{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "91fe5436-0424-4655-9c2a-c6ed84380239",
          "code": "11831",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11831",
          "code_system": "PUBCHEM",
          "references": [
            "7a3e84b7-6233-4cb9-a7af-1e9e7cc2c3e5"
          ]
        },
        {
          "uuid": "e4ee2bd7-5215-4bca-9163-002557c08e3e",
          "code": "607-57-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=607-57-8",
          "code_system": "CAS",
          "references": [
            "7a3e84b7-6233-4cb9-a7af-1e9e7cc2c3e5",
            "ce7716f6-9146-45bc-be7c-01b987bf8485"
          ]
        },
        {
          "uuid": "10b6945e-2597-4b96-b836-f47710481e70",
          "code": "C019499",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67019499",
          "code_system": "MESH",
          "references": [
            "7a3e84b7-6233-4cb9-a7af-1e9e7cc2c3e5"
          ]
        },
        {
          "uuid": "6354325b-9be1-405f-9e36-36a80c26ce35",
          "code": "2-NITROFLUORENE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/2-Nitrofluorene",
          "code_system": "WIKIPEDIA",
          "references": [
            "7a3e84b7-6233-4cb9-a7af-1e9e7cc2c3e5"
          ]
        },
        {
          "uuid": "bc44d2ee-b02b-41ba-ac59-dd2c200047f7",
          "code": "210-138-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.217",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7a3e84b7-6233-4cb9-a7af-1e9e7cc2c3e5"
          ]
        },
        {
          "uuid": "1e49c2c5-2651-03ee-1778-2974096c0f43",
          "code": "2111",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2111",
          "code_system": "HSDB",
          "references": [
            "80f855c5-cb26-cf74-7ccd-499a1bd568bb"
          ]
        },
        {
          "uuid": "510dbb39-e8dd-13c6-fb19-78a385f50768",
          "code": "DTXSID2020971",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2020971",
          "code_system": "EPA CompTox",
          "references": [
            "349053f0-2c5b-9a25-9baa-a0228b74f11f"
          ]
        },
        {
          "uuid": "8a955387-3ab5-4904-9f5c-7df15c9ec17f",
          "code": "191LL4U4GZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "54ebacd1-11fb-ab16-5ab1-fed4c08b60f6",
          "code": "1224",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:1224",
          "code_system": "CHEBI",
          "references": [
            "cd7e61ad-f409-90e0-c671-b78f8124c582"
          ]
        },
        {
          "uuid": "408f8ffc-932b-2b0f-aa3d-81b1ea224a6c",
          "code": "5182",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5182",
          "code_system": "NSC",
          "references": [
            "04654d40-ec2f-9371-b6ac-c1b464f45ebd"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c1e6cfbc-8ee8-451d-9e50-bf519341b188",
          "name": "2-NITRO-9H-FLUORENE [HSDB]",
          "stdName": "2-NITRO-9H-FLUORENE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4a0bb32-87a4-4c3a-9717-3bb13afab1e3"
          ],
          "display_name": false
        },
        {
          "uuid": "1004ccb5-6d36-4b0f-9bda-31d33b42b8c2",
          "name": "2-NITROFLUORENE",
          "stdName": "2-NITROFLUORENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d04ba6d-055d-4cad-9bdd-8b0dbd42ff32"
          ],
          "display_name": true
        },
        {
          "uuid": "12476d64-88ed-ffd1-edb5-a18e6fdaf552",
          "name": "2-NITROFLUORENE [IARC]",
          "stdName": "2-NITROFLUORENE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a4f35d-9b82-bfd1-607f-19ec8d09c227"
          ],
          "display_name": false
        },
        {
          "uuid": "5190d90b-41c2-40f2-b61b-e973f70a5aeb",
          "name": "NITROFLUORENE, 2-",
          "stdName": "NITROFLUORENE, 2-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6579c80-7e81-4c56-928d-1a4eab1d5633"
          ],
          "display_name": false
        },
        {
          "uuid": "56386d88-c860-4ee7-be36-d6874d46ea5f",
          "name": "NSC-5182",
          "stdName": "NSC-5182",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "160f57f8-6bdb-40ea-bcc2-ec555015e715"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c6579c80-7e81-4c56-928d-1a4eab1d5633",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7d04ba6d-055d-4cad-9bdd-8b0dbd42ff32",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4a0bb32-87a4-4c3a-9717-3bb13afab1e3",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "160f57f8-6bdb-40ea-bcc2-ec555015e715",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a3e84b7-6233-4cb9-a7af-1e9e7cc2c3e5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d943e4b-079c-49f1-a3b4-3af70655d307",
          "citation": "SRS import [191LL4U4GZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=191LL4U4GZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1cf712a-a211-49da-b418-e1b07c95227a",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80f855c5-cb26-cf74-7ccd-499a1bd568bb",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+607-57-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "349053f0-2c5b-9a25-9baa-a0228b74f11f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=607-57-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d5a4f35d-9b82-bfd1-607f-19ec8d09c227",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "cd7e61ad-f409-90e0-c671-b78f8124c582",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ce7716f6-9146-45bc-be7c-01b987bf8485",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "04654d40-ec2f-9371-b6ac-c1b464f45ebd",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2e99b87b-78a6-46d1-9e12-a71bb7e3df7b",
          "id": "2e99b87b-78a6-46d1-9e12-a71bb7e3df7b",
          "molfile": "\n  Marvin  01132102302D          \n\n 16 18  0  0  0  0            999 V2000\n    9.4483   -4.3597    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.1476   -5.1335    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.6684   -5.7674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3364   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0354   -6.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2213   -6.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7109   -5.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0018   -4.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3651   -4.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6699   -4.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8786   -4.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2896   -5.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5018   -5.8205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2980   -6.0405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8869   -5.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8132   -4.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n 16  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 15  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 16  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 15 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
          "smiles": "c1ccc-2c(c1)Cc3cc(ccc32)[N+](=O)[O-]",
          "formula": "C13H9NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f33d64e2-7d81-4433-b4c7-4f8b252beb25"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "211.2165",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f4a1c6b4-98c7-40be-b644-387f8ff9d44f",
      "version": "8",
      "structure": {
        "id": "300c73ab-e7a4-4337-93ac-9cd697e2747a",
        "molfile": "\n  Marvin  01132102352D          \n\n 16 18  0  0  0  0            999 V2000\n    6.7109   -5.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8869   -5.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6699   -4.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8786   -4.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2896   -5.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5018   -5.8205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2980   -6.0405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3651   -4.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0018   -4.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8132   -4.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3364   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1476   -5.1335    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.4483   -4.3597    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.6684   -5.7674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0354   -6.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2213   -6.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  2  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 11 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n  1 16  2  0  0  0  0\nM  CHG  2  12   1  13  -1\nM  END",
        "smiles": "c1ccc-2c(c1)Cc3cc(ccc32)[N+](=O)[O-]",
        "formula": "C13H9NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "211.2165",
        "optical_activity": "NONE",
        "references": [
          "9d943e4b-079c-49f1-a3b4-3af70655d307",
          "c1cf712a-a211-49da-b418-e1b07c95227a"
        ],
        "stereo_centers": 0
      },
      "unii": "191LL4U4GZ"
    }
  ]
}