{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2b71cdef-8826-4035-ab9e-825468cb5cf4", "code": "79-63-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=79-63-0", "code_system": "CAS", "references": [ "a5e33454-070b-4d41-bf65-0487fff76074", "0a2e83ba-6bdb-4494-932b-807e54bcfa63" ] }, { "uuid": "f4b74d17-2d1f-4214-906f-b64ac9058577", "code": "LANOSTEROL", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Lanosterol", "code_system": "WIKIPEDIA", "references": [ "a5e33454-070b-4d41-bf65-0487fff76074" ] }, { "uuid": "43fa0913-7ba8-417e-a8be-937187912800", "code": "201-214-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.105", "code_system": "ECHA (EC/EINECS)", "references": [ "a5e33454-070b-4d41-bf65-0487fff76074" ] }, { "uuid": "f32ecf32-f244-432f-b3ac-2795d04f712d", "code": "1442199", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1442199/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "a5e33454-070b-4d41-bf65-0487fff76074" ] }, { "uuid": "41ea6f7f-a526-47eb-b4c1-25a81a01b96d", "code": "m6681", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m6681?q=authorize", "code_system": "MERCK INDEX", "references": [ "a5e33454-070b-4d41-bf65-0487fff76074" ] }, { "uuid": "046ad7b8-81ad-4c3e-b5cf-2f03611b0ba2", "code": "246983", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/246983", "code_system": "PUBCHEM", "references": [ "a5e33454-070b-4d41-bf65-0487fff76074" ] }, { "uuid": "5661b3fc-daf1-04fe-b684-03b4e3cd6ca3", "code": "DTXSID1040744", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1040744", "code_system": "EPA CompTox", "references": [ "3cfcd7fa-877c-ba24-9465-e635a0fff1b3" ] }, { "uuid": "af26722e-f112-2933-da76-6cecb8320dd4", "code": "74898-8", "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Lanosterol [Moles/volume] in Serum or Plasma", "type": "PRIMARY", "url": "https://loinc.org/74898-8/", "code_system": "LOINC", "references": [ "af9da736-b7b1-85ab-2549-12a0a8f1f914" ] }, { "uuid": "7c9c8b6b-a032-6638-f470-cd818658d96d", "code": "DB03696", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB03696", "code_system": "DRUG BANK", "references": [ "af9da736-b7b1-85ab-2549-12a0a8f1f914" ] }, { "uuid": "70d2eee4-6827-4510-af2f-a8aabe06b1c4", "code": "1J05Z83K3M", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8bc82995-c055-138b-b807-3775cc3d6a74", "code": "16521", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16521", "code_system": "CHEBI", "references": [ "af9da736-b7b1-85ab-2549-12a0a8f1f914" ] }, { "uuid": "3cb3a151-f255-d581-7a31-7e48b50abeff", "code": "60677", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=60677", "code_system": "NSC", "references": [ "23931534-9780-b441-4a22-81627e46b641" ] }, { "uuid": "fc679aec-8db3-7197-30a5-1b07f29a7e33", "code": "1J05Z83K3M", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1J05Z83K3M", "code_system": "DAILYMED", "references": [ "639ffd02-325b-068c-58cf-589661133074" ] } ], "relationships": [ { "uuid": "6351faba-2f3a-43e2-8872-f9db032da81a", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "ad508482-37f6-476e-8ca4-8f6f2fec377d", "refuuid": "9deacf8b-8612-4193-98de-16c1da1ae9c3", "name": "LANOSTEROL", "unii": "1J05Z83K3M", "linking_id": "1J05Z83K3M", "ref_pname": "LANOSTEROL", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "824ca38d-65bc-4923-a25f-648b40c336dd", "name": "(3.BETA.)-LANOSTA-8,24-DIEN-3-OL", "stdName": "(3.BETA.)-LANOSTA-8,24-DIEN-3-OL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4c8a2c28-3b22-4a96-b373-ded1cc83de31", "4ab605d3-6ffb-4e50-9a0e-66b2328b5ca4" ], "display_name": false }, { "uuid": "c4b0bb51-91a6-4949-abf8-feb392738d30", "name": "KRYPTOSTEROL", "stdName": "KRYPTOSTEROL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4c8a2c28-3b22-4a96-b373-ded1cc83de31", "4ab605d3-6ffb-4e50-9a0e-66b2328b5ca4" ], "display_name": false }, { "uuid": "67cca0eb-ee0e-4e3c-95ae-aa94720ce0ea", "name": "LANOSTERIN", "stdName": "LANOSTERIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "72444e8a-d099-4787-ac37-5c17d0823f6d", "4ab605d3-6ffb-4e50-9a0e-66b2328b5ca4" ], "display_name": false }, { "uuid": "ea9ed8b4-145d-4a79-8bf9-5778f235e400", "name": "LANOSTEROL", "stdName": "LANOSTEROL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "ba44a17e-4056-4230-a3ba-eb9e25383737", "4c8a2c28-3b22-4a96-b373-ded1cc83de31", "f602c2dc-0c9c-4d7d-bf65-c6f4431f1d59", "4ab605d3-6ffb-4e50-9a0e-66b2328b5ca4", "6fcb419b-2eec-4284-a386-b61b660e1bad", "26d75e8d-ba66-4d97-8635-63221e65d24a" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f3bd1ed1-f3d9-445f-bafe-f205d2ee16c1", "name_org": "INCI" } ] }, { "uuid": "41ba3801-9a27-42c1-87c5-ab5498a2009e", "name": "LANOSTEROL [MI]", "stdName": "LANOSTEROL [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4ab605d3-6ffb-4e50-9a0e-66b2328b5ca4", "6fcb419b-2eec-4284-a386-b61b660e1bad" ], "display_name": false }, { "uuid": "2f39aa91-38fd-4ba8-9d65-4d3ea3d6008e", "name": "NSC-60677", "stdName": "NSC-60677", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "b5ad8c63-46d3-4c4c-b4be-11fd5c91ea5a", "4ab605d3-6ffb-4e50-9a0e-66b2328b5ca4" ], "display_name": false } ], "references": [ { "uuid": "4c8a2c28-3b22-4a96-b373-ded1cc83de31", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4ab605d3-6ffb-4e50-9a0e-66b2328b5ca4", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "72444e8a-d099-4787-ac37-5c17d0823f6d", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6fcb419b-2eec-4284-a386-b61b660e1bad", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ba44a17e-4056-4230-a3ba-eb9e25383737", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b5ad8c63-46d3-4c4c-b4be-11fd5c91ea5a", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a5e33454-070b-4d41-bf65-0487fff76074", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389672000, "tags": [ "NOMEN" ] }, { "uuid": "b0bc388e-e0de-4690-a1be-a23c5166793a", "citation": "SRS import [1J05Z83K3M]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1J05Z83K3M", "doc_type": "SRS", "public_domain": true, "document_date": 1493389672000, "tags": [ "NOMEN" ] }, { "uuid": "f602c2dc-0c9c-4d7d-bf65-c6f4431f1d59", "citation": "LANOSTEROL [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "26d75e8d-ba66-4d97-8635-63221e65d24a", "citation": "LANOSTEROL [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3cfcd7fa-877c-ba24-9465-e635a0fff1b3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79-63-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "af9da736-b7b1-85ab-2549-12a0a8f1f914", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "0a2e83ba-6bdb-4494-932b-807e54bcfa63", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "23931534-9780-b441-4a22-81627e46b641", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "639ffd02-325b-068c-58cf-589661133074", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "268f0c7c-aaa7-499e-b1d4-92aee7670676", "id": "268f0c7c-aaa7-499e-b1d4-92aee7670676", "molfile": "\n Marvin 01132102082D \n\n 31 34 0 0 1 0 999 V2000\n 7.9474 -2.4049 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.2934 -1.