{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4508e2d0-493b-49c2-8198-80263ca3d656",
          "code": "141-02-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=141-02-6",
          "code_system": "CAS",
          "references": [
            "f61a60e8-6013-42ea-a022-2a34a86e5515",
            "8d647028-7fe1-4346-81a2-c621a3d0abde"
          ]
        },
        {
          "uuid": "49950577-c800-4f37-a1d5-6162848e8521",
          "code": "205-448-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.954",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f61a60e8-6013-42ea-a022-2a34a86e5515"
          ]
        },
        {
          "uuid": "29c39eef-31f7-436f-9bd6-5ce7aca70cc8",
          "code": "5370325",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5370325",
          "code_system": "PUBCHEM",
          "references": [
            "f61a60e8-6013-42ea-a022-2a34a86e5515"
          ]
        },
        {
          "uuid": "04036da5-ceaa-f60f-db01-07755f1a933b",
          "code": "DTXSID2051710",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2051710",
          "code_system": "EPA CompTox",
          "references": [
            "665fb0a6-8412-0eb0-f180-68fd2e642b72"
          ]
        },
        {
          "uuid": "b7ca4b74-8664-4231-9de1-82c67a4fc578",
          "code": "19Q90W09ES",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "699f8f99-d766-409a-9e7b-75916ec91c64",
          "name": "(±)-DI(2-ETHYLHEXYL) FUMARATE",
          "stdName": "(+/-)-DI(2-ETHYLHEXYL) FUMARATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "b8d8693c-9d7b-4c0a-a444-c798ee2dc885"
          ],
          "display_name": false
        },
        {
          "uuid": "6c239e1f-15d0-4fa8-b4c7-06cdb3c144c2",
          "name": "2-BUTENEDIOIC ACID (2E)-, 1,4-BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "2-BUTENEDIOIC ACID (2E)-, 1,4-BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "e4155eb3-64d6-4718-8f2b-920757b86f41"
          ],
          "display_name": false
        },
        {
          "uuid": "c0ea8dda-bcab-42c3-9b15-faec011c7dbe",
          "name": "2-BUTENEDIOIC ACID (2E)-, BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "2-BUTENEDIOIC ACID (2E)-, BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "e4155eb3-64d6-4718-8f2b-920757b86f41"
          ],
          "display_name": false
        },
        {
          "uuid": "5919fe3e-d09d-4f6e-abd0-65f843d0d0a4",
          "name": "2-BUTENEDIOIC ACID (E)-, BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "2-BUTENEDIOIC ACID (E)-, BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "e4155eb3-64d6-4718-8f2b-920757b86f41"
          ],
          "display_name": false
        },
        {
          "uuid": "31d062c7-791b-4c5b-bf55-27b425ac79c0",
          "name": "2-ETHYLHEXYL FUMARATE",
          "stdName": "2-ETHYLHEXYL FUMARATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "e4155eb3-64d6-4718-8f2b-920757b86f41"
          ],
          "display_name": false
        },
        {
          "uuid": "2c923c8b-c96a-419e-bed7-4ace5fe5a775",
          "name": "BERNEL ESTER 284",
          "stdName": "BERNEL ESTER 284",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "e71f933b-8bac-4c1e-af03-77631fa71b1e"
          ],
          "display_name": false
        },
        {
          "uuid": "af5addcc-708e-4a54-9e1b-4a99a5c23f6f",
          "name": "BIS(2-ETHYLHEXYL) FUMARATE",
          "stdName": "BIS(2-ETHYLHEXYL) FUMARATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "aea62e43-08d8-4119-b1d4-6f8a2709be68"
          ],
          "display_name": false
        },
        {
          "uuid": "3f6d1a88-b3ba-417a-921f-9236fb78ac9d",
          "name": "DI(2-ETHYLHEXYL) FUMARATE",
          "stdName": "DI(2-ETHYLHEXYL) FUMARATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "7f46056f-5981-436e-9963-0544ac5aaeb3"
          ],
          "display_name": false
        },
        {
          "uuid": "c15447a6-28e2-4e08-bbe3-a5d747853b6a",
          "name": "DI(2-ETHYLHEXYL) FUMARATE, (±)-",
          "stdName": "DI(2-ETHYLHEXYL) FUMARATE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "b8d8693c-9d7b-4c0a-a444-c798ee2dc885"
          ],
          "display_name": false
        },
        {
          "uuid": "f015782c-0d9f-4391-82f6-3c7990e67661",
          "name": "DIETHYLHEXYL FUMARATE",
          "stdName": "DIETHYLHEXYL FUMARATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
            "9f2c36c6-a66f-4729-b89a-f2ca2a841ed5",
            "e71f933b-8bac-4c1e-af03-77631fa71b1e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d2f27afa-8543-4ce4-9266-89a74a16899e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "07fa3857-08fa-4b60-969d-9693c5885281",
          "name": "Dioctyl fumarate (Di-2-ethylhexyl fumarate)",
          "stdName": "DIOCTYL FUMARATE (DI-2-ETHYLHEXYL FUMARATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8d8693c-9d7b-4c0a-a444-c798ee2dc885"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e71f933b-8bac-4c1e-af03-77631fa71b1e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a2c77e9f-8f0e-4100-91c1-57dfaeb524e9",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4155eb3-64d6-4718-8f2b-920757b86f41",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f46056f-5981-436e-9963-0544ac5aaeb3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8d8693c-9d7b-4c0a-a444-c798ee2dc885",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aea62e43-08d8-4119-b1d4-6f8a2709be68",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f61a60e8-6013-42ea-a022-2a34a86e5515",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391492000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12c955ce-f049-4722-b4eb-98e73679aec8",
