{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ba741646-e4cc-4bc9-9303-f7e7cfcd1e24",
          "code": "482-89-3",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=482-89-3",
          "code_system": "CAS",
          "references": [
            "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e",
            "949a4097-a7da-4ef6-b13a-8d009ce09887"
          ]
        },
        {
          "uuid": "0fbf467d-b6de-4743-9b1b-505cad83c82f",
          "code": "64784-13-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=64784-13-0",
          "code_system": "CAS",
          "references": [
            "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e",
            "ff82bcec-151c-4adf-b528-83f22fc3da3a"
          ]
        },
        {
          "uuid": "c5bf4f51-0d74-4c94-8c79-0629dddf19e9",
          "code": "C008114",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67008114",
          "code_system": "MESH",
          "references": [
            "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e"
          ]
        },
        {
          "uuid": "4407be16-03f1-4f6c-9166-375891c200eb",
          "code": "207-586-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.898",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e"
          ]
        },
        {
          "uuid": "9245805e-b1f9-494b-a971-77750986d570",
          "code": "C71644",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71644",
          "code_system": "NCI_THESAURUS",
          "references": [
            "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e"
          ]
        },
        {
          "uuid": "602d08f8-a40b-4fb2-941f-92ac5616f71b",
          "code": "1426889",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426889/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e"
          ]
        },
        {
          "uuid": "f1c19d9b-2c4d-4736-a25c-284b0427ee53",
          "code": "m6251",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6251?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e"
          ]
        },
        {
          "uuid": "5e1adf5b-1636-4315-80ad-4d0724bf7e7f",
          "code": "SUB16081MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e"
          ]
        },
        {
          "uuid": "a2291205-b698-4794-9b82-5ffa0d1f7761",
          "code": "5318432",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5318432",
          "code_system": "PUBCHEM",
          "references": [
            "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e"
          ]
        },
        {
          "uuid": "97b4c3f8-3f42-48ea-ed9d-93833dc44c26",
          "code": "Indigo dye",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Indigo_dye",
          "code_system": "WIKIPEDIA",
          "references": [
            "c8745761-88c0-d1a1-7d87-4e92f4ac7c44"
          ]
        },
        {
          "uuid": "94a28cca-c02b-dbc2-02d7-88b0391cccde",
          "code": "482-89-3",
          "type": "PRIMARY",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+482-89-3",
          "code_system": "HSDB",
          "references": [
            "87afa3ad-4416-6d55-b1ed-77d16809e9a3"
          ]
        },
        {
          "uuid": "fec26db2-76f7-02f2-e8b9-5e9e1a86f0e4",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "457f0a08-e557-8e48-e8f4-76d93e2cafbf"
          ]
        },
        {
          "uuid": "7c39d426-a8dd-4c29-8d46-a15a872484e9",
          "code": "1G5BK41P4F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3eb41481-18f7-aa24-4584-15e0f222b810",
          "code": "DTXSID3026279",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3026279",
          "code_system": "EPA CompTox",
          "references": [
            "ab09018c-dce5-624d-3bc2-c4c402bc19cf"
          ]
        },
        {
          "uuid": "15a1a096-a72b-10a5-793c-a13880866de5",
          "code": "100000076182",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4f2c7617-22ec-787a-198d-6a4d3426c827"
          ]
        },
        {
          "uuid": "ebd39743-0b7c-f92c-7898-33d31fa7c518",
          "code": "8645",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8645",
          "code_system": "NSC",
          "references": [
            "c936a30b-d8ac-534e-bcbb-e74007b9140a"
          ]
        },
        {
          "uuid": "57b83bf6-a71e-1bc2-3f9d-86ed39491c73",
          "code": "1G5BK41P4F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1G5BK41P4F",
          "code_system": "DAILYMED",
          "references": [
            "636ff58e-e47e-5326-0c68-6469d3802a67"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "30bf5d98-fae8-4d5b-aa00-062fb79eee28",
          "name": "(.DELTA.(SUP 2,2')-BIINDOLINE)-3,3'-DIONE",
