{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "39929aa4-6723-4c3a-b33f-ddfd8df75b97",
          "code": "88-84-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=88-84-6",
          "code_system": "CAS",
          "references": [
            "06f67d5a-e5ad-4acd-bd2f-8cfa2f39f780",
            "9e61daad-f0a2-4db7-aa33-7f6159a9f1d4"
          ]
        },
        {
          "uuid": "265d0fc3-a785-4c1e-85e1-64c9a2bb9ba7",
          "code": "GUAIENE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4626",
          "code_system": "JECFA EVALUATION",
          "references": [
            "06f67d5a-e5ad-4acd-bd2f-8cfa2f39f780"
          ]
        },
        {
          "uuid": "075e69f3-3e80-4a2a-8fcd-f021b77e13df",
          "code": "201-860-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.691",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "06f67d5a-e5ad-4acd-bd2f-8cfa2f39f780"
          ]
        },
        {
          "uuid": "33292597-0379-471b-940b-271846639498",
          "code": "15560252",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15560252",
          "code_system": "PUBCHEM",
          "references": [
            "06f67d5a-e5ad-4acd-bd2f-8cfa2f39f780"
          ]
        },
        {
          "uuid": "db6b64b1-0394-fe7b-cb86-08cd53718cbc",
          "code": "Guaiene",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Guaiene",
          "code_system": "WIKIPEDIA",
          "references": [
            "2254c54c-9232-8647-98a2-55aa9f1b1df4"
          ]
        },
        {
          "uuid": "2b4eea3a-e722-8d8d-ed8c-f1f71a055aff",
          "code": "DTXSID5052599",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5052599",
          "code_system": "EPA CompTox",
          "references": [
            "a34180dd-f412-a73c-be16-b731782c2f11"
          ]
        },
        {
          "uuid": "79b1b007-4cf3-4e49-8c18-1976e0737c64",
          "code": "1D018Q907T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5bfb4030-c86e-270c-9bfb-75d21bf49384",
          "code": "1346",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1346/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "e4ccc844-bf8a-98c7-1abe-b9a0c2d59c0a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d74ca32d-9f80-4852-895b-71c20610201d",
          "name": ".BETA.-GUAIENE",
          "stdName": ".BETA.-GUAIENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4d4074f1-860b-4947-8e48-3aa9dbe32503",
            "f2764517-7128-4de3-ac12-241439850b51"
          ],
          "display_name": true
        },
        {
          "uuid": "c00623b8-887e-4a9f-ad09-d6c9c19582d4",
          "name": ".BETA.-GUAJENE",
          "stdName": ".BETA.-GUAJENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4e7c7db-02a3-431b-bc77-23eb4c32bf52",
            "4d4074f1-860b-4947-8e48-3aa9dbe32503"
          ],
          "display_name": false
        },
        {
          "uuid": "8d04f28e-80f1-4095-9cc4-68c69eda53d5",
          "name": "AZULENE, 1,2,3,4,5,6,7,8-OCTAHYDRO-1,4-DIMETHYL-7-(1-METHYLETHYLIDENE)-, (1S,4S)-",
          "stdName": "AZULENE, 1,2,3,4,5,6,7,8-OCTAHYDRO-1,4-DIMETHYL-7-(1-METHYLETHYLIDENE)-, (1S,4S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4e7c7db-02a3-431b-bc77-23eb4c32bf52",
            "4d4074f1-860b-4947-8e48-3aa9dbe32503"
          ],
          "display_name": false
        },
        {
          "uuid": "d799fe9d-6ad6-45be-8729-5c581a2893dd",
          "name": "AZULENE, 1,2,3,4,5,6,7,8-OCTAHYDRO-1,4-DIMETHYL-7-(1-METHYLETHYLIDENE)-, (1S-CIS)-",
          "stdName": "AZULENE, 1,2,3,4,5,6,7,8-OCTAHYDRO-1,4-DIMETHYL-7-(1-METHYLETHYLIDENE)-, (1S-CIS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4e7c7db-02a3-431b-bc77-23eb4c32bf52",
            "4d4074f1-860b-4947-8e48-3aa9dbe32503"
          ],
          "display_name": false
        },
        {
          "uuid": "0d372c9a-ccf5-4f6c-bd93-e4839c2605a9",
          "name": "GUAIA-1(5),7(11)-DIENE",
          "stdName": "GUAIA-1(5),7(11)-DIENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4e7c7db-02a3-431b-bc77-23eb4c32bf52",
            "4d4074f1-860b-4947-8e48-3aa9dbe32503"
          ],
          "display_name": false
        },
        {
          "uuid": "f287085e-1462-411b-85a8-485e7dd83f38",
          "name": "GUAIENE [FHFI]",
          "stdName": "GUAIENE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4d4074f1-860b-4947-8e48-3aa9dbe32503",
            "0141423e-1de2-4374-9701-f70d5d0312dc"
          ],
          "display_name": false
        },
        {
          "uuid": "0ec18a60-0819-4ba5-b99f-c63cafd8a981",
          "name": "GUAIENE, BETA-",
          "stdName": "GUAIENE, BETA-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4d4074f1-860b-4947-8e48-3aa9dbe32503",
