{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f96ca937-5c69-418f-a244-fd1c5c5f8f65", "code": "3864-99-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3864-99-1", "code_system": "CAS", "references": [ "36fbdb87-8e11-4f74-ba8a-a9631b219fdf", "8fd38b59-a59a-48c7-ad7d-849109a345f4" ] }, { "uuid": "00be022a-7b42-4d52-bfc2-aa58b64188df", "code": "FCN NO. 164", "comments": "FCN|UV LIGHT ABSORBER|POLYETHYLENE PHTHALATE POLYMERS", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=164", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "36fbdb87-8e11-4f74-ba8a-a9631b219fdf" ] }, { "uuid": "a6cc6e0c-9448-45a5-96e0-777a4ed74e31", "code": "223-383-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.259", "code_system": "ECHA (EC/EINECS)", "references": [ "36fbdb87-8e11-4f74-ba8a-a9631b219fdf" ] }, { "uuid": "8edec11d-67bc-4e5a-9e3e-6687ea330f74", "code": "77470", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/77470", "code_system": "PUBCHEM", "references": [ "36fbdb87-8e11-4f74-ba8a-a9631b219fdf" ] }, { "uuid": "ba2e981b-fe3a-56d7-c14a-85a5d16ce83d", "code": "DTXSID4038893", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4038893", "code_system": "EPA CompTox", "references": [ "b19e2725-808d-4205-24e6-e32e07d8a962" ] }, { "uuid": "d26b877b-22b3-4226-af85-653a41503c3c", "code": "17TJE602RX", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "bc239b95-a23e-41f4-a68c-a5d100fec216", "name": "2,4-DI-TERT-BUTYL-6-(5-CHLORO-2H-BENZOTRIAZOL-2-YL)PHENOL", "stdName": "2,4-DI-TERT-BUTYL-6-(5-CHLORO-2H-BENZOTRIAZOL-2-YL)PHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a94a18fc-e588-4809-a033-7b4b8ab297ea" ], "display_name": true }, { "uuid": "741d6c71-637f-4dd7-8bc9-ae53bd72534d", "name": "ANTIOXIDANT 327", "stdName": "ANTIOXIDANT 327", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "341436de-eb8e-495f-830a-0af99a487743" ], "display_name": false }, { "uuid": "669802ba-13a8-454e-9c05-71ff55624b59", "name": "LA-34", "stdName": "LA-34", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "341436de-eb8e-495f-830a-0af99a487743" ], "display_name": false }, { "uuid": "586c895a-343b-47ba-af10-66d87339a58a", "name": "PHENOL, 2,4-DI-TERT-BUTYL-6-(5-CHLORO-2H-BENZOTRIAZOL-2-YL)-", "stdName": "PHENOL, 2,4-DI-TERT-BUTYL-6-(5-CHLORO-2H-BENZOTRIAZOL-2-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "341436de-eb8e-495f-830a-0af99a487743" ], "display_name": false }, { "uuid": "4cd488f7-532d-4cbb-b81e-d359d3b9fc1a", "name": "PHENOL, 2-(5-CHLORO-2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1,1-DIMETHYLETHYL)-", "stdName": "PHENOL, 2-(5-CHLORO-2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1,1-DIMETHYLETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "af37ac40-ab97-423a-b9e2-f13f4d9abe94" ], "display_name": false }, { "uuid": "3a117f83-ce0d-4e2d-b42b-d666069ca263", "name": "UV-2", "stdName": "UV-2", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "341436de-eb8e-495f-830a-0af99a487743" ], "display_name": false }, { "uuid": "cc15b02c-58b8-4372-bbc3-22ef2d2fa3be", "name": "UV-327", "stdName": "UV-327", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "341436de-eb8e-495f-830a-0af99a487743" ], "display_name": false } ], "references": [ { "uuid": "a94a18fc-e588-4809-a033-7b4b8ab297ea", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "af37ac40-ab97-423a-b9e2-f13f4d9abe94", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "341436de-eb8e-495f-830a-0af99a487743", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "36fbdb87-8e11-4f74-ba8a-a9631b219fdf", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391012000, "tags": [ "NOMEN" ] }, { "uuid": "e25d324f-3eba-4b96-990a-75c104c59b2d", "citation": "SRS import [17TJE602RX]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=17TJE602RX", "doc_type": "SRS", "public_domain": true, "document_date": 1493391012000, "tags": [ "NOMEN" ] }, { "uuid": "e8d0eaa8-f47e-41cc-853c-3137e8f7057d", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b19e2725-808d-4205-24e6-e32e07d8a962", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3864-99-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8fd38b59-a59a-48c7-ad7d-849109a345f4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6a3d5e72-49fc-4cd1-8ad2-1560d78efc06", "id": "6a3d5e72-49fc-4cd1-8ad2-1560d78efc06", "molfile": "\n Marvin 01132105312D \n\n 25 27 0 0 0 0 999 V2000\n 5.3690 -6.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9573 -5.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5456 -5.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2423 -6.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6678 -5.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3800 -5.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0986 -5.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0986 -4.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8123 -4.0685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3772 -4.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6678 -4.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3772 -3.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5554 -3.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2035 -3.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3772 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8123 -5.7139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5708 -5.3794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1194 -5.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9410 -5.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3590 -6.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9503 -7.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3620 -8.1255 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1239 -7.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7109 -6.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8960 -6.5341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 5 2 1 0 0 0 0\n 5 6 1 0 0 0 0\n 11 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 16 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 12 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 25 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 24 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 21 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 2 0 0 0 0\nM END", "smiles": "CC(C)(C)c1cc(c(c(c1)-n2nc3ccc(cc3n2)Cl)O)C(C)(C)C", "formula": "C20H24ClN3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d0245e06-17aa-423d-a7fc-f634720b6228" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "357.8777", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "568bf30c-c07c-4f34-bdf3-fce55ff7e0f0", "version": "3", "structure": { "id": "dc70c6a4-309b-4322-8183-9afd5f9ebea5", "molfile": "\n Marvin 01132111262D \n\n 25 27 0 0 0 0 999 V2000\n 7.8123 -4.0685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0986 -4.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3772 -4.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6678 -4.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6678 -5.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3800 -5.7130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0986 -5.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8123 -5.7139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5708 -5.3794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1194 -5.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7109 -6.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1239 -7.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9503 -7.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3590 -6.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9410 -5.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3620 -8.1255 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8960 -6.5341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9573 -5.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3690 -6.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5456 -5.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2423 -6.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3772 -3.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5554 -3.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2035 -3.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3772 -2.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 2 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 10 1 0 0 0 0\n 13 16 1 0 0 0 0\n 11 17 2 0 0 0 0\n 17 8 1 0 0 0 0\n 5 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 18 21 1 0 0 0 0\n 3 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 22 25 1 0 0 0 0\nM END", "smiles": "CC(C)(C)c1cc(c(c(c1)-n2nc3ccc(cc3n2)Cl)O)C(C)(C)C", "formula": "C20H24ClN3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "357.8777", "optical_activity": "NONE", "references": [ "e8d0eaa8-f47e-41cc-853c-3137e8f7057d", "e25d324f-3eba-4b96-990a-75c104c59b2d" ], "stereo_centers": 0 }, "unii": "17TJE602RX" } ] }