{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "840b265c-d6ef-4bdc-87c1-df58e7d5b341",
          "code": "79-83-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79-83-4",
          "code_system": "CAS",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61",
            "750aaac8-d4d4-4af1-b6d7-0172af4cd2eb"
          ]
        },
        {
          "uuid": "c8bbe82d-5197-44d2-88d8-0775aa7e378b",
          "code": "C47783",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47783",
          "code_system": "NCI_THESAURUS",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "b30891e6-21f5-49c6-89d8-4828ff03f22d",
          "code": "D010205",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010205",
          "code_system": "MESH",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "600e88eb-15ec-4e63-900a-a379b62833c4",
          "code": "NBK548710",
          "comments": "LiverTox|HDS: Nutritional Sup|Vitamins|Vitamin B",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548710/",
          "code_system": "LIVERTOX",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "3269064c-77ee-4c8a-af26-2abd47773c24",
          "code": "PANTOTHENIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pantothenic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "2644ff1e-4351-46ab-9846-bb62c1aa207b",
          "code": "m8388",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8388?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "85e3db0b-df89-4558-b4ac-c82c8f46583c",
          "code": "62400",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/62400/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "9cd7949e-434c-48e7-b38c-d7d9949c24d9",
          "code": "7891",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/7891/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "f1fddef1-b8f1-46bd-b4ef-74ebb16073f1",
          "code": "SUB127094",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "0a3015d9-58b1-47bc-8809-0b10e9780664",
          "code": "SUB14758MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "249c5934-ef04-4b4e-ac82-83d8ceab0ed1",
          "code": "CHEMBL1594",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1594",
          "code_system": "ChEMBL",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "51ab3027-8099-4c6b-b390-7a386c8bee3d",
          "code": "201-229-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.118",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "37fbcb93-7a67-42d7-9c33-42d1fa6b2b5f",
          "code": "6613",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6613",
          "code_system": "PUBCHEM",
          "references": [
            "297fb66a-a779-4dcc-bb6b-7ec7a816ba61"
          ]
        },
        {
          "uuid": "981a8d15-f8fd-92f6-a151-ca024bf7835a",
          "code": "1020",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1020",
          "code_system": "HSDB",
          "references": [
            "62905c8e-4abf-8b33-8c5a-b5bacea32f95"
          ]
        },
        {
          "uuid": "dbabe98c-9b66-001f-b4da-09ea86478380",
          "code": "DTXSID9023417",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9023417",
          "code_system": "EPA CompTox",
          "references": [
            "42f050b4-0651-47cd-4d55-551ec08c3c41"
          ]
        },
        {
          "uuid": "903ac265-af59-4cdf-212c-b2029645511d",
          "code": "C45812",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Vitamin[C944]|Water-Soluble Vitamin[C1551]|B Vitamin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45812",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "fb41642d-a546-7bec-f4d5-8d761b7609f4",
          "code": "75060-4",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Pantothenate/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/75060-4/",
          "code_system": "LOINC",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "bdee2e3d-176a-3914-48e9-fcab2f8bff0a",
          "code": "2722-7",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas/Bld|Pantothenate [Mass/volume] in Serum, Plasma or Blood",
          "type": "PRIMARY",
          "url": "https://loinc.org/2722-7/",
          "code_system": "LOINC",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "4de41db2-3e90-b529-753d-e14493a64d3b",
          "code": "27351-6",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas/Bld|Pantothenate [Presence] in Serum, Plasma or Blood",
          "type": "PRIMARY",
          "url": "https://loinc.org/27351-6/",
          "code_system": "LOINC",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "7babcda0-e3fb-92af-9040-e4931162838e",
          "code": "75066-1",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Pantothenate [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/75066-1/",
          "code_system": "LOINC",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "c7f2305e-3fb6-d7b5-9003-3a065327855f",
          "code": "2547 (Number of products:2298)",
