{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "296e94fb-5713-43dd-8814-76dd02a1a0f2",
          "code": "43121-43-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=43121-43-3",
          "code_system": "CAS",
          "references": [
            "4d42ad30-a581-4609-9072-03366ed4d623",
            "43d4c639-bffc-4bed-9197-3d8ff4707a6e"
          ]
        },
        {
          "uuid": "95888a4e-25a6-47b5-9430-b6329e2fd9f1",
          "code": "C032910",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67032910",
          "code_system": "MESH",
          "references": [
            "4d42ad30-a581-4609-9072-03366ed4d623"
          ]
        },
        {
          "uuid": "79345e56-c42b-4d4a-8b09-8a8336d95915",
          "code": "109901",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4082",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "4d42ad30-a581-4609-9072-03366ed4d623"
          ]
        },
        {
          "uuid": "d334352a-4fca-4bf5-97c7-48ac59429a59",
          "code": "m11024",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11024?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4d42ad30-a581-4609-9072-03366ed4d623"
          ]
        },
        {
          "uuid": "251dffad-a7e2-4332-8a25-5260c3c78f24",
          "code": "39385",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/39385",
          "code_system": "PUBCHEM",
          "references": [
            "4d42ad30-a581-4609-9072-03366ed4d623"
          ]
        },
        {
          "uuid": "52fc1dfe-1a9c-4e8f-9442-78db50442b49",
          "code": "256-103-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.986",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4d42ad30-a581-4609-9072-03366ed4d623"
          ]
        },
        {
          "uuid": "77c45254-990a-49b9-40da-d57693bc89d2",
          "code": "Triadimefon",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Triadimefon",
          "code_system": "WIKIPEDIA",
          "references": [
            "ece6455d-b3f5-39d2-a184-18c5d4e09a6b"
          ]
        },
        {
          "uuid": "29580c52-367e-9ba9-a807-4eb8083923b1",
          "code": "6857",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6857",
          "code_system": "HSDB",
          "references": [
            "b02520fd-7f0e-ccaa-9443-0100e7161345"
          ]
        },
        {
          "uuid": "d20c1567-0d89-1529-b3f6-9c037ed551b6",
          "code": "DTXSID3023897",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3023897",
          "code_system": "EPA CompTox",
          "references": [
            "e958b456-6b99-76c8-b09e-170340918bae"
          ]
        },
        {
          "uuid": "d81f17a7-40d5-44bf-a679-e51c4ee96720",
          "code": "1HW039CJF0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "54b40774-81cb-c392-2377-06dd54777c2f",
          "code": "84002",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:84002",
          "code_system": "CHEBI",
          "references": [
            "1d75456e-90e0-cb55-13d3-409f5f2073c5"
          ]
        },
        {
          "uuid": "2ae0d92f-918b-7f91-a575-80fd9f28a99e",
          "code": "9665",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9665",
          "code_system": "CHEBI",
          "references": [
            "1d75456e-90e0-cb55-13d3-409f5f2073c5"
          ]
        },
        {
          "uuid": "ee81c983-a1ab-a8f9-2a4d-e5e8bdedc181",
          "code": "100000174507",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "995d7c02-438e-e6ea-4946-117a829d9e6b"
          ]
        },
        {
          "uuid": "b085be08-de32-fbf9-a465-dd762c2fde8c",
          "code": "triadimefon",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/triadimefon.html",
          "code_system": "ALANWOOD",
          "references": [
            "e3321f59-0f30-3dcb-72d9-424ddcc7fd50"
          ]
        },
        {
          "uuid": "018b7117-e8fa-d4c7-e687-2461d757a88f",
          "code": "303303",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=303303",
          "code_system": "NSC",
          "references": [
            "7b05e8bd-bec9-cd36-1040-2173b8f53f73"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "888bf891-09e6-4198-9abf-2804ee279859",
          "name": "(±)-TRIADIMEFON",
          "stdName": "(+/-)-TRIADIMEFON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3366a049-c673-4656-a06a-9dcb5c3bb3b1",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "4d03af16-b399-48d4-b8f1-2a8ad11822fe",
          "name": "1-(4-CHLOROPHENOXY)-3,3-DIMETHYL-1-(1H-1,2,4-TRIAZOL-1-YL)-2-BUTANONE",
          "stdName": "1-(4-CHLOROPHENOXY)-3,3-DIMETHYL-1-(1H-1,2,4-TRIAZOL-1-YL)-2-BUTANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57d99378-6c77-4938-898d-a8a35fc5b12f",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "81f076a4-c85a-46ac-920e-a96f0e5100c4",
          "name": "1-(4-CHLOROPHENOXY)-3,3-DIMETHYL-1-(1H-1,2,4-TRIAZOL-1-YL)BUTAN-2-ONE",
