{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ab9f69f6-7f16-4531-aec5-0f91e05bca2a",
          "code": "372137-35-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=372137-35-4",
          "code_system": "CAS",
          "references": [
            "1cecb6a8-6c72-451d-993f-57c7e6c78b94",
            "94160cc0-9235-4ee3-9561-8d232d6ac05f"
          ]
        },
        {
          "uuid": "9cffc31d-0124-4027-a15b-b2343d6deef7",
          "code": "118203",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1417",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "1cecb6a8-6c72-451d-993f-57c7e6c78b94"
          ]
        },
        {
          "uuid": "c2a35914-a28d-47db-8968-693acb6cf1d2",
          "code": "m9721",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9721?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1cecb6a8-6c72-451d-993f-57c7e6c78b94"
          ]
        },
        {
          "uuid": "cd1feb5b-2839-4070-a662-cee22989d41a",
          "code": "11571392",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11571392",
          "code_system": "PUBCHEM",
          "references": [
            "1cecb6a8-6c72-451d-993f-57c7e6c78b94"
          ]
        },
        {
          "uuid": "cb80c3d8-f3ad-e4d1-c039-d7a622d7f435",
          "code": "DTXSID9058072",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9058072",
          "code_system": "EPA CompTox",
          "references": [
            "2e3bb7fb-bb71-1ac5-a469-def39c10a2c3"
          ]
        },
        {
          "uuid": "a67977b2-1cb9-41e6-b938-b45fd0225508",
          "code": "189U20M808",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7434dec0-f070-298f-2bfa-8ca5109f210f",
          "code": "142824",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:142824",
          "code_system": "CHEBI",
          "references": [
            "0f4fd4ea-6bcd-a56f-3a79-9a84c3441fbf"
          ]
        },
        {
          "uuid": "680272cd-9cf3-d86a-e895-9524664a65d5",
          "code": "Saflufenacil",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Saflufenacil",
          "code_system": "WIKIPEDIA",
          "references": [
            "71ee0250-78c6-3877-6cd9-ffaff007a0bd"
          ]
        },
        {
          "uuid": "9343e23c-c6d6-53a5-8374-318a8b600188",
          "code": "saflufenacil",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/saflufenacil.html",
          "code_system": "ALANWOOD",
          "references": [
            "5e309bf2-5007-f423-445c-8422f1653055"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "90024475-0cd3-45c2-b321-414243d8b909",
          "name": "2-CHLORO-5-(3,6-DIHYDRO-3-METHYL-2,6-DIOXO-4-(TRIFLUOROMETHYL)-1(2H)-PYRIMIDINYL)-4-FLUORO-N-((METHYL(1-METHYLETHYL)AMINO)SULFONYL)BENZAMIDE",
          "stdName": "2-CHLORO-5-(3,6-DIHYDRO-3-METHYL-2,6-DIOXO-4-(TRIFLUOROMETHYL)-1(2H)-PYRIMIDINYL)-4-FLUORO-N-((METHYL(1-METHYLETHYL)AMINO)SULFONYL)BENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a820b8bc-8251-43cc-94ed-b9d2c635c4c8",
            "5bb255d4-6a40-4d4f-8f20-c113f71194be"
          ],
          "display_name": false
        },
        {
          "uuid": "7e19b281-24db-47ba-b3cb-73b9f2fd6da4",
          "name": "KIXOR",
          "stdName": "KIXOR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80395a81-2e32-4efd-a30a-4f938301d009",
            "4af1ea4e-e94f-4877-a16b-127500b54b20"
          ],
          "display_name": false
        },
        {
          "uuid": "cdb5a58b-5b8a-4ae5-bf73-8becd3cf9d23",
          "name": "N'-(2-CHLORO-4-FLUORO-5-(1,2,3,6-TETRAHYDRO-3-METHYL-2,6-DIOXO-4-(TRIFLUOROMETHYL)PYRIMIDIN-1-YL)BENZOYL)-N-ISOPROPYL-N-METHYLSULFAMIDE",
          "stdName": "N'-(2-CHLORO-4-FLUORO-5-(1,2,3,6-TETRAHYDRO-3-METHYL-2,6-DIOXO-4-(TRIFLUOROMETHYL)PYRIMIDIN-1-YL)BENZOYL)-N-ISOPROPYL-N-METHYLSULFAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bb255d4-6a40-4d4f-8f20-c113f71194be",
            "a8cf143a-4a02-4a8c-995c-42a5122148aa"
          ],
          "display_name": false
        },
        {
          "uuid": "cbc4dcf0-22ea-4d36-9e5f-cab74a2787ad",
          "name": "SAFLUFENACIL",
          "stdName": "SAFLUFENACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61322827-0da0-40ff-9757-38e5f6592bcf",
            "0cb5d489-5a00-4c7d-b6a9-a505e927574d",
            "5fadacb5-61a7-47c0-8b5a-f45d8c188a9b",
            "99a4c388-683b-474d-9b12-7e2c724eb705",
            "4af1ea4e-e94f-4877-a16b-127500b54b20",
            "35cdbde3-e42b-4359-89df-33074fe05078"
          ],
          "display_name": true
        },
        {
          "uuid": "119a96aa-a839-4bf5-8c50-f52346725699",
          "name": "SAFLUFENACIL [ISO]",
          "stdName": "SAFLUFENACIL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cb5d489-5a00-4c7d-b6a9-a505e927574d",
            "4af1ea4e-e94f-4877-a16b-127500b54b20"
          ],
          "display_name": false
        },
        {
          "uuid": "c02fce01-7a59-488e-8a68-268922e39c52",
          "name": "SAFLUFENACIL [MI]",
          "stdName": "SAFLUFENACIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61322827-0da0-40ff-9757-38e5f6592bcf",
            "4af1ea4e-e94f-4877-a16b-127500b54b20"
          ],
          "display_name": false
        },
        {
          "uuid": "245f6369-7b0d-4a0b-8b28-04c548305671",
          "name": "TREEVIX",
          "stdName": "TREEVIX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80395a81-2e32-4efd-a30a-4f938301d009",
            "4af1ea4e-e94f-4877-a16b-127500b54b20"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "99a4c388-683b-474d-9b12-7e2c724eb705",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5bb255d4-6a40-4d4f-8f20-c113f71194be",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8cf143a-4a02-4a8c-995c-42a5122148aa",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a820b8bc-8251-43cc-94ed-b9d2c635c4c8",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0cb5d489-5a00-4c7d-b6a9-a505e927574d",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4af1ea4e-e94f-4877-a16b-127500b54b20",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80395a81-2e32-4efd-a30a-4f938301d009",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61322827-0da0-40ff-9757-38e5f6592bcf",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cecb6a8-6c72-451d-993f-57c7e6c78b94",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390913000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de415096-eaa2-4065-951f-ca5e15cfbc58",
          "citation": "SRS import [189U20M808]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=189U20M808",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390913000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa84ddbf-d737-42b4-b777-18d61596624f",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35cdbde3-e42b-4359-89df-33074fe05078",
