{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "cafb6819-0b9d-4b3f-84e9-d1553b8121ed", "code": "7296-56-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=7296-56-2", "code_system": "CAS", "references": [ "edbcb0e9-94e4-431e-a35b-ac17774d42a9", "535d76ff-c616-4335-b6c4-339360c4ba77" ] }, { "uuid": "965e61b6-d3da-4eb3-9b5b-94d3accf044d", "code": "439764", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439764", "code_system": "PUBCHEM", "references": [ "edbcb0e9-94e4-431e-a35b-ac17774d42a9" ] }, { "uuid": "11e90db8-f699-bfa5-18a2-ccc6d8c834ab", "code": "DTXSID201315644", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201315644", "code_system": "EPA CompTox", "references": [ "0f5adc44-53bf-f0a9-613b-fc759358b051" ] }, { "uuid": "e91c0b46-0101-48a8-a689-28dc5f7349bb", "code": "194RG7YBRS", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "c742fab7-b7f0-4d5e-9e92-78192e8f5ed9", "name": ".BETA.-L-ARABINOPYRANOSE", "stdName": ".BETA.-L-ARABINOPYRANOSE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a7af1298-112d-4c33-827b-5e4b41a54c2b", "39fd3e0b-813d-4905-b87c-c0311b202521" ], "display_name": false }, { "uuid": "818978cc-3729-4350-a49f-d3e7b795678d", "name": ".BETA.-L-ARABINOSE", "stdName": ".BETA.-L-ARABINOSE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a7af1298-112d-4c33-827b-5e4b41a54c2b", "39fd3e0b-813d-4905-b87c-c0311b202521" ], "display_name": true }, { "uuid": "03a08333-38c1-4aa0-b9ad-2eaeb4226fc7", "name": "ARABINOPYRANOSE, .BETA.-L-", "stdName": "ARABINOPYRANOSE, .BETA.-L-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a7af1298-112d-4c33-827b-5e4b41a54c2b", "39fd3e0b-813d-4905-b87c-c0311b202521" ], "display_name": false } ], "references": [ { "uuid": "39fd3e0b-813d-4905-b87c-c0311b202521", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a7af1298-112d-4c33-827b-5e4b41a54c2b", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "edbcb0e9-94e4-431e-a35b-ac17774d42a9", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393568000, "tags": [ "NOMEN" ] }, { "uuid": "1074aeed-8e5c-441f-8437-94150c47ec6b", "citation": "SRS import [194RG7YBRS]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=194RG7YBRS", "doc_type": "SRS", "public_domain": true, "document_date": 1493393568000, "tags": [ "NOMEN" ] }, { "uuid": "535d76ff-c616-4335-b6c4-339360c4ba77", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0f5adc44-53bf-f0a9-613b-fc759358b051", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e2054ee7-9909-43a2-be3e-cd1a3571fe58", "id": "e2054ee7-9909-43a2-be3e-cd1a3571fe58", "molfile": "\n Marvin 01132111422D \n\n 10 10 0 0 1 0 999 V2000\n 9.3516 -5.6597 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.3516 -6.4846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0661 -5.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0661 -4.4222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3516 -4.0097 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.3516 -3.1847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6372 -4.4222 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.9228 -4.0097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6372 -5.2472 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.9228 -5.6597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 9 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 1 0 0 0\n 7 5 1 0 0 0 0\n 7 8 1 1 0 0 0\n 9 7 1 0 0 0 0\n 9 10 1 6 0 0 0\nM END", "smiles": "C1[C@@H]([C@@H]([C@H]([C@@H](O)O1)O)O)O", "formula": "C5H10O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ee54ae8d-f87f-4cb6-9d12-e3a099d32690" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "150.1301", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "26dd82bb-f5c9-4698-8f31-4c29698877e7", "version": "3", "structure": { "id": "a0821503-5af4-40de-bdc6-4b0f1d0a2c60", "molfile": "\n Marvin 01132108202D \n\n 10 10 0 0 1 0 999 V2000\n 7.9228 -5.6597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6372 -5.2472 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.3516 -5.6597 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.3516 -6.4846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0661 -5.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0661 -4.4222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3516 -4.0097 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.3516 -3.1847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6372 -4.4222 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.9228 -4.0097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 6 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 6 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 1 0 0 0\n 9 7 1 0 0 0 0\n 2 9 1 0 0 0 0\n 9 10 1 1 0 0 0\nM END", "smiles": "C1[C@@H]([C@@H]([C@H]([C@@H](O)O1)O)O)O", "formula": "C5H10O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "150.1301", "optical_activity": "UNSPECIFIED", "references": [ "1074aeed-8e5c-441f-8437-94150c47ec6b", "39fd3e0b-813d-4905-b87c-c0311b202521" ], "stereo_centers": 4 }, "unii": "194RG7YBRS" } ] }