{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "501c36b2-38ac-451a-a23a-fe79f0d31b32",
          "code": "C29075",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29075",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b959e2f2-9a82-48a3-bc4b-7b03d651b4f9"
          ]
        },
        {
          "uuid": "81502f22-2a63-4a6c-8610-d207cbca3de3",
          "code": "29031-19-4",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=29031-19-4",
          "code_system": "CAS",
          "references": [
            "b959e2f2-9a82-48a3-bc4b-7b03d651b4f9",
            "07265efc-3b13-4c60-b559-7355eb0db5a9"
          ]
        },
        {
          "uuid": "79d230b3-f00d-47ec-a348-c579fa1e75d2",
          "code": "14999-43-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14999-43-0",
          "code_system": "CAS",
          "references": [
            "b959e2f2-9a82-48a3-bc4b-7b03d651b4f9",
            "9eda4a8c-6ca2-4a5d-bdb5-7c607e4022c4"
          ]
        },
        {
          "uuid": "0b965fa5-6e4e-43f2-9571-531edf36c45b",
          "code": "239-088-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.520",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b959e2f2-9a82-48a3-bc4b-7b03d651b4f9"
          ]
        },
        {
          "uuid": "9362ada9-6e0d-4c33-b1d3-9165db69e04c",
          "code": "4847",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4847/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b959e2f2-9a82-48a3-bc4b-7b03d651b4f9"
          ]
        },
        {
          "uuid": "02de0fac-4706-43cd-afa0-02e84bc8fbc7",
          "code": "m5764",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5764?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b959e2f2-9a82-48a3-bc4b-7b03d651b4f9"
          ]
        },
        {
          "uuid": "2a206bb1-3e07-4ea6-b92a-c0961a5a3a3f",
          "code": "SUB02356MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b959e2f2-9a82-48a3-bc4b-7b03d651b4f9"
          ]
        },
        {
          "uuid": "7fbe06ab-9404-405a-a03a-21348b1c69cd",
          "code": "249-379-6",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.876",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b959e2f2-9a82-48a3-bc4b-7b03d651b4f9"
          ]
        },
        {
          "uuid": "61aa3138-1ee9-31ed-7233-07b23a10721e",
          "code": "Glucosamine sulfate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Glucosamine_sulfate",
          "code_system": "WIKIPEDIA",
          "references": [
            "d10dc47e-2740-14d5-f4a0-524ade8e4f40"
          ]
        },
        {
          "uuid": "dbded9f4-6a41-d9e3-a5d1-b5518646378f",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5106b107-92e2-077c-998a-eda9a32841bb"
          ]
        },
        {
          "uuid": "6ffef379-6432-9ded-67af-6eb58e13749f",
          "code": "74 (Number of products:671)",
          "comments": "Dietary Supplement Label Database|Chemical|Glucosamine Sulfate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=74&item=Glucosamine Sulfate",
          "code_system": "DSLD",
          "references": [
            "5106b107-92e2-077c-998a-eda9a32841bb"
          ]
        },
        {
          "uuid": "6295b01f-83e2-8fb8-4caa-0c167c8b0644",
          "code": "DBSALT001596",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT001596",
          "code_system": "DRUG BANK",
          "references": [
            "5106b107-92e2-077c-998a-eda9a32841bb"
          ]
        },
        {
          "uuid": "dd10fc95-d0a3-4801-bfe8-97dc7c673660",
          "code": "1FW7WLR731",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6b677411-489d-cc6a-ca9d-283a6a177b86",
          "code": "21155887",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21155887",
          "code_system": "PUBCHEM",
          "references": [
            "a6fde5b8-6240-5e1e-7c3a-67e990b0aa2f"
          ]
        },
        {
          "uuid": "71e108d9-7b34-f7e5-77e8-876e4282cedc",
          "code": "100000093045",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "77bcd148-2157-5875-a9fa-60f2d271ec60"
          ]
        },
        {
          "uuid": "28e48676-68e5-ea69-0029-66a6669f436d",
          "code": "DTXSID10933830",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10933830",
          "code_system": "EPA CompTox",
          "references": [
            "fae525e0-f9be-ce06-6bd1-aa3e85ab45d0"
          ]
        },
        {
          "uuid": "b7b443c9-fe75-7573-9312-49faad9e0b1b",
          "code": "1FW7WLR731",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1FW7WLR731",
