{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "edc373e6-ae83-4698-abd3-b8ad74950a44", "code": "5160-02-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=5160-02-1", "code_system": "CAS", "references": [ "8d056265-53e9-4ecc-9f2c-20ae9fb0de2c", "67a6a1ae-249b-4fee-91e7-0eca6f63891f" ] }, { "uuid": "67a313ae-b42f-4a9e-ab55-1deb243b8f47", "code": "C77195", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77195", "code_system": "NCI_THESAURUS", "references": [ "8d056265-53e9-4ecc-9f2c-20ae9fb0de2c" ] }, { "uuid": "b2bd2876-fd20-4932-94bd-febc061b17ba", "code": "225-935-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.578", "code_system": "ECHA (EC/EINECS)", "references": [ "8d056265-53e9-4ecc-9f2c-20ae9fb0de2c" ] }, { "uuid": "a0fe274b-6fd2-2852-f482-1ba69695b49d", "code": "4138", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4138", "code_system": "HSDB", "references": [ "6d25431d-5f78-fe0c-699f-0a6ad4cc4398" ] }, { "uuid": "e7e5d5cf-9eda-dd81-baa8-7dd0bf05cd25", "code": "DTXSID3021229", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3021229", "code_system": "EPA CompTox", "references": [ "63b286e3-6dd2-ecfc-11ab-14e3f8cef8fe" ] }, { "uuid": "28b712ec-44c9-74fc-92c0-f7dcbed52b44", "code": "C461", "comments": "Industrial Aid[C45678]|Dye", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461", "code_system": "NCI_THESAURUS", "references": [ "7d9e2135-3566-a07d-7558-16ba14b1c760" ] }, { "uuid": "a5277db5-ec07-4f59-a1ac-3f24db7ff280", "code": "1FO1ZO92Y1", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "a366861b-11d0-45e1-acec-6171d027428b", "name": "5-CHLORO-2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-4-METHYLBENZENESULFONIC ACID, BARIUM SALT(2:1)", "stdName": "5-CHLORO-2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-4-METHYLBENZENESULFONIC ACID, BARIUM SALT(2:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "91ade216-f220-4467-b3fc-1d22a694cb21", "99947559-a48f-4b9b-a6b7-be330f867691" ], "display_name": false }, { "uuid": "c9bf2daf-835c-466c-bae7-e72e75ccb4fa", "name": "AKA204", "stdName": "AKA204", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "91ade216-f220-4467-b3fc-1d22a694cb21", "0eb3fc29-7404-46c4-9785-26158b138b1b", "99947559-a48f-4b9b-a6b7-be330f867691" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "618e3519-1676-43e7-b2ef-df2b76b26d4a", "name_org": "INCI" } ] }, { "uuid": "8e0e1432-c49c-42b0-bc53-a49f945a23eb", "name": "BRIGHT RED", "stdName": "BRIGHT RED", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "337b9e2c-bdd5-4cd9-8232-a8432874efce", "99947559-a48f-4b9b-a6b7-be330f867691" ], "display_name": false }, { "uuid": "e6c3fdda-06b2-4c6c-a4b3-2fce0f6c8434", "name": "BRILLIANT RED", "stdName": "BRILLIANT RED", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "337b9e2c-bdd5-4cd9-8232-a8432874efce", "99947559-a48f-4b9b-a6b7-be330f867691" ], "display_name": true }, { "uuid": "16b0575b-f063-4af7-b86e-8ee182a3eba1", "name": "C.I. PIGMENT RED 53 [HSDB]", "stdName": "C.I. PIGMENT RED 53 [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d91e9fe1-ba9c-41e4-9e29-0ece12004a75", "99947559-a48f-4b9b-a6b7-be330f867691" ], "display_name": false }, { "uuid": "a0e01369-af50-4115-b83e-33dba52152c2", "name": "C.I. PIGMENT RED 53:1", "stdName": "C.I. PIGMENT RED 53:1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "26677586-d7e1-4dd8-803e-ee45492e3f1f", "99947559-a48f-4b9b-a6b7-be330f867691" ], "display_name": false }, { "uuid": "89921a44-a99d-4ccf-8e5b-802319f4d77d", "name": "D&C RED NO. 9 (DELISTED)", "stdName": "D&C RED NO. 9 (DELISTED)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7da32eec-1748-44c3-94a7-9f63f383f9a2", "99947559-a48f-4b9b-a6b7-be330f867691" ], "display_name": false }, { "uuid": "484fd67d-1521-6b86-97d5-b10dac2be117", "name": "D&C RED NO. 9 [IARC]", "stdName": "D&C RED NO. 9 [IARC]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f2afcb16-97d9-4c9f-074d-443757372456" ], "display_name": false }, { "uuid": "37b0790f-a2e6-4266-a108-c5f33262abf6", "name": "PIGMENT RED 53:1", "stdName": "PIGMENT RED 53:1", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "25a07c89-e34e-4e9e-b614-6d679a15e3c4", "38b6a17f-65b3-461a-805f-abd09512ce7d", "91ade216-f220-4467-b3fc-1d22a694cb21", "668647a7-47d8-4170-9bdb-7e1fc13665b9", "99947559-a48f-4b9b-a6b7-be330f867691" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "368a3cfc-941d-4997-901a-ecb20993c540", "name_org": "INCI" } ] } ], "references": [ { "uuid": "91ade216-f220-4467-b3fc-1d22a694cb21", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "25a07c89-e34e-4e9e-b614-6d679a15e3c4", "citation": "CTFA 2004", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4021bc23-7959-44a9-9a6f-e4ec2b3539e3", "citation": "CTFA", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4c7d6c23-c0ec-4e67-b821-4940e41e9fcf", "citation": "STN(CTFA 2004)", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d193b77c-3c23-42d3-80bd-34f8e5388ebe", "citation": "ACD 9.0(CTFA 