          "comments": "Dietary Supplement Label Database|vitamin|Vitamin B5 (Pantothenic Acid)",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2547&item=Vitamin B5 (Pantothenic Acid)",
          "code_system": "DSLD",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "880cbb98-b93f-9ff0-2433-5aa2b2e8d3da",
          "code": "1791 (Number of products:46)",
          "comments": "Dietary Supplement Label Database|Vitamin|Vitamin B5",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1791&item=Vitamin B5",
          "code_system": "DSLD",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "64f8ca59-d0bc-7359-3341-42693224100a",
          "code": "DB01783",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB01783",
          "code_system": "DRUG BANK",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "d168cb0d-05fe-4f16-a572-e995a5feb5be",
          "code": "19F5HK2737",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d9dd04f0-03de-597a-f955-e12c9eefc837",
          "code": "176840",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:176840",
          "code_system": "CHEBI",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "8747640b-08c7-d9a6-0d7a-7f9410774c03",
          "code": "46905",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:46905",
          "code_system": "CHEBI",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "04f8e0cf-8736-98bc-a1c7-ef49b29fae68",
          "code": "16454",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16454",
          "code_system": "CHEBI",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "fe09f52e-4ff4-4df5-5d5e-9b08eefef364",
          "code": "7916",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:7916",
          "code_system": "CHEBI",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "34ca7a97-8e6f-1a88-6c39-5763403dc5d7",
          "code": "29032",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:29032",
          "code_system": "CHEBI",
          "references": [
            "b002bd66-dc93-6166-578c-8c57c08f977b"
          ]
        },
        {
          "uuid": "23ec94a1-633e-f7b7-6584-1d4bd8836eab",
          "code": "19F5HK2737",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=19F5HK2737",
          "code_system": "DAILYMED",
          "references": [
            "92aab3f0-5c04-6226-ba29-0dee1fab0f9a"
          ]
        },
        {
          "uuid": "36bd83d0-30a7-dfbd-3890-7b6203ab9b4d",
          "code": "100000091279",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b76d39d9-398c-c23c-53f4-6015e85b0f56"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3d8d5bd5-af41-4b5e-8428-6e22bd3150a7",
          "amount": {
            "uuid": "0795b07c-e893-4a48-b31c-446d9e153c5f"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d3bb7b83-6846-4f40-ba7d-aa813cb78584",
            "refuuid": "a8c059bf-106f-4ba8-8dc9-7ab2bf9b3ada",
            "name": "PANTOTHENIC ACID",
            "unii": "19F5HK2737",
            "linking_id": "19F5HK2737",
            "ref_pname": "PANTOTHENIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "063822ec-dfcd-4478-b622-2ae4d2de0fcb",
          "amount": {
            "uuid": "9c9cd65d-0ae5-495a-ba1d-86125c6c3ac2"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "943ea758-026d-4305-af9c-97e36da42c6c",
            "refuuid": "141b0144-a275-4f99-8ff0-93e67e152d21",
            "name": "SODIUM PANTOTHENATE",
            "unii": "OES0R93F0C",
            "linking_id": "OES0R93F0C",
            "ref_pname": "SODIUM PANTOTHENATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "03b96342-9ec6-4564-81e5-cfddfb0a0d60",
          "amount": {
            "uuid": "4b53e48d-f3a9-4591-bb7a-0c7fd1ca83f0"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "d932b46b-beda-4e56-bf59-0f184638df5a",
            "refuuid": "820cd30d-b561-4e3f-ace7-eb744a08e065",
            "name": "VIOMYCIN PANTOTHENATE SULFATE",
            "unii": "0JTB9X596D",
            "linking_id": "0JTB9X596D",
            "ref_pname": "VIOMYCIN PANTOTHENATE SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fd31b5ed-335c-449c-8468-f928dde2e4be",
          "amount": {
            "uuid": "c774d46d-41c0-4372-882f-92cc0016ffc8"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "6b82172b-1f47-433b-8e38-5b1c23660c64",
            "refuuid": "194fa185-6f79-4989-b6e1-22f1d6a01b7f",
            "name": "STREPTOMYCIN PANTOTHENATE",
            "unii": "XOQ162YYFV",
            "linking_id": "XOQ162YYFV",
            "ref_pname": "STREPTOMYCIN PANTOTHENATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d06d2282-e255-4200-9afb-9e56f2dc2fa9",
          "amount": {
            "uuid": "0c94786b-c0ab-4197-bb48-6410decf573f"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "ebcc4282-b743-44d3-881b-233c56595af4",
            "refuuid": "74d82409-95df-4a5e-bf27-6e361d297d01",
            "name": "CALCIUM PANTOTHENATE",
            "unii": "568ET80C3D",
            "linking_id": "568ET80C3D",
