{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "77ab0405-b908-4bc1-8e00-dc28015ee0de",
          "code": "15905-32-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15905-32-5",
          "code_system": "CAS",
          "references": [
            "3d6e5b4d-dc58-41d7-8f07-3abec960a325",
            "b784831b-f9a6-4042-b5e0-6df53a6a1774"
          ]
        },
        {
          "uuid": "a3d9da90-0411-430a-9a54-60b372e75bef",
          "code": "C87418",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87418",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3d6e5b4d-dc58-41d7-8f07-3abec960a325"
          ]
        },
        {
          "uuid": "8dc33849-0690-4fd9-8da6-2975fd1f783f",
          "code": "120902",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:650",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "3d6e5b4d-dc58-41d7-8f07-3abec960a325"
          ]
        },
        {
          "uuid": "8a4992a1-e318-443f-8364-cb7b073a165d",
          "code": "240-046-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.390",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3d6e5b4d-dc58-41d7-8f07-3abec960a325"
          ]
        },
        {
          "uuid": "df2ae1ce-f957-4ad0-9fec-93c5977320eb",
          "code": "3259",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3259",
          "code_system": "PUBCHEM",
          "references": [
            "3d6e5b4d-dc58-41d7-8f07-3abec960a325"
          ]
        },
        {
          "uuid": "ae83bd40-360d-488a-9922-c2e94e7bf345",
          "code": "548-25-4",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=548-25-4",
          "code_system": "CAS",
          "references": [
            "8ba758d1-4cfc-419c-b583-b33f6206950e",
            "3b7fe126-a09e-4cd9-bc9c-d37f6d28e38b"
          ]
        },
        {
          "uuid": "f8d0c438-53b7-3a58-2105-35339b681fe2",
          "code": "DTXSID7044843",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7044843",
          "code_system": "EPA CompTox",
          "references": [
            "b9e9c4bf-c9f0-3930-9ada-3cba565cda1b"
          ]
        },
        {
          "uuid": "02f3867c-7c44-fb1d-1119-dab91a49287b",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e4a57007-a06d-fe12-1c6d-c6f72541bd36"
          ]
        },
        {
          "uuid": "eae53318-9a9a-4f1b-ada4-9f8b9c593cf3",
          "code": "1A878FZQ9B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "496e697e-2798-fb53-bbd2-fbeb8a0d2d84",
          "code": "61000",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:61000",
          "code_system": "CHEBI",
          "references": [
            "e4a57007-a06d-fe12-1c6d-c6f72541bd36"
          ]
        },
        {
          "uuid": "fa4da933-6f48-eefa-7b93-de7a805247c1",
          "code": "1A878FZQ9B",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1A878FZQ9B",
          "code_system": "DAILYMED",
          "references": [
            "6b8c94f9-0f76-ef99-820b-190338b905f0"
          ]
        },
        {
          "uuid": "abb3052d-a852-10f5-0077-2d003d8c9f4e",
          "code": "4905",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4905",
          "code_system": "NSC",
          "references": [
            "be0cdbf7-9377-75d2-816f-7f03b7249e24"
          ]
        },
        {
          "uuid": "018c8a4e-f4fc-2931-8a60-8d3653e258cd",
          "code": "328781",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=328781",
          "code_system": "NSC",
          "references": [
            "be0cdbf7-9377-75d2-816f-7f03b7249e24"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "77d37884-6654-42db-b3b2-0453231e9a2b",
          "amount": {
            "uuid": "a1895bc5-d69a-4242-9f98-cb10fef6e7bf"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "0f8b746e-7607-4cab-bc77-7bdb6f56a70b",
            "refuuid": "bffdb51a-60a0-4cb5-a05f-2892447feaf4",
            "name": "ERYTHROSINE SODIUM ANHYDROUS",
            "unii": "8TL7LH93FM",
            "linking_id": "8TL7LH93FM",
            "ref_pname": "ERYTHROSINE SODIUM ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e8e07719-f175-4b1c-beba-bc5d1fc514f6",
          "amount": {
            "uuid": "218996d7-a49a-4e23-b035-88f6e95c1499"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "fb22e427-6d64-4736-8f15-db0732fef114",
            "refuuid": "5cea5797-7d45-4bc9-a8cb-0cf0dd2bd436",
            "name": "FD&C RED NO. 3",
            "unii": "PN2ZH5LOQY",
            "linking_id": "PN2ZH5LOQY",
            "ref_pname": "FD&C RED NO. 3",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "84c7c575-c4b2-462c-85f4-c46c40ff475c",
          "amount": {
            "uuid": "0f571f3e-469c-4d67-8528-960adcbe6b05"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "529e5bdd-89c2-44d5-835f-369942fe9060",
            "refuuid": "7e7097ed-ede2-4369-a577-9c4e59b0fc49",
            "name": "ALTERNATIVE DEFINITION for [TETRAIODOFLUORESCEIN]",
            "linking_id": "7e7097ed-ede2-4369-a577-9c4e59b0fc49",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "7eb632dd-14cf-4d3b-8f80-c381fdd92cad",
          "amount": {
            "uuid": "8a470a8e-73d8-450c-a14a-d426a04697a5"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "b784831b-f9a6-4042-b5e0-6df53a6a1774"
          ],
          "related_substance": {
            "uuid": "07ebedcc-c988-40a6-b96d-f6931362d6e1",
            "refuuid": "3c1e5db0-92c4-45c8-87dc-c9cf0a0c076f",
            "name": "FD&C Red No. 3 aluminum lake",
            "unii": "WXF83K327F",
            "linking_id": "WXF83K327F",
            "ref_pname": "FD&C Red No. 3 aluminum lake",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6bf778f5-4958-4b4d-904d-d1ec9b692c90",
          "name": "2',4',5',7'-TETRAIODOFLUORESCEIN",