          "citation": "SRS import [19Q90W09ES]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=19Q90W09ES",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391492000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f2c36c6-a66f-4729-b89a-f2ca2a841ed5",
          "citation": "DIETHYLHEXYL FUMARATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "665fb0a6-8412-0eb0-f180-68fd2e642b72",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=141-02-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d647028-7fe1-4346-81a2-c621a3d0abde",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a73807ae-b1d2-4b3c-a44b-1bfc4e2294a3",
          "id": "a73807ae-b1d2-4b3c-a44b-1bfc4e2294a3",
          "molfile": "\n  Marvin  01132108412D          \n\n 24 23  0  0  0  0            999 V2000\n    3.9716   -7.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7139   -7.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7697   -6.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5010   -6.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5603   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.8700   -4.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1349   -5.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2990   -4.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9969   -5.3402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7282   -4.9690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7839   -4.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4149   -5.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1388   -5.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8293   -5.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7773   -6.3203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5605   -5.1510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2547   -5.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9934   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   12.0528   -4.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3623   -3.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6913   -5.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6319   -6.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3260   -6.9587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2629   -7.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 21  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC",
          "formula": "C20H36O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6cd37d87-3936-4ad3-ac6a-95272c8ad335"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "340.4982",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "83f30a5e-5b04-4279-be4d-2860721b5a38",
      "version": "5",
      "structure": {
        "id": "886ec6b2-4e4d-4061-945e-bf6ee8177dbf",
        "molfile": "\n  Marvin  01132107052D          \n\n 24 23  0  0  0  0            999 V2000\n    3.9716   -7.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7139   -7.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1349   -5.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7697   -6.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8700   -4.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5010   -6.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5603   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2990   -4.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7839   -4.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9969   -5.3402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7282   -4.9690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4149   -5.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2629   -7.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7773   -6.3203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1388   -5.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3260   -6.9587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8293   -5.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3623   -3.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6319   -6.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5605   -5.1510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0528   -4.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6913   -5.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2547   -5.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9934   -5.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 15 12  2  0  0  0  0\n 16 13  1  0  0  0  0\n 17 14  2  0  0  0  0\n 17 15  1  0  0  0  0\n 19 16  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 18  1  0  0  0  0\n 22 19  1  0  0  0  0\n 23 20  1  0  0  0  0\n 24 21  1  0  0  0  0\n 24 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)/C=C/C(=O)OCC(CC)CCCC",
        "formula": "C20H36O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "340.4982",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e4155eb3-64d6-4718-8f2b-920757b86f41",
          "12c955ce-f049-4722-b4eb-98e73679aec8"
        ],
        "stereo_centers": 2
      },
      "unii": "19Q90W09ES"
    }
  ]
}