{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "95118a45-5682-426a-a46f-08026baf70a5",
          "code": "29736-75-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=29736-75-2",
          "code_system": "CAS",
          "references": [
            "ebe77b1c-7fc7-4de2-8c0d-0be8077f892a",
            "5a4b7dec-08a8-469b-9d11-f346cd5237b0"
          ]
        },
        {
          "uuid": "b3a9c628-3e1d-42f9-b793-0df76217fe4c",
          "code": "249-820-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.276",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ebe77b1c-7fc7-4de2-8c0d-0be8077f892a"
          ]
        },
        {
          "uuid": "ee7f2916-1a07-ea18-5956-5e626f79f328",
          "code": "DTXSID9044906",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9044906",
          "code_system": "EPA CompTox",
          "references": [
            "bdd0478e-935d-1736-ae4b-83ac108fbf45"
          ]
        },
        {
          "uuid": "ae394a5e-0789-7985-19e5-b156e2be7df7",
          "code": "16684206",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16684206",
          "code_system": "PUBCHEM",
          "references": [
            "b1e363b4-5788-f06e-0a33-47b9259a6220"
          ]
        },
        {
          "uuid": "6c3b50a6-b75a-4cd4-969b-b34fe93c9e01",
          "code": "1723SUN67Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6bec7d31-d0ae-40c6-b250-221f576fbb32",
          "name": "2,5,7,10,11,14-HEXAOXA-1,6-DISTIBABICYCLO(4.4.4)TETRADECANE",
          "stdName": "2,5,7,10,11,14-HEXAOXA-1,6-DISTIBABICYCLO(4.4.4)TETRADECANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abe8661f-ea6a-4ba3-a5ab-22844ce67357"
          ],
          "display_name": false
        },
        {
          "uuid": "bfb8801e-bd2a-4de9-b839-f71046c6aa65",
          "name": "ANTIMONY ETHYLENE GLYCOXIDE",
          "stdName": "ANTIMONY ETHYLENE GLYCOXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abe8661f-ea6a-4ba3-a5ab-22844ce67357"
          ],
          "display_name": false
        },
        {
          "uuid": "3b179436-a786-43e8-b410-cd77ada3edf4",
          "name": "ANTIMONY TRIS(ETHYLENE GLYCOXIDE)",
          "stdName": "ANTIMONY TRIS(ETHYLENE GLYCOXIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ee85ee8-b20d-4412-aced-4457c98f61ad"
          ],
          "display_name": true
        },
        {
          "uuid": "c8b1e657-bcca-4415-be8d-6565b8d7d2c1",
          "name": "ANTIMONY, TRIS(ETHYLENE GLYCOLATO(2-))DI-",
          "stdName": "ANTIMONY, TRIS(ETHYLENE GLYCOLATO(2-))DI-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abe8661f-ea6a-4ba3-a5ab-22844ce67357"
          ],
          "display_name": false
        },
        {
          "uuid": "cabe4fdb-cc60-4f06-b6f6-97cf0c64c5d8",
          "name": "DIANTIMONY TRIS(ETHYLENE GLYCOLATE)",
          "stdName": "DIANTIMONY TRIS(ETHYLENE GLYCOLATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abe8661f-ea6a-4ba3-a5ab-22844ce67357"
          ],
          "display_name": false
        },
        {
          "uuid": "e98218f3-f766-412f-9366-c28eb3ad5ded",
          "name": "ETHYLENE ANTIMONATE(III)",
          "stdName": "ETHYLENE ANTIMONATE(III)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abe8661f-ea6a-4ba3-a5ab-22844ce67357"
          ],
          "display_name": false
        },
        {
          "uuid": "dcfcfc15-f5cd-4076-8038-945701e80ef9",
          "name": "J286.952G",
          "stdName": "J286.952G",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc195ebd-ae0a-44d2-b551-716e670a255e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6ee85ee8-b20d-4412-aced-4457c98f61ad",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "abe8661f-ea6a-4ba3-a5ab-22844ce67357",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc195ebd-ae0a-44d2-b551-716e670a255e",
          "citation": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907044425103480&q=J286.952G&t=7",
          "url": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907044425103480&q=J286.952G&t=7",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebe77b1c-7fc7-4de2-8c0d-0be8077f892a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392281000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b37ce4d-25f7-411d-ae59-6f3c3b9d9d8f",
          "citation": "SRS import [1723SUN67Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1723SUN67Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392281000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdd0478e-935d-1736-ae4b-83ac108fbf45",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=29736-75-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1e363b4-5788-f06e-0a33-47b9259a6220",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5a4b7dec-08a8-469b-9d11-f346cd5237b0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d3e4a23e-3575-4932-b6ef-06e78953e64e",
          "id": "d3e4a23e-3575-4932-b6ef-06e78953e64e",
          "molfile": "\n  Marvin  01132110592D          \n\n 14 15  0  0  0  0            999 V2000\n    0.0000   -1.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2557   -2.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9207   -2.5379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7470   -2.5379    0.0000 Sb  0  0  0  0  0  0  0  0  0  0  0  0\n    2.4120   -2.0539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6677   -1.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4120   -0.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7470    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9207    0.0000    0.0000 Sb  0  0  0  0  0  0  0  0  0  0  0  0\n    0.2557   -0.4839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3895   -2.9785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6413   -3.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4480   -3.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0027   -3.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 10  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n 14  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "C1CO[Sb]2OCCO[Sb](O1)OCCO2",
          "formula": "C6H12O6Sb2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "90ad9851-76e5-45da-97d8-eaee04a685d8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "423.6757",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8b35a9d8-d5ae-45a6-b2f6-52709d5bc15d",
      "version": "4",
      "structure": {
        "id": "a3a58b74-bb61-45d8-983c-bc30b206538d",
        "molfile": "\n  Marvin  01132108302D          \n\n 14 15  0  0  0  0            999 V2000\n    0.9207    0.0000    0.0000 Sb  0  0  0  0  0  0  0  0  0  0  0  0\n    0.2557   -0.4839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7470    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3895   -2.9785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4120   -0.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6413   -3.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2557   -2.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6677   -1.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4480   -3.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9207   -2.5379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4120   -2.0539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0027   -3.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7470   -2.5379    0.0000 Sb  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
        "smiles": "C1CO[Sb]2OCCO[Sb](O1)OCCO2",
        "formula": "C6H12O6Sb2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "423.6757",
        "optical_activity": "NONE",
        "references": [
          "8b37ce4d-25f7-411d-ae59-6f3c3b9d9d8f",
          "6ee85ee8-b20d-4412-aced-4457c98f61ad"
        ],
        "stereo_centers": 0
      },
      "unii": "1723SUN67Z"
    }
  ]
}