{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b7759c9a-c77a-4538-b0ca-b0ec81b17fbb",
          "code": "3415-62-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3415-62-1",
          "code_system": "CAS",
          "references": [
            "2d4c1043-bf26-4319-af8a-709331257caa",
            "bca21f91-3ec1-4f0d-823d-fe0e3ade93e5"
          ]
        },
        {
          "uuid": "9386792d-7119-4e38-8340-27fbb65d60b4",
          "code": "198822",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/198822",
          "code_system": "PUBCHEM",
          "references": [
            "2d4c1043-bf26-4319-af8a-709331257caa"
          ]
        },
        {
          "uuid": "de3bb14e-85bb-4022-9246-e6b71199e9f4",
          "code": "1A240UYN3Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0be185e8-b5f5-91ce-aa25-8a1aa4026dea",
          "code": "84641",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=84641",
          "code_system": "NSC",
          "references": [
            "9b2e5341-4b38-bc66-851f-35df5b32ef19"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "dc806208-dad1-451e-93cf-2fe63ead83cc",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "31e592c8-385a-40b4-aefc-6279d5bb46f7",
            "refuuid": "c16a95a0-e75e-4749-abde-acfb32336563",
            "name": "N-METHYL-3,3'-DIMESYLOXYDIPROPYLAMINE",
            "unii": "516Y26AZ8Z",
            "linking_id": "516Y26AZ8Z",
            "ref_pname": "N-METHYL-3,3'-DIMESYLOXYDIPROPYLAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f668c543-46e5-4c92-87a3-0f083c1f02f0",
          "name": "1-PROPANOL, 3,3'-(METHYLIMINO)DI-, DIMETHANESULFONATE (ESTER), HYDROCHLORIDE",
          "stdName": "1-PROPANOL, 3,3'-(METHYLIMINO)DI-, DIMETHANESULFONATE (ESTER), HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "153f4a74-276c-4b0f-a5ca-31a9a59ca540",
            "358014c0-b57b-4129-b9a3-78a72d131ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "5e332875-db6f-482c-8091-216728e106d9",
          "name": "1-PROPANOL, 3,3'-(METHYLIMINO)DI-, DIMETHANESULFONATE, HYDROCHLORIDE",
          "stdName": "1-PROPANOL, 3,3'-(METHYLIMINO)DI-, DIMETHANESULFONATE, HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "153f4a74-276c-4b0f-a5ca-31a9a59ca540",
            "358014c0-b57b-4129-b9a3-78a72d131ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "c10cfc60-1a5e-4e3b-8a0d-d6afec640b3c",
          "name": "3,3'-(METHYLIMINO)DI-1-PROPANOLDIMETHANESULFONATE HYDROCHLORIDE",
          "stdName": "3,3'-(METHYLIMINO)DI-1-PROPANOLDIMETHANESULFONATE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "153f4a74-276c-4b0f-a5ca-31a9a59ca540",
            "358014c0-b57b-4129-b9a3-78a72d131ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "355ca78d-c710-4bba-b8b9-e3eb2cd768b8",
          "name": "838",
          "stdName": "838",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "153f4a74-276c-4b0f-a5ca-31a9a59ca540",
            "358014c0-b57b-4129-b9a3-78a72d131ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "57857243-0a25-40f3-8d2f-fccd66c8ddb4",
          "name": "METHYLBIS(3-MESYLOXYPROPYL)AMINE HYDROCHLORIDE",
          "stdName": "METHYLBIS(3-MESYLOXYPROPYL)AMINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "153f4a74-276c-4b0f-a5ca-31a9a59ca540",
            "358014c0-b57b-4129-b9a3-78a72d131ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "7b200fe7-b6d4-4814-bde8-c1e6b13ea5c5",
          "name": "N-METHYL-3,3'-DIMESYLOXYDIPROPYLAMINE HYDROCHLORIDE",
          "stdName": "N-METHYL-3,3'-DIMESYLOXYDIPROPYLAMINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "153f4a74-276c-4b0f-a5ca-31a9a59ca540",
            "358014c0-b57b-4129-b9a3-78a72d131ddc"
          ],
          "display_name": true
        },
        {
          "uuid": "2972d4bd-03ad-4141-818b-89cebc626b03",
          "name": "N-METHYL-N,N-BIS(3-MESYLOXYPROPYL)AMINE HYDROCHLORIDE",
          "stdName": "N-METHYL-N,N-BIS(3-MESYLOXYPROPYL)AMINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "153f4a74-276c-4b0f-a5ca-31a9a59ca540",
            "358014c0-b57b-4129-b9a3-78a72d131ddc"
          ],
          "display_name": false
        },
        {
          "uuid": "94094751-169b-4fe7-b390-ada188c2953e",
          "name": "NSC-84641",
          "stdName": "NSC-84641",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "153f4a74-276c-4b0f-a5ca-31a9a59ca540",
            "358014c0-b57b-4129-b9a3-78a72d131ddc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "358014c0-b57b-4129-b9a3-78a72d131ddc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "153f4a74-276c-4b0f-a5ca-31a9a59ca540",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d4c1043-bf26-4319-af8a-709331257caa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394147000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dd4014a-2ee7-4344-8122-48e7e42acddb",
