{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c7ff44e7-327b-4bce-9f9b-67e65a1b5946",
          "code": "68489-09-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68489-09-8",
          "code_system": "CAS",
          "references": [
            "e2fae0f0-4753-62c4-474b-45d96388ce15"
          ]
        },
        {
          "uuid": "bab9be6e-c09e-4c96-bf67-61f269d1675b",
          "code": "11266244",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11266244",
          "code_system": "PUBCHEM",
          "references": [
            "d8f6ab76-90dd-0519-f19c-5f689569a10c"
          ]
        },
        {
          "uuid": "3f872129-2b28-4af4-8f0a-c53b0da66f07",
          "code": "847565-93-9",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=847565-93-9",
          "code_system": "CAS",
          "references": [
            "e2fae0f0-4753-62c4-474b-45d96388ce15"
          ]
        },
        {
          "uuid": "b60e5628-a627-49e4-9252-8754c99af2fa",
          "code": "1217498-35-5",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1217498-35-5",
          "code_system": "CAS",
          "references": [
            "e2fae0f0-4753-62c4-474b-45d96388ce15"
          ]
        },
        {
          "uuid": "105b46a7-ba94-4062-86ab-c45afbb501dc",
          "code": "57233-03-1",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57233-03-1",
          "code_system": "CAS",
          "references": [
            "e2fae0f0-4753-62c4-474b-45d96388ce15"
          ]
        },
        {
          "uuid": "cafe3878-32eb-470e-8871-e370ff56cec7",
          "code": "1L7BVT4Z4Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c416796d-e550-8773-9bb0-2861e2c7f915",
          "code": "DTXSID10460636",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10460636",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "6735f18c-bac4-5530-a923-b4a8557e2371",
          "code": "C189962",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C189962",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9fe0b4d8-29e9-9d83-56ec-39a7c0a8d780"
          ]
        },
        {
          "uuid": "1739ef54-ebf7-5ee0-89e7-61869559c8bb",
          "code": "300000045594",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "deac6f6d-71c7-3a17-fb57-a7df912a94ef"
          ]
        },
        {
          "uuid": "f40e0336-b04f-ba96-072e-f6b9ba914c5a",
          "code": "WS-12",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/WS-12",
          "code_system": "WIKIPEDIA",
          "references": [
            "e8378d1f-3f57-52f1-1dc7-2b08a731a2e2"
          ]
        },
        {
          "uuid": "619caed0-b7f8-46de-a76a-461f804a2672",
          "code": "12127",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=12127",
          "code_system": "INN",
          "references": [
            "b6464f9e-4cec-e2bd-f3cd-b9f0c1a8b407"
          ]
        },
        {
          "uuid": "18a9bad7-9c9c-41a8-bf41-0dfa466329d9",
          "code": "2079",
          "type": "PRIMARY",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "2d2edcf5-f2c0-f329-df20-fafdb80e119b"
          ]
        },
        {
          "uuid": "2f240784-d7f6-0916-e73b-6fe1a9c4e2ea",
          "code": "2056",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2056/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "d9696105-b11b-806c-a02c-2773b0bab942"
          ]
        },
        {
          "uuid": "3e73f80e-6e4d-46b3-8a5e-ba30162b626f",
          "code": "LM-158",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/LM-158/relevant/1/",
          "code_system": "USAN",
          "references": [
            "7909a4c1-86ac-4f6b-a791-1d1474017d6a"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "deac6f6d-71c7-3a17-fb57-a7df912a94ef",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d8f6ab76-90dd-0519-f19c-5f689569a10c",
          "citation": "FDA SRS IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "e2fae0f0-4753-62c4-474b-45d96388ce15",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "2d2edcf5-f2c0-f329-df20-fafdb80e119b",
          "citation": "FHFI",
          "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "0c359e08-7406-4b4d-b8d7-fdbe765b343a",
          "citation": "AR 15512 ",
          "url": "https://adisinsight.springer.com/drugs/800048064",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e8378d1f-3f57-52f1-1dc7-2b08a731a2e2",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "e2a2942a-0fae-461c-aa2f-e8d3b9e4dd36",
          "citation": "https://adisinsight.springer.com/drugs/800048064",
          "url": "https://adisinsight.springer.com/drugs/800048064",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "b6464f9e-4cec-e2bd-f3cd-b9f0c1a8b407",
          "citation": "P127",
          "doc_type": "INN_LIST",
          "public_domain": true
        },
        {
          "uuid": "9fe0b4d8-29e9-9d83-56ec-39a7c0a8d780",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "d9696105-b11b-806c-a02c-2773b0bab942",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        },
        {
          "uuid": "7909a4c1-86ac-4f6b-a791-1d1474017d6a",
          "citation": "USAN COUN 2023",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bb56fd6c-dfa3-9991-d0e0-2f072fbf23b2",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e97a4f52-956d-c4b1-c8e1-ef25f766214f",