2006)", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "337b9e2c-bdd5-4cd9-8232-a8432874efce", "citation": "HPA 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "99947559-a48f-4b9b-a6b7-be330f867691", "citation": "HANDBOOK OF PHARMACEUTICAL ADDITIVES", "doc_type": "HANDBOOK OF PHARMACEUTICAL ADDITIVES", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7da32eec-1748-44c3-94a7-9f63f383f9a2", "citation": "CFR", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "38b6a17f-65b3-461a-805f-abd09512ce7d", "citation": "PCP-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d91e9fe1-ba9c-41e4-9e29-0ece12004a75", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "26677586-d7e1-4dd8-803e-ee45492e3f1f", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8d056265-53e9-4ecc-9f2c-20ae9fb0de2c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390736000, "tags": [ "NOMEN" ] }, { "uuid": "8e17eb08-86bb-43cc-a99f-8053ea813df6", "citation": "SRS import [1FO1ZO92Y1]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1FO1ZO92Y1", "doc_type": "SRS", "public_domain": true, "document_date": 1493390736000, "tags": [ "NOMEN" ] }, { "uuid": "cb1a78bb-87e5-4193-8e5b-b3c4636e241d", "citation": "CTFA 2004; IARC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0eb3fc29-7404-46c4-9785-26158b138b1b", "citation": "AKA204 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "668647a7-47d8-4170-9bdb-7e1fc13665b9", "citation": "PIGMENT RED 53:1 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6d25431d-5f78-fe0c-699f-0a6ad4cc4398", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+5160-02-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "63b286e3-6dd2-ecfc-11ab-14e3f8cef8fe", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5160-02-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f2afcb16-97d9-4c9f-074d-443757372456", "citation": "IARC", "doc_type": "IARC", "public_domain": true }, { "uuid": "7d9e2135-3566-a07d-7558-16ba14b1c760", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "67a6a1ae-249b-4fee-91e7-0eca6f63891f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "8e96e20c-ba9a-46a7-8b4e-73288710417c", "id": "8e96e20c-ba9a-46a7-8b4e-73288710417c", "molfile": "\n Marvin 01132107242D \n\n 1 0 0 0 0 0 999 V2000\n 8.4685 -3.4815 0.0000 Ba 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Ba+2]", "formula": "Ba", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "474ef2db-58a2-4c9f-9f9c-579f78314a40" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "137.3269", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "ae379761-ed07-4910-b7e4-2c647b28044e", "id": "ae379761-ed07-4910-b7e4-2c647b28044e", "molfile": "\n Marvin 01132109022D \n\n 25 27 0 0 0 0 999 V2000\n 0.4227 -2.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1391 -3.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8519 -2.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5701 -3.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2799 -2.8998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9990 -3.3061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7093 -2.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7004 -2.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9793 -1.6631 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.4073 -1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1295 -2.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1359 -2.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8466 -3.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8543 -4.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1434 -4.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4299 -4.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4258 -3.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5721 -4.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8532 -4.5650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1383 -4.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4211 -4.5619 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2857 -4.5572 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9990 -4.1421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8706 -5.2705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6979 -5.2734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 20 2 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 18 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 17 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 12 17 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 19 18 2 0 0 0 0\n 18 22 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 22 25 2 0 0 0 0\nM CHG 1 9 -1\nM END", "smiles": "Cc1cc(c(cc1Cl)S(=O)(=O)O)/N=N/c2c3ccccc3ccc2[O-]", "formula": "C17H12ClN2O4S", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "944ca095-ced5-43f2-a960-65fd21b90d34" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "375.8078", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "9f9b595e-bd2a-4863-b172-6db919ccce7a", "version": "9", "structure": { "id": "2ccf5c63-b3f5-401e-9539-7e2fc5fec6fe", "molfile": "\n Marvin 01132102252D \n\n 51 54 0 0 0 0 999 V2000\n 1.1391 -3.