{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9c214052-423b-46b7-8ac3-8ba2d0695106",
          "code": "74070-46-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74070-46-5",
          "code_system": "CAS",
          "references": [
            "75650bba-fe35-4156-a218-3fcb337b0c9f",
            "7c8c0bf1-cedf-4cf6-8bb9-4711b5fee037"
          ]
        },
        {
          "uuid": "707f30f5-66e6-4d6f-a16b-825350c44b98",
          "code": "C106872",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67106872",
          "code_system": "MESH",
          "references": [
            "75650bba-fe35-4156-a218-3fcb337b0c9f"
          ]
        },
        {
          "uuid": "02837903-2c45-4cc3-b9a4-233593eed733",
          "code": "277-704-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.619",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "75650bba-fe35-4156-a218-3fcb337b0c9f"
          ]
        },
        {
          "uuid": "6d616741-a876-4b97-b1e0-422d352187f5",
          "code": "92389",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92389",
          "code_system": "PUBCHEM",
          "references": [
            "75650bba-fe35-4156-a218-3fcb337b0c9f"
          ]
        },
        {
          "uuid": "0693ff9e-161b-8ff4-6754-392637be2eba",
          "code": "DTXSID7058175",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7058175",
          "code_system": "EPA CompTox",
          "references": [
            "bea3549a-8be6-ed8a-90e7-172c1428625c"
          ]
        },
        {
          "uuid": "af3a61b7-7dc1-4cc7-8c87-629df7df80f3",
          "code": "m11749",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11749",
          "code_system": "MERCK INDEX",
          "references": [
            "d05ba6e1-e8a3-32b2-98a0-764a7cdf3252"
          ]
        },
        {
          "uuid": "9b869ba7-d4fd-41f8-8a99-753fef13df68",
          "code": "1762RDA835",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9878d37f-32a2-9cff-5979-9dd8ce79dd04",
          "code": "137374",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:137374",
          "code_system": "CHEBI",
          "references": [
            "82a566af-8310-67af-ddeb-9afe38d7b5ce"
          ]
        },
        {
          "uuid": "2a330913-957b-0a67-c12c-ea2d08ef95f1",
          "code": "Aclonifen",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Aclonifen",
          "code_system": "WIKIPEDIA",
          "references": [
            "e8c54c63-8d1e-af35-3b4d-303511c7a100"
          ]
        },
        {
          "uuid": "82e0de6d-a78e-ade7-0081-5c46ad61b591",
          "code": "aclonifen",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/aclonifen.html",
          "code_system": "ALANWOOD",
          "references": [
            "74562b2e-9ef2-de9b-c956-ad96b2c8e292"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "aefae830-5a64-4651-b344-0a6ba503d4bb",
          "name": "2-CHLORO-6-NITRO-3-PHENOXYANILINE",
          "stdName": "2-CHLORO-6-NITRO-3-PHENOXYANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a868e9c-4ae4-44a1-b7df-efc02d810f31",
            "16b091bd-5ade-4783-bdbb-d3644fcb626e"
          ],
          "display_name": false
        },
        {
          "uuid": "937c4f73-5876-41f7-83d8-1d5eb628536b",
          "name": "2-CHLORO-6-NITRO-3-PHENOXYBENZENAMINE",
          "stdName": "2-CHLORO-6-NITRO-3-PHENOXYBENZENAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a868e9c-4ae4-44a1-b7df-efc02d810f31",
            "16b091bd-5ade-4783-bdbb-d3644fcb626e"
          ],
          "display_name": false
        },
        {
          "uuid": "4f96e3f4-99b9-44c1-b904-6de598bc5175",
          "name": "ACLONIFEN",
          "stdName": "ACLONIFEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15026e67-3b3c-4e9d-9229-017e64909804",
            "870c559d-89e5-476f-acde-b3147a57a501",
            "359001a6-baab-4183-a175-9307a2c4cc26",
            "16b091bd-5ade-4783-bdbb-d3644fcb626e"
          ],
          "display_name": true
        },
        {
          "uuid": "20e46571-c482-4d24-8248-b3d7bd66b1ac",
          "name": "ACLONIFEN [ISO]",
          "stdName": "ACLONIFEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15026e67-3b3c-4e9d-9229-017e64909804",
            "16b091bd-5ade-4783-bdbb-d3644fcb626e"
          ],
          "display_name": false
        },
        {
          "uuid": "62548eb1-4c06-eaf8-258f-28ebafd83fef",
          "name": "ACLONIFEN [MI]",
          "stdName": "ACLONIFEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d05ba6e1-e8a3-32b2-98a0-764a7cdf3252"
          ],
          "display_name": false
        },
        {
          "uuid": "579c4caa-9b44-0b50-b679-cc0b4460fa2a",
          "name": "BANDUR",
          "stdName": "BANDUR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d05ba6e1-e8a3-32b2-98a0-764a7cdf3252"
          ],
          "display_name": false
        },
        {
          "uuid": "9d2aefdf-2e87-34f6-d5f0-8202afef234f",
          "name": "CHALLENGE",
          "stdName": "CHALLENGE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d05ba6e1-e8a3-32b2-98a0-764a7cdf3252"
          ],
          "display_name": false
        },
        {
          "uuid": "cff8c2f8-8cc8-daeb-1703-963bb4449a0b",
          "name": "CME 127",
          "stdName": "CME 127",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d05ba6e1-e8a3-32b2-98a0-764a7cdf3252"
          ],
          "display_name": false
        },
        {
          "uuid": "b76842e4-8a87-eab3-4bde-4ded6b396bd5",
          "name": "CME-127",
