{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fbe3ddf3-073c-49cb-9829-731f41ae4112",
          "code": "77-42-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77-42-9",
          "code_system": "CAS",
          "references": [
            "641b6a51-3a00-472c-99bb-5110fe088ee2",
            "9d27255a-510f-4e6b-aa02-cae2f8ede3f3"
          ]
        },
        {
          "uuid": "dae36f0c-6604-49f9-a96b-d74070ff8e33",
          "code": "201-027-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.935",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "641b6a51-3a00-472c-99bb-5110fe088ee2"
          ]
        },
        {
          "uuid": "af4147c9-41c5-41ab-8182-ad4d07e72681",
          "code": "m9765",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9765?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "641b6a51-3a00-472c-99bb-5110fe088ee2"
          ]
        },
        {
          "uuid": "065f806a-8ccb-403e-8a38-0a06ebc53e35",
          "code": "6857681",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6857681",
          "code_system": "PUBCHEM",
          "references": [
            "641b6a51-3a00-472c-99bb-5110fe088ee2"
          ]
        },
        {
          "uuid": "0760d1a7-f781-4aa3-a762-9074f7976a17",
          "code": "1JL7K2LW6L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e38383aa-ff57-ffde-6d7c-5274b8f289bd",
          "code": "DTXSID70892297",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70892297",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ffe3a3c2-5082-4313-8cd0-a27fa2c42576",
          "name": "(-)-.BETA.-SANTALOL",
          "stdName": "(-)-.BETA.-SANTALOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e4603a1-7768-4124-9478-f438cd75fb08",
            "28b152ae-ea19-4562-bc27-4bf89a9663ee"
          ],
          "display_name": false
        },
        {
          "uuid": "c83d289c-21ce-4504-b092-24dcb323a487",
          "name": ".BETA.-SANTALOL",
          "stdName": ".BETA.-SANTALOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28b152ae-ea19-4562-bc27-4bf89a9663ee",
            "3efd2761-1b55-4c59-9259-1df4f87f6116",
            "96b1871c-a812-42fe-b0ef-721d7127e129",
            "3e335420-fe0f-4b67-9970-db6e37127828"
          ],
          "display_name": true
        },
        {
          "uuid": "10b6a124-2f60-44bd-a36f-9914c6bc4788",
          "name": ".BETA.-SANTALOL [MI]",
          "stdName": ".BETA.-SANTALOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28b152ae-ea19-4562-bc27-4bf89a9663ee",
            "96b1871c-a812-42fe-b0ef-721d7127e129"
          ],
          "display_name": false
        },
        {
          "uuid": "444a9cfc-f3cd-4d35-b605-98c241716040",
          "name": "12-BETA-SANTALEN-14-OL",
          "stdName": "12-BETA-SANTALEN-14-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fca5963d-ca65-41ba-b872-73c58351cc0a",
            "28b152ae-ea19-4562-bc27-4bf89a9663ee"
          ],
          "display_name": false
        },
        {
          "uuid": "9662dd1a-ae74-4842-aba3-532557a31e77",
          "name": "2-PENTEN-1-OL, 2-METHYL-5-((1S,2R,4R)-2-METHYL-3-METHYLENEBICYCLO(2.2.1)HEPT-2-YL)-, (2Z)-",
          "stdName": "2-PENTEN-1-OL, 2-METHYL-5-((1S,2R,4R)-2-METHYL-3-METHYLENEBICYCLO(2.2.1)HEPT-2-YL)-, (2Z)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e4603a1-7768-4124-9478-f438cd75fb08",
            "28b152ae-ea19-4562-bc27-4bf89a9663ee"
          ],
          "display_name": false
        },
        {
          "uuid": "aa48b4d1-5f13-47cf-bad5-90f857e19b96",
          "name": "FEMA NO. 3006, .BETA.-",
          "stdName": "FEMA NO. 3006, .BETA.-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc59ce74-cefd-4183-b86a-569e3c1b3768",
            "28b152ae-ea19-4562-bc27-4bf89a9663ee"
          ],
          "display_name": false
        },
        {
          "uuid": "fb832654-701f-4c55-a3b5-8d95037b31c6",
          "name": "SANTALOL B",
          "stdName": "SANTALOL B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e4603a1-7768-4124-9478-f438cd75fb08",
            "28b152ae-ea19-4562-bc27-4bf89a9663ee"
          ],
          "display_name": false
        },
        {
          "uuid": "07d67b40-4275-4821-a44c-17b46c5907ff",
          "name": "SANTALOL, .BETA.-",
          "stdName": "SANTALOL, .BETA.-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62a09443-3d1b-4be6-9b3a-08ddcbef2530",
            "28b152ae-ea19-4562-bc27-4bf89a9663ee"
          ],
          "display_name": false
        },
        {
          "uuid": "c186dbd1-6f3b-4982-b702-aa240d5b7f71",
          "name": "SANTALOL, BETA-",
          "stdName": "SANTALOL, BETA-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62a09443-3d1b-4be6-9b3a-08ddcbef2530",