            "ref_pname": "CALCIUM PANTOTHENATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "896af9df-aabe-4857-98bf-db1f14a34b36",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "89e073eb-b508-4c5b-b001-e616d917df20",
            "refuuid": "0d35153b-c626-4ed7-b75b-d403c1b900d5",
            "name": "ALLANTOIN CALCIUM PANTOTHENATE",
            "unii": "SM1342S52N",
            "linking_id": "SM1342S52N",
            "ref_pname": "ALLANTOIN CALCIUM PANTOTHENATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9f7a8c72-394b-49ea-8c49-2d9b5aaa6aae",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "e3d7b0a8-4de9-4710-ab40-471ca4a0065a",
            "refuuid": "a18070df-a252-48f9-83f3-74426d5d42a9",
            "name": "DIHYDROSTREPTOMYCIN PANTOTHENATE",
            "unii": "4A47J84Y2K",
            "linking_id": "4A47J84Y2K",
            "ref_pname": "DIHYDROSTREPTOMYCIN PANTOTHENATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7aa99abe-d160-4873-b474-fe7e0ad932bb",
          "amount": {
            "uuid": "fb4416b4-f1a8-48cc-aec7-10b2b7296812"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "e9d1dfc7-4a44-4836-a577-06addcaa5871",
            "refuuid": "09cb4f36-8e10-44a6-871b-f3660dc5dda8",
            "name": "CALCIUM PANTOTHENATE, (S)-",
            "unii": "6IY177DF2V",
            "linking_id": "6IY177DF2V",
            "ref_pname": "CALCIUM PANTOTHENATE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d50c550d-4207-4a8b-8ee4-c53869b7b494",
          "amount": {
            "uuid": "b6760b38-0dba-4594-b02c-597be36479b3"
          },
          "type": "ENANTIOMER->ENANTIOMER",
          "related_substance": {
            "uuid": "229425e6-a665-426a-accd-8c7b70cb01b1",
            "refuuid": "40ee03fb-434e-4d44-9823-4fef4384b63a",
            "name": "L-Pantothenic acid",
            "unii": "D9B629W4Q4",
            "linking_id": "D9B629W4Q4",
            "ref_pname": "L-Pantothenic acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6fef7c97-56d0-4535-b4d7-5e075cbc4379",
          "name": ".BETA.-ALANINE, N-(2,4-DIHYDROXY-3,3-DIMETHYL-1-OXOBUTYL)-, (R)-",
          "stdName": ".BETA.-ALANINE, N-(2,4-DIHYDROXY-3,3-DIMETHYL-1-OXOBUTYL)-, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71a3598f-17f7-42f0-8249-8297a232e52e"
          ],
          "display_name": false
        },
        {
          "uuid": "0f06fd4b-2027-4e90-afd6-f6d70effa96b",
          "name": "CHICK ANTIDERMATITIS FACTOR",
          "stdName": "CHICK ANTIDERMATITIS FACTOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5919148d-4e0e-4390-ace7-08c0e59e5597"
          ],
          "display_name": false
        },
        {
          "uuid": "a0fb80f6-a98d-4305-9c15-c2b58a282199",
          "name": "D-PANTOTHENIC ACID",
          "stdName": "D-PANTOTHENIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c68a683d-9441-4fe8-acd0-4cad166735bb"
          ],
          "display_name": false
        },
        {
          "uuid": "c02db210-75ac-4b5d-9d88-6be68790dcb5",
          "name": "N-((2R)-2,4-DIHYDROXY-3,3-DIMETHYL-1-OXOBUTYL)-.BETA.-ALANINE",
          "stdName": "N-((2R)-2,4-DIHYDROXY-3,3-DIMETHYL-1-OXOBUTYL)-.BETA.-ALANINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5919148d-4e0e-4390-ace7-08c0e59e5597"
          ],
          "display_name": false
        },
        {
          "uuid": "a39cd7b6-d4fb-4cbd-87f1-e97fe34de5e1",
          "name": "PANTOTHENATE",
          "stdName": "PANTOTHENATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d290ba9e-1318-4145-8a05-5bb2d61729fb"
          ],
          "display_name": false
        },
        {
          "uuid": "de746a88-bb98-45e3-8db3-95a1490f4a25",
          "name": "PANTOTHENIC ACID",
          "stdName": "PANTOTHENIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bee95c30-68a6-4d5c-a9ca-60feb0da02b4",
            "b3e4dc34-da90-465b-a1be-f5468987c0da",
            "5ccc9ee9-aa80-452c-9ef1-4663de9240b4",
            "a93f3b5d-b950-4fc1-be69-832606bce227",
            "56fadc44-7638-4273-ac35-aa909db827b9",
            "cc336083-311c-484d-a452-7643ec597e25",
            "4c1552fa-136e-4a43-8b24-9d13364be182",
            "4992f5ca-2fe6-472f-af32-38de0c259d98",
            "acac0eda-5e97-4cfe-af80-2dfc5ebbf44f",
            "dc1e908d-429e-423d-92da-296185406b39",
            "5919148d-4e0e-4390-ace7-08c0e59e5597",
            "e28c21c7-30ac-4b88-b9cb-e891c9e5852e",
            "2d09f0c5-ebb6-423b-aee9-72c21587c12c",
            "af037e3a-0ffa-4899-bd82-9e950a0f12a1",
            "0ee28000-488f-4123-960f-3b62a27fb90d",
            "deb62276-e2dc-4a0a-8194-7a8e0864adec"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7b01d3c8-4469-4b2b-aeeb-1b4571fb2d22",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1a00b365-38cf-4219-9754-ee23b9a12bae",
          "name": "PANTOTHENIC ACID (D)",
          "stdName": "PANTOTHENIC ACID (D)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c301ca0-c951-4ad6-bec0-581d72fc0077"
          ],
          "display_name": false
        },
        {