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1383 -4.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8532 -4.5650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5721 -4.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5701 -3.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8519 -2.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2799 -2.8998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9990 -3.3061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7093 -2.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1295 -2.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4073 -1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7004 -2.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1359 -2.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4258 -3.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4299 -4.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1434 -4.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8543 -4.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8466 -3.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9793 -1.6631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4227 -2.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4211 -4.5619 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2857 -4.5572 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9990 -4.1421 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.8706 -5.2705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6979 -5.2734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4685 -3.4815 0.0000 Ba 0 2 0 0 0 0 0 0 0 0 0 0\n 1.1391 -3.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1383 -4.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8532 -4.5650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5721 -4.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5701 -3.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8519 -2.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2799 -2.8998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9990 -3.3061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7093 -2.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1295 -2.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4073 -1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7004 -2.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1359 -2.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4258 -3.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4299 -4.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1434 -4.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8543 -4.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8466 -3.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9793 -1.6631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4227 -2.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4211 -4.5619 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2857 -4.5572 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9990 -4.1421 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.8706 -5.2705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6979 -5.2734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 22 25 2 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 1 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 14 2 0 0 0 0\n 13 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 9 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 13 1 0 0 0 0\n 12 19 1 0 0 0 0\n 1 20 1 0 0 0 0\n 2 21 1 0 0 0 0\n 27 28 2 0 0 0 0\n 32 27 1 0 0 0 0\n 27 46 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 47 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 48 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 2 0 0 0 0\n 31 33 1 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 40 2 0 0 0 0\n 38 35 1 0 0 0 0\n 39 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 38 45 1 0 0 0 0\n 39 40 1 0 0 0 0\n 44 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 2 0 0 0 0\n 48 49 1 0 0 0 0\n 48 50 2 0 0 0 0\n 48 51 2 0 0 0 0\nM CHG 3 23 -1 26 2 49 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15\nM SAL 1 15 16 17 18 19 20 21 22 23 24 25 27 28 29 30 31\nM SAL 1 15 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46\nM SAL 1 5 47 48 49 50 51\nM SPA 1 15 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15\nM SPA 1 10 16 17 18 19 20 21 22 23 24 25\nM SDI 1 4 0.0011 -5.6934 0.0011 -1.2289\nM SDI 1 4 7.2743 -1.2289 7.2743 -5.6934\nM SMT 1 2\nM END", "smiles": "Cc1cc(c(cc1Cl)S(=O)(=O)[O-])/N=N/c2c3ccccc3ccc2O.Cc1cc(c(cc1Cl)S(=O)(=O)[O-])/N=N/c2c3ccccc3ccc2O.[Ba+2]", "formula": "2C17H12ClN2O4S.Ba", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "888.9426", "optical_activity": "NONE", "references": [ "8e17eb08-86bb-43cc-a99f-8053ea813df6", "cb1a78bb-87e5-4193-8e5b-b3c4636e241d" ], "stereo_centers": 0 }, "unii": "1FO1ZO92Y1" } ] }