{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "43649b2e-4979-4f8c-9c79-0354b23509ab", "code": "10128-55-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=10128-55-9", "code_system": "CAS", "references": [ "e0b5db8d-aaa8-4284-a36b-9aa9700d76ba", "52aa1ce8-7bd0-49c5-840f-2fdad803b8f5" ] }, { "uuid": "1fd3ac01-8755-4b06-a513-60af55146024", "code": "233-360-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.315", "code_system": "ECHA (EC/EINECS)", "references": [ "e0b5db8d-aaa8-4284-a36b-9aa9700d76ba" ] }, { "uuid": "05944e98-5e01-40c2-93c0-740a0306a15f", "code": "82379", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82379", "code_system": "PUBCHEM", "references": [ "e0b5db8d-aaa8-4284-a36b-9aa9700d76ba" ] }, { "uuid": "f74da2f8-8924-ca45-ed56-9a58461cd6d1", "code": "DTXSID1064958", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1064958", "code_system": "EPA CompTox", "references": [ "a2802166-8c81-9643-52d2-c0351ae6569a" ] }, { "uuid": "60642356-def4-47a9-ba1b-e11a0622b115", "code": "19C742D53K", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b9d7c1a8-d004-47c7-b5e6-d3718551b688", "name": "2-NAPHTHALENESULFONAMIDE, N-(2-(4-OXO-4H-3,1-BENZOXAZIN-2-YL)PHENYL)-", "stdName": "2-NAPHTHALENESULFONAMIDE, N-(2-(4-OXO-4H-3,1-BENZOXAZIN-2-YL)PHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e437ce41-08a6-4377-8bf9-0de5036d16e7", "4103614e-53cd-4eaf-9946-f928a873cfa4" ], "display_name": false }, { "uuid": "9e81ba0f-49c7-4d40-8e5b-d60ef562e4be", "name": "2-NAPHTHALENESULFONANILIDE, 2'-(4-OXO-4H-3,1-BENZOXAZIN-2-YL)-", "stdName": "2-NAPHTHALENESULFONANILIDE, 2'-(4-OXO-4H-3,1-BENZOXAZIN-2-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e437ce41-08a6-4377-8bf9-0de5036d16e7", "4103614e-53cd-4eaf-9946-f928a873cfa4" ], "display_name": false }, { "uuid": "02da5c94-d05f-46b8-b9fd-a60d4595aa77", "name": "N-(2-(4-OXO-4H-3,1-BENZOXAZIN-2-YL)PHENYL)-2-NAPHTHALENESULFONAMIDE", "stdName": "N-(2-(4-OXO-4H-3,1-BENZOXAZIN-2-YL)PHENYL)-2-NAPHTHALENESULFONAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e437ce41-08a6-4377-8bf9-0de5036d16e7", "4103614e-53cd-4eaf-9946-f928a873cfa4" ], "display_name": false }, { "uuid": "7b9034db-2ef9-458e-901f-b7a5a430c296", "name": "ORLUM WHITE 520T", "stdName": "ORLUM WHITE 520T", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e437ce41-08a6-4377-8bf9-0de5036d16e7", "4103614e-53cd-4eaf-9946-f928a873cfa4" ], "display_name": false }, { "uuid": "f976e3e3-4d99-4071-b54a-9c699f437c40", "name": "OXOBENZOXAZINYL NAPHTHALENE SULFOANILIDE", "stdName": "OXOBENZOXAZINYL NAPHTHALENE SULFOANILIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "4103614e-53cd-4eaf-9946-f928a873cfa4", "e026ca4d-50a9-4317-a9bc-bb7592f06d86", "b3fc9392-fbaa-45d8-8f72-015eab7a747a" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "e66f35e6-2f4e-4b41-be5a-424200338c85", "name_org": "INCI" } ] } ], "references": [ { "uuid": "e026ca4d-50a9-4317-a9bc-bb7592f06d86", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4103614e-53cd-4eaf-9946-f928a873cfa4", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e437ce41-08a6-4377-8bf9-0de5036d16e7", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e0b5db8d-aaa8-4284-a36b-9aa9700d76ba", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391528000, "tags": [ "NOMEN" ] }, { "uuid": "7b36b997-2425-4664-83c4-cbc54c6cfde9", "citation": "SRS import [19C742D53K]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=19C742D53K", "doc_type": "SRS", "public_domain": true, "document_date": 1493391528000, "tags": [ "NOMEN" ] }, { "uuid": "b3fc9392-fbaa-45d8-8f72-015eab7a747a", "citation": "OXOBENZOXAZINYL NAPHTHALENE SULFOANILIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a2802166-8c81-9643-52d2-c0351ae6569a", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10128-55-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "52aa1ce8-7bd0-49c5-840f-2fdad803b8f5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "03538427-f033-4715-8305-14581ce2c1f4", "id": "03538427-f033-4715-8305-14581ce2c1f4", "molfile": "\n Marvin 01132100292D \n\n 31 35 0 0 0 0 999 V2000\n 9.5107 -1.9134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5107 -2.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2258 -3.1524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2258 -3.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5107 -4.3882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7957 -3.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0806 -4.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3689 -3.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3689 -3.1524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0806 -2.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7957 -3.1524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9409 -4.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6526 -3.