          "code_system": "DAILYMED",
          "references": [
            "21c34b76-4589-29cf-35b8-7a3aeca5f5d6"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d901fd3c-669b-475d-95e9-082c6f37bd98",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "27a32b32-3c1f-4a0f-94bd-f4f6a68e82e7",
            "refuuid": "2cec419b-f063-4993-a7a6-3b252fe501c6",
            "name": "GLUCOSAMINE",
            "unii": "N08U5BOQ1K",
            "linking_id": "N08U5BOQ1K",
            "ref_pname": "GLUCOSAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8d9c4925-1ecc-43fa-be3c-01ed8a989e34",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "e131bd6c-cb4b-4f61-a8e8-3b93e2c8b912",
            "refuuid": "e7a885cf-4d62-4561-a507-13d0ad56c86d",
            "name": ".BETA.-GLUCOSAMINE, D-",
            "unii": "58L064K8RR",
            "linking_id": "58L064K8RR",
            "ref_pname": ".BETA.-GLUCOSAMINE, D-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6a78dd60-37fa-49e5-bf08-d9fb2c439d98",
          "name": "(2R,3R,4S,5R)-2-AMINO-3,4,5,6-TETRAHYDROXYHEXANAL HEMISULFATE",
          "stdName": "(2R,3R,4S,5R)-2-AMINO-3,4,5,6-TETRAHYDROXYHEXANAL HEMISULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c33d2c7-b6bc-4d89-96f3-63db9268d5bf"
          ],
          "display_name": false
        },
        {
          "uuid": "982976b3-6cd2-486c-9942-fb21e9a73cb1",
          "name": "(3R,4R,5S,6R)-3-AMINO-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2,4,5-TRIOL HEMISULFATE",
          "stdName": "(3R,4R,5S,6R)-3-AMINO-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2,4,5-TRIOL HEMISULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c33d2c7-b6bc-4d89-96f3-63db9268d5bf"
          ],
          "display_name": false
        },
        {
          "uuid": "04cf7487-d7b6-4b3d-b865-76e11eaaa423",
          "name": "BIS(D-GLUCOSE, 2-AMINO-2-DEOXY-), SULFATE",
          "stdName": "BIS(D-GLUCOSE, 2-AMINO-2-DEOXY-), SULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "213f8b22-659a-4a49-944a-32bf0f0491f6"
          ],
          "display_name": false
        },
        {
          "uuid": "e519fc40-1bf4-42f4-b862-1ae07a1eb182",
          "name": "BIS(D-GLUCOSE, 2-AMINO-2-DEOXY-), SULPHATE",
          "stdName": "BIS(D-GLUCOSE, 2-AMINO-2-DEOXY-), SULPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de3056e5-5f68-4fb4-8aa5-dcb258bcd65a"
          ],
          "display_name": false
        },
        {
          "uuid": "bf501f96-9839-406d-807d-619f54f8a6cd",
          "name": "D-GLUCOSAMINE SULFATE",
          "stdName": "D-GLUCOSAMINE SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12a18446-6028-4bc4-8c6a-6d23524efd91"
          ],
          "display_name": false
        },
        {
          "uuid": "045f7531-bda4-4198-bb3b-d4dc7de164c6",
          "name": "D-GLUCOSE, 2-AMINO-2-DEOXY-, SULFATE (2:1)",
          "stdName": "D-GLUCOSE, 2-AMINO-2-DEOXY-, SULFATE (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12a18446-6028-4bc4-8c6a-6d23524efd91"
          ],
          "display_name": false
        },
        {
          "uuid": "b3c7e0fa-3ef4-4387-a0cc-6d0e7b29a1a6",
          "name": "D-GLUCOSE, 2-AMINO-2-DEOXY-, SULFATE (2:1) (SALT)",
          "stdName": "D-GLUCOSE, 2-AMINO-2-DEOXY-, SULFATE (2:1) (SALT)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12a18446-6028-4bc4-8c6a-6d23524efd91"
          ],
          "display_name": false
        },
        {
          "uuid": "8743cd3c-ea3d-025f-2352-0fc96761ece2",
          "name": "DONA",
          "stdName": "DONA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a4d10a5-f48b-9d99-9f7a-60984048ef89"
          ],
          "display_name": false
        },
        {
          "uuid": "1653ba8a-08e4-36d1-33e4-3326e920724d",
          "name": "FAXIMIN",
          "stdName": "FAXIMIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a4d10a5-f48b-9d99-9f7a-60984048ef89"
          ],
          "display_name": false
        },
        {
          "uuid": "7eb1c5bd-bec6-4ce1-89df-4d4ad9aee5c1",
          "name": "GLUCOSAMINE SULFATE",
          "stdName": "GLUCOSAMINE SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc77c3a-1ca9-49b7-b9b0-a5d6d1f3c954",
            "dd635db8-01ec-4c31-af8c-47b11bb018f9",
            "60c3a900-041f-49c1-b35b-b7c194b25509",
            "28214fbc-bc29-496f-960b-67e90ee55ed5",
            "fb6b8b0e-527e-46f3-80b7-0ec6f6493190"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b29f4d0a-3cff-42b5-8cfd-d4c55e0d23e6",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ebc5c394-fce8-4a9b-8f02-b4a4cf6facab",
          "name": "GLUCOSAMINE SULFATE SALT",
