{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a9cf6bcd-da60-40db-af29-320b3c6d978e",
          "code": "90-66-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90-66-4",
          "code_system": "CAS",
          "references": [
            "40d06a93-63fe-4b7c-b5ad-d644bcefc7bc",
            "f90a57bb-08df-4e3a-bc07-9e2ffd5b6315"
          ]
        },
        {
          "uuid": "bc57c7a5-584a-4231-bef6-af2b8fe2bca2",
          "code": "202-009-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.827",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "40d06a93-63fe-4b7c-b5ad-d644bcefc7bc"
          ]
        },
        {
          "uuid": "e7caa16e-6fd7-4271-9bfa-d651f0b2f42e",
          "code": "66661",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66661",
          "code_system": "PUBCHEM",
          "references": [
            "40d06a93-63fe-4b7c-b5ad-d644bcefc7bc"
          ]
        },
        {
          "uuid": "3352329a-6f37-970c-5964-e40b41e657c7",
          "code": "DTXSID7059012",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7059012",
          "code_system": "EPA CompTox",
          "references": [
            "c3f61b92-dafa-9061-a24d-82ec60154c41"
          ]
        },
        {
          "uuid": "cd852a99-f722-45b0-bc4d-17c255bfb771",
          "code": "1C0V73I549",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "28d8b93a-d544-6937-aec8-2dc7e40d4d8c",
          "code": "67488",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=67488",
          "code_system": "NSC",
          "references": [
            "e79ebac0-2960-ddbf-beeb-c42fb79c91cd"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "931a6471-6345-468a-9b49-ae64b8911dd9",
          "name": "2,2'-DIHYDROXY-3,3'-DI-TERT-BUTYL-5,5'-DIMETHYLDIPHENYL SULFIDE",
          "stdName": "2,2'-DIHYDROXY-3,3'-DI-TERT-BUTYL-5,5'-DIMETHYLDIPHENYL SULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "5062d2da-5cf5-4fee-8663-434f94328a72",
          "name": "2,2'-THIOBIS(6-(1,1-DIMETHYLETHYL)-4-METHYLPHENOL)",
          "stdName": "2,2'-THIOBIS(6-(1,1-DIMETHYLETHYL)-4-METHYLPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "239aec99-4b09-4956-b1e2-1229da0ee6f3",
          "name": "2,2'-THIOBIS(6-TERT-BUTYL-4-METHYLPHENOL)",
          "stdName": "2,2'-THIOBIS(6-TERT-BUTYL-4-METHYLPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "738cf933-642c-42d6-a241-6f9a49985671",
          "name": "2,2'-THIOBIS(6-TERT-BUTYL-P-CRESOL)",
          "stdName": "2,2'-THIOBIS(6-TERT-BUTYL-P-CRESOL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74fb3abc-aff2-48e5-b48c-debe67cfcd57"
          ],
          "display_name": true
        },
        {
          "uuid": "acca8848-a343-49cd-b821-19871ef92604",
          "name": "6,6'-DI-TERT-BUTYL-2,2'-THIODI-P-CRESOL",
          "stdName": "6,6'-DI-TERT-BUTYL-2,2'-THIODI-P-CRESOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "594fd5a7-b7bb-4c3e-8a6f-2bcfab9521c9"
          ],
          "display_name": false
        },
        {
          "uuid": "1eab0d21-2b8c-4022-a74b-e938cf8592d3",
          "name": "ADVASTAB 406",
          "stdName": "ADVASTAB 406",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "94c09a19-67f3-47be-9be1-dc768bba94c5",
          "name": "ANTIOXIDANT 2246S",
          "stdName": "ANTIOXIDANT 2246S",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "9fc6e486-dc23-4f13-8f41-a65b7955bbaa",
          "name": "Antioxidant 2246",
          "stdName": "ANTIOXIDANT 2246",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d83f2fa6-97fe-4851-a06f-1f2279402e17"
          ],
          "display_name": false
        },
        {
          "uuid": "4958d4bf-025f-42fb-8ab2-1d451d2672db",
          "name": "BIS(2-HYDROXY-3-TERT-BUTYL-5-METHYLPHENYL) SULFIDE",
          "stdName": "BIS(2-HYDROXY-3-TERT-BUTYL-5-METHYLPHENYL) SULFIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "9ffcdd0c-9e19-4ff4-beef-ad48cc484b3f",
          "name": "IRGANOX 1081",
          "stdName": "IRGANOX 1081",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "c72f6e39-4b00-46fd-86c3-94af5c6bba7d",
          "name": "LOWINOX TBP-6",
          "stdName": "LOWINOX TBP-6",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "29c5afcf-1168-4fe5-aad7-93de6ca91c32",
          "name": "NSC-67488",
          "stdName": "NSC-67488",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "8121bd26-10c0-470a-9a47-cb0d78eb38f7",
          "name": "P-CRESOL, 2,2'-THIOBIS(6-TERT-BUTYL-",
          "stdName": "P-CRESOL, 2,2'-THIOBIS(6-TERT-BUTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "53474c09-7a54-451c-a164-1e0c5b577243",
          "name": "PHENOL, 2,2'-THIOBIS(6-(1,1-DIMETHYLETHYL)-4-METHYL-",
          "stdName": "PHENOL, 2,2'-THIOBIS(6-(1,1-DIMETHYLETHYL)-4-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        },
        {
          "uuid": "22507ba3-80cb-4744-87a2-14d1ebd51c91",
          "name": "THIOALKOFEN BP",
          "stdName": "THIOALKOFEN BP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "698260b6-a938-47fa-99d0-db259ec58d8e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "74fb3abc-aff2-48e5-b48c-debe67cfcd57",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "698260b6-a938-47fa-99d0-db259ec58d8e",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "594fd5a7-b7bb-4c3e-8a6f-2bcfab9521c9",
          "citation": "http://echa.europa.eu/substance-information/-/substanceinfo/100.001.827",
          "url": "http://echa.europa.eu/substance-information/-/substanceinfo/100.001.827",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40d06a93-63fe-4b7c-b5ad-d644bcefc7bc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392032000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c6fd523-64a7-430e-8bff-006cf7fc85c3",
