{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "29b6d585-d69d-43fe-bd30-d2ec51ef5684",
          "code": "1187627-98-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1187627-98-0",
          "code_system": "CAS",
          "references": [
            "315d8bae-6dfa-4f3e-a8aa-e675b2e7d536",
            "fbd24017-edce-40d9-9d66-4b21b63b9e07"
          ]
        },
        {
          "uuid": "8226507c-b66f-48a1-9780-798d05e67f62",
          "code": "852379-28-3",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=852379-28-3",
          "code_system": "CAS",
          "references": [
            "315d8bae-6dfa-4f3e-a8aa-e675b2e7d536",
            "b8e83df1-72eb-4113-b12b-1005b153d38a"
          ]
        },
        {
          "uuid": "196e18b4-4a74-4ee4-bb02-fde2a477b21c",
          "code": "44467796",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44467796",
          "code_system": "PUBCHEM",
          "references": [
            "315d8bae-6dfa-4f3e-a8aa-e675b2e7d536"
          ]
        },
        {
          "uuid": "3c4ede81-ceb2-198c-a199-84dacc25a204",
          "code": "DTXSID90152229",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90152229",
          "code_system": "EPA CompTox",
          "references": [
            "c204bd73-73bd-ef90-e234-9463e7795973"
          ]
        },
        {
          "uuid": "cc3227a5-2ef2-429e-a0fa-9d4e8684e4da",
          "code": "1G0T9SG12U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7809c5bc-c4bd-5804-b831-25deb886b106",
          "code": "1987",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1987/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "11a8ba52-c469-ca57-8a7c-f2bfca97afbc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "182646b6-2981-49b9-acbd-9ab56835f65c",
          "name": "CYANOMETHYLPHENYL MENTHANE CARBOXAMIDE",
          "stdName": "CYANOMETHYLPHENYL MENTHANE CARBOXAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "5472d099-a61e-4906-82af-44d89d38f7e6",
            "69e39289-d4a9-4e41-a6cd-ae56d7e892b4",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e2d61a7c-8706-4b75-8f67-0d3bbde61a1f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9ca94d45-d33d-419a-9180-b6a9c9d7683e",
          "name": "CYCLOHEXANECARBOXAMIDE, N-(4-(CYANOMETHYL)PHENYL)-5-METHYL-2-(1-METHYLETHYL)-, (1R,2S,5R)-",
          "stdName": "CYCLOHEXANECARBOXAMIDE, N-(4-(CYANOMETHYL)PHENYL)-5-METHYL-2-(1-METHYLETHYL)-, (1R,2S,5R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "960137d3-0775-4394-b0d0-576377d3859e",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false
        },
        {
          "uuid": "57625ebe-1933-4b15-878c-eb312bd77013",
          "name": "EVERCOOL 180",
          "stdName": "EVERCOOL 180",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "960137d3-0775-4394-b0d0-576377d3859e",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false
        },
        {
          "uuid": "35fab94d-5e8b-49be-a8b6-92561dfe4125",
          "name": "EVERCOOL G-180",
          "stdName": "EVERCOOL G-180",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e7dfeb4-2db5-4e12-b943-5504da632ba1",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false
        },
        {
          "uuid": "453c3b88-4fd2-4d5f-b766-1955e12e95d5",
          "name": "FEMA NO. 4496",
          "stdName": "FEMA NO. 4496",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb1d2a82-1711-4b4d-b642-a3bc03c4f89f",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false
        },
        {
          "uuid": "a4d542eb-6128-4df6-a959-e98a5effab55",
          "name": "G-180",
          "stdName": "G-180",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e7dfeb4-2db5-4e12-b943-5504da632ba1",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false
        },
        {
          "uuid": "ab1a3e26-9ee8-4a11-aadf-ace545613c1b",
          "name": "N-(P-BENZENEACETONITRILE)MENTHANECARBOXAMIDE",
          "stdName": "N-(P-BENZENEACETONITRILE)MENTHANECARBOXAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fa209a1-24d6-4c80-b116-464bb5e2c20f",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false
        },
        {
          "uuid": "c878ac39-a8c3-41fe-8de4-44185c6b8b96",
          "name": "N-P-BENZENEACETONITRILE MENTHANECARBOXAMIDE",
          "stdName": "N-P-BENZENEACETONITRILE MENTHANECARBOXAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92537c6d-ecae-45d3-abb6-b8e260fe4119",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": true
        },
        {
          "uuid": "d5d3d951-3458-430c-9fbc-d9d1e29f1545",
          "name": "N-P-BENZENEACETONITRILE MENTHANECARBOXAMIDE, (-)-",
          "stdName": "N-P-BENZENEACETONITRILE MENTHANECARBOXAMIDE, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "841fcd68-63df-41ac-84f4-d4517058d9e2",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false
        },
        {
          "uuid": "189544d1-9076-4477-a659-09d2fb0067a4",
          "name": "N-P-BENZENEACETONITRILE MENTHANECARBOXAMIDE, (1R,3R,4S)-",
          "stdName": "N-P-BENZENEACETONITRILE MENTHANECARBOXAMIDE, (1R,3R,4S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "841fcd68-63df-41ac-84f4-d4517058d9e2",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false
        },
        {
          "uuid": "a4a76d9c-1230-484b-ae37-7f1e0dde28b0",
          "name": "N-PARA-BENZENE ACETONITRILE MENTHANE CARBOXAMIDE",
          "stdName": "N-PARA-BENZENE ACETONITRILE MENTHANE CARBOXAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb1d2a82-1711-4b4d-b642-a3bc03c4f89f",
            "23e3992d-282c-4b2a-91c0-d6de4f815bb7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "92537c6d-ecae-45d3-abb6-b8e260fe4119",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "23e3992d-282c-4b2a-91c0-d6de4f815bb7",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "960137d3-0775-4394-b0d0-576377d3859e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "841fcd68-63df-41ac-84f4-d4517058d9e2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb1d2a82-1711-4b4d-b642-a3bc03c4f89f",
