{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0d59a921-bc43-4976-82be-78e13de52769", "code": "68239-79-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68239-79-2", "code_system": "CAS", "references": [ "a46d187b-93c1-4e42-9d2e-5ce249a2f6eb", "7b41cdbb-93e4-42b4-8082-94ef09c1f6f6" ] }, { "uuid": "b4245930-b3e3-4af2-a43e-6c650546ef79", "code": "269-473-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.063.138", "code_system": "ECHA (EC/EINECS)", "references": [ "a46d187b-93c1-4e42-9d2e-5ce249a2f6eb" ] }, { "uuid": "4f39db90-8c46-a309-07a9-feda8c82dea4", "code": "DTXSID0071338", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0071338", "code_system": "EPA CompTox", "references": [ "874bb86a-a165-1512-c36f-6e4b15cb973e" ] }, { "uuid": "0ffa758c-b776-34e7-1a29-7cdac0b063e4", "code": "109925", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/109925", "code_system": "PUBCHEM", "references": [ "38016593-049a-0d66-9442-9cebf9b3bd15" ] }, { "uuid": "8e9d3f44-9780-43a2-91fc-d7c9820b1cbb", "code": "1JI3169J37", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "6bf26c42-608c-424e-a276-fdee76a26c5e", "name": "2-AMINO-2-HYDROXYETHYL-4-HYDROXYTOLUENE SULFATE", "stdName": "2-AMINO-2-HYDROXYETHYL-4-HYDROXYTOLUENE SULFATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "71b3aeaf-c64f-4adb-9b5f-a140ba122230", "8e261ce8-3fb3-42f5-9d31-b4970d9149ad" ], "display_name": false }, { "uuid": "ce400239-48c2-41be-ae5b-72dc6030202c", "name": "3-ETHYLAMINO-P-CRESOL SULFATE", "stdName": "3-ETHYLAMINO-P-CRESOL SULFATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "71b3aeaf-c64f-4adb-9b5f-a140ba122230", "c86ab706-6100-4390-b8fd-7a4a0631317c", "a983fc11-7b46-4fb7-ae83-9ec5cc0f9631" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "d2bdee2a-7c59-47e5-ac46-71a520f91282", "name_org": "INCI" } ] }, { "uuid": "026a09ab-954c-45bd-b0c3-06bb6e80757f", "name": "PHENOL, 3-(ETHYLAMINO)-4-METHYL-, SULFATE", "stdName": "PHENOL, 3-(ETHYLAMINO)-4-METHYL-, SULFATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "71b3aeaf-c64f-4adb-9b5f-a140ba122230", "8ed7a6e7-07cb-4438-a548-e92886896fcf" ], "display_name": false }, { "uuid": "85a8ce93-8b6f-4aa3-8e17-0be35c363aec", "name": "RODOL EACS", "stdName": "RODOL EACS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "71b3aeaf-c64f-4adb-9b5f-a140ba122230", "c86ab706-6100-4390-b8fd-7a4a0631317c" ], "display_name": false } ], "references": [ { "uuid": "c86ab706-6100-4390-b8fd-7a4a0631317c", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "71b3aeaf-c64f-4adb-9b5f-a140ba122230", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8ed7a6e7-07cb-4438-a548-e92886896fcf", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8e261ce8-3fb3-42f5-9d31-b4970d9149ad", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a46d187b-93c1-4e42-9d2e-5ce249a2f6eb", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391407000, "tags": [ "NOMEN" ] }, { "uuid": "f358e8b1-9a12-4f04-9880-cf49b837bc32", "citation": "SRS import [1JI3169J37]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1JI3169J37", "doc_type": "SRS", "public_domain": true, "document_date": 1493391407000, "tags": [ "NOMEN" ] }, { "uuid": "a983fc11-7b46-4fb7-ae83-9ec5cc0f9631", "citation": "3-ETHYLAMINO-P-CRESOL SULFATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "874bb86a-a165-1512-c36f-6e4b15cb973e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68239-79-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "38016593-049a-0d66-9442-9cebf9b3bd15", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "7b41cdbb-93e4-42b4-8082-94ef09c1f6f6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "909bac7e-7947-46d1-8747-628b1d68a37d", "id": "909bac7e-7947-46d1-8747-628b1d68a37d", "molfile": "\n Marvin 01132107302D \n\n 5 4 0 0 0 0 999 V2000\n 11.0155 -6.2202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1951 -6.2202 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3701 -6.2202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1951 -5.3951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1951 -7.0452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 2 5 2 0 0 0 0\nM END", "smiles": "OS(=O)(=O)O", "formula": "H2O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "de0edcb6-0a2e-4cc0-8fd6-8ce66c459c23" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "98.0796", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "569e8616-6e75-4d08-b94e-0948ca7bc748", "id": "569e8616-6e75-4d08-b94e-0948ca7bc748", "molfile": "\n Marvin 01132104302D \n\n 11 11 0 0 0 0 999 V2000\n 6.3459 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3459 -5.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6289 -5.2093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9119 -5.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9119 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -6.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -7.6914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4824 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4824 -5.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -5.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 10 2 0 0 0 0\n 6 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\nM END", "smiles": "CCNc1cc(ccc1C)O", "formula": "C9H13NO", "atropisomerism": "No", "charge": 0, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "4cba226e-3e8f-4376-85f6-0157e555cbce" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "151.206", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2b004daf-6fe3-41cf-9f67-cc78e0d57eab", "version": "7", "structure": { "id": "6e40bc6f-305b-4263-affa-e55677b233fa", "molfile": "\n Marvin 01132105442D \n\n 27 26 0 0 0 0 999 V2000\n 10.2249 -6.2383 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2249 -5.4109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2249 -7.0657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0475 -6.2383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3974 -6.2383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4824 -5.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -5.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9119 -5.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9119 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -6.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4824 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -7.6914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6289 -5.2093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3459 -5.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3459 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4824 -5.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -5.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9119 -5.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9119 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -6.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4824 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -7.6914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6289 -5.2093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3459 -5.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3459 -6.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1948 -4.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 7 16 1 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 1 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 6 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 18 17 2 0 0 0 0\n 17 22 1 0 0 0 0\n 18 27 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 24 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 21 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20\nM SAL 1 7 21 22 23 24 25 26 27\nM SPA 1 11 6 7 8 9 10 11 12 13 14 15 16\nM SDI 1 4 3.0624 -8.1114 3.0624 -3.9619\nM SDI 1 4 6.7659 -3.9619 6.7659 -8.1114\nM SMT 1 2\nM END", "smiles": "CCNc1cc(ccc1C)O.CCNc1cc(ccc1C)O.OS(=O)(=O)O", "formula": "2C9H13NO.H2O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "400.4915", "optical_activity": "NONE", "references": [ "c86ab706-6100-4390-b8fd-7a4a0631317c", "f358e8b1-9a12-4f04-9880-cf49b837bc32" ], "stereo_centers": 0 }, "unii": "1JI3169J37" } ] }