{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6c3b3633-e0ac-49f9-b139-451f9be759bf",
          "code": "476-66-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=476-66-4",
          "code_system": "CAS",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96",
            "37a664f8-347f-4e5a-9bd2-278421645c0a"
          ]
        },
        {
          "uuid": "f510c948-521e-401c-ba91-c8b8637a9e45",
          "code": "C63641",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C63641",
          "code_system": "NCI_THESAURUS",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "a2426aac-d364-4d0e-a62d-83b83f79e75f",
          "code": "D004610",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004610",
          "code_system": "MESH",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "bffcba66-aafa-40d4-8cd4-06f4c3c8995e",
          "code": "ELLAGIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ellagic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "9303a18f-0e7c-4980-b9da-206507d63df8",
          "code": "SUB06488MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "ff732705-30a5-49fe-a5e7-9e4d9a1f82b2",
          "code": "2667",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2667",
          "code_system": "INN",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "493d2da6-9542-4321-8da4-932c36f8d4fa",
          "code": "1043181",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1043181/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "edc26b94-c65a-4df4-8a38-b6c77688b9d8",
          "code": "m4872",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4872?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "f7c859d0-c133-4d40-893b-aacd311f8d27",
          "code": "CHEMBL6246",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL6246",
          "code_system": "ChEMBL",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "8c998133-535f-4222-91d5-ac127858d14f",
          "code": "207-508-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.827",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "effbcfa9-d5dd-40c7-9aeb-d628db2b0cbb",
          "code": "5281855",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281855",
          "code_system": "PUBCHEM",
          "references": [
            "25ae8875-bba1-4127-a112-e2da08d00f96"
          ]
        },
        {
          "uuid": "d8065ef0-0880-72db-ee53-b50852d7acf1",
          "code": "7574",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7574",
          "code_system": "HSDB",
          "references": [
            "1e8225ab-bc5d-4422-0ef6-740a3d8d794d"
          ]
        },
        {
          "uuid": "875344dc-e428-adb0-e771-aab33bd0b7fd",
          "code": "DTXSID2020557",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2020557",
          "code_system": "EPA CompTox",
          "references": [
            "53ada5b2-45f6-1714-ca95-554dfa98ff1c"
          ]
        },
        {
          "uuid": "aa172074-e393-9693-ffa0-fc3b31369888",
          "code": "C68538",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Tannin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68538",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ff827b1a-d1f2-0064-4775-13df7d9b2810"
          ]
        },
        {
          "uuid": "395e5945-5221-4f5e-a41c-4ccaa3b55d87",
          "code": "19YRN3ZS9P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e5df87dd-88f9-61a6-4a9e-85c97f75bda1",
          "code": "1236 (Number of products:47)",
          "comments": "Dietary Supplement Label Database|Botanical|Ellagic Acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1236&item=Ellagic Acid",
          "code_system": "DSLD",
          "references": [
            "ff827b1a-d1f2-0064-4775-13df7d9b2810"
          ]
        },
        {
          "uuid": "488dc992-e8f2-84d8-9153-c52132deb6c6",
          "code": "DB08846",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08846",
          "code_system": "DRUG BANK",
          "references": [
            "ff827b1a-d1f2-0064-4775-13df7d9b2810"
          ]
        },
        {
          "uuid": "3ea92ddb-5d64-119e-596b-785976bbf109",
          "code": "4775",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4775",
          "code_system": "CHEBI",
          "references": [
            "ff827b1a-d1f2-0064-4775-13df7d9b2810"
          ]
        },
        {
          "uuid": "7b308c2b-804f-cd32-5734-2dc7a4558718",
          "code": "100000080747",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a5dffcd8-5e6e-4a8c-8281-67b6ea293a40"
          ]
        },
        {
          "uuid": "d0868948-62a8-a09d-07e4-36ba5f9d353d",
          "code": "656272",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=656272",
          "code_system": "NSC",
          "references": [
            "d14534d9-c959-0b58-1d0b-91bf56eb6936"
          ]
        },
        {
          "uuid": "b5c4a1d4-2ee2-d3d2-f387-59d7c1982aac",
          "code": "407286",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=407286",
          "code_system": "NSC",
          "references": [
            "d14534d9-c959-0b58-1d0b-91bf56eb6936"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "40f2eb5b-770a-4246-8422-a640963f7fda",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "1e93f060-b59b-44b7-89cd-5b039aeb1464",
            "refuuid": "9ef63249-390f-4942-8f9f-941fa76b3f45",
            "name": "ELLAGIC ACID",
            "unii": "19YRN3ZS9P",
            "linking_id": "19YRN3ZS9P",
            "ref_pname": "ELLAGIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1d1fc4fe-7331-4b95-ada8-9da61310cefa",
          "amount": {
            "uuid": "f0e327a3-80a8-4b18-a196-0cd30e529343"
          },
          "comments": "FORMED BY MICROFLORA",
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "d5682274-0e07-4b98-be59-2e391f3933a9"
          ],
          "related_substance": {
            "uuid": "c0d40404-db56-40a4-ad66-fcf206af05e0",
            "refuuid": "41841930-4044-4843-8221-23cf4e11165f",