          "id": "e97a4f52-956d-c4b1-c8e1-ef25f766214f",
          "molfile": "\n  Marvin  01132112052D          \n\n 21 22  0  0  1  0            999 V2000\n   17.8287   -3.8057    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   18.4729   -3.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8287   -4.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1846   -5.3646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5404   -4.8428    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   15.9027   -5.3646    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.2649   -4.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9027   -6.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5404   -3.8057    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   17.1846   -3.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9027   -3.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9027   -2.2532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2649   -3.8057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6207   -3.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6207   -2.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9830   -1.7379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3388   -2.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6947   -1.7379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0504   -2.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3388   -3.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9830   -3.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  6  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 21  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 20 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)Nc2ccc(cc2)OC",
          "formula": "C18H27NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d078cd5f-2f8a-4a99-9ea4-d57533594d5d"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "289.4132",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "587cdf0c-d044-4604-8b2e-c1e8c8b13bd0",
      "version": "35",
      "structure": {
        "id": "0a3fc1d4-16bf-ce3b-8c7c-42c5077d29bf",
        "molfile": "\n  Marvin  01132100472D          \n\n 21 22  0  0  1  0            999 V2000\n   14.2261   -3.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5352   -4.1464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7993   -3.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7543   -2.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0184   -2.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3275   -3.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5916   -2.6548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5466   -1.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1084   -4.2244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3725   -3.8515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1811   -2.8719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9620   -4.0686    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.0070   -4.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7429   -5.2652    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.7879   -6.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6529   -3.6177    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.3888   -3.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4338   -4.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6079   -2.7939    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.8720   -2.4210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2989   -2.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  6 10  1  0  0  0  0\n  1 11  2  0  0  0  0\n 12  1  1  1  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 12 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 14 18  1  0  0  0  0\n 16 19  1  6  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)Nc2ccc(cc2)OC",
        "formula": "C18H27NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "289.4132",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e2fae0f0-4753-62c4-474b-45d96388ce15",
          "2d2edcf5-f2c0-f329-df20-fafdb80e119b"
        ],
        "stereo_centers": 3
      },
      "unii": "1L7BVT4Z4Z",
      "relationships": [
        {
          "uuid": "e46aa5eb-4e7a-4a66-ac82-fb9755ae32ef",
          "amount": {
            "uuid": "f55e982c-f994-44f8-9143-250d60c941dc",
            "average": 39,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "0c359e08-7406-4b4d-b8d7-fdbe765b343a"
          ],
          "related_substance": {
            "uuid": "7becc1ae-e1a1-4e08-afc6-1eedb4465ffe",
            "refuuid": "b81b98d0-39e1-42d6-9bb2-be57d49179fb",
            "name": "TRANSIENT RECEPTOR POTENTIAL CATION CHANNEL SUBFAMILY M MEMBER 8",
            "unii": "UFM9CFV381",
            "linking_id": "UFM9CFV381",
            "ref_pname": "TRANSIENT RECEPTOR POTENTIAL CATION CHANNEL SUBFAMILY M MEMBER 8",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f6475cd7-e9fd-4156-b411-9c2f2f1f716c",
          "amount": {
            "uuid": "a67ed09d-e028-462b-bbeb-56f7c3ad6612"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "0c359e08-7406-4b4d-b8d7-fdbe765b343a"