          "citation": "http://www.thegoodscentscompany.com/data/rw1597441.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1597441.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fa209a1-24d6-4c80-b116-464bb5e2c20f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69e39289-d4a9-4e41-a6cd-ae56d7e892b4",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e7dfeb4-2db5-4e12-b943-5504da632ba1",
          "citation": "http://leffingwell.com/cooler_than_menthol.htm",
          "url": "http://leffingwell.com/cooler_than_menthol.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "315d8bae-6dfa-4f3e-a8aa-e675b2e7d536",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391497000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2e9ca0e-a5c2-4a3a-bdf6-742e21d690ee",
          "citation": "SRS import [1G0T9SG12U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1G0T9SG12U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391497000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5472d099-a61e-4906-82af-44d89d38f7e6",
          "citation": "CYANOMETHYLPHENYL MENTHANE CARBOXAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c204bd73-73bd-ef90-e234-9463e7795973",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1187627-98-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fbd24017-edce-40d9-9d66-4b21b63b9e07",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b8e83df1-72eb-4113-b12b-1005b153d38a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "11a8ba52-c469-ca57-8a7c-f2bfca97afbc",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "98478bcc-09a4-4fb6-95d1-34fcde257f17",
          "id": "98478bcc-09a4-4fb6-95d1-34fcde257f17",
          "molfile": "\n  Marvin  01132107542D          \n\n 22 23  0  0  1  0            999 V2000\n    7.8373   -4.0789    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.5518   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8373   -4.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1229   -5.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4084   -4.9039    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.6939   -5.3164    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.9795   -4.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6939   -6.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4084   -4.0789    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1229   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6939   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6939   -2.8414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9795   -4.0788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2650   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5505   -4.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8361   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8361   -2.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1216   -2.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4071   -2.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6926   -3.2538    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5505   -2.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2650   -2.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  6  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 22  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 21 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  3  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)Nc2ccc(cc2)CC#N",
          "formula": "C19H26N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1467a2ab-320e-43c6-86e6-dde8573245e1"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "298.4233",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a124ea79-a6f6-4305-aef2-01a67ff00223",
      "version": "6",
      "structure": {
        "id": "3da8f779-8d47-4d0d-83b2-c27460c08f95",
        "molfile": "\n  Marvin  01132103162D          \n\n 22 23  0  0  1  0            999 V2000\n    2.8361   -2.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1216   -2.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4071   -2.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6926   -3.2538    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8361   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5505   -4.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2650   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9795   -4.0788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6939   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4084   -4.0789    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4084   -4.9039    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.6939   -5.3164    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.9795   -4.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6939   -6.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1229   -5.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8373   -4.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8373   -4.0789    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5518   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1229   -3.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6939   -2.8414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2650   -2.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5505   -2.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  3  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  6  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 19 10  1  0  0  0  0\n  9 20  2  0  0  0  0\n  7 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22  1  2  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)Nc2ccc(cc2)CC#N",
        "formula": "C19H26N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "298.4233",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "960137d3-0775-4394-b0d0-576377d3859e",
          "e2e9ca0e-a5c2-4a3a-bdf6-742e21d690ee"
        ],
        "stereo_centers": 3
      },
      "unii": "1G0T9SG12U"
    }
  ]
}