{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "538848f1-3861-4c34-82c4-4c94613abd8e",
          "code": "INS-952(IV)",
          "comments": "JECFA|Functional Classification|SWEETENER",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=952(iv)",
          "code_system": "JECFA EVALUATION",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "00378832-3b7f-424e-b61c-a249afdcf113",
          "code": "INS-952(IV)",
          "comments": "Codex Alimentarius|Functional Classification|SWEETENER",
          "type": "PRIMARY",
          "url": "http://www.codexalimentarius.net/gsfaonline/groups/details.html?id=71",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "98547608-621b-460a-ae11-a89450ca899b",
          "code": "21 CFR 189.135",
          "comments": "PART 189 -- SUBSTANCES PROHIBITED FROM USE IN HUMAN FOOD|SUBPART C--SUBSTANCES GENERALLY PROHIBITED FROM DIRECT ADDITION OR USE AS HUMAN FOOD|SEC. 189.135 CYCLAMATE AND ITS DERIVATIVES",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=189.135",
          "code_system": "CFR",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "ffaeec60-285b-43cd-bcc0-1380950f9903",
          "code": "139-05-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=139-05-9",
          "code_system": "CAS",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5",
            "616c5943-f9ae-4368-8684-c13fd98bc714"
          ]
        },
        {
          "uuid": "d0ebe82d-8a5a-4a1d-b257-a47bab26841b",
          "code": "C84153",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84153",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "5ce9ee82-b6e1-40e0-97b6-318148f59ccd",
          "code": "SODIUM CYCLAMATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sodium_cyclamate",
          "code_system": "WIKIPEDIA",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "7feade49-0b25-4451-9627-c94d84df4550",
          "code": "SUB10555MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "299c4547-11e0-4a30-bc67-587701a8cb3c",
          "code": "168",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=168",
          "code_system": "INN",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "bdfa1c19-3e67-4d4e-8ea5-b4daa4c827f1",
          "code": "56467",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/56467/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "49acafac-7717-4ff6-bdbf-ca5a39da4662",
          "code": "SUB36452",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "e469a7c4-49b4-4b15-a7dd-79d5a07c9544",
          "code": "CHEMBL273977",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL273977",
          "code_system": "ChEMBL",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "326beaaa-8c2f-497d-b086-d81ad1d163ff",
          "code": "205-348-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.863",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "05c0342d-bd72-4a35-aa4d-a5c2386e8d45",
          "code": "23665706",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23665706",
          "code_system": "PUBCHEM",
          "references": [
            "e9581435-e63d-47df-93b8-c6024b668ef5"
          ]
        },
        {
          "uuid": "38db792c-3757-f35c-084c-7c7ec2b8225f",
          "code": "DTXSID6020355",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6020355",
          "code_system": "EPA CompTox",
          "references": [
            "91d15825-1c47-e404-5f71-f19a102969ac"
          ]
        },
        {
          "uuid": "e6bc4b71-fd37-dc76-0992-c7bc95496fb7",
          "code": "C283",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Artificial Sweetener",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C283",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c151ce70-e6a9-3ea7-640c-473081daa7b5"
          ]
        },
        {
          "uuid": "b5ebf2bf-b1e2-4d4d-b274-f2da99d45e0f",
          "code": "1I6F42RME1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "92a5f81e-7eb9-464b-97bd-5883b60eafc3",
          "code": "1613860",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1613860",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "c151ce70-e6a9-3ea7-640c-473081daa7b5"
          ]
        },
        {
          "uuid": "2a3b687e-8621-e941-3ef0-a7dcf6e3a3ec",
          "code": "1I6F42RME1",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1I6F42RME1",
          "code_system": "DAILYMED",
          "references": [
