{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1631be67-f458-4a53-82ba-72e137df840e",
          "code": "12270-13-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=12270-13-2",
          "code_system": "CAS",
          "references": [
            "375b0970-fe44-455b-b599-ce39fc9008c8",
            "5de70e7d-fbff-4caa-b56e-93e06221e925"
          ]
        },
        {
          "uuid": "ceb944c7-a7a1-47ef-91a5-cb0a18fc53ac",
          "code": "C518666",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67518666",
          "code_system": "MESH",
          "references": [
            "375b0970-fe44-455b-b599-ce39fc9008c8"
          ]
        },
        {
          "uuid": "f437a294-a48f-466f-ba47-904fe82a7e59",
          "code": "235-546-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.032.302",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "375b0970-fe44-455b-b599-ce39fc9008c8"
          ]
        },
        {
          "uuid": "43fd0c8f-ca2f-4e72-b38e-419e4d6afba2",
          "code": "83008",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/83008",
          "code_system": "PUBCHEM",
          "references": [
            "375b0970-fe44-455b-b599-ce39fc9008c8"
          ]
        },
        {
          "uuid": "9a66a682-b895-bd78-9277-2643bea88645",
          "code": "DTXSID3051624",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3051624",
          "code_system": "EPA CompTox",
          "references": [
            "dd9bdd2e-0874-a05f-cb55-7db8eb08b4db"
          ]
        },
        {
          "uuid": "49890c51-884f-4959-a53c-e65cfe2f7a18",
          "code": "1ECX0J387P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "48b53321-29fd-484c-81c5-5e8064a82368",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "d243b177-b538-48cb-a654-59ccef7afc42",
            "refuuid": "22046ece-3b8d-4bd0-ad05-091841fc459e",
            "name": "Methyl sulfate",
            "unii": "R24I7CLU7K",
            "linking_id": "R24I7CLU7K",
            "ref_pname": "Methyl sulfate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fd23ce06-d304-48b8-8fc2-7e5cd24a5653",
          "name": "2-((4-(ETHYL(2-HYDROXYETHYL)AMINO)PHENYL)AZO)-6-METHOXY-3-METHYLBENZOTHIAZOLIUM METHYL SULFATE",
          "stdName": "2-((4-(ETHYL(2-HYDROXYETHYL)AMINO)PHENYL)AZO)-6-METHOXY-3-METHYLBENZOTHIAZOLIUM METHYL SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3e8cec5-dc69-40f0-9aa0-a4ab2f76f2e1",
            "4080933f-6373-4a6a-90e4-e063e9a0d826"
          ],
          "display_name": false
        },
        {
          "uuid": "65a77e5d-fd3a-40fc-afe2-0b064929b4f8",
          "name": "ANILAN BLUE GRL",
          "stdName": "ANILAN BLUE GRL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3e8cec5-dc69-40f0-9aa0-a4ab2f76f2e1",
            "4080933f-6373-4a6a-90e4-e063e9a0d826"
          ],
          "display_name": false
        },
        {
          "uuid": "28f85912-7dcb-4650-bdc1-b4882842272f",
          "name": "BASACRYL BLUE X 3GL",
          "stdName": "BASACRYL BLUE X 3GL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3e8cec5-dc69-40f0-9aa0-a4ab2f76f2e1",
            "4080933f-6373-4a6a-90e4-e063e9a0d826"
          ],
          "display_name": false
        },
        {
          "uuid": "b7373085-05e4-41f7-ac01-cc319b89ee12",
          "name": "BASIC BLUE 41",
          "stdName": "BASIC BLUE 41",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3e8cec5-dc69-40f0-9aa0-a4ab2f76f2e1",
            "594fb863-961d-4981-ac28-bd0aa05c9318",
            "d197a397-1d3a-42e7-82c9-db1f6c4bc2ad",
            "b478454e-b2aa-4ab8-8038-5775268d945c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "040c59fa-7544-48f8-9b2c-244247240b0f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "219104ef-11db-46af-99d5-799b2d7c992e",
          "name": "BENZOTHIAZOLIUM, 2-((4-(ETHYL(2-HYDROXYETHYL)AMINO)PHENYL)AZO)-6-METHOXY-3-METHYL-, METHYL SULFATE (SALT)",
          "stdName": "BENZOTHIAZOLIUM, 2-((4-(ETHYL(2-HYDROXYETHYL)AMINO)PHENYL)AZO)-6-METHOXY-3-METHYL-, METHYL SULFATE (SALT)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3e8cec5-dc69-40f0-9aa0-a4ab2f76f2e1",
            "4080933f-6373-4a6a-90e4-e063e9a0d826"
          ],
          "display_name": false
        },
        {
          "uuid": "dd672bf3-a7a8-4a89-91b7-c85fb6c5cde3",
          "name": "BENZOTHIAZOLIUM, 2-(2-(4-(ETHYL(2-HYDROXYETHYL)AMINO)PHENYL)DIAZENYL)-6-METHOXY-3-METHYL-, METHYL SULFATE (1:1)",
          "stdName": "BENZOTHIAZOLIUM, 2-(2-(4-(ETHYL(2-HYDROXYETHYL)AMINO)PHENYL)DIAZENYL)-6-METHOXY-3-METHYL-, METHYL SULFATE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3e8cec5-dc69-40f0-9aa0-a4ab2f76f2e1",
            "4080933f-6373-4a6a-90e4-e063e9a0d826"
          ],
          "display_name": false
        },
        {
          "uuid": "8d95f31f-ff78-4168-81c8-00da46934ca8",
          "name": "C.I. BASIC BLUE 41",
          "stdName": "C.I. BASIC BLUE 41",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e77d278a-1725-42e7-99c3-03c8679488c5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e77d278a-1725-42e7-99c3-03c8679488c5",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "594fb863-961d-4981-ac28-bd0aa05c9318",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3e8cec5-dc69-40f0-9aa0-a4ab2f76f2e1",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4080933f-6373-4a6a-90e4-e063e9a0d826",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d197a397-1d3a-42e7-82c9-db1f6c4bc2ad",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "375b0970-fe44-455b-b599-ce39fc9008c8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391018000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "414ffdee-a160-45ea-85d9-8914bbacef39",
          "citation": "SRS import [1ECX0J387P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1ECX0J387P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391018000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68a18d9a-fcdd-4d44-b467-c62c1a0de683",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b478454e-b2aa-4ab8-8038-5775268d945c",
          "citation": "BASIC BLUE 41 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dd9bdd2e-0874-a05f-cb55-7db8eb08b4db",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=12270-13-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5de70e7d-fbff-4caa-b56e-93e06221e925",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bbf8a2d3-e514-45ed-92f7-25a15aac0fd5",
          "id": "bbf8a2d3-e514-45ed-92f7-25a15aac0fd5",
