{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "55ac256e-0d3d-4050-a90a-c287001e8f78",
          "code": "86-96-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=86-96-4",
          "code_system": "CAS",
          "references": [
            "f0470e57-e852-4e20-9732-cbde5726c185",
            "c775cd68-4a7c-4a2a-bae4-fd3dc9b4c5e0"
          ]
        },
        {
          "uuid": "04f34845-25a3-4f5c-a853-aaaec53fcde5",
          "code": "201-712-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.557",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f0470e57-e852-4e20-9732-cbde5726c185"
          ]
        },
        {
          "uuid": "9a5cb0b2-4b5f-42a9-9e68-bd3da1455637",
          "code": "64048",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/64048",
          "code_system": "PUBCHEM",
          "references": [
            "f0470e57-e852-4e20-9732-cbde5726c185"
          ]
        },
        {
          "uuid": "507fbd84-e35c-023b-09c9-f74a2cdc33b5",
          "code": "DTXSID30235343",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30235343",
          "code_system": "EPA CompTox",
          "references": [
            "be58bd0e-7dd9-6cbc-b943-386dab31fd7b"
          ]
        },
        {
          "uuid": "d8a23e86-6f32-47fe-8ae7-2e32a91e38c6",
          "code": "18K00A531C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3869a311-d9d1-8a74-6de1-8405112ad5a6",
          "code": "2108",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2108",
          "code_system": "NSC",
          "references": [
            "9558ee26-8b23-a2e6-216b-fcbdedee19fb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "724b9922-d95a-42fe-98da-3822b38c9e48",
          "name": "(1H,3H)-QUINAZOLINE-2,4-DIONE",
          "stdName": "(1H,3H)-QUINAZOLINE-2,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa1b8951-5998-498f-9c29-88bcb500a43b"
          ],
          "display_name": false
        },
        {
          "uuid": "f6d9f9a5-10b7-46f7-9c87-010448b0c923",
          "name": "1,2,3,4-TETRAHYDRO-2,4-DIOXOQUINAZOLINE",
          "stdName": "1,2,3,4-TETRAHYDRO-2,4-DIOXOQUINAZOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "f4a616a2-e149-400d-8c97-481881c9545a",
          "name": "1,2,3,4-TETRAHYDROQUINAZOLINE-2,4-DIONE",
          "stdName": "1,2,3,4-TETRAHYDROQUINAZOLINE-2,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "73c369e5-f776-4a36-88d8-f9266899c1a9",
          "name": "2,4(1H,3H)-QUINAZOLINEDIONE",
          "stdName": "2,4(1H,3H)-QUINAZOLINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "d8bdf418-432d-4a9c-8983-a652f7b57bbb",
          "name": "2,4-DIHYDROXYQUINAZOLINE",
          "stdName": "2,4-DIHYDROXYQUINAZOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": true
        },
        {
          "uuid": "73680f70-dc4c-41ec-8f02-9b452d9bea4f",
          "name": "2,4-DIOXOTETRAHYDROQUINAZOLINE",
          "stdName": "2,4-DIOXOTETRAHYDROQUINAZOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "bf4a13a0-948b-4cfe-a1ce-7b64bb28d88c",
          "name": "2,4-QUINAZOLINEDIOL",
          "stdName": "2,4-QUINAZOLINEDIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "93b96be8-fa75-474e-9e76-7dc7d4b9159e",
          "name": "BENZOURACIL",
          "stdName": "BENZOURACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "91a2402a-4198-4eec-b6d6-00f5eae36397",
          "name": "BENZOYLENEUREA",
          "stdName": "BENZOYLENEUREA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "958e9274-5c78-4efc-8649-aee56d32801f",
          "name": "NSC-2108",
          "stdName": "NSC-2108",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "6634af24-026d-4f6e-810b-cd5771a970b1",
          "name": "QUINAZOLINE-2,4-DIONE",
          "stdName": "QUINAZOLINE-2,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "c351d974-b224-4c50-93e0-2331b21e33cd",
          "name": "QUINAZOLINEDIONE",
          "stdName": "QUINAZOLINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "330872e3-643d-4271-809b-5667b81e6747",
          "name": "UREA, BENZOYLENE-",
          "stdName": "UREA, BENZOYLENE-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "8b708036-d359-420a-8749-bcf8e18f6f8d",
          "name": "Y-THYMINE",
          "stdName": "Y-THYMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        },
        {
          "uuid": "d3025672-d415-4b6f-b267-2bb4bc02cc67",
          "name": "YT",
          "stdName": "YT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc871c59-13d0-44c6-97ca-987e3c0d5118"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "aa1b8951-5998-498f-9c29-88bcb500a43b",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cc871c59-13d0-44c6-97ca-987e3c0d5118",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0470e57-e852-4e20-9732-cbde5726c185",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391535000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "401c9fa2-8632-44ed-8a8f-12ea5ceaed77",
          "citation": "SRS import [18K00A531C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=18K00A531C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391535000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be58bd0e-7dd9-6cbc-b943-386dab31fd7b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=86-96-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c775cd68-4a7c-4a2a-bae4-fd3dc9b4c5e0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9558ee26-8b23-a2e6-216b-fcbdedee19fb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "47077d2f-69e4-488e-a7f6-5705cd64adfe",
          "id": "47077d2f-69e4-488e-a7f6-5705cd64adfe",
          "molfile": "\n  Marvin  01132103442D          \n\n 12 13  0  0  0  0            999 V2000\n    0.0000   -2.4749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7179   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4249   -2.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1428   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8606   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5714   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5714   -1.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8606   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1428   -1.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4249   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4249    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7179   -1.2393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 12  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(=O)[nH]c(=O)[nH]2",
          "formula": "C8H6N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "798a13dc-12f7-4f6a-868c-94ad0b716dea"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "162.1457",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "19e4a5ed-a390-4eae-a017-8648abc45d94",
      "version": "4",
      "structure": {
        "id": "90dffde6-7330-42ba-ab4d-141359fe648e",
        "molfile": "\n  Marvin  01132107312D          \n\n 12 13  0  0  0  0            999 V2000\n    0.7179   -1.2393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4249   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7179   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1428   -1.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4249   -2.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1428   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4249    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8606   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8606   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5714   -1.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5714   -2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  5  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  6  2  0  0  0  0\n  4  9  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 10 12  2  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(=O)[nH]c(=O)[nH]2",
        "formula": "C8H6N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "162.1457",
        "optical_activity": "NONE",
        "references": [
          "401c9fa2-8632-44ed-8a8f-12ea5ceaed77",
          "aa1b8951-5998-498f-9c29-88bcb500a43b"
        ],
        "stereo_centers": 0
      },
      "unii": "18K00A531C"
    }
  ]
}