          "stdName": "CME-127",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d05ba6e1-e8a3-32b2-98a0-764a7cdf3252"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8a868e9c-4ae4-44a1-b7df-efc02d810f31",
          "citation": "http://www.alanwood.net/pesticides/aclonifen.html",
          "url": "http://www.alanwood.net/pesticides/aclonifen.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "16b091bd-5ade-4783-bdbb-d3644fcb626e",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "359001a6-baab-4183-a175-9307a2c4cc26",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15026e67-3b3c-4e9d-9229-017e64909804",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75650bba-fe35-4156-a218-3fcb337b0c9f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390934000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba0a4224-bdff-45eb-ab6a-8e2ac43122b0",
          "citation": "SRS import [1762RDA835]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1762RDA835",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390934000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79c3eb07-f081-45cc-9b9e-f0c3ac1efbc7",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "870c559d-89e5-476f-acde-b3147a57a501",
          "citation": "ACLONIFEN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bea3549a-8be6-ed8a-90e7-172c1428625c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=74070-46-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d05ba6e1-e8a3-32b2-98a0-764a7cdf3252",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "e8c54c63-8d1e-af35-3b4d-303511c7a100",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "74562b2e-9ef2-de9b-c956-ad96b2c8e292",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "7c8c0bf1-cedf-4cf6-8bb9-4711b5fee037",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "82a566af-8310-67af-ddeb-9afe38d7b5ce",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2e9b0b8f-507a-4d2c-a588-5270df4694d6",
          "id": "2e9b0b8f-507a-4d2c-a588-5270df4694d6",
          "molfile": "\n  Marvin  01132102302D          \n\n 18 19  0  0  0  0            999 V2000\n    7.1203   -3.4080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4055   -2.9955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6915   -3.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6915   -4.2349    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9777   -2.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2569   -3.4073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5425   -2.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5425   -2.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8272   -1.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1194   -2.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1194   -2.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8272   -3.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9777   -2.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6962   -1.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4055   -2.1712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1206   -1.7629    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.8323   -2.1802    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.1206   -0.9449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 15  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  5  1  0  0  0  0\n 13  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\nM  CHG  2  16   1  17  -1\nM  END",
          "smiles": "c1ccc(cc1)Oc2ccc(c(c2Cl)N)[N+](=O)[O-]",
          "formula": "C12H9ClN2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "81d1328c-9910-4a5e-bc9e-084180670801"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "264.6649",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2428436d-6fcc-4d48-a8d8-6bb9f7ff59ae",
      "version": "7",
      "structure": {
        "id": "2bc8b1dc-88f2-4036-80e0-90e7e03eb11f",
        "molfile": "\n  Marvin  01132102222D          \n\n 18 19  0  0  0  0            999 V2000\n    3.5425   -2.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8272   -1.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1194   -2.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1194   -2.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8272   -3.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5425   -2.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2569   -3.4073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9777   -2.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6915   -3.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6915   -4.2349    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.4055   -2.9955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1203   -3.4080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4055   -2.1712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1206   -1.7629    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.8323   -2.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1206   -0.9449    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.6962   -1.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9777   -2.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 13 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18  8  2  0  0  0  0\nM  CHG  2  14   1  16  -1\nM  END",
        "smiles": "c1ccc(cc1)Oc2ccc(c(c2Cl)N)[N+](=O)[O-]",
        "formula": "C12H9ClN2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "264.6649",
        "optical_activity": "NONE",
        "references": [
          "ba0a4224-bdff-45eb-ab6a-8e2ac43122b0",
          "79c3eb07-f081-45cc-9b9e-f0c3ac1efbc7"
        ],
        "stereo_centers": 0
      },
      "unii": "1762RDA835"
    }
  ]
}