          "stdName": "GLUCOSAMINE SULFATE SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80654665-2c5d-4f86-9a7f-b4e53043755e",
            "0d1142e7-0934-4a39-a4ec-6c5370c16eda"
          ],
          "display_name": false
        },
        {
          "uuid": "e2a59f5e-753e-4985-a2a7-a15403d55315",
          "name": "GLUCOSAMINE SULFATE SALT [MI]",
          "stdName": "GLUCOSAMINE SULFATE SALT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80654665-2c5d-4f86-9a7f-b4e53043755e"
          ],
          "display_name": false
        },
        {
          "uuid": "813a94e9-89a2-41b5-ab20-5165853b00e2",
          "name": "GLUCOSAMINE SULPHATE",
          "stdName": "GLUCOSAMINE SULPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de3056e5-5f68-4fb4-8aa5-dcb258bcd65a"
          ],
          "display_name": false
        },
        {
          "uuid": "56a317c1-d914-884c-4986-495be2969d4f",
          "name": "Glucosamine sulfate [WHO-DD]",
          "stdName": "GLUCOSAMINE SULFATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0ca220e-245f-8a59-b80f-e9e021f575da"
          ],
          "display_name": false
        },
        {
          "uuid": "11765039-a43d-4b2c-8578-3512d93f33d3",
          "name": "TIOCONDRAMINA",
          "stdName": "TIOCONDRAMINA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12a18446-6028-4bc4-8c6a-6d23524efd91"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b959e2f2-9a82-48a3-bc4b-7b03d651b4f9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390469000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31b3d96f-e529-476d-a0dc-6b6037b385f1",
          "citation": "SRS import [1FW7WLR731]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1FW7WLR731",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390469000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb6b8b0e-527e-46f3-80b7-0ec6f6493190",
          "citation": "GLUCOSAMINE SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dd635db8-01ec-4c31-af8c-47b11bb018f9",
          "citation": "GLUCOSAMINE SULFATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0d1142e7-0934-4a39-a4ec-6c5370c16eda",
          "citation": "GLUCOSAMINE SULFATE SALT [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "60c3a900-041f-49c1-b35b-b7c194b25509",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "213f8b22-659a-4a49-944a-32bf0f0491f6",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de3056e5-5f68-4fb4-8aa5-dcb258bcd65a",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28214fbc-bc29-496f-960b-67e90ee55ed5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fc77c3a-1ca9-49b7-b9b0-a5d6d1f3c954",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80654665-2c5d-4f86-9a7f-b4e53043755e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12a18446-6028-4bc4-8c6a-6d23524efd91",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c33d2c7-b6bc-4d89-96f3-63db9268d5bf",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d10dc47e-2740-14d5-f4a0-524ade8e4f40",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Glucosamine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6a4d10a5-f48b-9d99-9f7a-60984048ef89",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "77bcd148-2157-5875-a9fa-60f2d271ec60",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5106b107-92e2-077c-998a-eda9a32841bb",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9eda4a8c-6ca2-4a5d-bdb5-7c607e4022c4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "07265efc-3b13-4c60-b559-7355eb0db5a9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a6fde5b8-6240-5e1e-7c3a-67e990b0aa2f",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "21c34b76-4589-29cf-35b8-7a3aeca5f5d6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e0ca220e-245f-8a59-b80f-e9e021f575da",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "fae525e0-f9be-ce06-6bd1-aa3e85ab45d0",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "13e37fdf-f4ac-4a95-b9d9-f70ec9e6a960",
          "id": "13e37fdf-f4ac-4a95-b9d9-f70ec9e6a960",
          "molfile": "\n  Marvin  01132101142D          \n\n  5  4  0  0  1  0            999 V2000\n    8.3428   -5.2170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1678   -5.2170    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9928   -5.2170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1678   -4.3920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1678   -6.0419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2875ae83-cd53-48d5-9ec1-20cb6ec3e0e1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9bb4c579-5409-46ee-ac6a-1a890a22848b",