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3677 -4.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3677 -5.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6526 -5.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9409 -5.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2258 -5.6271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2258 -6.4509 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0463 -6.3784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3675 -7.2648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4283 -6.6651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8451 -6.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0477 -6.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8335 -7.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0393 -7.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8252 -8.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4084 -8.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2058 -8.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4167 -7.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2142 -7.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 2 11 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 12 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 11 2 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 2 0 0 0 0\n 19 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 31 2 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 30 25 2 0 0 0 0\n 26 27 2 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\nM END", "smiles": "c1ccc2cc(ccc2c1)S(=O)(=O)Nc3ccccc3-c4nc5ccccc5c(=O)o4", "formula": "C24H16N2O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "816cc58f-d6fd-4b45-a0ce-f57f66f4cbf7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "428.4618", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "11448866-8e31-4dae-bfe3-f145afd55232", "version": "4", "structure": { "id": "66a76383-0817-4e9f-b3ed-2d8610bd7ce4", "molfile": "\n Marvin 01132105212D \n\n 31 35 0 0 0 0 999 V2000\n 10.9409 -4.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2258 -3.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5107 -4.3882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7957 -3.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7957 -3.1524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0806 -2.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3689 -3.1524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3689 -3.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0806 -4.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5107 -2.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2258 -3.1524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5107 -1.9134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9409 -5.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2258 -5.6271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2258 -6.4509 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4283 -6.6651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2142 -7.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4167 -7.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8335 -7.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0393 -7.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8252 -8.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4084 -8.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2058 -8.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0477 -6.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8451 -6.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0463 -6.3784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3675 -7.2648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6526 -5.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3677 -5.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3677 -4.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6526 -3.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 7 1 0 0 0 0\n 4 9 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 5 1 0 0 0 0\n 2 11 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 12 2 0 0 0 0\n 1 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 21 1 0 0 0 0\n 18 23 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 19 1 0 0 0 0\n 16 25 1 0 0 0 0\n 25 24 2 0 0 0 0\n 15 26 2 0 0 0 0\n 15 27 2 0 0 0 0\n 13 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 30 29 1 0 0 0 0\n 1 31 1 0 0 0 0\n 31 30 2 0 0 0 0\nM END", "smiles": "c1ccc2cc(ccc2c1)S(=O)(=O)Nc3ccccc3-c4nc5ccccc5c(=O)o4", "formula": "C24H16N2O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "428.4618", "optical_activity": "NONE", "references": [ "e437ce41-08a6-4377-8bf9-0de5036d16e7", "7b36b997-2425-4664-83c4-cbc54c6cfde9" ], "stereo_centers": 0 }, "unii": "19C742D53K" } ] }