{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8986ee85-81e8-4d14-810f-ab96eb2f647f",
          "code": "1918-11-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1918-11-2",
          "code_system": "CAS",
          "references": [
            "763a61ba-065a-40bc-a7e4-bd77d5be2a6b",
            "4166d350-0f2b-484f-88cd-3b411d14272e"
          ]
        },
        {
          "uuid": "b70fc5a4-1696-4205-a68e-1d61450a7fe7",
          "code": "38801",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3277",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "763a61ba-065a-40bc-a7e4-bd77d5be2a6b"
          ]
        },
        {
          "uuid": "e14650fc-a71f-4781-867a-ccab2ab404ae",
          "code": "15967",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15967",
          "code_system": "PUBCHEM",
          "references": [
            "763a61ba-065a-40bc-a7e4-bd77d5be2a6b"
          ]
        },
        {
          "uuid": "5279fcf2-8ead-0ec4-b6ca-ba25aec309b4",
          "code": "DTXSID1042441",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1042441",
          "code_system": "EPA CompTox",
          "references": [
            "72bc7fde-9763-c735-09d5-4484f629251f"
          ]
        },
        {
          "uuid": "00bf02a3-edf4-4aaa-b8d7-45c921e3a52a",
          "code": "17B625R8YT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4f06eec8-636a-baba-fa95-5d5e24ed2f6d",
          "code": "terbucarb",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/terbucarb.html",
          "code_system": "ALANWOOD",
          "references": [
            "c11da610-e6cf-33ba-5daf-2c43c9990666"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "55ff1519-32de-4a91-9d5b-f111f650e448",
          "name": "2,6-BIS(1,1-DIMETHYLETHYL)-4-METHYLPHENYL N-METHYLCARBAMATE",
          "stdName": "2,6-BIS(1,1-DIMETHYLETHYL)-4-METHYLPHENYL N-METHYLCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65778154-a12d-4793-b59d-c77c65759e6b",
            "3e2cd205-eea4-42c8-a32b-812d569684bb"
          ],
          "display_name": false
        },
        {
          "uuid": "7ef23d41-e9ed-4523-b025-1100aef92f59",
          "name": "2,6-DI-TERT-BUTYL-P-TOLYL METHYLCARBAMATE",
          "stdName": "2,6-DI-TERT-BUTYL-P-TOLYL METHYLCARBAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65778154-a12d-4793-b59d-c77c65759e6b",
            "3e2cd205-eea4-42c8-a32b-812d569684bb"
          ],
          "display_name": false
        },
        {
          "uuid": "d65ebe65-790e-4618-af80-368c969c57b7",
          "name": "AZAR",
          "stdName": "AZAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbb8b544-6cd7-4db2-bf8c-61875332535a",
            "3e2cd205-eea4-42c8-a32b-812d569684bb"
          ],
          "display_name": false
        },
        {
          "uuid": "56e978f9-a460-407d-8f5e-25daac169ebb",
          "name": "HERCULES 9573",
          "stdName": "HERCULES 9573",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbb8b544-6cd7-4db2-bf8c-61875332535a",
            "3e2cd205-eea4-42c8-a32b-812d569684bb"
          ],
          "display_name": false
        },
        {
          "uuid": "0ea315bb-7ff6-4da5-94a0-8947a725fd11",
          "name": "HERCULES-9573",
          "stdName": "HERCULES-9573",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e2cd205-eea4-42c8-a32b-812d569684bb",
            "d9eaffbe-eae2-435f-881c-f1ebff10a475"
          ],
          "display_name": false
        },
        {
          "uuid": "595a1a56-c8fe-4c13-9868-0f834927cf51",
          "name": "PHENOL, 2,6-BIS(1,1-DIMETHYLETHYL)-4-METHYL-, METHYLCARBAMATE",
          "stdName": "PHENOL, 2,6-BIS(1,1-DIMETHYLETHYL)-4-METHYL-, METHYLCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3955e5d3-9f57-4dff-808e-0e222dedccd0",
            "3e2cd205-eea4-42c8-a32b-812d569684bb"
          ],
          "display_name": false
        },
        {
          "uuid": "0342412c-b58b-4e0e-a6f2-351fa800819d",
          "name": "TERBUCARB",
          "stdName": "TERBUCARB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fbccef3-c102-497f-a42a-28a7e816e9c3",
            "65778154-a12d-4793-b59d-c77c65759e6b",
            "3e2cd205-eea4-42c8-a32b-812d569684bb",
            "ce3dd3e1-4851-4dbe-a1e6-2b8d05fe96ee"
          ],
          "display_name": true
        },
        {
          "uuid": "54d1a360-c417-4007-96e5-5ab8d917064d",
          "name": "TERBUCARB [ISO]",
          "stdName": "TERBUCARB [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65778154-a12d-4793-b59d-c77c65759e6b",
            "3e2cd205-eea4-42c8-a32b-812d569684bb"
          ],
          "display_name": false
        },
        {
          "uuid": "fbf0f361-b74b-4d95-bb9e-e449f485e2f1",
          "name": "TERBUTOL",
          "stdName": "TERBUTOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65778154-a12d-4793-b59d-c77c65759e6b",
            "3e2cd205-eea4-42c8-a32b-812d569684bb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ce3dd3e1-4851-4dbe-a1e6-2b8d05fe96ee",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "65778154-a12d-4793-b59d-c77c65759e6b",
          "citation": "http://www.alanwood.net/pesticides/terbucarb.html",