          "id": "9bb4c579-5409-46ee-ac6a-1a890a22848b",
          "molfile": "\n  Marvin  01132108052D          \n\n 12 11  0  0  1  0            999 V2000\n    6.1635   -5.2650    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.1635   -4.4400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8780   -5.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8780   -6.5026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4491   -5.6776    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.4491   -6.5026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7346   -5.2650    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.7346   -4.4400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0201   -5.6776    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.0201   -6.5026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3057   -5.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5912   -5.6776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)N",
          "formula": "C6H13NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "b736bcb4-0d4c-46f3-b543-8b77917a0346"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "179.1714",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2d4248f4-6f33-4b46-9b4f-88dfbebfa65b",
      "version": "20",
      "structure": {
        "id": "2f0522ce-d376-41e4-8a45-e954a913b5a7",
        "molfile": "\n  Marvin  01132102322D          \n\n 29 26  0  0  1  0            999 V2000\n   18.5398   -3.8727    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5398   -3.0477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5398   -4.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7148   -3.8727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3648   -3.8727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9632   -4.3334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6777   -3.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3921   -4.3334    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.1066   -3.9208    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.8211   -4.3334    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.5355   -3.9208    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.2500   -4.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2500   -5.1584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5355   -3.0958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8211   -5.1584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1066   -3.0958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3921   -5.1584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9632   -4.3334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6777   -3.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3921   -4.3334    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.1066   -3.9208    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.8211   -4.3334    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.5355   -3.9208    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.2500   -4.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2500   -5.1584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5355   -3.0958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8211   -5.1584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1066   -3.0958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3921   -5.1584    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 10 15  1  1  0  0  0\n  9 16  1  1  0  0  0\n  8 17  1  6  0  0  0\n  1  5  1  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 11 14  1  1  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 29  1  6  0  0  0\n 20 21  1  0  0  0  0\n 21 28  1  1  0  0  0\n 21 22  1  0  0  0  0\n 22 27  1  1  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 26  1  1  0  0  0\n 24 25  2  0  0  0  0\nM  STY  1   1 MUL\nM  SAL   1 15   6   7   8   9  10  11  12  13  14  15  16  17  18  19  20\nM  SAL   1  9  21  22  23  24  25  26  27  28  29\nM  SPA   1 12   6   7   8   9  10  11  12  13  14  15  16  17\nM  SDI   1  4   11.5432   -5.5784   11.5432   -2.6758\nM  SDI   1  4   16.6700   -2.6758   16.6700   -5.5784\nM  SMT   1 2\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)N.C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)N.OS(=O)(=O)O",
        "formula": "2C6H13NO5.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "456.4223",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "31b3d96f-e529-476d-a0dc-6b6037b385f1",
          "80654665-2c5d-4f86-9a7f-b4e53043755e"
        ],
        "stereo_centers": 8
      },
      "unii": "1FW7WLR731"
    }
  ]
}