            "4a607522-9a30-4931-86dd-77d391d041ae"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f2764517-7128-4de3-ac12-241439850b51",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4d4074f1-860b-4947-8e48-3aa9dbe32503",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4e7c7db-02a3-431b-bc77-23eb4c32bf52",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0141423e-1de2-4374-9701-f70d5d0312dc",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a607522-9a30-4931-86dd-77d391d041ae",
          "citation": "cfsan",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06f67d5a-e5ad-4acd-bd2f-8cfa2f39f780",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391225000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5f3dd9d-5499-4189-a910-9c929fc170ba",
          "citation": "SRS import [1D018Q907T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1D018Q907T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391225000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2254c54c-9232-8647-98a2-55aa9f1b1df4",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Guaiene",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a34180dd-f412-a73c-be16-b731782c2f11",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=88-84-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9e61daad-f0a2-4db7-aa33-7f6159a9f1d4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fefa1d2d-42a1-2ebc-048f-1b9a7d9c18d4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e4ccc844-bf8a-98c7-1abe-b9a0c2d59c0a",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ee32fb17-f1ed-45e3-a48c-52e47e1620b3",
          "id": "ee32fb17-f1ed-45e3-a48c-52e47e1620b3",
          "molfile": "\n  Marvin  01132112202D          \n\n 15 16  0  0  1  0            999 V2000\n    6.9922   -5.3934    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1645   -6.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2315   -5.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3167   -4.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1268   -4.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5409   -4.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3470   -4.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9512   -4.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8818   -3.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2143   -3.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4279   -3.3076    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.8575   -2.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7197   -4.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8485   -5.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3674   -4.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
          "smiles": "CC(=C1CC[C@H](C)C2=C(C1)[C@@H](C)CC2)C",
          "formula": "C15H24",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1553be9f-55e2-4ebe-852d-251cf0c27748"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "204.3516",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dfba546b-67c2-4b3a-8fb3-e827b146109b",
      "version": "8",
      "structure": {
        "id": "923dbf91-c59f-451a-a303-0978b3618b91",
        "molfile": "\n  Marvin  01132107352D          \n\n 15 16  0  0  1  0            999 V2000\n    9.8485   -5.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3674   -4.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7197   -4.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8818   -3.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8575   -2.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2143   -3.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1645   -6.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2315   -5.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9512   -4.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3167   -4.2506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4279   -3.3076    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.9922   -5.3934    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3470   -4.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1268   -4.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5409   -4.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  6  4  1  0  0  0  0\n 10  8  1  0  0  0  0\n  3  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  9  3  2  0  0  0  0\n  9  4  1  0  0  0  0\n 11  5  1  1  0  0  0\n 11  6  1  0  0  0  0\n 12  7  1  1  0  0  0\n 12  8  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 10  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 12  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 14  2  0  0  0  0\nM  END",
        "smiles": "CC(=C1CC[C@H](C)C2=C(C1)[C@@H](C)CC2)C",
        "formula": "C15H24",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "204.3516",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b4e7c7db-02a3-431b-bc77-23eb4c32bf52",
          "a5f3dd9d-5499-4189-a910-9c929fc170ba"
        ],
        "stereo_centers": 2
      },
      "unii": "1D018Q907T"
    }
  ]
}