          "uuid": "d3039370-5bda-49ee-ab8d-6eff71a1110e",
          "name": "PANTOTHENIC ACID [HSDB]",
          "stdName": "PANTOTHENIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bee95c30-68a6-4d5c-a9ca-60feb0da02b4"
          ],
          "display_name": false
        },
        {
          "uuid": "b0f301e8-a9ea-43b9-b61d-3e2fec1737dc",
          "name": "PANTOTHENIC ACID [MART.]",
          "stdName": "PANTOTHENIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "deb62276-e2dc-4a0a-8194-7a8e0864adec"
          ],
          "display_name": false
        },
        {
          "uuid": "4c879956-8438-47bb-ba07-9e51df3c66e5",
          "name": "PANTOTHENIC ACID [MI]",
          "stdName": "PANTOTHENIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acac0eda-5e97-4cfe-af80-2dfc5ebbf44f"
          ],
          "display_name": false
        },
        {
          "uuid": "6bf5244a-d1a8-498e-aa71-6c6467c73e1e",
          "name": "PANTOTHENIC ACID [ORANGE BOOK]",
          "stdName": "PANTOTHENIC ACID [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3e4dc34-da90-465b-a1be-f5468987c0da"
          ],
          "display_name": false
        },
        {
          "uuid": "f36e9f3f-3ab5-4cbf-8ec9-5be75c0d8f7f",
          "name": "PANTOTHENIC ACID [VANDF]",
          "stdName": "PANTOTHENIC ACID [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d09f0c5-ebb6-423b-aee9-72c21587c12c"
          ],
          "display_name": false
        },
        {
          "uuid": "90f03183-940b-9520-5cbe-02ee8e3a154d",
          "name": "Pantothenic acid [WHO-DD]",
          "stdName": "PANTOTHENIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b604a7c4-30cf-6041-87fc-92ff1074d837"
          ],
          "display_name": false
        },
        {
          "uuid": "12238b6b-caae-4386-a3e1-1189ae4ae456",
          "name": "VITAMIN B-5",
          "stdName": "VITAMIN B-5",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d575a702-61cc-427e-9061-353fd980762a"
          ],
          "display_name": false
        },
        {
          "uuid": "37e7047a-c860-4b5d-b677-522fd7138003",
          "name": "VITAMIN B5",
          "stdName": "VITAMIN B5",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf121ac4-d148-4681-9c24-3ec7fd9562a2",
            "2d09f0c5-ebb6-423b-aee9-72c21587c12c",
            "1f16c0f1-f26b-4f66-ae58-313cc2e4ed8d",
            "8fa8e1a8-b48f-4020-a85d-8c541a65333c",
            "e7fe9e87-d9c2-453e-ae7c-004176f8d1ba"
          ],
          "display_name": false
        },
        {
          "uuid": "87fcb8c8-7349-427d-94c7-3d7917caca48",
          "name": "VITAMIN B5 [GREEN BOOK]",
          "stdName": "VITAMIN B5 [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf121ac4-d148-4681-9c24-3ec7fd9562a2"
          ],
          "display_name": false
        },
        {
          "uuid": "a7ab5f4f-742d-421b-9277-d3c0dcb83a8a",
          "name": "VITAMIN B5 [VANDF]",
          "stdName": "VITAMIN B5 [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d09f0c5-ebb6-423b-aee9-72c21587c12c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e7fe9e87-d9c2-453e-ae7c-004176f8d1ba",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5919148d-4e0e-4390-ace7-08c0e59e5597",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a93f3b5d-b950-4fc1-be69-832606bce227",
          "citation": "OTC",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71a3598f-17f7-42f0-8249-8297a232e52e",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3e4dc34-da90-465b-a1be-f5468987c0da",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "deb62276-e2dc-4a0a-8194-7a8e0864adec",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acac0eda-5e97-4cfe-af80-2dfc5ebbf44f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf121ac4-d148-4681-9c24-3ec7fd9562a2",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af037e3a-0ffa-4899-bd82-9e950a0f12a1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d290ba9e-1318-4145-8a05-5bb2d61729fb",
          "citation": "rxnorm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bee95c30-68a6-4d5c-a9ca-60feb0da02b4",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ccc9ee9-aa80-452c-9ef1-4663de9240b4",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d09f0c5-ebb6-423b-aee9-72c21587c12c",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c68a683d-9441-4fe8-acd0-4cad166735bb",
          "citation": "HEALTH CANADA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c301ca0-c951-4ad6-bec0-581d72fc0077",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d575a702-61cc-427e-9061-353fd980762a",
          "citation": "DSID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "297fb66a-a779-4dcc-bb6b-7ec7a816ba61",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb970950-b5b0-4b57-a23f-bd343e6a88a1",
          "citation": "SRS import [19F5HK2737]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=19F5HK2737",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e28c21c7-30ac-4b88-b9cb-e891c9e5852e",
