "stereo_centers": 0
      },
      "unii": "1M84V6QIEM"
    }
  ]
}