{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f01918f4-aff4-41a3-8110-e869febb2176",
          "code": "963-07-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=963-07-5",
          "code_system": "CAS",
          "references": [
            "d4a121d4-aeb2-43b4-aacf-0b3892c73025",
            "2886ffb8-a962-4165-93bb-913815399926"
          ]
        },
        {
          "uuid": "0142b7d5-e76a-4073-8be4-1b891d8c85b4",
          "code": "213-512-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.284",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d4a121d4-aeb2-43b4-aacf-0b3892c73025"
          ]
        },
        {
          "uuid": "ff51082b-7591-4d15-b9e9-053748413cb8",
          "code": "C96326",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C96326",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d4a121d4-aeb2-43b4-aacf-0b3892c73025"
          ]
        },
        {
          "uuid": "efc10242-78b1-4984-a4ed-2ec52c07a736",
          "code": "SUB12889MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d4a121d4-aeb2-43b4-aacf-0b3892c73025"
          ]
        },
        {
          "uuid": "fab6cb6a-2d5f-4410-bfad-a970cae07bbb",
          "code": "12428",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12428",
          "code_system": "PUBCHEM",
          "references": [
            "d4a121d4-aeb2-43b4-aacf-0b3892c73025"
          ]
        },
        {
          "uuid": "1670498c-c066-6687-085f-e36744212708",
          "code": "DTXSID70242192",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70242192",
          "code_system": "EPA CompTox",
          "references": [
            "aa777898-9eb2-875c-0ccb-8ccc04116ce4"
          ]
        },
        {
          "uuid": "8b6e3345-acfa-02ee-afce-132a66d07e00",
          "code": "C245",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anesthetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C245",
          "code_system": "NCI_THESAURUS",
          "references": [
            "64ffbdec-3289-61cb-2edd-76d336ac08d1"
          ]
        },
        {
          "uuid": "fe2e69e3-f634-446c-8a80-70f8dbdea1d6",
          "code": "1801659K6K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a4a02cdb-7c63-a160-f2c8-5ef0a8ca7a31",
          "code": "100000077395",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2a062da1-06c7-3c67-f69d-adfdb6634d33"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3b7dfb38-ea3b-46fb-a905-2bd0670a71f2",
          "name": "1,1-BIS(DIMETHYLAMINOMETHYL)PROPYL BENZOATE",
          "stdName": "1,1-BIS(DIMETHYLAMINOMETHYL)PROPYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8b881d8-6716-4108-8b04-9b18cd280dda",
            "5508334e-b86f-40cb-a34d-130c3cfe91f6"
          ],
          "display_name": false
        },
        {
          "uuid": "1969db9b-6bce-4400-99dd-8829803d8185",
          "name": "2-BENZOXY-2-DIMETHYLAMINOMETHYL-1-DIMETHYLAMINOBUTANE",
          "stdName": "2-BENZOXY-2-DIMETHYLAMINOMETHYL-1-DIMETHYLAMINOBUTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8b881d8-6716-4108-8b04-9b18cd280dda",
            "d59af769-1191-4733-97c0-c03853e9ebe4"
          ],
          "display_name": false
        },
        {
          "uuid": "834db765-3983-4d66-acc6-a7af34122dd4",
          "name": "2-BUTANOL, 1-(DIMETHYLAMINO)-2-((DIMETHYLAMINO)METHYL)-, 2-BENZOATE",
          "stdName": "2-BUTANOL, 1-(DIMETHYLAMINO)-2-((DIMETHYLAMINO)METHYL)-, 2-BENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8b881d8-6716-4108-8b04-9b18cd280dda",
            "d59af769-1191-4733-97c0-c03853e9ebe4"
          ],
          "display_name": false
        },
        {
          "uuid": "18d1cfcb-b11d-467b-8afa-92c17415551a",
          "name": "2-BUTANOL, 1-(DIMETHYLAMINO)-2-((DIMETHYLAMINO)METHYL)-, BENZOATE",
          "stdName": "2-BUTANOL, 1-(DIMETHYLAMINO)-2-((DIMETHYLAMINO)METHYL)-, BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8b881d8-6716-4108-8b04-9b18cd280dda",
            "d59af769-1191-4733-97c0-c03853e9ebe4"
          ],
          "display_name": false
        },
        {
          "uuid": "59f8e7a2-1c11-47c5-b436-ee59b918901a",
          "name": "2-BUTANOL, 1-(DIMETHYLAMINO)-2-((DIMETHYLAMINO)METHYL)-, BENZOATE (ESTER)",
          "stdName": "2-BUTANOL, 1-(DIMETHYLAMINO)-2-((DIMETHYLAMINO)METHYL)-, BENZOATE (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8b881d8-6716-4108-8b04-9b18cd280dda",
            "d59af769-1191-4733-97c0-c03853e9ebe4"
          ],
          "display_name": false
        },
        {
          "uuid": "ca0dbf03-9067-441c-9582-623e709e29c3",
          "name": "ALIPINA",
          "stdName": "ALIPINA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8b881d8-6716-4108-8b04-9b18cd280dda",
            "d59af769-1191-4733-97c0-c03853e9ebe4"
          ],
          "display_name": false
        },
        {
          "uuid": "236739f4-4626-4e56-9a57-9d26abe94b34",
          "name": "ALYPIN",
          "stdName": "ALYPIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8db50414-0dc9-4e16-9fbf-a9dce930fab0",
            "b8b881d8-6716-4108-8b04-9b18cd280dda"
          ],
          "display_name": false
        },
        {
          "uuid": "54260f03-7008-49cd-8a61-e1e2977f05b9",
          "name": "ALYPINE",
          "stdName": "ALYPINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8b881d8-6716-4108-8b04-9b18cd280dda",
            "d59af769-1191-4733-97c0-c03853e9ebe4"
          ],
          "display_name": false
        },
        {
          "uuid": "7ab79af2-26d1-41b7-9886-c91a6b209cc0",
          "name": "AMYDRICAINE",
          "stdName": "AMYDRICAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d9d6003-2c26-4a54-b43e-4602106c788d",
            "b8b881d8-6716-4108-8b04-9b18cd280dda",
            "7a54d807-8e5c-44b6-a8db-2a470c5aac17",
            "d59af769-1191-4733-97c0-c03853e9ebe4"
          ],
          "display_name": true
        },
        {
          "uuid": "5b2aa960-430b-e7d7-5610-76890c98ed7b",
          "name": "Amydricaine [WHO-DD]",