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7278 -1.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4732 -2.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3873 -1.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1092 -2.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1092 -3.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9342 -1.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9121 -3.0729 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.5309 -3.5276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5309 -4.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1575 -4.3526 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.1575 -5.0370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4824 -4.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7418 -4.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7418 -3.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4543 -3.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1575 -3.5181 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.1575 -2.8150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0339 -4.7416 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.0339 -3.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3120 -4.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5948 -4.7416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5948 -5.5668 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 2.8916 -5.9839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3120 -5.9839 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.6932 -6.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5136 -6.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0339 -5.5668 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.7418 -5.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4824 -5.5714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 9 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 18 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 6 0 0 0\n 12 14 1 0 0 0 0\n 18 12 1 0 0 0 0\n 15 14 2 0 0 0 0\n 31 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 20 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 1 0 0 0\n 20 21 1 1 0 0 0\n 22 20 1 0 0 0 0\n 20 29 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 1 0 0 0\n 24 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 26 1 0 0 0 0\n 29 26 1 1 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\nM END", "smiles": "CC(=CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]4(C)CC[C@@H](C(C)(C)[C@@H]4CC3)O)C", "formula": "C30H50O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7eebbaff-09bc-4600-9816-36cf18ef94e2" }, "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "426.7185", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "9deacf8b-8612-4193-98de-16c1da1ae9c3", "version": "10", "structure": { "id": "d7116bc1-8860-448c-9f25-eea19eda9fb2", "molfile": "\n Marvin 01132111092D \n\n 33 36 0 0 1 0 999 V2000\n 7.1575 -4.3526 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.4824 -4.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7418 -4.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0339 -4.7416 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.3120 -4.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5948 -4.7416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5948 -5.5668 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.3120 -5.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0339 -5.5668 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.7418 -5.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4824 -5.5714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0339 -6.3870 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6932 -6.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5136 -6.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8916 -5.9839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0339 -3.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7418 -3.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4543 -3.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1575 -3.5181 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.9121 -3.0729 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.9474 -2.4049 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.7278 -1.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4732 -2.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3873 -1.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1092 -2.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1092 -3.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9342 -1.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2934 -1.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5919 -2.6697 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5309 -3.5276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5309 -4.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1575 -2.8150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1575 -5.0370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 2 1 0 0 0 0\n 9 12 1 6 0 0 0\n 4 9 1 0 0 0 0\n 13 8 1 0 0 0 0\n 14 8 1 0 0 0 0\n 7 15 1 1 0 0 0\n 4 16 1 1 0 0 0\n 17 3 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 1 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 27 25 1 0 0 0 0\n 21 28 1 6 0 0 0\n 20 29 1 6 0 0 0\n 20 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 1 1 0 0 0 0\n 19 32 1 1 0 0 0\n 1 33 1 6 0 0 0\nM END", "smiles": "CC(=CCC[C@@H](C)[C@@]1([H])CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]4(C)CC[C@@H](C(C)(C)[C@]4([H])CC3)O)C", "formula": "C30H50O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "426.7185", "optical_activity": "UNSPECIFIED", "references": [ "4c8a2c28-3b22-4a96-b373-ded1cc83de31", "b0bc388e-e0de-4690-a1be-a23c5166793a" ], "stereo_centers": 7 }, "unii": "1J05Z83K3M" } ] }