          "stdName": "2',4',5',7'-TETRAIODOFLUORESCEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8eabe481-84fd-4d65-99b1-5cfc5a51ff45"
          ],
          "display_name": false
        },
        {
          "uuid": "0bbc2fae-b9eb-4585-a7a3-5be10c0cc493",
          "name": "3',6'-DIHYDROXY-2',4',5',7'-TETRAIODO-3H-SPIRO(2-BENZOFURAN-1,9'-XANTHEN)-3-ONE",
          "stdName": "3',6'-DIHYDROXY-2',4',5',7'-TETRAIODO-3H-SPIRO(2-BENZOFURAN-1,9'-XANTHEN)-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f084308-efd0-4fee-b51a-9f356066e61c",
            "e0e7f061-7e62-4ff5-8ddb-649d0add4704"
          ],
          "display_name": false
        },
        {
          "uuid": "5fa6f7ac-8d77-430c-a217-f52850ca26b7",
          "name": "C.I. 45430:2",
          "stdName": "C.I. 45430:2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ba758d1-4cfc-419c-b583-b33f6206950e",
            "23830fdc-01e2-427e-b165-102d09b90422"
          ],
          "display_name": false
        },
        {
          "uuid": "4ce08908-09b7-faee-f7e0-e0dd77260227",
          "name": "CI 45430:2",
          "stdName": "CI 45430:2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b784831b-f9a6-4042-b5e0-6df53a6a1774"
          ],
          "display_name": false
        },
        {
          "uuid": "24aa5bcc-0f93-5315-09a2-0e1c0dfa8ab9",
          "name": "ERYTHROSIN",
          "stdName": "ERYTHROSIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ba758d1-4cfc-419c-b583-b33f6206950e"
          ],
          "display_name": false
        },
        {
          "uuid": "8f128ef9-d9df-4fe9-a7c0-279ea0f1c42a",
          "name": "ERYTHROSIN B",
          "stdName": "ERYTHROSIN B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23830fdc-01e2-427e-b165-102d09b90422",
            "4b645f6e-ec3f-4b94-8f60-85abb21cd976"
          ],
          "display_name": false
        },
        {
          "uuid": "f0e3d5c8-8e56-4b64-8357-f6e40b2a2f90",
          "name": "ERYTHROSINE ACID",
          "stdName": "ERYTHROSINE ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ba758d1-4cfc-419c-b583-b33f6206950e",
            "23830fdc-01e2-427e-b165-102d09b90422"
          ],
          "display_name": false
        },
        {
          "uuid": "dc55610b-0fa3-4659-baf7-4f6abc689b1b",
          "name": "ERYTHROSINE J",
          "stdName": "ERYTHROSINE J",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ba758d1-4cfc-419c-b583-b33f6206950e",
            "23830fdc-01e2-427e-b165-102d09b90422"
          ],
          "display_name": false
        },
        {
          "uuid": "5a68b64f-620a-49c2-9e12-e1385e4f262d",
          "name": "NSC-328781",
          "stdName": "NSC-328781",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ba758d1-4cfc-419c-b583-b33f6206950e",
            "23830fdc-01e2-427e-b165-102d09b90422"
          ],
          "display_name": false
        },
        {
          "uuid": "8330d99e-ae8f-ba05-02be-699c795bd1ec",
          "name": "NSC-4905",
          "stdName": "NSC-4905",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ba758d1-4cfc-419c-b583-b33f6206950e"
          ],
          "display_name": false
        },
        {
          "uuid": "4aa2a0d0-21ff-45eb-9563-fa9974695516",
          "name": "SOLVENT RED 140",
          "stdName": "SOLVENT RED 140",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ba758d1-4cfc-419c-b583-b33f6206950e",
            "23830fdc-01e2-427e-b165-102d09b90422"
          ],
          "display_name": false
        },
        {
          "uuid": "894928f5-e37e-4301-aa74-585566eb23a6",
          "name": "TETRAIODOFLUORESCEIN",
          "stdName": "TETRAIODOFLUORESCEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23830fdc-01e2-427e-b165-102d09b90422",
            "5f0eb2f3-89df-41d2-9019-04d1b9b58217"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "8eabe481-84fd-4d65-99b1-5cfc5a51ff45",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e0e7f061-7e62-4ff5-8ddb-649d0add4704",
          "citation": "ACD 8.0(21CFR74.1260",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f084308-efd0-4fee-b51a-9f356066e61c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ba758d1-4cfc-419c-b583-b33f6206950e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23830fdc-01e2-427e-b165-102d09b90422",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f0eb2f3-89df-41d2-9019-04d1b9b58217",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b645f6e-ec3f-4b94-8f60-85abb21cd976",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d6e5b4d-dc58-41d7-8f07-3abec960a325",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "160c0899-970c-4318-8f2f-d40adbfbe564",
          "citation": "SRS import [1A878FZQ9B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1A878FZQ9B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0dd4bab8-bd6c-4545-a3fa-2bf13621bd66",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9e9c4bf-c9f0-3930-9ada-3cba565cda1b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15905-32-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e4a57007-a06d-fe12-1c6d-c6f72541bd36",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "dfcf71a7-74ec-d7da-568b-22f7d5fa0064",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "b784831b-f9a6-4042-b5e0-6df53a6a1774",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3b7fe126-a09e-4cd9-bc9c-d37f6d28e38b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "be0cdbf7-9377-75d2-816f-7f03b7249e24",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6b8c94f9-0f76-ef99-820b-190338b905f0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "06ae2879-5805-4a4b-b51f-6bcd0304fa48",
          "id": "06ae2879-5805-4a4b-b51f-6bcd0304fa48",