          "citation": "SAFLUFENACIL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5fadacb5-61a7-47c0-8b5a-f45d8c188a9b",
          "citation": "SAFLUFENACIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2e3bb7fb-bb71-1ac5-a469-def39c10a2c3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=372137-35-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "71ee0250-78c6-3877-6cd9-ffaff007a0bd",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "5e309bf2-5007-f423-445c-8422f1653055",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "94160cc0-9235-4ee3-9561-8d232d6ac05f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0f4fd4ea-6bcd-a56f-3a79-9a84c3441fbf",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bcf96b39-8b16-4a4a-8b49-d6af6529466d",
          "id": "bcf96b39-8b16-4a4a-8b49-d6af6529466d",
          "molfile": "\n  Marvin  01132109462D          \n\n 32 33  0  0  0  0            999 V2000\n   11.2915   -3.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4630   -4.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1870   -3.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2809   -4.9610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0795   -5.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5682   -5.3735    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3161   -4.6081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9990   -6.0680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8511   -5.7860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -5.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -4.5439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4212   -5.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7041   -5.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9914   -5.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9914   -6.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2742   -7.0236    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7041   -7.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4212   -6.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -7.0236    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.2742   -5.3735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -5.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -6.6110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8444   -5.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8444   -4.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -4.1314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -3.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2742   -4.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9914   -4.1314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1272   -4.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4146   -4.5439    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1272   -3.3063    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4146   -3.7189    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  2  0  0  0  0\n  9  6  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 18 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 20 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 27  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 24 29  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 29 32  1  0  0  0  0\nM  END",
          "smiles": "CC(C)N(C)S(=O)(=O)NC(=O)c1cc(c(cc1Cl)F)-n2c(=O)cc(C(F)(F)F)n(C)c2=O",
          "formula": "C17H17ClF4N4O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2e6a7dfc-1332-449a-93cd-43aecbf35459"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "500.854",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ee69d9f7-1f2b-4e34-9dbf-52551197e2cd",
      "version": "8",
      "structure": {
        "id": "e309ac6a-229a-43aa-a2b3-e0be1142a6b6",
        "molfile": "\n  Marvin  01132111452D          \n\n 32 33  0  0  0  0            999 V2000\n    4.5570   -4.1314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8444   -4.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8444   -5.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -5.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2742   -5.3735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2742   -4.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9914   -4.1314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9914   -5.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7041   -5.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4212   -5.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4212   -6.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7041   -7.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9914   -6.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2742   -7.0236    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -7.0236    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -5.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1339   -4.5439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8511   -5.7860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5682   -5.3735    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3161   -4.6081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9990   -6.0680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2809   -4.9610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0795   -5.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4630   -4.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2915   -3.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1870   -3.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -6.6110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1272   -4.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4146   -4.5439    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1272   -3.3063    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4146   -3.7189    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -3.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n  8 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 10 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  2  0  0  0  0\n 19 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n  4 27  2  0  0  0  0\n  2 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 28 31  1  0  0  0  0\n  1 32  1  0  0  0  0\nM  END",
        "smiles": "CC(C)N(C)S(=O)(=O)NC(=O)c1cc(c(cc1Cl)F)-n2c(=O)cc(C(F)(F)F)n(C)c2=O",
        "formula": "C17H17ClF4N4O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "500.854",
        "optical_activity": "NONE",
        "references": [
          "de415096-eaa2-4065-951f-ca5e15cfbc58",
          "fa84ddbf-d737-42b4-b777-18d61596624f"
        ],
        "stereo_centers": 0
      },
      "unii": "189U20M808"
    }
  ]
}