{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c16b300e-c8fb-4a18-8657-9acdc5aa295f", "code": "a03", "type": "PRIMARY", "url": "http://swgdrug.org/Monographs/A03%20HCl.pdf", "code_system": "SWGDRUG" }, { "uuid": "028a426b-0aa9-4c4e-838e-935c41a3bf27", "code": "752142-28-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=752142-28-2", "code_system": "CAS", "references": [ "05d014c0-7333-4e34-8ad0-b543750e4431" ] }, { "uuid": "309eb835-3a0e-6446-a33a-e38df4c390ea", "code": "16455901", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16455901", "code_system": "PUBCHEM", "references": [ "1e260494-616e-af8e-c1e6-a29a30290ecd" ] }, { "uuid": "a2f8b287-9b1a-442b-b4db-d223e20955de", "code": "16M9TU0YZM", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4db07e58-0e04-4dde-fe37-891f098e9936", "code": "DTXSID701342543", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701342543", "code_system": "EPA CompTox", "references": [ "19931ece-2125-6676-b437-0abb2ba06372" ] } ], "relationships": [ { "uuid": "8c6d47ea-9d14-4540-8c82-666bc458b78e", "type": "ACTIVE MOIETY", "references": [ "cee66401-2852-f68e-e7b1-bdedccc49b80", "3a73645f-c9fc-6a4c-b0eb-3d15ec7b5eaa" ], "related_substance": { "uuid": "2ef73b7d-5b3e-4a75-9f14-5b825b3df2ca", "refuuid": "9fffeff7-1aef-4539-9fad-694c4405f791", "name": "N-((1-(DIMETHYLAMINO)CYCLOHEXYL)METHYL)-4-FLUOROBENZAMIDE", "unii": "16M9TU0YZM", "linking_id": "16M9TU0YZM", "ref_pname": "N-((1-(DIMETHYLAMINO)CYCLOHEXYL)METHYL)-4-FLUOROBENZAMIDE", "substance_class": "reference" } }, { "uuid": "968aee39-3fc9-49bd-b52e-2a738343d3a9", "type": "SALT/SOLVATE->PARENT", "references": [ "acde8269-4e9d-459d-82b8-6d88d9a03fec" ], "related_substance": { "uuid": "eac0a2b1-7750-46f5-a06f-8eca745e1590", "refuuid": "850162f1-47ee-df04-a5d2-1ffa32739a17", "name": "1-(4-FLUOROBENZAMIDOMETHYL)CYCLOHEXYLDIMETHYLAMINE HYDROCHLORIDE", "unii": "531O57HUM6", "linking_id": "531O57HUM6", "ref_pname": "1-(4-FLUOROBENZAMIDOMETHYL)CYCLOHEXYLDIMETHYLAMINE HYDROCHLORIDE" } } ], "substance_class": "chemical", "names": [ { "uuid": "d9665f89-2c06-ff23-e93d-29fbb716631d", "name": "1-(4-FLUOROBENZAMIDOMETHYL)-CYCLOHEXYLDIMETHYLAMINE", "stdName": "1-(4-FLUOROBENZAMIDOMETHYL)-CYCLOHEXYLDIMETHYLAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3a73645f-c9fc-6a4c-b0eb-3d15ec7b5eaa" ], "display_name": false }, { "uuid": "56044ac2-e3f5-8f3e-a284-8e21b15805f6", "name": "A-03", "stdName": "A-03", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "3a73645f-c9fc-6a4c-b0eb-3d15ec7b5eaa" ], "display_name": false }, { "uuid": "6ebe2db1-4776-f200-6053-304c3440bccb", "name": "BENZAMIDE, N-((1-(DIMETHYLAMINO)CYCLOHEXYL)METHYL)-4-FLUORO-", "stdName": "BENZAMIDE, N-((1-(DIMETHYLAMINO)CYCLOHEXYL)METHYL)-4-FLUORO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cee66401-2852-f68e-e7b1-bdedccc49b80" ], "display_name": false }, { "uuid": "20a9413e-b726-5419-95ef-05400c6fb889", "name": "N-((1-(DIMETHYLAMINO)CYCLOHEXYL)METHYL)-4-FLUOROBENZAMIDE", "stdName": "N-((1-(DIMETHYLAMINO)CYCLOHEXYL)METHYL)-4-FLUOROBENZAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cee66401-2852-f68e-e7b1-bdedccc49b80", "1e260494-616e-af8e-c1e6-a29a30290ecd" ], "display_name": true } ], "references": [ { "uuid": "cee66401-2852-f68e-e7b1-bdedccc49b80", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3a73645f-c9fc-6a4c-b0eb-3d15ec7b5eaa", "citation": "http://swgdrug.org/Monographs/A03%20HCl.pdf", "url": "http://swgdrug.org/Monographs/A03%20HCl.pdf", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "05d014c0-7333-4e34-8ad0-b543750e4431", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "acde8269-4e9d-459d-82b8-6d88d9a03fec", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "1e260494-616e-af8e-c1e6-a29a30290ecd", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "19931ece-2125-6676-b437-0abb2ba06372", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "64aec6d1-af0a-174d-189f-ca62fae0f8b8", "id": "64aec6d1-af0a-174d-189f-ca62fae0f8b8", "molfile": "\n Marvin 01132105142D \n\n 20 21 0 0 0 0 999 V2000\n 14.1907 -7.1637 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1907 -6.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9053 -5.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9053 -5.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1907 -4.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1907 -3.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4764 -3.4512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9053 -3.4512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9053 -2.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6197 -2.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3343 -2.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0486 -2.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0486 -1.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3343 -0.9763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6197 -1.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6197 -3.0387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4447 -3.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3343 -3.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4764 -5.1013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4764 -5.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 20 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 19 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 15 1 0 0 0 0\n 10 16 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 19 20 2 0 0 0 0\nM END", "smiles": "CN(C)C1(CCCCC1)CNC(=O)c2ccc(cc2)F", "formula": "C16H23FN2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0334e8cc-add7-42c7-8a79-3ab67b21b50e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "278.3656", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "9fffeff7-1aef-4539-9fad-694c4405f791", "version": "10", "structure": { "id": "cfd0091a-66dc-7470-5f2e-af7a3b15892a", "molfile": "\n Marvin 01132110442D \n\n 20 21 0 0 0 0 999 V2000\n 13.3382 -5.8162 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3382 -4.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0528 -4.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0528 -3.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3382 -3.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3382 -2.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6239 -2.1037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0528 -2.1037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9053 -2.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6197 -2.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3343 -2.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0486 -2.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0486 -1.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6197 -1.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3343 -0.9763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6197 -3.0387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4447 -3.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3718 -3.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6239 -4.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6239 -3.7537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 13 15 1 0 0 0 0\n 10 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 2 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 5 20 1 0 0 0 0\nM END", "smiles": "CN(C)C1(CCCCC1)CNC(=O)c2ccc(cc2)F", "formula": "C16H23FN2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "278.3656", "optical_activity": "NONE", "references": [ "cee66401-2852-f68e-e7b1-bdedccc49b80" ], "stereo_centers": 0 }, "unii": "16M9TU0YZM" } ] }