          "molfile": "\n  Marvin  01132109432D          \n\n  6  5  0  0  0  0            999 V2000\n    7.2845   -8.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1094   -8.9269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9397   -8.9269    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7647   -8.9269    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.9397   -8.1019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9397   -9.7573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "COS(=O)(=O)[O-]",
          "formula": "CH3O4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3784793f-0098-4f15-b775-10a6c392a7b6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "111.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "22631b40-a5b8-49c2-8945-03ab0f9ebf21",
          "id": "22631b40-a5b8-49c2-8945-03ab0f9ebf21",
          "molfile": "\n  Marvin  01132101562D          \n\n 26 28  0  0  0  0            999 V2000\n    9.9173   -2.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3356   -3.2003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9301   -3.9305    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.3503   -4.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2420   -4.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7834   -5.1538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1041   -3.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6851   -3.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8647   -3.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4586   -3.9436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8775   -4.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7025   -4.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6327   -3.9436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2247   -4.6782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3987   -4.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9177   -5.3485    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1246   -5.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4112   -5.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6995   -5.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9850   -5.5070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9850   -6.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6995   -4.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4112   -3.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1246   -4.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9031   -4.0057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5593   -3.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  7  3  2  3  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 12  1  0  0  0  0\n  9  8  2  3  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 13 10  2  3  0  0  0\n 12 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  3  0  0  0\n 15 16  1  0  0  0  0\n 25 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 24 17  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 22  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  CHG  1   3   1\nM  END",
          "smiles": "CC[N+](=C1C=CC(=NN=c2n(C)c3ccc(cc3s2)OC)C=C1)CCO",
          "formula": "C19H23N4O2S",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96dc83d8-052a-4e90-8740-8f0987288ff0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "371.4783",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "11d4f958-fb2e-45c3-8646-0b6101341fe4",
      "version": "4",
      "structure": {
        "id": "0be0ec1a-c449-4735-b10b-2bd0703f73c2",
        "molfile": "\n  Marvin  01132100522D          \n\n 32 33  0  0  0  0            999 V2000\n    6.6713   -7.3439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9927   -7.3439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3544   -7.3439    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3544   -6.6652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0331   -7.3439    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3544   -8.0270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9177   -5.3485    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1246   -5.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4112   -5.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6995   -5.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9850   -5.5070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9850   -6.3330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6995   -4.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4112   -3.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1246   -4.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9031   -4.0057    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.5593   -3.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3987   -4.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2247   -4.6782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6327   -3.9436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4586   -3.9436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8775   -4.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7025   -4.6454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1041   -3.9305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6851   -3.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8647   -3.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9301   -3.9305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3356   -3.2003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9173   -2.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3503   -4.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2420   -4.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7834   -5.1538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15  8  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 18  7  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 21 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 27 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  CHG  2   5  -1  16   1\nM  END",
        "smiles": "CCN(CCO)c1ccc(cc1)/N=N/c2[n+](C)c3ccc(cc3s2)OC.COS(=O)(=O)[O-]",
        "formula": "C19H23N4O2S.CH3O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "482.5766",
        "optical_activity": "NONE",
        "references": [
          "414ffdee-a160-45ea-85d9-8914bbacef39",
          "68a18d9a-fcdd-4d44-b467-c62c1a0de683"
        ],
        "stereo_centers": 0
      },
      "unii": "1ECX0J387P"
    }
  ]
}