            "d7e4f7a1-fd5e-7efb-038e-347ef78e870d"
          ]
        },
        {
          "uuid": "1ea9c1b4-d460-df48-4653-47bc4abc6d8d",
          "code": "100000083527",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d8551f58-2514-dd51-1963-390c94923866"
          ]
        },
        {
          "uuid": "5a053775-b955-8fb6-fa3d-7d22e8dc410e",
          "code": "42195",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=42195",
          "code_system": "NSC",
          "references": [
            "1fa7f8e0-5e89-131b-ae09-52bec5436af3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a950d25c-ec2d-494d-9066-f28310fb2e47",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6360a5c3-2166-4da2-9d80-1d7e44150cda",
            "refuuid": "6acf30b2-7157-4866-8ce3-135d1ed80748",
            "name": "CYCLAMIC ACID",
            "unii": "HN3OFO5036",
            "linking_id": "HN3OFO5036",
            "ref_pname": "CYCLAMIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b83f2413-e84d-43b5-9ea5-00d602cc4402",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "70f23f99-6188-4747-8126-0c4764ca4061",
            "refuuid": "6acf30b2-7157-4866-8ce3-135d1ed80748",
            "name": "CYCLAMIC ACID",
            "unii": "HN3OFO5036",
            "linking_id": "HN3OFO5036",
            "ref_pname": "CYCLAMIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df87a15d-41e7-4355-bd0d-91701221c540",
          "name": "E-952(IV)",
          "stdName": "E-952(IV)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba1dc865-6ab5-4f34-abd4-716f9558455f"
          ],
          "display_name": false
        },
        {
          "uuid": "06c1cf0b-4a7b-4289-a19b-bf626ab6e5fe",
          "name": "INS NO. 952(IV)",
          "stdName": "INS NO. 952(IV)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba1dc865-6ab5-4f34-abd4-716f9558455f"
          ],
          "display_name": false
        },
        {
          "uuid": "22fc9890-a7f0-4762-9267-cc3c1513f4f0",
          "name": "INS-952(IV)",
          "stdName": "INS-952(IV)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba1dc865-6ab5-4f34-abd4-716f9558455f"
          ],
          "display_name": false
        },
        {
          "uuid": "8d5228fe-d209-4dd0-8b2b-79b5d02d3774",
          "name": "NSC-42195",
          "stdName": "NSC-42195",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95e8a7d3-40bb-4fe3-91e8-69eb385bc82c"
          ],
          "display_name": false
        },
        {
          "uuid": "5443fdde-27f9-4d39-bc10-00d45974594e",
          "name": "SODIUM CYCLAMATE",
          "stdName": "SODIUM CYCLAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab07243e-00d8-40cc-877c-bfeb87890fdd",
            "1634c4f3-68e9-44ef-a454-5a1c4188a0e0",
            "871f6fc7-d97a-4958-87f2-6bb90ff8bf5d",
            "3c38fad8-4782-4acb-97f1-bb880ad113ea",
            "cb8b70d9-a9e9-43ec-88a8-bb1e128525a3",
            "3bc7d1c2-5f5c-4a29-881c-5e06c7c72ed5",
            "c5452955-2914-44dc-938a-9721f91af157",
            "43afcb8c-4eda-43c9-9237-698d5c02424a",
            "9856dbea-e6c6-4024-9643-1f04cf43e8f1",
            "85ff248a-3a0b-46a5-85b5-c7adc6c94642",
            "f047575d-9045-4806-a228-e52bb15c1265",
            "7bc65aa5-c320-4ece-a6a3-bb99816ac77a",
            "98a1bafa-60a8-40f7-8742-0f449d65a48c",
            "7c3b3ccc-a616-4ca0-8268-affe9d396978"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d2bed09f-45e0-41c3-8387-4ca6b9130a35",
              "name_org": "INN"
            },
            {
              "uuid": "ce65dfe6-f704-438a-babe-5b529a237ff0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "50886ff1-5b2a-42c5-b395-8f20431bc4bd",
          "name": "SODIUM CYCLAMATE ANHYDROUS",
          "stdName": "SODIUM CYCLAMATE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22869d7f-bdf6-4bf7-a241-e4ca2306b761"
          ],
          "display_name": false
        },
        {
          "uuid": "bed2a472-a2ca-edc4-1ece-a48a80858369",
          "name": "SODIUM CYCLAMATE [EP MONOGRAPH]",
          "stdName": "SODIUM CYCLAMATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e38c7a6c-a18c-5fbc-7aaa-5fa3fc55bcaa"
          ],
          "display_name": false
        },
        {
          "uuid": "a6701be5-2a65-b95b-bdf4-aa70cd6af34f",
          "name": "SODIUM CYCLAMATE [IARC]",
          "stdName": "SODIUM CYCLAMATE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "960a1af6-2d98-e8eb-a56b-e91fa6eb678a"
