{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "54fc5300-8ee2-4468-b982-bc00c727f05d",
          "code": "14101-61-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14101-61-2",
          "code_system": "CAS",
          "references": [
            "cba512cb-ac60-4d13-a94c-ff91741be060",
            "22ae49d7-6a87-4158-aca4-bec36df24f41"
          ]
        },
        {
          "uuid": "8651622d-1640-4c26-b98b-c0015a5a0de3",
          "code": "C013649",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67013649",
          "code_system": "MESH",
          "references": [
            "cba512cb-ac60-4d13-a94c-ff91741be060"
          ]
        },
        {
          "uuid": "1fd54a0e-8069-4d59-82eb-f17a573c85d5",
          "code": "5282349",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5282349",
          "code_system": "PUBCHEM",
          "references": [
            "cba512cb-ac60-4d13-a94c-ff91741be060"
          ]
        },
        {
          "uuid": "b8d11592-d903-ffca-caa5-7f2b19792c92",
          "code": "gamma-Tocotrienol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/gamma-Tocotrienol",
          "code_system": "WIKIPEDIA",
          "references": [
            "3d493da1-3284-48e6-d60e-00a766836fe6"
          ]
        },
        {
          "uuid": "d42a40c5-d80c-40f5-8928-72ae302f8fff",
          "code": "185QAE24TR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7025532a-3f21-6ce1-cb40-3d42902a3503",
          "code": "33277",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33277",
          "code_system": "CHEBI",
          "references": [
            "5260207a-cf71-51ec-cc46-f9912f85723c"
          ]
        },
        {
          "uuid": "8938eb7f-b7ad-c4ad-980b-e36f168f86d9",
          "code": "DTXSID101019984",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID101019984",
          "code_system": "EPA CompTox",
          "references": [
            "5260207a-cf71-51ec-cc46-f9912f85723c"
          ]
        },
        {
          "uuid": "a062adb3-1b2b-df51-6ce6-3fd6517dbb14",
          "code": "100000172042",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7cae08b2-f06b-c9af-a8e8-1a3d0e56b8d5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1bf9c809-942d-4417-a998-c07ccb543473",
          "name": "(R)-.GAMMA.-TOCOTRIENOL",
          "stdName": "(R)-.GAMMA.-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22ae49d7-6a87-4158-aca4-bec36df24f41",
            "d8b73679-6226-443c-b043-dd91347b8fee"
          ],
          "display_name": false
        },
        {
          "uuid": "dab62fd0-b1f3-462e-bff0-d1b59c985853",
          "name": ".GAMMA.-TOCOTRIENOL",
          "stdName": ".GAMMA.-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22ae49d7-6a87-4158-aca4-bec36df24f41",
            "d8b73679-6226-443c-b043-dd91347b8fee"
          ],
          "display_name": true
        },
        {
          "uuid": "3a9a025b-04b5-4f39-bbe3-5d0ab67f3737",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,7,8-TRIMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIEN-1-YL)-, (2R)-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,7,8-TRIMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIEN-1-YL)-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22ae49d7-6a87-4158-aca4-bec36df24f41",
            "d8b73679-6226-443c-b043-dd91347b8fee"
          ],
          "display_name": false
        },
        {
          "uuid": "1cfb490b-3619-484b-995e-cd8a64ead912",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,7,8-TRIMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (2R)-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,7,8-TRIMETHYL-2-((3E,7E)-4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22ae49d7-6a87-4158-aca4-bec36df24f41",
            "d8b73679-6226-443c-b043-dd91347b8fee"
          ],
          "display_name": false
        },
        {
          "uuid": "bf68fd76-70ae-4327-885d-a4e741c35b40",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,7,8-TRIMETHYL-2-(4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (R-(E,E))-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,7,8-TRIMETHYL-2-(4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-, (R-(E,E))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22ae49d7-6a87-4158-aca4-bec36df24f41",
            "d8b73679-6226-443c-b043-dd91347b8fee"
          ],
          "display_name": false
        },
        {
          "uuid": "f69ef0d1-bbbf-4722-9852-784c802842f6",
          "name": "7,8-DIMETHYLTOCOTRIENOL",
          "stdName": "7,8-DIMETHYLTOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22ae49d7-6a87-4158-aca4-bec36df24f41",
            "d8b73679-6226-443c-b043-dd91347b8fee"
          ],
          "display_name": false
        },
        {
          "uuid": "2da19147-6d2d-47f2-bd16-61db83b9f23e",
          "name": "D-.GAMMA.-TOCOTRIENOL",
          "stdName": "D-.GAMMA.-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22ae49d7-6a87-4158-aca4-bec36df24f41"
          ],
          "display_name": false
        },
        {
          "uuid": "3928ad76-222e-43b4-b469-ebcb50998d44",
          "name": "GAMMA-TOCOTRIENOL",
          "stdName": "GAMMA-TOCOTRIENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "641e2150-e675-4949-98fb-0e7d2b8ac164"
          ],
          "display_name": false
        },
        {
          "uuid": "ef11fbeb-3cfe-9579-90db-b6972af6d8dd",
          "name": "Gamma Tocotrienol [WHO-DD]",
          "stdName": "GAMMA TOCOTRIENOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73b85f31-a8ec-4ca6-a528-711fc3fecaef"
          ],
          "display_name": false
        },
        {
          "uuid": "c4b0bb6a-d8c6-4e14-9a52-dd69a46538b9",
          "name": "J13.903C",
          "stdName": "J13.903C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e1bcdc6-99c6-45d7-a204-8e7f84478be9",
            "22ae49d7-6a87-4158-aca4-bec36df24f41"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "641e2150-e675-4949-98fb-0e7d2b8ac164",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d8b73679-6226-443c-b043-dd91347b8fee",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22ae49d7-6a87-4158-aca4-bec36df24f41",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e1bcdc6-99c6-45d7-a204-8e7f84478be9",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J13.903C",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J13.903C",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cba512cb-ac60-4d13-a94c-ff91741be060",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391084000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31cc16c2-accb-48d9-9b6e-52de0f6d5e84",