            "name": "UROLITHIN A",
            "unii": "ILJ8NEF6DT",
            "linking_id": "ILJ8NEF6DT",
            "ref_pname": "UROLITHIN A"
          }
        },
        {
          "uuid": "e3455fdb-9bdf-4fa6-8f67-b51a4cdab05b",
          "amount": {
            "uuid": "59b52cfc-3988-40f5-ac55-0770cb6c3aa7"
          },
          "type": "PARENT->METABOLITE",
          "mediator_substance": {
            "uuid": "0ef5d70b-f30b-4145-81fb-aac0f1f98c73",
            "refuuid": "9b589a87-c467-4633-b380-236e9f5e39bb",
            "name": "INTESTINAL MICROBIOTA",
            "unii": "7V624678YX",
            "linking_id": "7V624678YX",
            "ref_pname": "INTESTINAL MICROBIOTA",
            "substance_class": "reference"
          },
          "references": [
            "8362f236-68a1-4205-a407-382c363283b3"
          ],
          "related_substance": {
            "uuid": "f349cf11-6391-4731-a619-5d501a3b201b",
            "refuuid": "e2eaa401-b25e-47c1-abaa-75f4bd6cf546",
            "name": "PUNICALAGIN",
            "unii": "9S9XW36W2A",
            "linking_id": "9S9XW36W2A",
            "ref_pname": "PUNICALAGIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4a2dc0bf-b0df-448d-b4c1-b31191a22541",
          "name": "2,3,7,8-TETRAHYDROXY(1)BENZOPYRANO(5,4,3-CDE)-(1)BENZOPYRAN-5,10-DIONE",
          "stdName": "2,3,7,8-TETRAHYDROXY(1)BENZOPYRANO(5,4,3-CDE)-(1)BENZOPYRAN-5,10-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f045e36-2392-4247-9ced-5dea9c8512cf"
          ],
          "display_name": false
        },
        {
          "uuid": "05efcef2-160e-41cd-b7fb-cefaf7837ca4",
          "name": "ELLAGIC ACID",
          "stdName": "ELLAGIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "172a095d-5621-4e4d-8b3e-cfb91754f83b",
            "d3fa4319-173e-42f5-b93b-64003862f3e3",
            "f7b12506-8f5b-40fc-aa5a-64f3ecd1f33c",
            "89d97e78-2e0e-4861-9565-77b25ee8d8bc",
            "e24a0f3e-7207-43b2-9a06-62e2a42ac66e",
            "31e7dbe0-bac8-44bc-aa97-19a16b938e4b",
            "66ddb915-9160-4682-a810-ed5d00fcf8b4",
            "1ba0039c-e7b5-4ee1-83e4-79590b7e5d5d",
            "1f045e36-2392-4247-9ced-5dea9c8512cf",
            "5cce7f57-b3c8-4cbf-be6e-484303dd5fa9",
            "ca9fc59b-675d-428d-b0c5-b1086bfd7c90"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1a2ad6bf-e837-4a34-826c-e0395853051b",
              "name_org": "INN"
            },
            {
              "uuid": "876e9674-dbee-43e7-82f3-083d87099318",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5cc326cf-4367-4528-9ccd-9aca254583cd",
          "name": "ELLAGIC ACID [HSDB]",
          "stdName": "ELLAGIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89d97e78-2e0e-4861-9565-77b25ee8d8bc"
          ],
          "display_name": false
        },
        {
          "uuid": "1f23827c-f92a-4a1f-a14e-aaf2ad2bb606",
          "name": "ELLAGIC ACID [MI]",
          "stdName": "ELLAGIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31e7dbe0-bac8-44bc-aa97-19a16b938e4b"
          ],
          "display_name": false
        },
        {
          "uuid": "e068e4db-91ed-183f-6fda-7f0c7cb9cea5",
          "name": "Ellagic acid [WHO-DD]",
          "stdName": "ELLAGIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9245af4-bff6-5464-52ff-ffac538bc2a6"
          ],
          "display_name": false
        },
        {
          "uuid": "bbd7f2fc-783f-41dd-a280-603ecbfe4c2b",
          "name": "NSC-407286",
          "stdName": "NSC-407286",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc666e69-d4cb-445a-b8d7-ef28046583d7"
          ],
          "display_name": false
        },
        {
          "uuid": "c3c17691-f1a2-4561-a026-559e4beb0eea",
          "name": "NSC-656272",
          "stdName": "NSC-656272",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc666e69-d4cb-445a-b8d7-ef28046583d7"
          ],
          "display_name": false
        },
        {
          "uuid": "57912761-0f10-489c-8029-d945055889d8",
          "name": "ellagic acid [INN]",
          "stdName": "ELLAGIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7b12506-8f5b-40fc-aa5a-64f3ecd1f33c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1f045e36-2392-4247-9ced-5dea9c8512cf",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f7b12506-8f5b-40fc-aa5a-64f3ecd1f33c",
          "citation": "INN Proposed List 21",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL21.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31e7dbe0-bac8-44bc-aa97-19a16b938e4b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e24a0f3e-7207-43b2-9a06-62e2a42ac66e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89d97e78-2e0e-4861-9565-77b25ee8d8bc",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "172a095d-5621-4e4d-8b3e-cfb91754f83b",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc666e69-d4cb-445a-b8d7-ef28046583d7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25ae8875-bba1-4127-a112-e2da08d00f96",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389717000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8458ca51-0408-4ccf-9fcf-ecba22567c78",
          "citation": "SRS import [19YRN3ZS9P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=19YRN3ZS9P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389717000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3fa4319-173e-42f5-b93b-64003862f3e3",
          "citation": "ELLAGIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "66ddb915-9160-4682-a810-ed5d00fcf8b4",
          "citation": "ELLAGIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1ba0039c-e7b5-4ee1-83e4-79590b7e5d5d",
          "citation": "ELLAGIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ca9fc59b-675d-428d-b0c5-b1086bfd7c90",
          "citation": "ELLAGIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5cce7f57-b3c8-4cbf-be6e-484303dd5fa9",
