{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5e48a163-688e-4415-925f-abc242e428e4",
          "code": "612526-40-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=612526-40-6",
          "code_system": "CAS",
          "references": [
            "092360a3-a1f8-4c75-b623-f8830a3ffcad",
            "19b4c914-5a0d-4013-a723-8c27c5691fb5"
          ]
        },
        {
          "uuid": "e530607e-3b83-493c-8c1d-3a4ff5db3487",
          "code": "FLUBROMAZOLAM",
          "comments": "Flubromazolam is a benzodiazepine derivative closely related to triazolam and flubromazepam that has been sold online as a designer drug. Flubromazolam is reputed to be highly potent, and concerns have been raised that clonazolam and flubromazolam in particular may pose comparatively higher risks than other designer benzodiazepines, due to their ability to produce strong sedation and amnesia at oral doses of as little as 0.5mg.[5] Life-threatening adverse reactions have been observed at doses of only 3mg of flubromazolam.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Flubromazolam",
          "code_system": "WIKIPEDIA",
          "references": [
            "092360a3-a1f8-4c75-b623-f8830a3ffcad"
          ]
        },
        {
          "uuid": "d3495a29-8693-4ea1-836f-1cf10af5d7d2",
          "code": "SUB179556",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "092360a3-a1f8-4c75-b623-f8830a3ffcad"
          ]
        },
        {
          "uuid": "623d69a3-20a1-4607-93cb-5b2767448650",
          "code": "21930924",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21930924",
          "code_system": "PUBCHEM",
          "references": [
            "092360a3-a1f8-4c75-b623-f8830a3ffcad"
          ]
        },
        {
          "uuid": "0b8678c2-edad-9983-e293-c433ca77f7ed",
          "code": "DTXSID40620266",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40620266",
          "code_system": "EPA CompTox",
          "references": [
            "ada4581c-a47c-70cd-13ae-ec16e62af675"
          ]
        },
        {
          "uuid": "cca1f552-5410-44c2-3e8e-d62ee2257b7d",
          "code": "Designer-drugs-Flubromazolam",
          "comments": "Wikipedia|List of designer drugs|Sedatives|Benzodiazepines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "994e8eed-8282-bd8b-6d45-91753c0c4951"
          ]
        },
        {
          "uuid": "165b6b87-dae2-436c-ba36-6f4b6b7a023a",
          "code": "1BF1HN5GWD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a738bb72-6290-53b8-239a-e8e6ab423852",
          "code": "100000164920",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c40bf720-f3ef-a8d9-aadc-ecd26e18acf6"
          ]
        },
        {
          "uuid": "3d43ff03-9771-40cb-850f-5ac7ac979900",
          "code": "2788",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Temporary listing of substances subject to emergency scheduling",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "code_system": "DEA NO.",
          "references": [
            "3960c11b-4be8-4319-8ee8-b86890515886"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "dd71eea1-a6e0-43a6-a200-828560eeee41",
          "amount": {
            "uuid": "13a1589c-8607-4ad6-b0e2-3c0579ead1cb"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "76e7b39c-15a8-4f4c-8169-98e55dadc218",
            "refuuid": "a7c8fe29-86fe-4c86-bf94-951a8faa2202",
            "name": "Flubromazolam",
            "unii": "1BF1HN5GWD",
            "linking_id": "1BF1HN5GWD",
            "ref_pname": "Flubromazolam",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ab113a25-55bb-40c6-a70c-1cd6e2de735f",
          "name": "4H-[1,2,4]Triazolo[4,3-a][1,4]benzodiazepine, 8-bromo-6-(2-fluorophenyl)-1-methyl-",
          "stdName": "4H-(1,2,4)TRIAZOLO(4,3-A)(1,4)BENZODIAZEPINE, 8-BROMO-6-(2-FLUOROPHENYL)-1-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1eeafc1b-232d-4a29-abec-7c4e1dc09492"
          ],
          "display_name": false
        },
        {
          "uuid": "78e1680f-0e26-4c50-bfa5-1db2e702f9af",
          "name": "8-Bromo-1-methyl-6-(2-fluorophenyl)-4H-s-triazolo[4,3-a][1,4]benzodiazepine",
          "stdName": "8-BROMO-1-METHYL-6-(2-FLUOROPHENYL)-4H-S-TRIAZOLO(4,3-A)(1,4)BENZODIAZEPINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1eeafc1b-232d-4a29-abec-7c4e1dc09492"
          ],
          "display_name": false
        },
        {
          "uuid": "eb5cacd9-19cc-4c36-9604-1adcdb243af1",
          "name": "8-bromo-6-(2-fluorophenyl)-1-methyl-4H-benzo[f][1,2,4]triazolo[4,3-a][1,4]diazepine",
          "stdName": "8-BROMO-6-(2-FLUOROPHENYL)-1-METHYL-4H-BENZO(F)(1,2,4)TRIAZOLO(4,3-A)(1,4)DIAZEPINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3960c11b-4be8-4319-8ee8-b86890515886"
          ],
          "display_name": false
        },
        {
          "uuid": "d70d9d98-2a10-4a58-80f4-d3f45bd7eb99",
          "name": "DEA NO. 2788",
          "stdName": "DEA NO. 2788",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3960c11b-4be8-4319-8ee8-b86890515886"
          ],
          "display_name": false
        },
        {
          "uuid": "5e6afdd9-ee96-4276-ad7d-db10855bdfa8",
          "name": "Flubromazolam",
          "stdName": "FLUBROMAZOLAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7bd2bd9f-38dd-4fac-bb24-ca7a9a16331e"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "7bd2bd9f-38dd-4fac-bb24-ca7a9a16331e",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1eeafc1b-232d-4a29-abec-7c4e1dc09492",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "092360a3-a1f8-4c75-b623-f8830a3ffcad",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393299000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b4cedc6-a9e8-4721-bce8-a0a72a42e196",