          ],
          "related_substance": {
            "uuid": "8cd5b668-5171-4186-9d46-d24b55733d06",
            "refuuid": "587cdf0c-d044-4604-8b2e-c1e8c8b13bd0",
            "name": "Acoltremon",
            "unii": "1L7BVT4Z4Z",
            "linking_id": "1L7BVT4Z4Z",
            "ref_pname": "Acoltremon",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1c9889d6-d8bb-4d27-ad0b-bd75873bd940",
          "amount": {
            "uuid": "d3deae85-46fe-485b-becb-61406d6511d6"
          },
          "type": "IMPURITY->PARENT",
          "related_substance": {
            "uuid": "f9e92650-a0b4-48ff-977f-aa926909baa7",
            "refuuid": "3bece75c-8e0b-408d-a2c1-b36964943d59",
            "name": "Menthyl chloride",
            "unii": "7VJ55B8UEM",
            "linking_id": "7VJ55B8UEM",
            "ref_pname": "Menthyl chloride",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "0e7729f3-ddd5-455d-9edf-2be8c8455fd2",
          "name": "(1R,2S,5R)-N-(4-Methoxyphenyl)-5-methyl-2-(1-methylethyl)cyclohexanecarboxamide",
          "stdName": "(1R,2S,5R)-N-(4-METHOXYPHENYL)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXANECARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2fae0f0-4753-62c4-474b-45d96388ce15"
          ],
          "display_name": false
        },
        {
          "uuid": "f7f41a8d-8105-4db6-8bd6-56caf3e06e1f",
          "name": "(1R,2S,5R)-N-(4-methoxyphenyl)-5-methyl-2-(propan-2-yl)cyclohexane-1-carboxamide",
          "stdName": "(1R,2S,5R)-N-(4-METHOXYPHENYL)-5-METHYL-2-(PROPAN-2-YL)CYCLOHEXANE-1-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6464f9e-4cec-e2bd-f3cd-b9f0c1a8b407"
          ],
          "display_name": false
        },
        {
          "uuid": "627169d0-3142-473a-886d-9dff98171f84",
          "name": "AR-15512",
          "stdName": "AR-15512",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2a2942a-0fae-461c-aa2f-e8d3b9e4dd36"
          ],
          "display_name": false
        },
        {
          "uuid": "5514ee73-22a5-42dd-bbde-72e62a739407",
          "name": "AVX-012",
          "stdName": "AVX-012",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2a2942a-0fae-461c-aa2f-e8d3b9e4dd36"
          ],
          "display_name": false
        },
        {
          "uuid": "f0edf94f-8d7f-4355-9b9b-98ce08d6f0c0",
          "name": "Acoltremon",
          "stdName": "ACOLTREMON",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6464f9e-4cec-e2bd-f3cd-b9f0c1a8b407",
            "7909a4c1-86ac-4f6b-a791-1d1474017d6a"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "326d13cc-911e-489a-829d-6ec9adf6c7ff",
              "name_org": "INN"
            },
            {
              "uuid": "109d085b-0770-4ce5-86a8-30e3f8c9de19",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "d2b9608e-8033-b429-8677-d74b6194a845",
          "name": "Cyclohexanecarboxamide, N-(4-methoxyphenyl)-5-methyl-2-(1-methylethyl)-, (1R,2S,5R)-",
          "stdName": "CYCLOHEXANECARBOXAMIDE, N-(4-METHOXYPHENYL)-5-METHYL-2-(1-METHYLETHYL)-, (1R,2S,5R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2fae0f0-4753-62c4-474b-45d96388ce15"
          ],
          "display_name": false
        },
        {
          "uuid": "54b1fca6-f340-4bc3-8acc-6aa251e9b148",
          "name": "Cyclohexanecarboxamide, N-(4-methoxyphenyl)-5-methyl-2-(1-methylethyl)-, [1R-(1α,2β,5α)]-",
          "stdName": "CYCLOHEXANECARBOXAMIDE, N-(4-METHOXYPHENYL)-5-METHYL-2-(1-METHYLETHYL)-, (1R-(1.ALPHA.,2.BETA.,5.ALPHA.))-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2fae0f0-4753-62c4-474b-45d96388ce15"
          ],
          "display_name": false
        },
        {
          "uuid": "3b0d8387-37b2-72f4-3070-69eeebaa5f6e",
          "name": "FEMA NO. 4681",
          "stdName": "FEMA NO. 4681",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2edcf5-f2c0-f329-df20-fafdb80e119b"
          ],
          "display_name": false
        },
        {
          "uuid": "34d03bd9-cc8b-11b5-ce74-5d560584f90e",
          "name": "N-(4-METHOXYPHENYL)-P-MENTHANECARBOXAMIDE",
          "stdName": "N-(4-METHOXYPHENYL)-P-MENTHANECARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2edcf5-f2c0-f329-df20-fafdb80e119b"
          ],
          "display_name": false
        },
        {
          "uuid": "c51462a1-3300-4180-8044-25e1e371ad27",
          "name": "WS-12",
          "stdName": "WS-12",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2fae0f0-4753-62c4-474b-45d96388ce15"
          ],
          "display_name": false
        },
        {
          "uuid": "c8625b28-0382-456f-8342-562ad30b4d08",
          "name": "[1R,2S,5R]-N-(4-Methoxyphenyl)-p-menthanecarboxamide",
          "stdName": "(1R,2S,5R)-N-(4-METHOXYPHENYL)-P-MENTHANECARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2fae0f0-4753-62c4-474b-45d96388ce15"
          ],
          "display_name": false
        },
        {
          "uuid": "696acbaa-3613-015b-455b-cc32c0b51b7f",
          "name": "acoltremon [INN]",
          "stdName": "ACOLTREMON [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6464f9e-4cec-e2bd-f3cd-b9f0c1a8b407"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "2f00e20a-c437-4017-8ad4-75b1d41ce37d"
      }
    }
  ]
}