{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5fd2b12f-61ac-4ae0-8e66-f3ecaef811b3",
          "code": "145-73-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=145-73-3",
          "code_system": "CAS",
          "references": [
            "8a5c11e0-f0b8-4e5b-a98f-3a6c4c95558c",
            "6f6b7623-45ed-4ce3-a870-8cf9a7418f67"
          ]
        },
        {
          "uuid": "302c3ac4-89c3-4ffa-80d4-107882b21aa3",
          "code": "28874-46-6",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28874-46-6",
          "code_system": "CAS",
          "references": [
            "8a5c11e0-f0b8-4e5b-a98f-3a6c4c95558c",
            "93709450-6446-4abd-8f34-2600aa8d4134"
          ]
        },
        {
          "uuid": "0a987328-c26f-4950-82ac-047afde863f1",
          "code": "349466-39-3",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=349466-39-3",
          "code_system": "CAS",
          "references": [
            "8a5c11e0-f0b8-4e5b-a98f-3a6c4c95558c",
            "38141fc2-50da-4e04-b12b-bfc0b80d5f55"
          ]
        },
        {
          "uuid": "f8150fa7-d34f-4287-80f1-91ae706b7756",
          "code": "857020-72-5",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=857020-72-5",
          "code_system": "CAS",
          "references": [
            "8a5c11e0-f0b8-4e5b-a98f-3a6c4c95558c",
            "735bc57c-d3db-4d2e-ac64-c7a8e1b76a8f"
          ]
        },
        {
          "uuid": "aee43301-5792-49b8-8405-1448042a35cd",
          "code": "38901",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2259",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "8a5c11e0-f0b8-4e5b-a98f-3a6c4c95558c"
          ]
        },
        {
          "uuid": "133dd651-f2ab-401f-a725-155749e4bcd3",
          "code": "m4900",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4900?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8a5c11e0-f0b8-4e5b-a98f-3a6c4c95558c"
          ]
        },
        {
          "uuid": "bf1dafdc-e993-4e6f-92c2-68485946b10d",
          "code": "205-660-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.146",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8a5c11e0-f0b8-4e5b-a98f-3a6c4c95558c"
          ]
        },
        {
          "uuid": "2414895c-6abe-4fbe-861b-18cae750bd22",
          "code": "168842",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/168842",
          "code_system": "PUBCHEM",
          "references": [
            "8a5c11e0-f0b8-4e5b-a98f-3a6c4c95558c"
          ]
        },
        {
          "uuid": "d916201d-03f1-0387-e774-79debf4307d3",
          "code": "391",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/391",
          "code_system": "HSDB",
          "references": [
            "9ab7bd3f-5fd7-a7f5-63f3-bd3e6e4f5383"
          ]
        },
        {
          "uuid": "1841850d-166c-83fe-d25c-ec7ce7570d0f",
          "code": "DTXSID7024081",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7024081",
          "code_system": "EPA CompTox",
          "references": [
            "7577ba0d-f5a0-7fd5-8165-0bd22ed87c56"
          ]
        },
        {
          "uuid": "7c24ef9c-5e98-47ea-a24b-0957789c5f16",
          "code": "18F7018HG1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8818f73e-bb54-0a16-337a-2271fa80845a",
          "code": "112771",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=112771",
          "code_system": "NSC",
          "references": [
            "644ea1e2-3552-35b5-5fbc-d34da46e4658"
          ]
        },
        {
          "uuid": "fd309552-9c65-7208-0954-6646b94a5201",
          "code": "Endothall",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Endothall",
          "code_system": "WIKIPEDIA",
          "references": [
            "10b27ef4-e5f8-df29-f876-7060d5406678"
          ]
        },
        {
          "uuid": "5c0005ff-2913-5117-1d29-2da13c9a1c22",
          "code": "endothal",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/endothal.html",
          "code_system": "ALANWOOD",
          "references": [
            "eebfb7b0-420a-a591-d5dc-373f0be9d2b6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "431fd1f7-4b7a-48f7-a406-89bc0c068bad",
          "name": "1,2-BENZENEDICARBOXYLIC ACID, HEXAHYDRO-3,6-ENDO-OXY-",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID, HEXAHYDRO-3,6-ENDO-OXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "dc7f96ca-e613-4cdd-9f6c-666d846224b9",
          "name": "1,2-CYCLOHEXANEDICARBOXYLIC ACID, 3,6-ENDO-EPOXY-",
          "stdName": "1,2-CYCLOHEXANEDICARBOXYLIC ACID, 3,6-ENDO-EPOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "3043b7a0-a0fa-407a-a7b7-10ed17ff4c88",
          "name": "3,6-ENDOOXYPHTHALIC ACID, HEXAHYDRO-",
          "stdName": "3,6-ENDOOXYPHTHALIC ACID, HEXAHYDRO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "ff022020-1645-4376-8589-2b748a90c63a",
