{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1fc8b94f-f6eb-4955-8ea0-061a1a8a0888",
          "code": "40164-67-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=40164-67-8",
          "code_system": "CAS",
          "references": [
            "b5521162-efb1-4683-9475-91938c322c32",
            "1af0fee9-1a58-480b-855c-b18bddb42d04"
          ]
        },
        {
          "uuid": "b02da827-f93a-43d9-80ef-623e2c16f638",
          "code": "C120862",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67120862",
          "code_system": "MESH",
          "references": [
            "b5521162-efb1-4683-9475-91938c322c32"
          ]
        },
        {
          "uuid": "c76d6ace-691a-4af8-8a3d-96d5b7135e31",
          "code": "128001",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1188",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b5521162-efb1-4683-9475-91938c322c32"
          ]
        },
        {
          "uuid": "3af8a574-dd83-4013-836d-9dcfadcef31a",
          "code": "m557",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m557?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b5521162-efb1-4683-9475-91938c322c32"
          ]
        },
        {
          "uuid": "4becd185-f539-4ef2-844d-8aea192da03b",
          "code": "38407",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/38407",
          "code_system": "PUBCHEM",
          "references": [
            "b5521162-efb1-4683-9475-91938c322c32"
          ]
        },
        {
          "uuid": "82501935-d671-f0ff-65d5-7d9870a25fd6",
          "code": "DTXSID7041596",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7041596",
          "code_system": "EPA CompTox",
          "references": [
            "fda22fff-8753-acd5-d2a3-253a57ab3b41"
          ]
        },
        {
          "uuid": "32fd7088-9ec2-4ae3-9d9b-74b7609bea0d",
          "code": "190Y97F39F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f96df29d-f2e8-c2e2-b107-970d3f9ffdb9",
          "code": "amidochlor",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/amidochlor.html",
          "code_system": "ALANWOOD",
          "references": [
            "2654eeb3-2d17-2066-95ea-b62b05c9a846"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d2cabbe3-30a5-4cf1-a183-bd502b3680fa",
          "name": "AMIDOCHLOR",
          "stdName": "AMIDOCHLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "481d8e8c-2bb5-40b6-984b-a092f6d4844a",
            "f4e0fc8a-de87-41c0-8be2-212206466f75",
            "a1533646-6400-46af-9047-61eb08735e46",
            "3b4b9a84-8f6e-4017-b487-ac3702528036"
          ],
          "display_name": true
        },
        {
          "uuid": "ca792964-cf52-42ad-92b5-ce1b754fb349",
          "name": "AMIDOCHLOR [MI]",
          "stdName": "AMIDOCHLOR [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4e0fc8a-de87-41c0-8be2-212206466f75",
            "3b4b9a84-8f6e-4017-b487-ac3702528036"
          ],
          "display_name": false
        },
        {
          "uuid": "028d2013-df03-4e09-b533-42e4dd25076f",
          "name": "LS-7947",
          "stdName": "LS-7947",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2f042a7-cf0c-4696-88a1-ec53fc9974c5",
            "f4e0fc8a-de87-41c0-8be2-212206466f75"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1533646-6400-46af-9047-61eb08735e46",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e2f042a7-cf0c-4696-88a1-ec53fc9974c5",
          "citation": "pubchem",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4e0fc8a-de87-41c0-8be2-212206466f75",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b4b9a84-8f6e-4017-b487-ac3702528036",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5521162-efb1-4683-9475-91938c322c32",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390934000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47258c2b-2a23-4c4c-a0e2-939fd108fc84",
          "citation": "SRS import [190Y97F39F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=190Y97F39F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390934000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d98d5b2-10b3-4644-8f46-097ca78d6f05",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "481d8e8c-2bb5-40b6-984b-a092f6d4844a",
          "citation": "AMIDOCHLOR [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fda22fff-8753-acd5-d2a3-253a57ab3b41",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=40164-67-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2654eeb3-2d17-2066-95ea-b62b05c9a846",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "1af0fee9-1a58-480b-855c-b18bddb42d04",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0e796b29-c6a4-4f38-a988-29fdf6bc2815",
          "id": "0e796b29-c6a4-4f38-a988-29fdf6bc2815",
          "molfile": "\n  Marvin  01132100592D          \n\n 20 20  0  0  0  0            999 V2000\n    8.8443   -5.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1264   -5.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4262   -5.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4262   -6.3809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7176   -6.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9968   -6.3809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9968   -5.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2788   -5.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5481   -5.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7176   -5.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7176   -4.3315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4094   -3.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1264   -4.3087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8328   -3.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5499   -4.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8328   -3.0780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9867   -3.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9867   -3.0252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2849   -4.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5303   -3.9029    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 10  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 10  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 17  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CCc1cccc(CC)c1N(CNC(=O)C)C(=O)CCl",
          "formula": "C15H21ClN2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b6e37c74-92b6-414d-9d36-d4afa97f4f4a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "296.7929",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "be4a7bb3-ef27-4494-a340-d56624012540",
      "version": "4",
      "structure": {
        "id": "54d3e9d7-099c-46a3-903f-9e0180555f8f",
        "molfile": "\n  Marvin  01132104252D          \n\n 20 20  0  0  0  0            999 V2000\n    6.7176   -5.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7176   -4.3315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4094   -3.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1264   -4.3087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8328   -3.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5499   -4.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8328   -3.0780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9867   -3.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2849   -4.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5303   -3.9029    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9867   -3.0252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9968   -5.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9968   -6.3809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7176   -6.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4262   -6.3809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4262   -5.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1264   -5.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8443   -5.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2788   -5.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5481   -5.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  8 11  2  0  0  0  0\n  1 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 12 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "CCc1cccc(CC)c1N(CNC(=O)C)C(=O)CCl",
        "formula": "C15H21ClN2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "296.7929",
        "optical_activity": "NONE",
        "references": [
          "4d98d5b2-10b3-4644-8f46-097ca78d6f05",
          "47258c2b-2a23-4c4c-a0e2-939fd108fc84"
        ],
        "stereo_centers": 0
      },
      "unii": "190Y97F39F"
    }
  ]
}