          "stdName": "1-(4-CHLOROPHENOXY)-3,3-DIMETHYL-1-(1H-1,2,4-TRIAZOL-1-YL)BUTAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57d99378-6c77-4938-898d-a8a35fc5b12f",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "27b7f373-0712-4a3c-b915-3b0e1ad8d539",
          "name": "2-BUTANONE, 1- (4-CHLOROPHENOXY)-3,3-DIMETHYL-1-(1H-1,2,4-TRIAZOL-1-YL)-",
          "stdName": "2-BUTANONE, 1- (4-CHLOROPHENOXY)-3,3-DIMETHYL-1-(1H-1,2,4-TRIAZOL-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57d99378-6c77-4938-898d-a8a35fc5b12f",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "f47a1e4b-f3cd-4ba5-85f0-0d0465d6de2f",
          "name": "AZOCENE",
          "stdName": "AZOCENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1eee3549-e70e-4894-a671-dac0b9d960f7",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "f8cbce3d-e01a-4fe6-bef8-f55d6fb56d73",
          "name": "BAY 6681 F",
          "stdName": "BAY 6681 F",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57d99378-6c77-4938-898d-a8a35fc5b12f",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "e13a32a1-7cf9-4d52-b693-6ebf8e393eeb",
          "name": "BAYLETON",
          "stdName": "BAYLETON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1eee3549-e70e-4894-a671-dac0b9d960f7",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "89b10cd5-0265-4fc2-ae95-2179672f9b43",
          "name": "FENXIUNIN",
          "stdName": "FENXIUNIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1eee3549-e70e-4894-a671-dac0b9d960f7",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "87897bbf-bc1c-426b-96fe-2f3b2e0544ea",
          "name": "NSC-303303",
          "stdName": "NSC-303303",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58899cd1-e1e9-4619-b931-19927aeb69d9",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "c38c0b8c-ee2d-4fe0-a245-4ee5501a977a",
          "name": "TRIADIMEFON",
          "stdName": "TRIADIMEFON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d9563d-bf45-4e7c-a1a9-613c66ba51e1",
            "f2313ed1-2e8e-4b38-9ce5-857ab2985bcd",
            "f8e44052-1e41-428d-8c32-701ea9593224",
            "e32aa129-c749-4092-a987-e8b7f9328cb8",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12",
            "6c676534-bd9a-4640-a76a-afc0051aa8fb",
            "ef70b283-0f1b-4e2a-9a02-91d0f65acfdb"
          ],
          "display_name": true
        },
        {
          "uuid": "3cbdcbfd-5455-425d-acd8-7714c013ccb9",
          "name": "TRIADIMEFON [HSDB]",
          "stdName": "TRIADIMEFON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e32aa129-c749-4092-a987-e8b7f9328cb8",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "51a9de11-55e5-4c21-aa81-b2d57eff3983",
          "name": "TRIADIMEFON [ISO]",
          "stdName": "TRIADIMEFON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12",
            "ef70b283-0f1b-4e2a-9a02-91d0f65acfdb"
          ],
          "display_name": false
        },
        {
          "uuid": "1243fa15-fcff-4c71-8b83-4b73d9821d4f",
          "name": "TRIADIMEFON [MI]",
          "stdName": "TRIADIMEFON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8e44052-1e41-428d-8c32-701ea9593224",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "24399814-41af-432a-823e-1e8dcb681d28",
          "name": "TRIADIMEFON, (±)-",
          "stdName": "TRIADIMEFON, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3366a049-c673-4656-a06a-9dcb5c3bb3b1",
            "c317e96b-f1f4-4e35-bd7b-4196ced7fa12"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1eee3549-e70e-4894-a671-dac0b9d960f7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c317e96b-f1f4-4e35-bd7b-4196ced7fa12",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58899cd1-e1e9-4619-b931-19927aeb69d9",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8e44052-1e41-428d-8c32-701ea9593224",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3366a049-c673-4656-a06a-9dcb5c3bb3b1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57d99378-6c77-4938-898d-a8a35fc5b12f",
          "citation": "CHEMSPIDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e32aa129-c749-4092-a987-e8b7f9328cb8",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef70b283-0f1b-4e2a-9a02-91d0f65acfdb",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d42ad30-a581-4609-9072-03366ed4d623",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391415000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0570b4e-5953-4eaf-bcd0-2e5ce96b9c06",
          "citation": "SRS import [1HW039CJF0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1HW039CJF0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391415000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2313ed1-2e8e-4b38-9ce5-857ab2985bcd",
          "citation": "TRIADIMEFON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "11d9563d-bf45-4e7c-a1a9-613c66ba51e1",
          "citation": "TRIADIMEFON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6c676534-bd9a-4640-a76a-afc0051aa8fb",