          "name": "3,6-ENDOXOHEXAHYDROPHTHALIC ACID",
          "stdName": "3,6-ENDOXOHEXAHYDROPHTHALIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de1bf199-6376-49a1-ae3a-3fd419f6ad61",
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd"
          ],
          "display_name": false
        },
        {
          "uuid": "795e797c-a043-4983-88b3-88f6eb36c505",
          "name": "7-OXABICYCLO(2.2.1)HEPTANE-2,3-DICARBOXYLIC ACID",
          "stdName": "7-OXABICYCLO(2.2.1)HEPTANE-2,3-DICARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "e97b8f76-65c0-4945-a663-c899cb1e83fc",
          "name": "7-OXABICYCLO(2.2.1)HEPTANE-2,3-DICARBOXYLIC ACID, (1R,2S,3R,4S)-REL-",
          "stdName": "7-OXABICYCLO(2.2.1)HEPTANE-2,3-DICARBOXYLIC ACID, (1R,2S,3R,4S)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "3485b86c-f21f-47d2-a5b5-2f8d842a1d7c",
          "name": "7-OXABICYCLO(2.2.1)HEPTANE-2,3-DICARBOXYLIC ACID, EXO,EXO-",
          "stdName": "7-OXABICYCLO(2.2.1)HEPTANE-2,3-DICARBOXYLIC ACID, EXO,EXO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "e7561b3a-0792-4fed-bd92-68f6bd1c0396",
          "name": "7-OXABICYCLO(2.2.1)HEPTANE-2,3-EXO-CIS-DICARBOXYLIC ACID",
          "stdName": "7-OXABICYCLO(2.2.1)HEPTANE-2,3-EXO-CIS-DICARBOXYLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "44ea975a-9e66-4b2a-9431-7a2001ad4202",
          "name": "AQUATHOL",
          "stdName": "AQUATHOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "3ce9aeab-5dfd-4d12-b9fe-ac6ac4eab518",
          "name": "AQUOTHOL",
          "stdName": "AQUOTHOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "689b11d7-8dfc-4e2a-8a44-1234c1c12db1",
          "name": "ENDOTHAL",
          "stdName": "ENDOTHAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1bdba10-83dc-4bfd-bc54-f44b78379379",
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "38673d43-e864-4096-9a64-089b87fa7fc5"
          ],
          "display_name": true
        },
        {
          "uuid": "1bed8977-5923-49b1-b537-b96ad4b60518",
          "name": "ENDOTHAL [ISO]",
          "stdName": "ENDOTHAL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1bdba10-83dc-4bfd-bc54-f44b78379379",
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd"
          ],
          "display_name": false
        },
        {
          "uuid": "f49a5808-f831-4640-9252-89c2c679a9b8",
          "name": "ENDOTHAL, (±)-",
          "stdName": "ENDOTHAL, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "0a46b47e-8e67-410c-a415-5d6e8ecd03d2"
          ],
          "display_name": false
        },
        {
          "uuid": "736638d4-4193-473f-b894-f9d7b03358f1",
          "name": "ENDOTHALIC ACID",
          "stdName": "ENDOTHALIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "e1779121-52c2-4009-b824-b493faeb8309",
          "name": "ENDOTHALL",
          "stdName": "ENDOTHALL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1bdba10-83dc-4bfd-bc54-f44b78379379",
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f",
            "8eb408e6-2fa2-4ba2-8418-58fc24fe69f9"
          ],
          "display_name": false
        },
        {
          "uuid": "447a8155-5a47-4adc-ad5d-366a7ee5f026",
          "name": "ENDOTHALL [MI]",
          "stdName": "ENDOTHALL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1bdba10-83dc-4bfd-bc54-f44b78379379",
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd"
          ],
          "display_name": false
        },
        {
          "uuid": "e3c0dec9-d832-4789-bc00-061aabcece2e",
          "name": "ENDOTHALLIC ACID",
          "stdName": "ENDOTHALLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "966373e2-6bd2-4300-b865-884001dd2c32",
          "name": "HERBON PENNOUT",
          "stdName": "HERBON PENNOUT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "8a636910-535d-4f1e-880c-edff59eb7cf8",
          "name": "HYDOUT",
          "stdName": "HYDOUT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "d92c8934-fc2e-4464-be32-a4c40ab8b336",
          "name": "HYDROTHOL",
          "stdName": "HYDROTHOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
            "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "922f6240-6456-49d2-bd1d-c356a3e5e5c5",
          "name": "NSC-112771",
          "stdName": "NSC-112771",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1bdba10-83dc-4bfd-bc54-f44b78379379",
            "6e6ec052-935c-4bf9-86ea-206c15a01bbd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "920f67c8-27ae-4df7-aca7-03d2621c4b0f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6e6ec052-935c-4bf9-86ea-206c15a01bbd",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de1bf199-6376-49a1-ae3a-3fd419f6ad61",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1bdba10-83dc-4bfd-bc54-f44b78379379",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a46b47e-8e67-410c-a415-5d6e8ecd03d2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a5c11e0-f0b8-4e5b-a98f-3a6c4c95558c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34124986-9e9b-4b12-801a-58eeb151d13a",