          "stdName": "AMYDRICAINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "baba5398-fe1f-8371-c2a7-c88e68ec27c8"
          ],
          "display_name": false
        },
        {
          "uuid": "8bc360c7-4f20-4a96-83d2-78e960af6808",
          "name": "DIMETHYLAMINOSTOVAINE",
          "stdName": "DIMETHYLAMINOSTOVAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8b881d8-6716-4108-8b04-9b18cd280dda",
            "d59af769-1191-4733-97c0-c03853e9ebe4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d59af769-1191-4733-97c0-c03853e9ebe4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b8b881d8-6716-4108-8b04-9b18cd280dda",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5508334e-b86f-40cb-a34d-130c3cfe91f6",
          "citation": "http://www.chemexper.com/chemicals/supplier/cas/963-07-5.html",
          "url": "http://www.chemexper.com/chemicals/supplier/cas/963-07-5.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8db50414-0dc9-4e16-9fbf-a9dce930fab0",
          "citation": "SAX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a54d807-8e5c-44b6-a8db-2a470c5aac17",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4a121d4-aeb2-43b4-aacf-0b3892c73025",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6ce56bf-0389-4470-9aee-bd198d89e333",
          "citation": "SRS import [1801659K6K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1801659K6K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1872d7d-e212-4190-8983-8848355b2e33",
          "citation": "http://www.chemindustry.com/chemicals/0350201.html",
          "url": "http://www.chemindustry.com/chemicals/0350201.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d9d6003-2c26-4a54-b43e-4602106c788d",
          "citation": "AMYDRICAINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa777898-9eb2-875c-0ccb-8ccc04116ce4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=963-07-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2a062da1-06c7-3c67-f69d-adfdb6634d33",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "64ffbdec-3289-61cb-2edd-76d336ac08d1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2886ffb8-a962-4165-93bb-913815399926",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "baba5398-fe1f-8371-c2a7-c88e68ec27c8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3a86cd3f-58ba-4c65-9f0f-c55c7fce5bb1",
          "id": "3a86cd3f-58ba-4c65-9f0f-c55c7fce5bb1",
          "molfile": "\n  Marvin  01132103062D          \n\n 20 20  0  0  0  0            999 V2000\n    4.1048   -1.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2799   -1.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8695   -0.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4592   -0.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6342   -0.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2196   -0.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2238    0.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5876   -0.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5876    0.4859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3033    0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8744    0.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1514   -1.1597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1514   -1.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8646   -2.3993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4358   -2.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7202   -1.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0045   -2.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0045   -3.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7202   -3.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4358   -3.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  8  3  1  0  0  0  0\n  3 12  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CCC(CN(C)C)(CN(C)C)OC(=O)c1ccccc1",
          "formula": "C16H26N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cd5a9eae-17e5-4353-ac07-d1c75ff1449f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "278.3905",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4a8ace7f-3e71-4677-8f50-bd3d28ea1a3b",
      "version": "7",
      "structure": {
        "id": "f2ca4f8d-88ea-4817-819d-3ec65228e104",
        "molfile": "\n  Marvin  01132112362D          \n\n 20 20  0  0  0  0            999 V2000\n    2.8646   -2.3993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1514   -1.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1514   -1.1597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8695   -0.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4592   -0.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6342   -0.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2196   -0.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2238    0.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2799   -1.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1048   -1.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5876   -0.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5876    0.4859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3033    0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8744    0.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4358   -2.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7202   -1.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0045   -2.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0045   -3.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7202   -3.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4358   -3.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15  2  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 15 20  2  0  0  0  0\nM  END",
        "smiles": "CCC(CN(C)C)(CN(C)C)OC(=O)c1ccccc1",
        "formula": "C16H26N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "278.3905",
        "optical_activity": "NONE",
        "references": [
          "f1872d7d-e212-4190-8983-8848355b2e33",
          "a6ce56bf-0389-4470-9aee-bd198d89e333"
        ],
        "stereo_centers": 0
      },
      "unii": "1801659K6K"
    }
  ]
}