          "citation": "TRIADIMEFON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ece6455d-b3f5-39d2-a184-18c5d4e09a6b",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Triadimefon",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b02520fd-7f0e-ccaa-9443-0100e7161345",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+43121-43-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e958b456-6b99-76c8-b09e-170340918bae",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=43121-43-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "995d7c02-438e-e6ea-4946-117a829d9e6b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e3321f59-0f30-3dcb-72d9-424ddcc7fd50",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "1d75456e-90e0-cb55-13d3-409f5f2073c5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "43d4c639-bffc-4bed-9197-3d8ff4707a6e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7b05e8bd-bec9-cd36-1040-2173b8f53f73",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4516b4b5-7f67-4e63-9773-0994c0a21d1b",
          "id": "4516b4b5-7f67-4e63-9773-0994c0a21d1b",
          "molfile": "\n  Marvin  01132103382D          \n\n 20 21  0  0  0  0            999 V2000\n    6.9401   -8.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6546   -7.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0671   -8.5673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2421   -7.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3690   -7.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3690   -6.6153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0835   -7.8528    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.7980   -7.4403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5125   -7.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2269   -7.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9414   -7.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9414   -8.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6559   -9.0903    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.2269   -9.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5125   -8.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0835   -8.6778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7510   -9.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4960   -9.9473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6710   -9.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4161   -9.1627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 15  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 20  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)C(=O)C(n1cncn1)Oc2ccc(cc2)Cl",
          "formula": "C14H16ClN3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "93e9a934-db45-4d07-9de4-618b125c5c7b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "293.7492",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cacb834a-9acb-43fe-b853-3bb9729f53f5",
      "version": "10",
      "structure": {
        "id": "d164622d-4efd-457a-9b3b-1dbfd43e11c5",
        "molfile": "\n  Marvin  01132110492D          \n\n 20 21  0  0  0  0            999 V2000\n    6.9401   -8.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6546   -7.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0671   -8.5673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2421   -7.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3690   -7.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3690   -6.6153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0835   -7.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7980   -7.4403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5125   -7.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2269   -7.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9414   -7.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9414   -8.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6559   -9.0903    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.2269   -9.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5125   -8.6778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0835   -8.6778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7510   -9.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4960   -9.9473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6710   -9.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4161   -9.1627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n  9 15  1  0  0  0  0\n  7 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 16 20  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)C(=O)C(n1cncn1)Oc2ccc(cc2)Cl",
        "formula": "C14H16ClN3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "293.7492",
        "optical_activity": "( + / - )",
        "references": [
          "57d99378-6c77-4938-898d-a8a35fc5b12f",
          "f0570b4e-5953-4eaf-bcd0-2e5ce96b9c06"
        ],
        "stereo_centers": 1
      },
      "unii": "1HW039CJF0"
    }
  ]
}