          "stdName": "(.DELTA.(SUP 2,2')-BIINDOLINE)-3,3'-DIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "247df58e-4ade-47bf-a595-91aeb1da2eec",
            "2dee8f00-b924-4b65-99c9-1e73f18c3dda"
          ],
          "display_name": false
        },
        {
          "uuid": "10c84cca-d400-4b2d-b1e2-1fed9d1f58f8",
          "name": "2,2'-BIINDOLE-3,3'(1H,1'H)-DIONE",
          "stdName": "2,2'-BIINDOLE-3,3'(1H,1'H)-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eeeffa88-fa3e-40f4-8f7c-b5d95fa1aacd",
            "2dee8f00-b924-4b65-99c9-1e73f18c3dda"
          ],
          "display_name": false
        },
        {
          "uuid": "42f016b8-1106-4e7b-b538-7b4a700bfbea",
          "name": "AO201",
          "stdName": "AO201",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "cf41af68-441e-4607-a468-b2a5c48f551d",
            "7326ff2e-ff9a-46a7-9eab-574aea0e960f",
            "acfbac40-951f-440e-9711-bf2e29140307",
            "f40b4697-657b-4043-b6a6-b45f956cde6b",
            "32c7f9e6-cbce-4c80-b8ea-654111ee1137"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f6d607a7-2e63-4e8b-9152-e3ce07468fa4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5fb204f5-ca27-4f40-952e-7eda273f71c0",
          "name": "C.I.73000",
          "stdName": "C.I.73000",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfbac40-951f-440e-9711-bf2e29140307",
            "32c7f9e6-cbce-4c80-b8ea-654111ee1137"
          ],
          "display_name": false
        },
        {
          "uuid": "ae12f710-f999-4e92-98fc-fca0739b8756",
          "name": "CI 73000",
          "stdName": "CI 73000",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "cf41af68-441e-4607-a468-b2a5c48f551d",
            "7326ff2e-ff9a-46a7-9eab-574aea0e960f",
            "894b475a-9fb0-404c-a6db-8ac196116bfa"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "508c37b6-496c-47cd-b23e-98e78e3a0e8e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ed34ce20-ae70-4ba0-8583-576f8f5f3fbd",
          "name": "D&C BLUE NO. 6",
          "stdName": "D&C BLUE NO. 6",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "247df58e-4ade-47bf-a595-91aeb1da2eec",
            "7abc6e06-4263-42a2-8c93-a580fb0401f2"
          ],
          "display_name": false
        },
        {
          "uuid": "b4b5919a-6ae6-4980-8cef-add7635a11f9",
          "name": "D&C BLUE NO. 6 [II]",
          "stdName": "D&C BLUE NO. 6 [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "247df58e-4ade-47bf-a595-91aeb1da2eec"
          ],
          "display_name": false
        },
        {
          "uuid": "660bde97-53a6-4d87-9216-189b19f2665e",
          "name": "INDIGO",
          "stdName": "INDIGO",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a8a3637-432f-410b-8462-3f86fc19bdbe",
            "665957d7-241a-4889-ac7a-c4cecc2c0fa6",
            "fd3021e8-cc7b-4a5c-b7ee-e4cc6323aebb",
            "70401bd2-9627-4ed5-abe8-17ddcd6e8420",
            "20735b8e-7c74-40f8-8a55-fe2e81b80439",
            "7326ff2e-ff9a-46a7-9eab-574aea0e960f",
            "6d6e4488-5c58-4d55-bf38-2c989057eaf4",
            "e1143725-7b31-4d51-aaa4-c9fda66c02b5",
            "87f0c1bb-3488-41d5-b3b2-cccc2ea7d6ff"
          ],
          "display_name": true
        },
        {
          "uuid": "618631d1-1b45-42f1-b343-6f70228ebb7b",
          "name": "INDIGO BLUE",
          "stdName": "INDIGO BLUE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7326ff2e-ff9a-46a7-9eab-574aea0e960f",
            "6d6e4488-5c58-4d55-bf38-2c989057eaf4"
          ],
          "display_name": false
        },
        {
          "uuid": "e80e6a47-a214-4276-ba77-5cfa3c41ff01",
          "name": "INDIGO [HPUS]",
          "stdName": "INDIGO [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70401bd2-9627-4ed5-abe8-17ddcd6e8420",
            "e1143725-7b31-4d51-aaa4-c9fda66c02b5"
          ],
          "display_name": false
        },
        {
          "uuid": "6e5d6429-9107-4aca-90c9-1c03ad660856",
          "name": "INDIGO [HSDB]",
          "stdName": "INDIGO [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7326ff2e-ff9a-46a7-9eab-574aea0e960f",
            "87f0c1bb-3488-41d5-b3b2-cccc2ea7d6ff"
          ],
          "display_name": false
        },
        {
          "uuid": "d477d524-031b-4d13-8b1e-eedbd929d655",
          "name": "INDIGO [MI]",
          "stdName": "INDIGO [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "665957d7-241a-4889-ac7a-c4cecc2c0fa6",
            "7326ff2e-ff9a-46a7-9eab-574aea0e960f"
          ],
          "display_name": false
        },
        {
          "uuid": "509c6c95-53ec-8008-4b8b-b0ec5d119524",
          "name": "INDIGOFERA TINCTORIA LEAF EXTRACT",
          "stdName": "INDIGOFERA TINCTORIA LEAF EXTRACT",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "398f33b5-9370-b9d4-bc1f-177604541726",