          ],
          "display_name": false
        },
        {
          "uuid": "9808fc71-9fbb-4ee6-acb2-5f5006706f85",
          "name": "SODIUM CYCLAMATE [II]",
          "stdName": "SODIUM CYCLAMATE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "871f6fc7-d97a-4958-87f2-6bb90ff8bf5d"
          ],
          "display_name": false
        },
        {
          "uuid": "0f58045c-9fa4-41a7-a5e8-df5bb19caf59",
          "name": "SODIUM CYCLAMATE [MART.]",
          "stdName": "SODIUM CYCLAMATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3bc7d1c2-5f5c-4a29-881c-5e06c7c72ed5"
          ],
          "display_name": false
        },
        {
          "uuid": "41ed9b99-af58-49d8-8a45-9da1a0ae4d0f",
          "name": "SODIUM CYCLAMATE [USP-RS]",
          "stdName": "SODIUM CYCLAMATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a1bafa-60a8-40f7-8742-0f449d65a48c"
          ],
          "display_name": false
        },
        {
          "uuid": "58e8b368-cad2-4ca6-bfd0-8b981bfb9d50",
          "name": "SODIUM CYCLOHEXANESULFAMATE",
          "stdName": "SODIUM CYCLOHEXANESULFAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c087948e-4c4d-4662-9cf6-33692202a301"
          ],
          "display_name": false
        },
        {
          "uuid": "048d28a3-ca53-c70c-66f3-f0b843de2849",
          "name": "SUCARYL",
          "stdName": "SUCARYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "871f6fc7-d97a-4958-87f2-6bb90ff8bf5d"
          ],
          "display_name": false
        },
        {
          "uuid": "473f6a6c-4789-4cfd-b40e-9ebb5fc5c4d4",
          "name": "SUCARYL SODIUM",
          "stdName": "SUCARYL SODIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9b64007-d82b-497e-bc33-bdea69d8ef69"
          ],
          "display_name": false
        },
        {
          "uuid": "83daf837-7112-2194-ffb4-488ced354fe4",
          "name": "Sodium cyclamate [WHO-DD]",
          "stdName": "SODIUM CYCLAMATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2127194-0652-f934-c063-781c85e3c062"
          ],
          "display_name": false
        },
        {
          "uuid": "29ae14c1-42ba-4e14-ba66-c375b4ac1e78",
          "name": "sodium cyclamate [INN]",
          "stdName": "SODIUM CYCLAMATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f047575d-9045-4806-a228-e52bb15c1265"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "871f6fc7-d97a-4958-87f2-6bb90ff8bf5d",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c087948e-4c4d-4662-9cf6-33692202a301",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9b64007-d82b-497e-bc33-bdea69d8ef69",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f047575d-9045-4806-a228-e52bb15c1265",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "85ff248a-3a0b-46a5-85b5-c7adc6c94642",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bc7d1c2-5f5c-4a29-881c-5e06c7c72ed5",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c3b3ccc-a616-4ca0-8268-affe9d396978",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98a1bafa-60a8-40f7-8742-0f449d65a48c",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb8b70d9-a9e9-43ec-88a8-bb1e128525a3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba1dc865-6ab5-4f34-abd4-716f9558455f",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22869d7f-bdf6-4bf7-a241-e4ca2306b761",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95e8a7d3-40bb-4fe3-91e8-69eb385bc82c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9581435-e63d-47df-93b8-c6024b668ef5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea9a020d-3420-4092-8f97-4b898b78199e",
          "citation": "SRS import [1I6F42RME1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1I6F42RME1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4d4bde1-7626-46cd-aeb1-2a7447e6712c",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c38fad8-4782-4acb-97f1-bb880ad113ea",
          "citation": "SODIUM CYCLAMATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7bc65aa5-c320-4ece-a6a3-bb99816ac77a",
          "citation": "SODIUM CYCLAMATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1634c4f3-68e9-44ef-a454-5a1c4188a0e0",
          "citation": "SODIUM CYCLAMATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "43afcb8c-4eda-43c9-9237-698d5c02424a",
          "citation": "SODIUM CYCLAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9856dbea-e6c6-4024-9643-1f04cf43e8f1",