          "citation": "SRS import [1A240UYN3Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1A240UYN3Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394147000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b2e5341-4b38-bc66-851f-35df5b32ef19",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bca21f91-3ec1-4f0d-823d-fe0e3ade93e5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9fbdf26a-1be7-4b1f-b5ed-1430dc690c9f",
          "id": "9fbdf26a-1be7-4b1f-b5ed-1430dc690c9f",
          "molfile": "\n  Marvin  01132108182D          \n\n  1  0  0  0  0  0            999 V2000\n    9.6620  -12.8480    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5f50b6c0-d741-4da3-b134-fb9f8e80838f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2d79f166-c6c5-4b88-9c13-b439145f8051",
          "id": "2d79f166-c6c5-4b88-9c13-b439145f8051",
          "molfile": "\n  Marvin  01132102272D          \n\n 18 17  0  0  0  0            999 V2000\n    7.4790  -12.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4790  -11.1768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1923  -10.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9102  -11.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6236  -10.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3370  -11.1768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0502  -10.7623    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4600  -11.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7636  -10.3527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6405  -10.0491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7656  -10.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0523  -11.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3390  -10.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6255  -11.1768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9076  -10.7624    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4980  -11.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1943  -10.3527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3220  -10.0491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  7 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 15 18  2  0  0  0  0\nM  END",
          "smiles": "CN(CCCOS(=O)(=O)C)CCCOS(=O)(=O)C",
          "formula": "C9H21NO6S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b25c66e0-fdf0-4ee6-a8b3-07faac1f575d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "303.3987",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b566e58d-648f-401f-922a-cdbdf6378a43",
      "version": "3",
      "structure": {
        "id": "28531553-915d-4bc8-b4ed-3dc0460b601c",
        "molfile": "\n  Marvin  01132102122D          \n\n 19 17  0  0  0  0            999 V2000\n   10.3370  -11.1768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0502  -10.7623    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4600  -11.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7636  -10.3527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6405  -10.0491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6236  -10.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9102  -11.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1923  -10.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4790  -11.1768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7656  -10.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0523  -11.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3390  -10.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6255  -11.1768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9076  -10.7624    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4980  -11.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1943  -10.3527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3220  -10.0491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4790  -12.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6620  -12.8480    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 14 17  2  0  0  0  0\n  9 18  1  0  0  0  0\nM  END",
        "smiles": "CN(CCCOS(=O)(=O)C)CCCOS(=O)(=O)C.Cl",
        "formula": "C9H21NO6S2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "339.8596",
        "optical_activity": "NONE",
        "references": [
          "3dd4014a-2ee7-4344-8122-48e7e42acddb",
          "358014c0-b57b-4129-b9a3-78a72d131ddc"
        ],
        "stereo_centers": 0
      },
      "unii": "1A240UYN3Z"
    }
  ]
}