          "citation": "SRS import [1C0V73I549]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1C0V73I549",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392032000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3f61b92-dafa-9061-a24d-82ec60154c41",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90-66-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f90a57bb-08df-4e3a-bc07-9e2ffd5b6315",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e79ebac0-2960-ddbf-beeb-c42fb79c91cd",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d83f2fa6-97fe-4851-a06f-1f2279402e17",
          "citation": "https://drugsdata.org/stats_substance_by_year.php",
          "url": "https://drugsdata.org/stats_substance_by_year.php",
          "doc_type": "WEB PAGE",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "01a8c211-ae8b-4cdd-b960-4d163f85df65",
          "id": "01a8c211-ae8b-4cdd-b960-4d163f85df65",
          "molfile": "\n  Marvin  01132100242D          \n\n 25 26  0  0  0  0            999 V2000\n    3.5801   -0.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8653   -1.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8653   -1.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1447   -2.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1447   -3.1912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8595   -3.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8595   -4.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -4.8441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -5.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2950   -4.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2950   -3.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -3.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -2.3620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -3.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7191   -2.7737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4217   -3.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5924   -2.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4298   -1.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7149   -2.3677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4298   -1.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1447   -0.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7149   -0.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1267    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3031   -1.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 21  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4 18  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 14 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(c(c(c1)Sc2cc(C)cc(c2O)C(C)(C)C)O)C(C)(C)C",
          "formula": "C22H30O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5ca8a5df-db58-48d5-b393-2a02ad1815dc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "358.5393",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "00a4efde-6ca9-4b04-a38d-3ae7f0c52faa",
      "version": "5",
      "structure": {
        "id": "50ea2edb-cd63-40e7-9e98-90be5ff0e4aa",
        "molfile": "\n  Marvin  01132104132D          \n\n 25 26  0  0  0  0            999 V2000\n    2.1447   -3.1912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7149   -2.3677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7149   -0.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1267    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3031   -1.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5801   -0.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -2.3620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0042   -3.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7191   -2.7737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4217   -3.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5924   -2.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -5.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1447   -2.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4298   -1.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8653   -1.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4298   -1.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8653   -1.1267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1447   -0.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8595   -3.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -3.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8595   -4.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2950   -3.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5744   -4.8441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2950   -4.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1 14  1  0  0  0  0\n  1 20  1  0  0  0  0\n  2 15  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3 17  1  0  0  0  0\n  7 18  1  0  0  0  0\n  8 21  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 23  1  0  0  0  0\n 13 24  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 17 19  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 23 25  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(c(c(c1)Sc2cc(C)cc(c2O)C(C)(C)C)O)C(C)(C)C",
        "formula": "C22H30O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "358.5393",
        "optical_activity": "NONE",
        "references": [
          "0c6fd523-64a7-430e-8bff-006cf7fc85c3",
          "74fb3abc-aff2-48e5-b48c-debe67cfcd57"
        ],
        "stereo_centers": 0
      },
      "unii": "1C0V73I549"
    }
  ]
}