            "b8771b63-93cd-6848-e0f1-b761a8625649",
            "f30c89d7-284c-d918-20ec-aacfa2e2c42c",
            "fe7ec34a-0030-2cef-e42f-f028988de9ad"
          ],
          "display_name": false,
          "name_orgs": [
            {
              "uuid": "4b8b59d0-c425-988e-b4a8-4afc33f02178",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a4f01d8f-edfb-439a-a4c4-fd30c859efe0",
          "name": "INDIGOTIN",
          "stdName": "INDIGOTIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7326ff2e-ff9a-46a7-9eab-574aea0e960f",
            "6d6e4488-5c58-4d55-bf38-2c989057eaf4"
          ],
          "display_name": false
        },
        {
          "uuid": "ba44939a-98b6-709f-cee3-626a056b8885",
          "name": "Indigo [WHO-DD]",
          "stdName": "INDIGO [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6dc32e31-5e5c-69bd-8c16-a891b481d15f"
          ],
          "display_name": false
        },
        {
          "uuid": "eb548546-7e96-4b12-8119-c4ae72fb9a19",
          "name": "NSC-8645",
          "stdName": "NSC-8645",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7326ff2e-ff9a-46a7-9eab-574aea0e960f",
            "4284d2b4-36d4-41bf-afa5-47f3a4b3d55f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6d6e4488-5c58-4d55-bf38-2c989057eaf4",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7326ff2e-ff9a-46a7-9eab-574aea0e960f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32c7f9e6-cbce-4c80-b8ea-654111ee1137",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acfbac40-951f-440e-9711-bf2e29140307",
          "citation": "CTFA 2004",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2dee8f00-b924-4b65-99c9-1e73f18c3dda",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "247df58e-4ade-47bf-a595-91aeb1da2eec",
          "citation": "21CFR74.3106",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eeeffa88-fa3e-40f4-8f7c-b5d95fa1aacd",
          "citation": "ACD 9.0(21CFR74.3106",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70401bd2-9627-4ed5-abe8-17ddcd6e8420",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1143725-7b31-4d51-aaa4-c9fda66c02b5",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "665957d7-241a-4889-ac7a-c4cecc2c0fa6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87f0c1bb-3488-41d5-b3b2-cccc2ea7d6ff",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf41af68-441e-4607-a468-b2a5c48f551d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4284d2b4-36d4-41bf-afa5-47f3a4b3d55f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "537ee1cc-8e0f-43b9-aacb-23a3f8d4fa3e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390166000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5883b907-cc3a-4b3b-a028-6f1e74d1ab2d",
          "citation": "SRS import [1G5BK41P4F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1G5BK41P4F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390166000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20735b8e-7c74-40f8-8a55-fe2e81b80439",
          "citation": "INDIGO [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7a8a3637-432f-410b-8462-3f86fc19bdbe",
          "citation": "INDIGO [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7abc6e06-4263-42a2-8c93-a580fb0401f2",
          "citation": "D&C BLUE NO. 6 [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fd3021e8-cc7b-4a5c-b7ee-e4cc6323aebb",
          "citation": "INDIGO [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f40b4697-657b-4043-b6a6-b45f956cde6b",
          "citation": "AO201 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "894b475a-9fb0-404c-a6db-8ac196116bfa",
          "citation": "CI 73000 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "87afa3ad-4416-6d55-b1ed-77d16809e9a3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+482-89-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e8e54275-83a4-16ec-f36f-3a3e9d1db3c1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=482-89-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4f2c7617-22ec-787a-198d-6a4d3426c827",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "457f0a08-e557-8e48-e8f4-76d93e2cafbf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0c36da41-4e3f-d2c6-97c2-a8591d2ba860",
          "citation": "WHO DRUG DICTIONARY 2019",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "949a4097-a7da-4ef6-b13a-8d009ce09887",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ff82bcec-151c-4adf-b528-83f22fc3da3a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c8745761-88c0-d1a1-7d87-4e92f4ac7c44",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "636ff58e-e47e-5326-0c68-6469d3802a67",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c936a30b-d8ac-534e-bcbb-e74007b9140a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6dc32e31-5e5c-69bd-8c16-a891b481d15f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ab09018c-dce5-624d-3bc2-c4c402bc19cf",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "b8771b63-93cd-6848-e0f1-b761a8625649",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "398f33b5-9370-b9d4-bc1f-177604541726",