          "citation": "SODIUM CYCLAMATE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab07243e-00d8-40cc-877c-bfeb87890fdd",
          "citation": "SODIUM CYCLAMATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c5452955-2914-44dc-938a-9721f91af157",
          "citation": "SODIUM CYCLAMATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "91d15825-1c47-e404-5f71-f19a102969ac",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=139-05-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d8551f58-2514-dd51-1963-390c94923866",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "960a1af6-2d98-e8eb-a56b-e91fa6eb678a",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "c151ce70-e6a9-3ea7-640c-473081daa7b5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "616c5943-f9ae-4368-8684-c13fd98bc714",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d5e4315e-d96d-ba57-93ce-ba5959ebe0a7",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "e38c7a6c-a18c-5fbc-7aaa-5fa3fc55bcaa",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "1fa7f8e0-5e89-131b-ae09-52bec5436af3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e2127194-0652-f934-c063-781c85e3c062",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d7e4f7a1-fd5e-7efb-038e-347ef78e870d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "88795dc1-5c22-492e-923d-287ea235ecf4",
          "id": "88795dc1-5c22-492e-923d-287ea235ecf4",
          "molfile": "\n  Marvin  01132107052D          \n\n  1  0  0  0  0  0            999 V2000\n    0.0000   -0.6475    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5a4755b3-b704-4d5b-9116-22b13d4587c2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a353d727-f20b-4f69-b547-cfcb70c24c86",
          "id": "a353d727-f20b-4f69-b547-cfcb70c24c86",
          "molfile": "\n  Marvin  01132108292D          \n\n 11 11  0  0  0  0            999 V2000\n    1.1104   -0.6397    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.7163   -1.1807    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2156   -0.5149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1234   -1.7814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4497   -1.6305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1700   -1.2326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8722   -1.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5977   -1.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6055   -0.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9034    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1700   -0.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 11  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "C1CCC(CC1)NS(=O)(=O)[O-]",
          "formula": "C6H12NO3S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "41260658-9018-45ee-804c-471257b249f1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "178.2307",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5b1f2b3f-da12-4877-8921-84a1cf2d6f3d",
      "version": "20",
      "structure": {
        "id": "56018ebd-9a73-46e3-90bf-20929695bffd",
        "molfile": "\n  Marvin  01132104282D          \n\n 12 11  0  0  0  0            999 V2000\n    1.7163   -1.1807    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4497   -1.6305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1104   -0.6397    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.2156   -0.5149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1234   -1.7814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1700   -1.2326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1700   -0.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8722   -1.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5977   -1.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9034    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6055   -0.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.6475    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  CHG  2   3  -1  12   1\nM  END",
        "smiles": "C1CCC(CC1)NS(=O)(=O)[O-].[Na+]",
        "formula": "C6H12NO3S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "201.2205",
        "optical_activity": "NONE",
        "references": [
          "d4d4bde1-7626-46cd-aeb1-2a7447e6712c",
          "ea9a020d-3420-4092-8f97-4b898b78199e",
          "f047575d-9045-4806-a228-e52bb15c1265"
        ],
        "stereo_centers": 0
      },
      "unii": "1I6F42RME1"
    }
  ]
}