            "28b152ae-ea19-4562-bc27-4bf89a9663ee"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3efd2761-1b55-4c59-9259-1df4f87f6116",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "28b152ae-ea19-4562-bc27-4bf89a9663ee",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e4603a1-7768-4124-9478-f438cd75fb08",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96b1871c-a812-42fe-b0ef-721d7127e129",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc59ce74-cefd-4183-b86a-569e3c1b3768",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62a09443-3d1b-4be6-9b3a-08ddcbef2530",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fca5963d-ca65-41ba-b872-73c58351cc0a",
          "citation": "http://ec.europa.eu/food/food/chemicalsafety/flavouring/database/",
          "url": "http://ec.europa.eu/food/food/chemicalsafety/flavouring/database/",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "641b6a51-3a00-472c-99bb-5110fe088ee2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390003000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2e26743-abfe-4ed6-9c1e-195ee2458a25",
          "citation": "SRS import [1JL7K2LW6L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1JL7K2LW6L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390003000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "adc4fcf2-f9a7-4727-b3e9-247aa320586e",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e335420-fe0f-4b67-9970-db6e37127828",
          "citation": ".BETA.-SANTALOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d27255a-510f-4e6b-aa02-cae2f8ede3f3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e70fed9b-2c84-4912-9a78-2b924b1a8594",
          "id": "e70fed9b-2c84-4912-9a78-2b924b1a8594",
          "molfile": "\n  Marvin  01132111572D          \n\n 16 17  0  0  1  0            999 V2000\n    7.3902   -3.3313    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.0987   -3.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0987   -4.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3902   -4.9695    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1561   -4.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6907   -4.5704    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.4111   -5.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8779   -4.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3488   -5.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5359   -4.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0067   -5.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1940   -5.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2902   -6.3272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7610   -6.9601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6907   -3.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9727   -3.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  1  0  0  0\n  1 15  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  6 15  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 16 15  2  0  0  0  0\nM  END",
          "smiles": "C/C(=C/CC[C@@]1(C)C(=C)[C@@H]2CC[C@H]1C2)/CO",
          "formula": "C15H24O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "db0806d2-6475-45de-b5e4-7785f4582b9f"
          },
          "defined_stereo": 3,
          "ez_centers": 1,
          "molecular_weight": "220.351",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d1ae5972-aa17-47cc-93be-11807631de64",
      "version": "3",
      "structure": {
        "id": "b22564c1-a7db-4ad8-a355-5e7ad9e98aa2",
        "molfile": "\n  Marvin  01132109142D          \n\n 16 17  0  0  1  0            999 V2000\n    6.6907   -3.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6907   -4.5704    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3902   -4.9695    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1561   -4.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3902   -3.3313    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.0987   -3.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0987   -4.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8779   -4.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3488   -5.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5359   -4.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0067   -5.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2902   -6.3272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7610   -6.9601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1940   -5.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4111   -5.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9727   -3.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  4  1  1  0  0  0\n  5  1  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  3  1  0  0  0  0\n  2  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 11  1  0  0  0  0\n  2 15  1  6  0  0  0\n 16  1  2  0  0  0  0\nM  END",
        "smiles": "C/C(=C/CC[C@@]1(C)C(=C)[C@@H]2CC[C@H]1C2)/CO",
        "formula": "C15H24O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 1,
        "molecular_weight": "220.351",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b2e26743-abfe-4ed6-9c1e-195ee2458a25",
          "adc4fcf2-f9a7-4727-b3e9-247aa320586e"
        ],
        "stereo_centers": 3
      },
      "unii": "1JL7K2LW6L"
    }
  ]
}