          "citation": "ELLAGIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e8225ab-bc5d-4422-0ef6-740a3d8d794d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+476-66-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "53ada5b2-45f6-1714-ca95-554dfa98ff1c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=476-66-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a5dffcd8-5e6e-4a8c-8281-67b6ea293a40",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8362f236-68a1-4205-a407-382c363283b3",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Punicalagin",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ff827b1a-d1f2-0064-4775-13df7d9b2810",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "47ec65bb-ebe8-4480-80d2-44b7899fe889",
          "citation": "https://en.wikipedia.org/wiki/Urolithin_A",
          "url": "https://en.wikipedia.org/wiki/Urolithin_A",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "37a664f8-347f-4e5a-9bd2-278421645c0a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d14534d9-c959-0b58-1d0b-91bf56eb6936",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d9245af4-bff6-5464-52ff-ffac538bc2a6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d5682274-0e07-4b98-be59-2e391f3933a9",
          "citation": "https://en.wikipedia.org/wiki/Urolithin_A",
          "url": "https://en.wikipedia.org/wiki/Urolithin_A",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "244a8d9e-546e-45af-8e07-2415f927ff72",
          "id": "244a8d9e-546e-45af-8e07-2415f927ff72",
          "molfile": "\n  Marvin  01132102012D          \n\n 22 25  0  0  0  0            999 V2000\n    2.0717    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4954   -0.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3090   -0.7233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7069   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2884   -2.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6992   -2.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5335   -2.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9441   -2.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7760   -2.1569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5335   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9441   -0.7233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2806   -3.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6992   -4.2958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4644   -3.5751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0639   -2.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4825   -2.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0717   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2399   -1.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8318   -2.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.1414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2399   -2.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8318   -3.5751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 17  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n 10  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 16  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 12  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 21 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 21  2  0  0  0  0\nM  END",
          "smiles": "c1c2c3c4c(cc(c(=O)c4oc2O)O)c(O)oc3c(=O)c1O",
          "formula": "C14H6O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "956cb933-91be-4d5e-9880-31e792115cdf"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "302.1932",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9ef63249-390f-4942-8f9f-941fa76b3f45",
      "version": "19",
      "structure": {
        "id": "deab491b-42ee-43ed-be7e-20ef5cbf276b",
        "molfile": "\n  Marvin  01132111322D          \n\n 22 25  0  0  0  0            999 V2000\n    3.2884   -2.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4825   -2.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0639   -2.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7069   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6992   -2.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0717   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3090   -0.7233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4644   -3.5751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4954   -0.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2806   -3.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5335   -1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2399   -2.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2399   -1.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5335   -2.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8318   -2.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9441   -2.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0717    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6992   -4.2958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9441   -0.7233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8318   -3.5751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.1414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7760   -2.1569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  6  2  0  0  0  0\n 14  5  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17  9  2  0  0  0  0\n 18 10  2  0  0  0  0\n 19 11  1  0  0  0  0\n 20 12  1  0  0  0  0\n 21 15  1  0  0  0  0\n 22 16  1  0  0  0  0\n 11 16  2  0  0  0  0\n  3  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n 12 15  2  0  0  0  0\nM  END",
        "smiles": "c1c2c3c4c(cc(c(c4oc2=O)O)O)c(=O)oc3c(c1O)O",
        "formula": "C14H6O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "302.1932",
        "optical_activity": "NONE",
        "references": [
          "1f045e36-2392-4247-9ced-5dea9c8512cf",
          "8458ca51-0408-4ccf-9fcf-ecba22567c78",
          "f7b12506-8f5b-40fc-aa5a-64f3ecd1f33c"
        ],
        "stereo_centers": 0
      },
      "unii": "19YRN3ZS9P"
    }
  ]
}