{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a24eb567-7231-42ec-b5f9-67b948ad1145",
          "code": "91531-30-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=91531-30-5",
          "code_system": "CAS",
          "references": [
            "78d7a17a-5f36-4f2c-ac82-770a095f06a0",
            "9aa15350-c30e-46df-b179-2a5718c87cf5"
          ]
        },
        {
          "uuid": "4f589817-ebca-4a30-8ba1-3e570dda1359",
          "code": "C052091",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67052091",
          "code_system": "MESH",
          "references": [
            "78d7a17a-5f36-4f2c-ac82-770a095f06a0"
          ]
        },
        {
          "uuid": "eb13f6f5-a0ce-4deb-a201-33b1a8ccd6e7",
          "code": "C1004",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1004",
          "code_system": "NCI_THESAURUS",
          "references": [
            "78d7a17a-5f36-4f2c-ac82-770a095f06a0",
            "7e80b7b1-83dd-44e7-0e88-91a9a57c8686"
          ]
        },
        {
          "uuid": "345c649e-bdf4-4367-970e-e24b809499d1",
          "code": "56260",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/56260",
          "code_system": "PUBCHEM",
          "references": [
            "78d7a17a-5f36-4f2c-ac82-770a095f06a0"
          ]
        },
        {
          "uuid": "afd9878b-ce25-c7c0-e249-b8d2b5e95600",
          "code": "189804",
          "comments": "ORPHAN DRUG|Designated|Treatment for patients with brain stem glioma",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=189804",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "d5a893bb-d18b-853e-c588-6a40d87267b9",
          "code": "267408",
          "comments": "ORPHAN DRUG|Designated|Treatment of gliomas",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=267408",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "49b7409e-776a-f198-56b5-07d715e80582",
          "code": "C2500",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Cell Differentiating Agent[C2122]|Differentiation Inducer[C1934]|Antineoplaston Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2500",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8be0d56f-1db6-deae-3b29-8503ce1ab5a5"
          ]
        },
        {
          "uuid": "5ef43689-ae5c-769e-08c7-09038492d834",
          "code": "DB11702",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11702",
          "code_system": "DRUG BANK",
          "references": [
            "8be0d56f-1db6-deae-3b29-8503ce1ab5a5"
          ]
        },
        {
          "uuid": "755bc8f0-d3ea-4a15-abe5-10587fd40469",
          "code": "16VY3TM7ZO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "52186c82-ba57-d2cc-69e6-0d6275e8fdbb",
          "code": "DTXSID00919683",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00919683",
          "code_system": "EPA CompTox",
          "references": [
            "8be0d56f-1db6-deae-3b29-8503ce1ab5a5"
          ]
        },
        {
          "uuid": "97a3ac9a-8f32-3889-095a-31ee0d3ee38f",
          "code": "300000046592",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "41054f6b-e5c6-75a9-849c-a2856161a393"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "abea7cfa-36e8-4456-949f-c096096a46bd",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "234de0dd-2ebe-4492-84e1-18162781c953",
            "refuuid": "f42a5caa-f6d0-4bc5-b09b-f49876b9a64a",
            "name": "ANTINEOPLASTON A10",
            "unii": "16VY3TM7ZO",
            "linking_id": "16VY3TM7ZO",
            "ref_pname": "ANTINEOPLASTON A10",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1b841bf6-bdda-44cf-868f-8f8de9313913",
          "name": "ANTINEOPLASTON A 10",
          "stdName": "ANTINEOPLASTON A 10",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea2f442f-8f8e-4487-9255-5a506647e162",
            "c5b47508-784b-4799-b6b7-a79327d8002d",
            "3bbe9892-5a3d-4adb-8e29-cb1d0ae1c1fb",
            "06dcb420-b0ac-4725-aaf1-df7dffa3d886",
            "7e80b7b1-83dd-44e7-0e88-91a9a57c8686"
          ],
          "display_name": false
        },
        {
          "uuid": "c4064d3d-ecd2-4d69-b5bf-181f748fa968",
          "name": "ANTINEOPLASTON A10",
          "stdName": "ANTINEOPLASTON A10",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfbd0ff3-f7f5-4afe-981a-f07669733ceb",
            "c5b47508-784b-4799-b6b7-a79327d8002d",
            "7e80b7b1-83dd-44e7-0e88-91a9a57c8686"
          ],
          "display_name": true
        },
        {
          "uuid": "5f75c6ad-ddc7-4eb3-90d4-bc5c4c508a7c",
          "name": "ATENGENAL",
          "stdName": "ATENGENAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1c06f5d-8ac1-40d5-b5fe-22ea70e6fbf7",
            "c5b47508-784b-4799-b6b7-a79327d8002d",
            "7e80b7b1-83dd-44e7-0e88-91a9a57c8686"
          ],
          "display_name": false
        },
        {
          "uuid": "9eaae189-725c-ac42-1017-ffa7f7b84f4e",
          "name": "Antineoplaston A 10 [WHO-DD]",
          "stdName": "ANTINEOPLASTON A 10 [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "504ae493-ff48-284d-e04a-e2b42caa607e"
          ],
          "display_name": false
        },
        {
          "uuid": "02d9f606-54cc-4060-9fd7-aa616808d49d",
          "name": "BENZENEACETAMIDE, N-((3S)-2,6-DIOXO-3-PIPERIDINYL)-",
          "stdName": "BENZENEACETAMIDE, N-((3S)-2,6-DIOXO-3-PIPERIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5b47508-784b-4799-b6b7-a79327d8002d",
            "6148d7ff-1466-4d38-94f1-f21b9cd07556"
          ],
          "display_name": false
        },
        {
          "uuid": "f8d5cf74-b150-44df-819a-9c22142a6072",
          "name": "BENZENEACETAMIDE, N-(2,6-DIOXO-3-PIPERIDINYL)-, (S)-",