          "citation": "INCI",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f30c89d7-284c-d918-20ec-aacfa2e2c42c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe7ec34a-0030-2cef-e42f-f028988de9ad",
          "citation": "INDIGOFERA TINCTORIA LEAF EXTRACT [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "23a21eb3-c202-4480-bed0-d86fb1345a9b",
          "id": "23a21eb3-c202-4480-bed0-d86fb1345a9b",
          "molfile": "\n  Marvin  01132101592D          \n\n 20 23  0  0  0  0            999 V2000\n    5.4042  -10.1501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4110   -9.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9247   -8.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4030   -7.9881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1892   -8.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9037   -7.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6157   -8.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6157   -9.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9037   -9.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1963   -9.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0989   -8.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6351   -9.3656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8426   -9.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1037   -9.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3917   -9.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3917   -8.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1037   -7.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8157   -8.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5923   -8.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5875   -7.2084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n 10  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 11  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 19  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(c(C3=Nc4ccccc4C3=O)[nH]2)O",
          "formula": "C16H10N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1a6665a2-a21b-4bff-b96f-ef6ded911c82"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "262.2634",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b969fbc6-d424-4b12-8822-8014cd76881c",
      "version": "21",
      "structure": {
        "id": "009dbcca-9fdf-4494-b7a5-4aac1ded2f94",
        "molfile": "\n  Marvin  01132100202D          \n\n 20 23  0  0  0  0            999 V2000\n    5.4030   -7.9881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1892   -8.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1963   -9.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4110   -9.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9247   -8.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9037   -7.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6157   -8.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6157   -9.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9037   -9.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4042  -10.1501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0989   -8.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5923   -8.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8157   -8.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8426   -9.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6351   -9.3656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3917   -8.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3917   -9.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1037   -9.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1037   -7.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5875   -7.2084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  9  1  0  0  0  0\n  2  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  4 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 19  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 14  1  0  0  0  0\n 13 19  1  0  0  0  0\n 12 20  2  0  0  0  0\n 11  5  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)/C(=C\\3/C(=O)c4ccccc4N3)/N2",
        "formula": "C16H10N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "262.2634",
        "optical_activity": "NONE",
        "references": [
          "247df58e-4ade-47bf-a595-91aeb1da2eec",
          "5883b907-cc3a-4b3b-a028-6f1e74d1ab2d"
        ],
        "stereo_centers": 0
      },
      "modifications": {
        "uuid": "7566109d-70cc-4afa-89db-6afe830af5e7"
      },
      "unii": "1G5BK41P4F"
    }
  ]
}