          "url": "http://www.alanwood.net/pesticides/terbucarb.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e2cd205-eea4-42c8-a32b-812d569684bb",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbb8b544-6cd7-4db2-bf8c-61875332535a",
          "citation": "dose",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9eaffbe-eae2-435f-881c-f1ebff10a475",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3955e5d3-9f57-4dff-808e-0e222dedccd0",
          "citation": "EPA PEST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "763a61ba-065a-40bc-a7e4-bd77d5be2a6b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f9343bd-31e3-427a-a6e1-6f329331192b",
          "citation": "SRS import [17B625R8YT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=17B625R8YT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390914000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "faa5d1b7-8e80-4470-b06f-0b1fde2af276",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0fbccef3-c102-497f-a42a-28a7e816e9c3",
          "citation": "TERBUCARB [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "72bc7fde-9763-c735-09d5-4484f629251f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1918-11-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c11da610-e6cf-33ba-5daf-2c43c9990666",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4166d350-0f2b-484f-88cd-3b411d14272e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "046a28b4-44d5-4bd8-9a40-8e1e24fdb267",
          "id": "046a28b4-44d5-4bd8-9a40-8e1e24fdb267",
          "molfile": "\n  Marvin  01132100322D          \n\n 20 20  0  0  0  0            999 V2000\n    6.4764   -2.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6197   -2.9168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9878   -3.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1310   -4.2596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2125   -3.1650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4981   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7836   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0692   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0692   -4.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3547   -4.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7836   -4.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4981   -4.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1300   -4.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7620   -5.4630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9053   -4.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9868   -5.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7836   -2.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7836   -1.5150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9586   -2.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6086   -2.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  2  0  0  0  0\n  7  8  2  0  0  0  0\n  7 17  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(c(c(c1)C(C)(C)C)OC(=O)NC)C(C)(C)C",
          "formula": "C17H27NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "27a19eb0-d5a2-4e33-8659-ae3761de5161"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "277.4024",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "73ddfbda-ab22-447d-bba0-8261b0d6edf0",
      "version": "4",
      "structure": {
        "id": "644e78ca-64ed-4cbd-a450-6f07b1256f13",
        "molfile": "\n  Marvin  01132105132D          \n\n 20 20  0  0  0  0            999 V2000\n    4.4981   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4981   -4.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7836   -4.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0692   -4.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3547   -4.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0692   -3.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7836   -3.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7836   -2.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7836   -1.5150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9586   -2.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6086   -2.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1300   -4.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7620   -5.4630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9053   -4.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9868   -5.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2125   -3.1650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9878   -3.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6197   -2.9168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4764   -2.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1310   -4.2596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 17 20  2  0  0  0  0\nM  END",
        "smiles": "Cc1cc(c(c(c1)C(C)(C)C)OC(=O)NC)C(C)(C)C",
        "formula": "C17H27NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "277.4024",
        "optical_activity": "NONE",
        "references": [
          "1f9343bd-31e3-427a-a6e1-6f329331192b",
          "faa5d1b7-8e80-4470-b06f-0b1fde2af276"
        ],
        "stereo_centers": 0
      },
      "unii": "17B625R8YT"
    }
  ]
}