          "citation": "SRS import [18F7018HG1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=18F7018HG1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38673d43-e864-4096-9a64-089b87fa7fc5",
          "citation": "ENDOTHAL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8eb408e6-2fa2-4ba2-8418-58fc24fe69f9",
          "citation": "ENDOTHALL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ab7bd3f-5fd7-a7f5-63f3-bd3e6e4f5383",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+145-73-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7577ba0d-f5a0-7fd5-8165-0bd22ed87c56",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=145-73-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "10b27ef4-e5f8-df29-f876-7060d5406678",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "eebfb7b0-420a-a591-d5dc-373f0be9d2b6",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "93709450-6446-4abd-8f34-2600aa8d4134",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "38141fc2-50da-4e04-b12b-bfc0b80d5f55",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "735bc57c-d3db-4d2e-ac64-c7a8e1b76a8f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6f6b7623-45ed-4ce3-a870-8cf9a7418f67",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "644ea1e2-3552-35b5-5fbc-d34da46e4658",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "418da0d9-c6f7-4672-a810-fc9fd7206a4b",
          "id": "418da0d9-c6f7-4672-a810-fc9fd7206a4b",
          "molfile": "\n  Marvin  01132103282D          \n\n 13 14  0  0  0  0            999 V2000\n    7.2994   -3.5192    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.5852   -3.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5857   -4.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3004   -5.1692    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.8236   -4.3446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0146   -4.7564    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.7294   -5.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7299   -5.9934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4436   -4.7554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0141   -3.9314    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.7284   -3.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7279   -2.6934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4431   -3.9304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  1  0  0  0\n  1 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  1  0  0  0\n 10  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10 11  1  1  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\nM  END",
          "smiles": "C1C[C@@H]2[C@H]([C@H]([C@H]1O2)C(=O)O)C(=O)O",
          "formula": "C8H10O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "36bd62ad-5fab-45cb-ab33-69b65fce28bc"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "186.1623",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "44d4f52d-a8fa-414b-9dea-b242635be288",
      "version": "8",
      "structure": {
        "id": "fe230226-3f7c-49c5-99ef-a4c737134041",
        "molfile": "\n  Marvin  01132113092D          \n\n 13 14  0  0  1  0            999 V2000\n    8.0146   -4.7564    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.0141   -3.9314    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2994   -3.5192    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3004   -5.1692    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.7284   -3.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7279   -2.6934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4431   -3.9304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8236   -4.3446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5857   -4.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5852   -3.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7294   -5.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7299   -5.9934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4436   -4.7554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  2  5  1  1  0  0  0\n  6  5  2  0  0  0  0\n  7  5  1  0  0  0  0\n  4  8  1  1  0  0  0\n  3  8  1  1  0  0  0\n  9  4  1  0  0  0  0\n  3 10  1  0  0  0  0\n 10  9  1  0  0  0  0\n  1 11  1  1  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\nM  END",
        "smiles": "C1C[C@@H]2[C@H]([C@H]([C@H]1O2)C(=O)O)C(=O)O",
        "formula": "C8H10O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "186.1623",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "34124986-9e9b-4b12-801a-58eeb151d13a",
          "920f67c8-27ae-4df7-aca7-03d2621c4b0f"
        ],
        "stereo_centers": 4
      },
      "unii": "18F7018HG1"
    }
  ]
}