          "molfile": "\n  Marvin  01132100382D          \n\n 29 33  0  0  0  0            999 V2000\n   -0.6329   -1.4231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1681   -1.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1673   -2.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5512   -2.8782    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8805   -2.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5937   -2.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5957   -1.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3091   -1.2251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0249   -1.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7360   -1.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7326   -0.4053    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4489   -1.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1616   -1.2277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4500   -2.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1616   -2.8811    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7368   -2.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0219   -2.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3016   -2.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0969   -3.0881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7296   -3.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5229   -3.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0093   -4.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0086   -4.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2904   -5.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5782   -4.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5827   -4.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2962   -3.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8792   -1.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8748   -0.4024    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 28  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6 18  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 28  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 17  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 27  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 27 22  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(=O)OC23c4cc(c(c(c4Oc5c3cc(c(c5I)O)I)I)O)I",
          "formula": "C20H8I4O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d718eee9-e1c8-4e34-8de7-d8452be1a430"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "835.8932",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "43bf2112-c2c7-4db0-992b-ccec587961a2",
      "version": "14",
      "structure": {
        "id": "0ae5bb4e-fc5d-41c1-8a19-5612411f8a23",
        "molfile": "\n  Marvin  01132100492D          \n\n 29 33  0  0  0  0            999 V2000\n    0.1681   -1.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1673   -2.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8805   -2.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8792   -1.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5957   -1.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5937   -2.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3091   -1.2251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0249   -1.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4500   -2.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4489   -1.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7360   -1.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5827   -4.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5782   -4.9335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2904   -5.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0086   -4.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6329   -1.4231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8748   -0.4024    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7326   -0.4053    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1616   -1.2277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0219   -2.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3016   -2.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2962   -3.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0093   -4.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7296   -3.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7368   -2.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0969   -3.0881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5229   -3.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1616   -2.8811    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5512   -2.8782    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n 12 13  1  0  0  0  0\n  3  6  2  0  0  0  0\n 13 14  2  0  0  0  0\n  5  7  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 23  2  0  0  0  0\n  6 21  1  0  0  0  0\n  1 16  1  0  0  0  0\n  8  7  1  0  0  0  0\n  4 17  1  0  0  0  0\n  1  2  2  0  0  0  0\n 11 18  1  0  0  0  0\n  8 20  2  0  0  0  0\n 10 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n  5  4  2  0  0  0  0\n 25  9  2  0  0  0  0\n  4  1  1  0  0  0  0\n  9 10  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10 11  2  0  0  0  0\n 20 25  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 11  8  1  0  0  0  0\n 21 26  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  2  0  0  0  0\n 22 12  2  0  0  0  0\n  9 28  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 29  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)OC23c4cc(c(c(c4Oc5c3cc(c(c5I)O)I)I)O)I",
        "formula": "C20H8I4O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "835.8932",
        "optical_activity": "NONE",
        "references": [
          "160c0899-970c-4318-8f2f-d40adbfbe564",
          "0dd4bab8-bd6c-4545-a3fa-2bf13621bd66"
        ],
        "stereo_centers": 0
      },
      "unii": "1A878FZQ9B"
    }
  ]
}