          "stdName": "BENZENEACETAMIDE, N-(2,6-DIOXO-3-PIPERIDINYL)-, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5b47508-784b-4799-b6b7-a79327d8002d",
            "6148d7ff-1466-4d38-94f1-f21b9cd07556"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dfbd0ff3-f7f5-4afe-981a-f07669733ceb",
          "citation": "http://www.beckerdata.com/wordpress/SearchApi.php",
          "url": "http://www.beckerdata.com/wordpress/SearchApi.php",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c5b47508-784b-4799-b6b7-a79327d8002d",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bbe9892-5a3d-4adb-8e29-cb1d0ae1c1fb",
          "citation": "who-dd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6148d7ff-1466-4d38-94f1-f21b9cd07556",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea2f442f-8f8e-4487-9255-5a506647e162",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1c06f5d-8ac1-40d5-b5fe-22ea70e6fbf7",
          "citation": "clin trials",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78d7a17a-5f36-4f2c-ac82-770a095f06a0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "adeccbe0-13b9-49af-8c6f-3d772020a9ae",
          "citation": "SRS import [16VY3TM7ZO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=16VY3TM7ZO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389728000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06dcb420-b0ac-4725-aaf1-df7dffa3d886",
          "citation": "ANTINEOPLASTON A 10 [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "41054f6b-e5c6-75a9-849c-a2856161a393",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8be0d56f-1db6-deae-3b29-8503ce1ab5a5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7e80b7b1-83dd-44e7-0e88-91a9a57c8686",
          "citation": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1004",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1004",
          "doc_type": "NCI THESAURUS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9aa15350-c30e-46df-b179-2a5718c87cf5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "504ae493-ff48-284d-e04a-e2b42caa607e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8e4c1ffb-5862-42e9-aabb-05942e290871",
          "id": "8e4c1ffb-5862-42e9-aabb-05942e290871",
          "molfile": "\n  Marvin  01132107232D          \n\n 18 19  0  0  1  0            999 V2000\n   -1.3911   -2.0726    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -1.4066   -1.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1035   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8262   -1.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5387   -0.8362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8185   -2.0726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1035   -2.4855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1035   -3.3063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6711   -2.4855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0310   -2.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0310   -1.2466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7460   -2.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4660   -2.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4660   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1758   -0.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8959   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8959   -2.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1784   -2.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  0  0  0  0\n  1  9  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)CC(=O)N[C@H]2CCC(=O)NC2=O",
          "formula": "C13H14N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b237438c-7060-405a-b001-3f4d26391de4"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "246.2624",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f42a5caa-f6d0-4bc5-b09b-f49876b9a64a",
      "version": "12",
      "structure": {
        "id": "bb04f008-d4ac-48c7-8560-774078d58b5f",
        "molfile": "\n  Marvin  01132109402D          \n\n 18 19  0  0  1  0            999 V2000\n   -2.8185   -2.0726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1035   -2.4855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8262   -1.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0310   -2.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3911   -2.0726    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.6711   -2.4855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1035   -3.3063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0310   -1.2466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5387   -0.8362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4066   -1.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7460   -2.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1035   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4660   -2.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1784   -2.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4660   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1758   -0.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8959   -2.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8959   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  6  0  0  0\n  7  2  2  0  0  0  0\n  8  4  2  0  0  0  0\n  9  3  2  0  0  0  0\n 10 12  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 14  1  0  0  0  0\n 18 16  1  0  0  0  0\n 10  5  1  0  0  0  0\n 18 17  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)CC(=O)N[C@H]2CCC(=O)NC2=O",
        "formula": "C13H14N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "246.2624",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6148d7ff-1466-4d38-94f1-f21b9cd07556",
          "adeccbe0-13b9-49af-8c6f-3d772020a9ae"
        ],
        "stereo_centers": 1
      },
      "unii": "16VY3TM7ZO"
    }
  ]
}