          "citation": "SRS import [1BF1HN5GWD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1BF1HN5GWD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393299000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ada4581c-a47c-70cd-13ae-ec16e62af675",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=612526-40-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c40bf720-f3ef-a8d9-aadc-ecd26e18acf6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "19b4c914-5a0d-4013-a723-8c27c5691fb5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "994e8eed-8282-bd8b-6d45-91753c0c4951",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3960c11b-4be8-4319-8ee8-b86890515886",
          "citation": "CFR",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "060bf77e-9a67-4745-90fd-76bc368aaa5c",
          "id": "060bf77e-9a67-4745-90fd-76bc368aaa5c",
          "molfile": "\n  Marvin  01132100362D          \n\n 23 26  0  0  0  0            999 V2000\n    9.2617   -2.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8000   -3.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6222   -3.5403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9411   -4.3012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3159   -4.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4208   -5.6579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8465   -6.2501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0253   -6.1702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5971   -6.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7724   -6.8572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3442   -7.5624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7408   -8.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5656   -8.3041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9938   -7.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8185   -7.6171    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5758   -5.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7676   -5.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2200   -5.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4118   -5.1930    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.4805   -4.2445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2887   -4.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8363   -4.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6107   -4.4113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2 23  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n 23  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 16  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 22 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "Cc1nnc2CN=C(c3ccccc3F)c4cc(ccc4-n12)Br",
          "formula": "C17H12BrFN4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bd193bfa-b418-4c36-aa05-9e6a48453633"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "371.2065",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a7c8fe29-86fe-4c86-bf94-951a8faa2202",
      "version": "8",
      "structure": {
        "id": "34108ae2-4fce-4f0a-a020-df991d4bfcc8",
        "molfile": "\n  Marvin  01132102472D          \n\n 23 26  0  0  0  0            999 V2000\n   15.8476   -1.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3860   -2.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1967   -2.8377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4222   -3.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1617   -3.9048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6113   -4.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4324   -4.6764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0068   -4.0842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9019   -3.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5270   -2.7275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2082   -1.9666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1831   -5.3017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5797   -6.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4045   -6.0434    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1515   -6.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3267   -6.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9301   -5.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3583   -5.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3536   -4.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8059   -3.4535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0664   -2.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8746   -2.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9977   -3.6193    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n  2 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 12 18  1  0  0  0  0\n  5 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n  4 22  2  0  0  0  0\n 20 23  1  0  0  0  0\nM  END",
        "smiles": "Cc1nnc2CN=C(c3ccccc3F)c4cc(ccc4-n12)Br",
        "formula": "C17H12BrFN4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "371.2065",
        "optical_activity": "NONE",
        "references": [
          "6b4cedc6-a9e8-4721-bce8-a0a72a42e196",
          "1eeafc1b-232d-4a29-abec-7c4e1dc09492"
        ],
        "stereo_centers": 0
      },
      "unii": "1BF1HN5GWD"
    }
  ]
}