          "citation": "SRS import [185QAE24TR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=185QAE24TR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391084000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6232487f-5804-4b99-93bb-043b4c4d820e",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d493da1-3284-48e6-d60e-00a766836fe6",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/gamma-Tocotrienol",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7cae08b2-f06b-c9af-a8e8-1a3d0e56b8d5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "73b85f31-a8ec-4ca6-a528-711fc3fecaef",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5260207a-cf71-51ec-cc46-f9912f85723c",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f54e7644-c995-4380-8f16-a0699537588c",
          "id": "f54e7644-c995-4380-8f16-a0699537588c",
          "molfile": "\n  Marvin  01132112432D          \n\n 30 31  0  0  1  0            999 V2000\n    1.5449   -5.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6870   -6.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0545   -7.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4616   -6.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0940   -6.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8686   -6.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5012   -6.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3544   -5.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2757   -6.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9081   -5.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6827   -6.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3151   -5.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1685   -4.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0897   -5.9243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7222   -5.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4968   -5.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1292   -5.1451    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.4968   -4.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5417   -5.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3667   -5.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7791   -5.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6041   -5.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0166   -4.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8416   -4.4302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6041   -3.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0166   -3.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7791   -3.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3667   -3.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3667   -4.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5417   -4.4302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 17 30  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 29  2  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 25  1  0  0  0  0\n 25 27  2  0  0  0  0\n 28 27  1  0  0  0  0\n 27 29  1  0  0  0  0\n 30 29  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC/C(=C/CC/C(=C/CC[C@]1(C)CCc2cc(c(C)c(C)c2O1)O)/C)/C)C",
          "formula": "C28H42O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9148cf2b-f4c8-40e5-a5a7-e82649bbb3ca"
          },
          "defined_stereo": 1,
          "ez_centers": 2,
          "molecular_weight": "410.6329",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3227fce2-2cb3-4149-8475-749d4963cb7e",
      "version": "10",
      "structure": {
        "id": "f0e65360-b4e9-4ee0-a40f-f07fdd47bf57",
        "molfile": "\n  Marvin  01132112302D          \n\n 30 31  0  0  1  0            999 V2000\n   11.3667   -4.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7791   -3.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6041   -3.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0166   -3.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0166   -4.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6041   -5.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7791   -5.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3667   -5.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5417   -5.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1292   -5.1451    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.5417   -4.4302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4968   -5.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7222   -5.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0897   -5.9243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3151   -5.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6827   -6.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9081   -5.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2757   -6.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5012   -6.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8686   -6.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0940   -6.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4616   -6.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6870   -6.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5449   -5.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0545   -7.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3544   -5.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1685   -4.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4968   -4.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8416   -4.4302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3667   -3.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  1  1  0  0  0  0\n 10 12  1  1  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 19  1  0  0  0  0\n 27 15  1  0  0  0  0\n 10 28  1  6  0  0  0\n 29  5  1  0  0  0  0\n 30  2  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC/C(=C/CC/C(=C/CC[C@]1(C)CCc2cc(c(C)c(C)c2O1)O)/C)/C)C",
        "formula": "C28H42O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 2,
        "molecular_weight": "410.6329",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6232487f-5804-4b99-93bb-043b4c4d820e",
          "31cc16c2-accb-48d9-9b6e-52de0f6d5e84",
          "73b85f31-a8ec-4ca6-a528-711fc3fecaef"
        ],
        "stereo_centers": 1
      },
      "unii": "185QAE24TR"
    }
  ]
}