          "citation": "PANTOTHENIC ACID [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56fadc44-7638-4273-ac35-aa909db827b9",
          "citation": "PANTOTHENIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dc1e908d-429e-423d-92da-296185406b39",
          "citation": "PANTOTHENIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8fa8e1a8-b48f-4020-a85d-8c541a65333c",
          "citation": "VITAMIN B5 [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0ee28000-488f-4123-960f-3b62a27fb90d",
          "citation": "PANTOTHENIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4992f5ca-2fe6-472f-af32-38de0c259d98",
          "citation": "PANTOTHENIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc336083-311c-484d-a452-7643ec597e25",
          "citation": "PANTOTHENIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1f16c0f1-f26b-4f66-ae58-313cc2e4ed8d",
          "citation": "VITAMIN B5 [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4c1552fa-136e-4a43-8b24-9d13364be182",
          "citation": "PANTOTHENIC ACID [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62905c8e-4abf-8b33-8c5a-b5bacea32f95",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+79-83-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "42f050b4-0651-47cd-4d55-551ec08c3c41",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79-83-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b76d39d9-398c-c23c-53f4-6015e85b0f56",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b002bd66-dc93-6166-578c-8c57c08f977b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "750aaac8-d4d4-4af1-b6d7-0172af4cd2eb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b604a7c4-30cf-6041-87fc-92ff1074d837",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "92aab3f0-5c04-6226-ba29-0dee1fab0f9a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fccd2da3-945d-4558-9334-53807b7adfe0",
          "id": "fccd2da3-945d-4558-9334-53807b7adfe0",
          "molfile": "\n  Marvin  01132113052D          \n\n 15 14  0  0  1  0            999 V2000\n    5.9362   -3.1239    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.9362   -3.9485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6462   -2.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6462   -1.8871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3609   -3.1193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0755   -2.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7854   -3.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5000   -2.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2146   -3.1102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5000   -1.8734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2215   -2.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8093   -1.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6338   -1.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5116   -3.1239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7970   -2.7208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 11  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O",
          "formula": "C9H17NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c95f6d80-46f0-4767-98fb-6b90325c6924"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "219.2353",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a8c059bf-106f-4ba8-8dc9-7ab2bf9b3ada",
      "version": "30",
      "structure": {
        "id": "6f2016e4-bd52-4f6b-bafa-789610cfbb90",
        "molfile": "\n  Marvin  01132105462D          \n\n 15 14  0  0  1  0            999 V2000\n    6.6462   -2.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9362   -3.1239    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.2215   -2.7116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5116   -3.1239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7970   -2.7208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8093   -1.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6338   -1.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9362   -3.9485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6462   -1.8871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3609   -3.1193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0755   -2.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7854   -3.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5000   -2.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2146   -3.1102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5000   -1.8734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  3  1  0  0  0  0\n  2  8  1  6  0  0  0\n  9  1  2  0  0  0  0\n 10  1  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O",
        "formula": "C9H17NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "219.2353",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5919148d-4e0e-4390-ace7-08c0e59e5597",
          "fb970950-b5b0-4b57-a23f-bd343e6a88a1"
        ],
        "stereo_centers": 1
      },
      "unii": "19F5HK2737"
    }
  ]
}